/// <summary>
/// Read the login.properties file to receive the session ticket.
/// </summary>
public override void login()
{
IXProperties lprops = new IXProperties();
lprops.Read(loginProperties);
lrVal = readLoginResult(lprops);
}
public void run()
{
lockKey = "mykey";
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// Prepare ClientInfo object with language and country
// ClientInfo ci = new ClientInfo();
// ci.language = "de";
// ci.country = "DE";
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
// get constants
Logger.instance().log("get const...");
IXServicePortC CONST = ix.CONST;
Logger.instance().log("get const OK");
// Get the current archive key
int keyIdBeforeLock = ix.Ix.lockArchive(null);
Logger.instance().log("key before lock=" + keyIdBeforeLock);
// LOCK
int keyIdBeforeLock2 = ix.Ix.lockArchive(lockKey);
// Get the current archive key
int keyIdAfterLock = ix.Ix.lockArchive(null);
Logger.instance().log("key after lock=" + keyIdAfterLock);
// UNLOCK
int keyIdBeforeUnlock = ix.Ix.lockArchive("0");
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
Logger.instance().log("IX logout OK");
}
}
}
private void findDeletedFiles(IXProperties checkoutMap, List <string> checkoutFiles, List <string> deletedFiles)
{
Dictionary <string, string> mapCheckoutFiles = new Dictionary <string, string>(StringComparer.OrdinalIgnoreCase);
foreach (string f in checkoutFiles)
{
mapCheckoutFiles.Add(f, f);
}
foreach (string key in checkoutMap.Keys)
{
if (key.StartsWith("LM_") || key.StartsWith("MD5_"))
{
continue;
}
try { Convert.ToInt32(key); } catch (Exception) { continue; }
string f = checkoutMap[key];
if (f.StartsWith("\\"))
{
f = f.Substring(1);
}
f = Path.Combine(checkoutDir.FullName, f);
if (!mapCheckoutFiles.ContainsKey(f))
{
deletedFiles.Add(f);
}
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// Prepare ClientInfo object with language and country
// ClientInfo ci = new ClientInfo();
// ci.language = "de";
// ci.country = "DE";
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
// get constants
Logger.instance().log("get const...");
IXServicePortC CONST = ix.CONST;
Logger.instance().log("get const OK");
// Create a root folder based on keywording form "Email".
// Parent is the "imaginary" archive entry with object ID = 1.
String parentId = "1";
String maskId = "email";
EditInfo ed = ix.Ix.createSord(parentId, maskId, EditInfoC.mbAll);
ed.sord.name = "New Sord";
ViewAndEditSordDlg dlg = new ViewAndEditSordDlg();
dlg.init(ix, ed);
dlg.ShowDialog(null);
// CHECKIN
int objId = ix.Ix.checkinSord(dlg.getSord(), SordC.mbAll, LockC.NO);
Logger.instance().log("Created sord successfully, objId=" + objId);
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
Logger.instance().log("IX logout OK");
}
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
Logger.instance().log("Version=" + connFact.Version);
Logger.instance().log("ImplVersion=" + ix.ImplVersion);
Logger.instance().log("InterfaceVersion=" + ix.InterfaceVersion);
Logger.instance().log("ClientVersion=" + ix.ClientVersion);
LoginResult loginResult = ix.LoginResult;
// If successfully logged on, you can find the ticket here:
// loginResult.clientInfo.ticket.
Logger.instance().log("login successfully, ticket=" + loginResult.clientInfo.ticket);
Logger.instance().log("ticket lifetime seconds=" + loginResult.ticketLifetime);
Logger.instance().log("user ID=" + loginResult.user.id);
// Otherwise an exception was thrown in ix.Ix.login() and you will not
// reach this lines.
// Use in subsequent calls always the returned ClientInfo object (contains ticket).
// ci = ix.Login.ci
ix.Ix.checkoutWorkflowTemplate("6439", "", WFDiagramC.mbAll, LockC.NO);
FindWorkflowInfo findInfo = new FindWorkflowInfo();
findInfo.type = WFTypeC.TEMPLATE;
FindResult findResult = ix.Ix.findFirstWorkflows(findInfo, 100, WFDiagramC.mbLean);
Logger.instance().log("wfs=" + findResult.workflows);
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
ix.Dispose();
Logger.instance().log("IX logout OK");
}
}
}
/// <summary>
/// Constructor
/// </summary>
/// <param name="conn">Connection to IndexServer</param>
/// <param name="connProps">Connection properties</param>
public FWSessionInterface(FWConnection conn, IXProperties connProps)
{
this.classFactoryVal = new FWSessionClassFactory(this);
this.connVal = conn;
this.sessOptsVal = ClassFactory.NewSessionOptions();
this.encrPasswordsVal = ClassFactory.NewEncrPasswords();
this.userProfileVal = ClassFactory.NewUserProfile(null);
}
/// <summary>
/// Creates an object that provides the relogin mechanism.
/// </summary>
/// <param name="ixClient">IXClient object</param>
/// <param name="ci">ClientInfo object</param>
/// <param name="userName">User name</param>
/// <param name="userPwd">User password</param>
/// <param name="computerName">Computer name</param>
/// <param name="runAs">Run as user</param>
/// <param name="reportAs">Report as user</param>
/// <param name="sessOpts">Session options</param>
/// <param name="sso">Use Single Sign On supplied by ixlogin servlet.</param>
/// <returns>Login object</returns>
protected override IXConnLogin InternalCreateLoginObject(IXClient ixClient, ClientInfo ci,
String userName, String userPwd, String computerName, String runAs, String reportAs,
IXProperties sessOpts, bool sso)
{
IXConnLogin ixsl = new FWConnLoginEventHandler(ixClientVal, ci);
return(ixsl);
}
/// <summary>
/// Initializes this object
/// </summary>
/// <param name="conn">Connection object</param>
/// <param name="arcName">Archive name</param>
/// <param name="connProps">Connection properties</param>
public override void Init(FWConnection conn, string arcName, IXProperties connProps)
{
base.Init(conn, arcName, connProps);
// read more members than the base class:
// e.g. the archive path is required to build ELOFS paths
base.sordZVal = new SordZ(SordC.mbLeanMembers | SordC.mbDocVersionMembers | SordC.mbRefPaths);
base.editZVal = new EditInfoZ(EditInfoC.mbDocumentMembers | EditInfoC.mbSignatureMembers | EditInfoC.mbAttachmentMembers, sordZVal);
}
/// <summary>
/// Constructor.
/// </summary>
/// <remarks>Reads the ELOFS properties from the conf.properties file.</remarks>
/// <exception cref="NotSupportedException">If ELO File System configuration cannot be found in installation directory or application data directory.</exception>
public FSConfig()
{
props = ReadConfigProperties();
if (props == null)
{
throw new System.NotSupportedException("Cannot find ELO File System configuration");
}
InitTempFileFilters();
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
// Create a document
EditInfo ed = ix.Ix.createDoc("1", null, null, EditInfoC.mbSordDoc);
ed.sord.name = "document with sticky notes";
ed.document = new Document();
ed.document.docs = new DocVersion[1] {
new DocVersion()
};
ed.document.docs[0].ext = "tif";
ed.document.docs[0].pathId = ed.sord.path;
ed.document.docs[0].encryptionSet = ed.sord.details.encryptionSet;
ed.document = ix.Ix.checkinDocBegin(ed.document);
ed.document.docs[0].uploadResult = ix.Upload(ed.document.docs[0].url, @"..\..\00000001.TIF");
ed.document = ix.Ix.checkinDocEnd(ed.sord, SordC.mbAll, ed.document, LockC.NO);
Note[] notes = new Note[3];
// Create a normal sticky note
notes[0] = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_NORMAL, null);
notes[0].desc = "This is a normal sticky note";
// Create a personal note
notes[1] = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_PERSONAL, null);
notes[1].desc = "This is a personal note";
// Create a stamp note
notes[2] = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_STAMP, null);
notes[2].desc = "This is a stamp note";
int[] noteIds = ix.Ix.checkinNotes(null, notes, NoteC.mbAll, LockC.NO);
Logger.instance().log("noteIds=" + noteIds);
}
finally
{
ix.Logout();
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection conn = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
conn = connFact.Create(userName, userPwd, "myComputer", null);
Logger.instance().log("login OK");
Logger.instance().log("Check whether OCR is available...");
bool avail = checkOcrAvail(conn);
Logger.instance().log("OCR is available=" + avail);
if (avail)
{
String fileName = "..\\..\\sample.tif";
Logger.instance().log("Recognize file synchronously");
String text = recognizeFileSync(conn, fileName);
Logger.instance().log("text=" + text.Substring(0, 100) + "...");
// Recognize rectangle.
// Rectangle units are given in per thousand of document width resp. height.
Logger.instance().log("Recognize rect ");
int pmLeft = 50, pmTop = 100, pmRight = 200, pmBottom = 1000;
text = recognizeRect(conn, fileName, pmLeft, pmTop, pmRight, pmBottom);
Logger.instance().log("text=" + text.Substring(0, 100) + "...");
// Return character positions
Logger.instance().log("Recognize file return character positions");
recognizeFileCharPos(conn, fileName);
}
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
if (conn != null)
{
Logger.instance().log("IX logout...");
conn.Logout();
Logger.instance().log("IX logout OK");
}
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// Prepare ClientInfo object with language and country
// ClientInfo ci = new ClientInfo();
// ci.language = "de";
// ci.country = "DE";
// LOGIN
Logger.instance().log("login ...");
ClientInfo ci = new ClientInfo();
ci.timeZone = "GMT+01:00"; // "Europe/Berlin";
ix = connFact.CreateSso(ci, Environment.MachineName);
LoginResult loginResult = ix.LoginResult;
// If successfully logged on, you can find the ticket here:
// loginResult.clientInfo.ticket.
Logger.instance().log("login successfully, ticket=" + loginResult.clientInfo.ticket);
Logger.instance().log("ticket lifetime seconds=" + loginResult.ticketLifetime);
Logger.instance().log("user ID=" + loginResult.user.id);
// Otherwise an exception was thrown in ix.Ix.login() and you will not
// reach this lines.
// Use in subsequent calls always the returned ClientInfo object (contains ticket).
// ci = ix.Login.ci
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
Logger.instance().log("IX logout OK");
}
}
}
private void findFiles(List <string> checkoutFiles, List <string> deletedFiles)
{
// Sammle alle Dateien im Checkout-Verzeichnis
findFilesInDir(checkoutDir, checkoutFiles);
// Hole aus checkoutobjs.properties die aktuell ausgecheckten Dokumente und
// lese sie in map ein.
IXProperties checkoutMap = new IXProperties();
checkoutMap.Read(Path.Combine(checkoutDir.FullName, "checkoutobjs.properties"));
// Gelöschte Dateien sind diejenigen, die in der checkoutMap aber nicht in checkoutFiles enthalten sind.
findDeletedFiles(checkoutMap, checkoutFiles, deletedFiles);
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
FindInfo findInfo = new FindInfo();
findInfo.findDirect = new FindDirect();
findInfo.findDirect.query = "buch sord.type:[254 TO 255]";
findInfo.findDirect.searchInFulltext = true;
findInfo.findDirect.searchInIndex = true;
findInfo.findDirect.searchInMemo = true;
findInfo.findDirect.searchInSordName = true;
FindResult findResult = ix.Ix.findFirstSords(findInfo, 100, SordC.mbAll);
for (int i = 0; i < findResult.sords.Length; i++)
{
Logger.instance().log(findResult.sords[i].name + "," + findResult.sords[i].type);
}
ix.Ix.findClose(findResult.searchId);
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
Logger.instance().log("IX logout OK");
}
}
}
/// <summary>
/// Initialize
/// </summary>
/// <param name="conn">Connection object</param>
/// <param name="arcName">Archive name</param>
/// <param name="connProps">Connection properties</param>
/// <returns></returns>
public virtual void Init(FWConnection conn, string arcName, IXProperties connProps)
{
this.connVal = conn;
this.classFactoryVal = new FWContentClassFactory(this);
this.sordZVal = new SordZ(SordC.mbLeanMembers | SordC.mbDocVersionMembers);
this.editZVal = new EditInfoZ(EditInfoC.mbDocumentMembers | EditInfoC.mbSignatureMembers | EditInfoC.mbAttachmentMembers, sordZVal);
// try to get the temporary directory from the connection properties
String tmpDir = (connProps != null) ? connProps[FWConnFactory.PROP_TEMP_DIR] : null;
if (tmpDir != null && tmpDir.Length != 0)
{
tempDirVal = makeTempDir(tmpDir, Path.Combine(arcName, "Temp"));
checkoutDirVal = makeTempDir(tmpDir, Path.Combine(arcName, "Checkout"));
}
else
{
try
{
// not found: use the users APPDATA directory
tempDirVal = makeTempDir(Path.Combine(Environment.GetFolderPath(Environment.SpecialFolder.ApplicationData), "ELO Digital Office"), Path.Combine(arcName, "Temp"));
checkoutDirVal = makeTempDir(Path.Combine(Environment.GetFolderPath(Environment.SpecialFolder.ApplicationData), "ELO Digital Office"), Path.Combine(arcName, "Checkout"));
}
catch (Exception)
{
try
{
tempDirVal = makeTempDir(Path.Combine(Environment.GetFolderPath(Environment.SpecialFolder.LocalApplicationData), "ELO Digital Office"), Path.Combine(arcName, "Temp"));
checkoutDirVal = makeTempDir(Path.Combine(Environment.GetFolderPath(Environment.SpecialFolder.LocalApplicationData), "ELO Digital Office"), Path.Combine(arcName, "Checkout"));
}
catch (Exception)
{
// Konto "Local System" unter Windows 2003 kann nicht auf APPDATA zugreifen.
tempDirVal = makeTempDir(Path.Combine(Path.GetTempPath(), "ELO Digital Office"), Path.Combine(arcName, "Temp"));
checkoutDirVal = makeTempDir(Path.Combine(Path.GetTempPath(), "ELO Digital Office"), Path.Combine(arcName, "Checkout"));
}
}
}
// Initialize the FWDownloadManager object
downloadManagerVal = ClassFactory.NewDownloadManager(
tempDirVal,
connProps.Get(FWConnFactory.PROP_CACHE_DOCUMENT_LIFETIME_SECONDS,
FWConnFactory.PROP_CACHE_DOCUMENT_LIFETIME_DEFAULT));
checkedOutDocumentsManagerVal = ClassFactory.NewCheckedOutDocumentsManager(checkoutDirVal);
}
public void run()
{
IXConnFactory connFact = null;
IXConnection conn = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
conn = connFact.Create(userName, userPwd, "myComputer", null);
Logger.instance().log("login OK");
Logger.instance().log("Check whether OCR is available...");
bool avail = checkOcrAvail(conn);
Logger.instance().log("OCR is available=" + avail);
if (avail)
{
Logger.instance().log("Query languages:");
OcrInfo ocrInfo = new OcrInfo();
ocrInfo.queryLanguages = new OcrInfoQueryLanguages();
// Extenal language names should be returned in this language
ocrInfo.messagesLanguage = OcrInfoC.MESSAGES_LANGUAGE_GERMAN;
OcrResult ocrResult = conn.Ix.processOcr(ocrInfo);
for (int i = 0; i < ocrResult.queryLanguages.externalLangs.Length; i++)
{
Logger.instance().log("external=" + ocrResult.queryLanguages.externalLangs[i]);
Logger.instance().log("internal=" + ocrResult.queryLanguages.internalLangs[i]);
}
}
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
if (conn != null)
{
Logger.instance().log("IX logout...");
conn.Logout();
Logger.instance().log("IX logout OK");
}
}
}
/// <summary>
/// Read LoginResult object from login.properties.
/// </summary>
/// <param name="lprops">Map that contains login.properties</param>
/// <returns>LoginResult object</returns>
protected static LoginResult readLoginResult(IXProperties lprops)
{
LoginResult loginResult = new LoginResult();
loginResult.clientInfo = new ClientInfo();
loginResult.clientInfo.ticket = lprops["loginResult.clientInfo.ticket"];
loginResult.clientInfo.language = lprops["loginResult.clientInfo.language"];
loginResult.clientInfo.country = lprops["loginResult.clientInfo.country"];
loginResult.ticketLifetime = lprops.Get("loginResult.ticketLifetime", 120);
loginResult.user = new UserInfo();
loginResult.user.id = lprops.Get("loginResult.user.id", -1);
loginResult.user.name = lprops["loginResult.user.name"];
loginResult.user.flags = lprops.Get("loginResult.user.flags", 0);
return(loginResult);
}
private static IXProperties ReadConfigProperties()
{
IXProperties props = null;
String appDir = GetAppdataDir();
props = ReadConfigPropertiesInDir(appDir);
if (props == null)
{
String instDir = GetElofsInstDirFromRegistry();
props = ReadConfigPropertiesInDir(instDir);
}
return(props);
}
/// <summary>
/// Creates a connection to IndexServer that is initialized by the
/// session ticket of ELOFS.
/// </summary>
/// <param name="arcName">Archive name</param>
/// <returns>Connection to IndexServer</returns>
protected virtual FSConnection CreateConnection(String arcName)
{
String login_properties = getLoginPropertiesFileName(arcName);
IXProperties lprops = new IXProperties();
lprops.Read(login_properties);
String url = lprops["url"];
IXClient ixClient = new IXClient(url, nbOfConnections, timeoutSeconds);
FSConnLogin connLogin = new FSConnLogin(ixClient, login_properties);
IXProperties connProps = new IXProperties();
FSConnection conn = new FSConnection(config, arcName, new IXConnection(ixClient, connLogin, connProps));
return(conn);
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// Prepare ClientInfo object with language and country
// ClientInfo ci = new ClientInfo();
// ci.language = "de";
// ci.country = "DE";
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
SelectKeywordDlg dlg = new SelectKeywordDlg(ix);
dlg.ShowDialog();
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
Logger.instance().log("IX logout OK");
}
}
}
private static IXProperties ReadConfigPropertiesInDir(String dir)
{
IXProperties props = null;
if (dir.Length != 0 && Directory.Exists(dir))
{
String confFile = Path.Combine(dir, "conf.properties");
if (File.Exists(confFile))
{
props = new IXProperties();
props.Read(confFile);
String localFile = Path.Combine(dir, "local.properties");
if (File.Exists(localFile))
{
props.Read(localFile);
}
}
}
return(props);
}
public void run()
{
IXConnFactory connFact = null;
IXConnection conn = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
conn = connFact.Create(userName, userPwd, "myComputer", null);
Logger.instance().log("login OK");
Logger.instance().log("Check whether OCR is available...");
bool avail = checkOcrAvail(conn);
Logger.instance().log("OCR is available=" + avail);
if (avail)
{
String fileName = "..\\..\\sample.tif";
Logger.instance().log("Recognize file asynchronously");
String text = recognizeFileAsync(conn, fileName, 30);
Logger.instance().log("text=" + text.Substring(0, 100) + "...");
}
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
if (conn != null)
{
Logger.instance().log("IX logout...");
conn.Logout();
Logger.instance().log("IX logout OK");
}
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix1 = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// LOGIN
Logger.instance().log("login connections...");
ix1 = connFact.Create(userName, userPwd, "myComputer-conn1", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
EventBusWatchFolderEventsDlg dlg = new EventBusWatchFolderEventsDlg(ix1);
dlg.ShowDialog();
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix1 != null)
{
Logger.instance().log("IX logout...");
ix1.Logout();
Logger.instance().log("IX logout OK");
}
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// Prepare ClientInfo object with language and country
// ClientInfo ci = new ClientInfo();
// ci.language = "de";
// ci.country = "DE";
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
// get constants
Logger.instance().log("get const...");
IXServicePortC CONST = ix.CONST;
Logger.instance().log("get const OK");
// lock key data
// This is optional since checkinKeys and
// deleteKeys check the lock too.
Logger.instance().log("lock key data...");
ix.Ix.checkoutKeys(null, LockC.YES);
Logger.instance().log("lock key data OK");
// create key
// - be aware to set KeyInfo.id = -1 to create a new key!
Logger.instance().log("create key...");
KeyInfo ki = new KeyInfo();
ki.id = -1;
ki.name = "C# Example Key";
ki.id = ix.Ix.checkinKeys(new KeyInfo[] { ki }, LockC.NO)[0];
Logger.instance().log("create key OK, name=" + ki.name + ", id=" + ki.id);
// delete key and unlock
Logger.instance().log("delete key...");
ix.Ix.deleteKeys(new String[] { ki.name }, LockC.YES);
Logger.instance().log("delete key OK");
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
Logger.instance().log("IX logout OK");
}
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// Prepare ClientInfo object with language and country
// ClientInfo ci = new ClientInfo();
// ci.language = "de";
// ci.country = "DE";
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
// get constants
Logger.instance().log("get const...");
IXServicePortC CONST = ix.CONST;
Logger.instance().log("get const OK");
// Example for initializing an encryption set with a new internal password.
// If you uncomment this lines, aready encrypted documents of this encryption set
// cannot be decrypted anymore since the internal key is lost!
// Logger.instance().log("init encryption set ...");
//initializeNewEncryptionSet(ix, CONST, 13, "CS-TEST", encryptionPassword);
// Logger.instance().log("init encryption set OK");
// checkin example document and encrypt it
string objId = checkinDocEncrypted(ix, CONST);
// checkout example document
checkoutDocDecryptedUsingSessionOption(ix, CONST, objId);
// checkout example document
checkoutDocDecryptedUsingUrlExt(ix, CONST, objId);
bool cleanUp = true;
if (cleanUp)
{
// Delete Document
DeleteOptions delOpts = new DeleteOptions();
delOpts.deleteFinally = true;
ix.Ix.deleteSord(null, objId, LockC.NO, null);
ix.Ix.deleteSord(null, objId, LockC.NO, delOpts);
}
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
Logger.instance().log("IX logout OK");
}
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
// Create a document
EditInfo ed = ix.Ix.createDoc("1", null, null, EditInfoC.mbSordDoc);
ed.sord.name = "document with annotations";
ed.document = new Document();
ed.document.docs = new DocVersion[1] {
new DocVersion()
};
ed.document.docs[0].ext = "tif";
ed.document.docs[0].pathId = ed.sord.path;
ed.document.docs[0].encryptionSet = ed.sord.details.encryptionSet;
ed.document = ix.Ix.checkinDocBegin(ed.document);
ed.document.docs[0].uploadResult = ix.Upload(ed.document.docs[0].url, @"..\..\00000001.TIF");
ed.document = ix.Ix.checkinDocEnd(ed.sord, SordC.mbAll, ed.document, LockC.NO);
List <Note> notes = new List <Note>();
// -------------------------------------------------------
// Do not use the member Note.desc for annotations because
// it contains position and formatting information.
// -------------------------------------------------------
// Text on a opaque rectangle
if (true)
{
Note note = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_NOTE_WITHFONT, null);
note.noteText.text = "This is an annotation with font=" + note.noteText.fontInfo.faceName;
note.color = NetColorToEloColor(System.Drawing.Color.RosyBrown);
note.noteText.fontInfo.height *= 2;
note.noteText.fontInfo.bold = true;
note.noteText.fontInfo.italic = true;
note.noteText.fontInfo.RGB = NetColorToEloColor(System.Drawing.Color.SkyBlue);
note.XPos = 100;
note.YPos = 200;
note.width = 1000;
note.height = 500;
notes.Add(note);
}
// Horizontal line
if (true)
{
Note note = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_HORIZONTAL_LINE, null);
PointInfo p1 = new PointInfo();
p1.x = 100;
p1.y = 750;
PointInfo p2 = new PointInfo();
p2.x = p1.x + 900;
p2.y = p1.y;
note.noteFreehand.points = new PointInfo[] { p1, p2 };
note.noteFreehand.width = 20; // Pen width
note.color = NetColorToEloColor(System.Drawing.Color.Violet);
notes.Add(note);
}
// Freehand line (this example draws a circle)
if (true)
{
Note note = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_FREEHAND, null);
List <PointInfo> points = new List <PointInfo>();
for (int i = 0; i < 360; i += 5)
{
double alpha = 2 * Math.PI * (double)i / 360.0;
PointInfo p = new PointInfo();
p.x = 200 + (int)(Math.Sin(alpha) * 100);
p.y = 900 + (int)(Math.Cos(alpha) * 100);
points.Add(p);
}
note.noteFreehand.points = points.ToArray();
note.noteFreehand.width = 50; // Pen width
note.color = NetColorToEloColor(System.Drawing.Color.Tomato);
notes.Add(note);
}
// Draws a half-transparent rectangle
if (true)
{
Note note = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_MARKER, null);
note.XPos = 400;
note.YPos = 800;
note.width = 300;
note.height = 200;
note.color = NetColorToEloColor(System.Drawing.Color.YellowGreen);
notes.Add(note);
}
// Draws a filled (opaque) rectangle
if (true)
{
Note note = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_FILLEDRECTANGLE, null);
note.XPos = 800;
note.YPos = 800;
note.width = 300;
note.height = 200;
note.color = NetColorToEloColor(System.Drawing.Color.YellowGreen);
notes.Add(note);
}
// Draws a strikeout line
if (true)
{
Note note = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_STRIKEOUT, null);
PointInfo p1 = new PointInfo();
p1.x = 100;
p1.y = 1100;
PointInfo p2 = new PointInfo();
p2.x = p1.x + 900;
p2.y = p1.y;
note.noteFreehand.points = new PointInfo[] { p1, p2 };
note.noteFreehand.width = 100;
note.noteFreehand.strikeoutWidth = 20;
note.noteFreehand.strikeoutColor = NetColorToEloColor(System.Drawing.Color.Red);
note.color = NetColorToEloColor(System.Drawing.Color.Yellow);
notes.Add(note);
}
int[] noteIds = ix.Ix.checkinNotes(null, notes.ToArray(), NoteC.mbAll, LockC.NO);
Logger.instance().log("noteIds=" + noteIds);
}
finally
{
ix.Logout();
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// Prepare ClientInfo object with language and country
// ClientInfo ci = new ClientInfo();
// ci.language = "de";
// ci.country = "DE";
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
// get constants
Logger.instance().log("get const...");
IXServicePortC CONST = ix.CONST;
Logger.instance().log("get const OK");
// 1. Create archive hirarchie
// root folder
Sord sordRoot = ix.Ix.createSord("1", null, EditInfoC.mbSord).sord;
sordRoot.name = "C# example FindFirstFindNext";
sordRoot.id = ix.Ix.checkinSord(sordRoot, SordC.mbAll, LockC.NO);
// create sords
Logger.instance().log("create sords...");
for (int i = 0; i < nbOfChildren; i++)
{
String namePrefix = "" + i;
while (namePrefix.Length < 4)
{
namePrefix = "0" + namePrefix;
}
Sord sord = ix.Ix.createSord(sordRoot.guid, null, EditInfoC.mbSord).sord;
sord.name = namePrefix + "-o-" + namePrefix;
sord.id = ix.Ix.checkinSord(sord, SordC.mbAll, LockC.NO);
}
Logger.instance().log("create sords OK");
// 2. List hirarchie
Logger.instance().log("find...");
// Prepare FindInfo object
FindInfo findInfo = new FindInfo();
findInfo.findChildren = new EloixClient.IndexServer.FindChildren();
findInfo.findChildren.parentId = sordRoot.guid;
// find
FindResult findResult = ix.Ix.findFirstSords(findInfo, 1000, SordC.mbAll);
Logger.instance().log("found #=" + findResult.sords.Length);
for (int i = 0; i < findResult.sords.Length; i++)
{
Logger.instance().log("sord.id=" + findResult.sords[i].id + ", sord.name=" + findResult.sords[i].name);
}
ix.Ix.findClose(findResult.searchId);
Logger.instance().log("find OK");
bool cleanUp = true;
if (cleanUp)
{
Logger.instance().log("clean up...");
DeleteOptions delOpts = new DeleteOptions();
delOpts.deleteFinally = true;
ix.Ix.deleteSord(null, sordRoot.guid, LockC.NO, null);
ix.Ix.deleteSord(null, sordRoot.guid, LockC.NO, delOpts);
Logger.instance().log("clean up OK");
}
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
Logger.instance().log("IX logout OK");
}
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix1 = null;
IXConnection ix2 = null;
// generate an event type that is most likely only used by me.
myEventType = computeMyEventType();
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// LOGIN
Logger.instance().log("login connections...");
ix1 = connFact.Create(userName, userPwd, "myComputer-conn1", null);
ix2 = connFact.Create(userName, userPwd, "myComputer-conn2", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
// Add event bus handlers.
// This handlers are called for the received events from a background thread.
// Thus we cannot update the user interfache in this threads directly.
// The handlers will add the received events to the list receivedMessages and
// the items of the list are printed from the main thread.
ix1.EventBusApi.EventBusHandler += new EventBusApi.ProcessEventBusEvents(EventBusApi_EventBusHandler1);
ix2.EventBusApi.EventBusHandler += new EventBusApi.ProcessEventBusEvents(EventBusApi_EventBusHandler2);
// Add listeners to our private event.
ix1.EventBusApi.BroadcastBus.AddListener(myEventType);
ix2.EventBusApi.BroadcastBus.AddListener(myEventType);
Logger.instance().log("conn1.subsId=" + ix1.EventBusApi.SubscriberId);
Logger.instance().log("conn2.subsId=" + ix2.EventBusApi.SubscriberId);
// Each connection sends 3 events to the other connection.
// Here, the event data is a simple string. But it could be a Sord e.g. too.
Logger.instance().log("send events");
for (int i = 0; i < 3; i++)
{
EventBusApi.Bus bbus1 = ix1.EventBusApi.BroadcastBus;
bbus1.Send(myEventType, "Hello conn2 - " + i);
EventBusApi.Bus bbus2 = ix2.EventBusApi.BroadcastBus;
bbus2.Send(myEventType, "Hello conn1 - " + i);
}
// Wait for the events and print them.
Logger.instance().log("wait 1");
Thread.Sleep(1 * 1000);
// Print received messages
Logger.instance().log("received:");
foreach (String s in receivedMessages)
{
Logger.instance().log(s);
}
if (receivedMessages.Count != 6)
{
Logger.instance().log("Error: 6 events should have been received");
}
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix1 != null && ix2 != null)
{
Logger.instance().log("IX logout...");
ix1.Logout();
ix2.Logout();
Logger.instance().log("IX logout OK");
}
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// Prepare ClientInfo object with language and country
// ClientInfo ci = new ClientInfo();
// ci.language = "de";
// ci.country = "DE";
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
// get constants
Logger.instance().log("get const...");
IXServicePortC CONST = ix.CONST;
Logger.instance().log("get const OK");
// 1. Create archive structure
Logger.instance().log("create structure...");
// create root folder s1
EditInfo ed = ix.Ix.createSord("1", "0", EditInfoC.mbAll);
Sord s1 = ed.sord;
s1.name = "s1 C# example FindByIndexValues";
s1.id = ix.Ix.checkinSord(s1, SordC.mbAll, LockC.NO);
/// d1, name=The Inner Circle, AUTHOR=T. Coraghessan Boyle, PRICE=039
/// d2 name=The Shifting Tide, AUTHOR=Anne Perry, PRICE=037
/// d3 name=Feel, AUTHOR=Robbie Williams, PRICE=142
/// d4 name=The Da Vinci Code, AUTHOR=Dan Brown, PRICE=032
///
Sord d1 = internalCreateBook(ix, CONST, s1.guid, "The Inner Circle", "T. Coraghessan Boyle", "039");
Sord d2 = internalCreateBook(ix, CONST, s1.guid, "The Shifting Tide", "Anne Perry", "037");
Sord d3 = internalCreateBook(ix, CONST, s1.guid, "Feel", "Robbie Williams", "142");
Sord d4 = internalCreateBook(ix, CONST, s1.guid, "The Da Vinci Code", "Dan Brown", "032");
Logger.instance().log("create structure OK");
// 2. Find books from Authors with names from "A" to "J"
internalFindBooks(ix, CONST, s1.guid, "A* ... J*", "");
// Finds: The Da Vinci Code,The Shifting Tide
// 3. Find books from Authors with names from "J"
internalFindBooks(ix, CONST, s1.guid, "J*...*", "");
// Finds: Feel,The Inner Circle
// 4. Find books from Authors with names from "J" and price higher than 100
internalFindBooks(ix, CONST, s1.guid, "J*...", "100...*");
// Finds: Feel
bool cleanUp = true;
if (cleanUp)
{
Logger.instance().log("clean up...");
ix.Ix.deleteSord(null, s1.guid, LockC.NO, null);
Logger.instance().log("clean up OK");
}
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
Logger.instance().log("IX logout OK");
}
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// Prepare ClientInfo object with language and country
// ClientInfo ci = new ClientInfo();
// ci.language = "de";
// ci.country = "DE";
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
// get constants
Logger.instance().log("get const...");
IXServicePortC CONST = ix.CONST;
Logger.instance().log("get const OK");
// 1. Create sord for document without version
// Initialize Sord object
EditInfo ed = ix.Ix.createDoc("1", "0", null, EditInfoC.mbSordDocAtt);
ed.sord.name = "C# example CheckinAttachment";
// Create attachment file
String attFile = internalCreateTestFile("CheckinNewAttachment attachment file", "txt");
// Supply the extension of the document
ed.document.atts = new DocVersion[1];
ed.document.atts[0] = new DocVersion();
ed.document.atts[0].ext = ix.GetFileExt(attFile);
ed.document.atts[0].pathId = ed.sord.path;
// ed.document.atts[0].encryptionSet = ignored
// CheckinDocBegin: let IndexServer generate an URL to upload the document
ed.document = ix.Ix.checkinDocBegin(ed.document);
Logger.instance().log("prepared upload URL=" + ed.document.atts[0].url + ", att-guid=" + ed.document.atts[0].guid);
// Upload the document
String uploadResult = ix.Upload(ed.document.atts[0].url, attFile);
ed.document.atts[0].uploadResult = uploadResult;
Logger.instance().log("upload succeeded");
System.IO.File.Delete(attFile);
// CheckinDocEnd: uploadResult contains the document information from ELODM.
// Pass this information to
ed.document = ix.Ix.checkinDocEnd(ed.sord, SordC.mbAll, ed.document, LockC.NO);
Logger.instance().log("inserted document:");
Logger.instance().log(" objId=" + ed.document.objId);
Logger.instance().log(" attId=" + ed.document.atts[0].id);
Logger.instance().log(" att-guid=" + ed.document.atts[0].guid);
Logger.instance().log(" URL=" + ed.document.atts[0].url);
// 2. Checkout and show document
ed = ix.Ix.checkoutDoc(ed.sord.guid, null, EditInfoC.mbAll, LockC.NO);
String tempName2 = internalMakeTempFileName(ed.document.atts[0].ext);
ix.Download(ed.document.atts[0].url, tempName2);
// Uncomment this to show document in notepad:
// System.Diagnostics.Process.Start("notepad.exe", tempName2);
// System.Threading.Thread.Sleep(3000);
System.IO.File.Delete(tempName2);
bool cleanUp = true;
if (cleanUp)
{
// Delete Document
DeleteOptions delOpts = new DeleteOptions();
delOpts.deleteFinally = true;
ix.Ix.deleteSord(null, ed.sord.guid, LockC.NO, null);
ix.Ix.deleteSord(null, ed.sord.guid, LockC.NO, delOpts);
}
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
Logger.instance().log("IX logout OK");
}
}
}
