コード例 #1
0
        /// <summary>
        /// Read the login.properties file to receive the session ticket.
        /// </summary>
        public override void login()
        {
            IXProperties lprops = new IXProperties();

            lprops.Read(loginProperties);
            lrVal = readLoginResult(lprops);
        }
コード例 #2
0
        public void run()
        {
            lockKey = "mykey";

            IXConnFactory connFact = null;
            IXConnection  ix       = null;

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                Logger.instance().log("create IXConnFactory OK");

                // Prepare ClientInfo object with language and country
                // ClientInfo ci = new ClientInfo();
                // ci.language = "de";
                // ci.country = "DE";

                // LOGIN
                Logger.instance().log("login...");
                ix = connFact.Create(userName, userPwd, "myComputer", null);
                // ci = ix.Login.ci
                Logger.instance().log("login OK");

                // get constants
                Logger.instance().log("get const...");
                IXServicePortC CONST = ix.CONST;
                Logger.instance().log("get const OK");

                // Get the current archive key
                int keyIdBeforeLock = ix.Ix.lockArchive(null);
                Logger.instance().log("key before lock=" + keyIdBeforeLock);

                // LOCK
                int keyIdBeforeLock2 = ix.Ix.lockArchive(lockKey);

                // Get the current archive key
                int keyIdAfterLock = ix.Ix.lockArchive(null);
                Logger.instance().log("key after lock=" + keyIdAfterLock);

                // UNLOCK
                int keyIdBeforeUnlock = ix.Ix.lockArchive("0");
            }
            catch (Exception e)
            {
                throw e;
            }
            finally
            {
                // Logout
                // --
                if (ix != null)
                {
                    Logger.instance().log("IX logout...");
                    ix.Logout();
                    Logger.instance().log("IX logout OK");
                }
            }
        }
コード例 #3
0
ファイル: FSCheckoutFolder.cs プロジェクト: ThomasEcherer/elo
        private void findDeletedFiles(IXProperties checkoutMap, List <string> checkoutFiles, List <string> deletedFiles)
        {
            Dictionary <string, string> mapCheckoutFiles = new Dictionary <string, string>(StringComparer.OrdinalIgnoreCase);

            foreach (string f in checkoutFiles)
            {
                mapCheckoutFiles.Add(f, f);
            }

            foreach (string key in checkoutMap.Keys)
            {
                if (key.StartsWith("LM_") || key.StartsWith("MD5_"))
                {
                    continue;
                }
                try { Convert.ToInt32(key); } catch (Exception) { continue; }
                string f = checkoutMap[key];
                if (f.StartsWith("\\"))
                {
                    f = f.Substring(1);
                }
                f = Path.Combine(checkoutDir.FullName, f);
                if (!mapCheckoutFiles.ContainsKey(f))
                {
                    deletedFiles.Add(f);
                }
            }
        }
コード例 #4
0
ファイル: ViewAndEditSord.cs プロジェクト: ThomasEcherer/elo
        public void run()
        {
            IXConnFactory connFact = null;
            IXConnection  ix       = null;

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                Logger.instance().log("create IXConnFactory OK");

                // Prepare ClientInfo object with language and country
                // ClientInfo ci = new ClientInfo();
                // ci.language = "de";
                // ci.country = "DE";

                // LOGIN
                Logger.instance().log("login...");
                ix = connFact.Create(userName, userPwd, "myComputer", null);
                // ci = ix.Login.ci
                Logger.instance().log("login OK");

                // get constants
                Logger.instance().log("get const...");
                IXServicePortC CONST = ix.CONST;
                Logger.instance().log("get const OK");

                // Create a root folder based on keywording form "Email".
                // Parent is the "imaginary" archive entry with object ID = 1.
                String   parentId = "1";
                String   maskId   = "email";
                EditInfo ed       = ix.Ix.createSord(parentId, maskId, EditInfoC.mbAll);
                ed.sord.name = "New Sord";

                ViewAndEditSordDlg dlg = new ViewAndEditSordDlg();
                dlg.init(ix, ed);
                dlg.ShowDialog(null);

                // CHECKIN
                int objId = ix.Ix.checkinSord(dlg.getSord(), SordC.mbAll, LockC.NO);
                Logger.instance().log("Created sord successfully, objId=" + objId);
            }
            catch (Exception e)
            {
                throw e;
            }
            finally
            {
                // Logout
                // --
                if (ix != null)
                {
                    Logger.instance().log("IX logout...");
                    ix.Logout();
                    Logger.instance().log("IX logout OK");
                }
            }
        }
コード例 #5
0
ファイル: StandardLogin.cs プロジェクト: ThomasEcherer/elo
        public void run()
        {
            IXConnFactory connFact = null;
            IXConnection  ix       = null;

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                Logger.instance().log("create IXConnFactory OK");

                // LOGIN
                Logger.instance().log("login...");
                ix = connFact.Create(userName, userPwd, "myComputer", null);

                Logger.instance().log("Version=" + connFact.Version);
                Logger.instance().log("ImplVersion=" + ix.ImplVersion);
                Logger.instance().log("InterfaceVersion=" + ix.InterfaceVersion);
                Logger.instance().log("ClientVersion=" + ix.ClientVersion);

                LoginResult loginResult = ix.LoginResult;

                // If successfully logged on, you can find the ticket here:
                // loginResult.clientInfo.ticket.
                Logger.instance().log("login successfully, ticket=" + loginResult.clientInfo.ticket);
                Logger.instance().log("ticket lifetime seconds=" + loginResult.ticketLifetime);
                Logger.instance().log("user ID=" + loginResult.user.id);

                // Otherwise an exception was thrown in ix.Ix.login() and you will not
                // reach this lines.

                // Use in subsequent calls always the returned ClientInfo object (contains ticket).
                // ci = ix.Login.ci


                ix.Ix.checkoutWorkflowTemplate("6439", "", WFDiagramC.mbAll, LockC.NO);
                FindWorkflowInfo findInfo = new FindWorkflowInfo();
                findInfo.type = WFTypeC.TEMPLATE;
                FindResult findResult = ix.Ix.findFirstWorkflows(findInfo, 100, WFDiagramC.mbLean);
                Logger.instance().log("wfs=" + findResult.workflows);
            }
            catch (Exception e)
            {
                throw e;
            }
            finally
            {
                // Logout
                // --
                if (ix != null)
                {
                    Logger.instance().log("IX logout...");
                    ix.Logout();
                    ix.Dispose();
                    Logger.instance().log("IX logout OK");
                }
            }
        }
コード例 #6
0
 /// <summary>
 /// Constructor
 /// </summary>
 /// <param name="conn">Connection to IndexServer</param>
 /// <param name="connProps">Connection properties</param>
 public FWSessionInterface(FWConnection conn, IXProperties connProps)
 {
     this.classFactoryVal  = new FWSessionClassFactory(this);
     this.connVal          = conn;
     this.sessOptsVal      = ClassFactory.NewSessionOptions();
     this.encrPasswordsVal = ClassFactory.NewEncrPasswords();
     this.userProfileVal   = ClassFactory.NewUserProfile(null);
 }
コード例 #7
0
        /// <summary>
        /// Creates an object that provides the relogin mechanism.
        /// </summary>
        /// <param name="ixClient">IXClient object</param>
        /// <param name="ci">ClientInfo object</param>
        /// <param name="userName">User name</param>
        /// <param name="userPwd">User password</param>
        /// <param name="computerName">Computer name</param>
        /// <param name="runAs">Run as user</param>
        /// <param name="reportAs">Report as user</param>
        /// <param name="sessOpts">Session options</param>
        /// <param name="sso">Use Single Sign On supplied by ixlogin servlet.</param>
        /// <returns>Login object</returns>
        protected override IXConnLogin InternalCreateLoginObject(IXClient ixClient, ClientInfo ci,
                                                                 String userName, String userPwd, String computerName, String runAs, String reportAs,
                                                                 IXProperties sessOpts, bool sso)
        {
            IXConnLogin ixsl = new FWConnLoginEventHandler(ixClientVal, ci);

            return(ixsl);
        }
コード例 #8
0
        /// <summary>
        /// Initializes this object
        /// </summary>
        /// <param name="conn">Connection object</param>
        /// <param name="arcName">Archive name</param>
        /// <param name="connProps">Connection properties</param>
        public override void Init(FWConnection conn, string arcName, IXProperties connProps)
        {
            base.Init(conn, arcName, connProps);

            // read more members than the base class:
            // e.g. the archive path is required to build ELOFS paths
            base.sordZVal = new SordZ(SordC.mbLeanMembers | SordC.mbDocVersionMembers | SordC.mbRefPaths);
            base.editZVal = new EditInfoZ(EditInfoC.mbDocumentMembers | EditInfoC.mbSignatureMembers | EditInfoC.mbAttachmentMembers, sordZVal);
        }
コード例 #9
0
 /// <summary>
 /// Constructor.
 /// </summary>
 /// <remarks>Reads the ELOFS properties from the conf.properties file.</remarks>
 /// <exception cref="NotSupportedException">If ELO File System configuration cannot be found in installation directory or application data directory.</exception>
 public FSConfig()
 {
     props = ReadConfigProperties();
     if (props == null)
     {
         throw new System.NotSupportedException("Cannot find ELO File System configuration");
     }
     InitTempFileFilters();
 }
コード例 #10
0
        public void run()
        {
            IXConnFactory connFact = null;
            IXConnection  ix       = null;

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                Logger.instance().log("create IXConnFactory OK");

                // LOGIN
                Logger.instance().log("login...");
                ix = connFact.Create(userName, userPwd, "myComputer", null);
                // ci = ix.Login.ci
                Logger.instance().log("login OK");

                // Create a document
                EditInfo ed = ix.Ix.createDoc("1", null, null, EditInfoC.mbSordDoc);
                ed.sord.name     = "document with sticky notes";
                ed.document      = new Document();
                ed.document.docs = new DocVersion[1] {
                    new DocVersion()
                };
                ed.document.docs[0].ext           = "tif";
                ed.document.docs[0].pathId        = ed.sord.path;
                ed.document.docs[0].encryptionSet = ed.sord.details.encryptionSet;
                ed.document = ix.Ix.checkinDocBegin(ed.document);
                ed.document.docs[0].uploadResult = ix.Upload(ed.document.docs[0].url, @"..\..\00000001.TIF");
                ed.document = ix.Ix.checkinDocEnd(ed.sord, SordC.mbAll, ed.document, LockC.NO);

                Note[] notes = new Note[3];

                // Create a normal sticky note
                notes[0]      = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_NORMAL, null);
                notes[0].desc = "This is a normal sticky note";

                // Create a personal note
                notes[1]      = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_PERSONAL, null);
                notes[1].desc = "This is a personal note";

                // Create a stamp note
                notes[2]      = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_STAMP, null);
                notes[2].desc = "This is a stamp note";

                int[] noteIds = ix.Ix.checkinNotes(null, notes, NoteC.mbAll, LockC.NO);
                Logger.instance().log("noteIds=" + noteIds);
            }
            finally
            {
                ix.Logout();
            }
        }
コード例 #11
0
ファイル: OcrRecognize.cs プロジェクト: ThomasEcherer/elo
        public void run()
        {
            IXConnFactory connFact = null;
            IXConnection  conn     = null;

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                conn     = connFact.Create(userName, userPwd, "myComputer", null);
                Logger.instance().log("login OK");

                Logger.instance().log("Check whether OCR is available...");
                bool avail = checkOcrAvail(conn);
                Logger.instance().log("OCR is available=" + avail);

                if (avail)
                {
                    String fileName = "..\\..\\sample.tif";

                    Logger.instance().log("Recognize file synchronously");
                    String text = recognizeFileSync(conn, fileName);
                    Logger.instance().log("text=" + text.Substring(0, 100) + "...");

                    // Recognize rectangle.
                    // Rectangle units are given in per thousand of document width resp. height.
                    Logger.instance().log("Recognize rect ");
                    int pmLeft = 50, pmTop = 100, pmRight = 200, pmBottom = 1000;
                    text = recognizeRect(conn, fileName, pmLeft, pmTop, pmRight, pmBottom);
                    Logger.instance().log("text=" + text.Substring(0, 100) + "...");

                    // Return character positions
                    Logger.instance().log("Recognize file return character positions");
                    recognizeFileCharPos(conn, fileName);
                }
            }
            catch (Exception e)
            {
                throw e;
            }
            finally
            {
                // Logout
                if (conn != null)
                {
                    Logger.instance().log("IX logout...");
                    conn.Logout();
                    Logger.instance().log("IX logout OK");
                }
            }
        }
コード例 #12
0
        public void run()
        {
            IXConnFactory connFact = null;
            IXConnection  ix       = null;

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                Logger.instance().log("create IXConnFactory OK");

                // Prepare ClientInfo object with language and country
                // ClientInfo ci = new ClientInfo();
                // ci.language = "de";
                // ci.country = "DE";

                // LOGIN
                Logger.instance().log("login ...");
                ClientInfo ci = new ClientInfo();
                ci.timeZone = "GMT+01:00"; // "Europe/Berlin";
                ix          = connFact.CreateSso(ci, Environment.MachineName);
                LoginResult loginResult = ix.LoginResult;

                // If successfully logged on, you can find the ticket here:
                // loginResult.clientInfo.ticket.
                Logger.instance().log("login successfully, ticket=" + loginResult.clientInfo.ticket);
                Logger.instance().log("ticket lifetime seconds=" + loginResult.ticketLifetime);
                Logger.instance().log("user ID=" + loginResult.user.id);

                // Otherwise an exception was thrown in ix.Ix.login() and you will not
                // reach this lines.

                // Use in subsequent calls always the returned ClientInfo object (contains ticket).
                // ci = ix.Login.ci
            }
            catch (Exception e)
            {
                throw e;
            }
            finally
            {
                // Logout
                // --
                if (ix != null)
                {
                    Logger.instance().log("IX logout...");
                    ix.Logout();
                    Logger.instance().log("IX logout OK");
                }
            }
        }
コード例 #13
0
ファイル: FSCheckoutFolder.cs プロジェクト: ThomasEcherer/elo
        private void findFiles(List <string> checkoutFiles, List <string> deletedFiles)
        {
            // Sammle alle Dateien im Checkout-Verzeichnis
            findFilesInDir(checkoutDir, checkoutFiles);

            // Hole aus checkoutobjs.properties die aktuell ausgecheckten Dokumente und
            // lese sie in map ein.
            IXProperties checkoutMap = new IXProperties();

            checkoutMap.Read(Path.Combine(checkoutDir.FullName, "checkoutobjs.properties"));

            // Gelöschte Dateien sind diejenigen, die in der checkoutMap aber nicht in checkoutFiles enthalten sind.
            findDeletedFiles(checkoutMap, checkoutFiles, deletedFiles);
        }
コード例 #14
0
ファイル: FindISearch.cs プロジェクト: ThomasEcherer/elo
        public void run()
        {
            IXConnFactory connFact = null;
            IXConnection  ix       = null;

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                Logger.instance().log("create IXConnFactory OK");

                // LOGIN
                Logger.instance().log("login...");
                ix = connFact.Create(userName, userPwd, "myComputer", null);
                // ci = ix.Login.ci
                Logger.instance().log("login OK");

                FindInfo findInfo = new FindInfo();
                findInfo.findDirect                  = new FindDirect();
                findInfo.findDirect.query            = "buch sord.type:[254 TO 255]";
                findInfo.findDirect.searchInFulltext = true;
                findInfo.findDirect.searchInIndex    = true;
                findInfo.findDirect.searchInMemo     = true;
                findInfo.findDirect.searchInSordName = true;

                FindResult findResult = ix.Ix.findFirstSords(findInfo, 100, SordC.mbAll);
                for (int i = 0; i < findResult.sords.Length; i++)
                {
                    Logger.instance().log(findResult.sords[i].name + "," + findResult.sords[i].type);
                }

                ix.Ix.findClose(findResult.searchId);
            }
            catch (Exception e)
            {
                throw e;
            }
            finally
            {
                // Logout
                // --
                if (ix != null)
                {
                    Logger.instance().log("IX logout...");
                    ix.Logout();
                    Logger.instance().log("IX logout OK");
                }
            }
        }
コード例 #15
0
        /// <summary>
        /// Initialize
        /// </summary>
        /// <param name="conn">Connection object</param>
        /// <param name="arcName">Archive name</param>
        /// <param name="connProps">Connection properties</param>
        /// <returns></returns>
        public virtual void Init(FWConnection conn, string arcName, IXProperties connProps)
        {
            this.connVal         = conn;
            this.classFactoryVal = new FWContentClassFactory(this);
            this.sordZVal        = new SordZ(SordC.mbLeanMembers | SordC.mbDocVersionMembers);
            this.editZVal        = new EditInfoZ(EditInfoC.mbDocumentMembers | EditInfoC.mbSignatureMembers | EditInfoC.mbAttachmentMembers, sordZVal);

            // try to get the temporary directory from the connection properties
            String tmpDir = (connProps != null) ? connProps[FWConnFactory.PROP_TEMP_DIR] : null;

            if (tmpDir != null && tmpDir.Length != 0)
            {
                tempDirVal     = makeTempDir(tmpDir, Path.Combine(arcName, "Temp"));
                checkoutDirVal = makeTempDir(tmpDir, Path.Combine(arcName, "Checkout"));
            }
            else
            {
                try
                {
                    // not found: use the users APPDATA directory
                    tempDirVal     = makeTempDir(Path.Combine(Environment.GetFolderPath(Environment.SpecialFolder.ApplicationData), "ELO Digital Office"), Path.Combine(arcName, "Temp"));
                    checkoutDirVal = makeTempDir(Path.Combine(Environment.GetFolderPath(Environment.SpecialFolder.ApplicationData), "ELO Digital Office"), Path.Combine(arcName, "Checkout"));
                }
                catch (Exception)
                {
                    try
                    {
                        tempDirVal     = makeTempDir(Path.Combine(Environment.GetFolderPath(Environment.SpecialFolder.LocalApplicationData), "ELO Digital Office"), Path.Combine(arcName, "Temp"));
                        checkoutDirVal = makeTempDir(Path.Combine(Environment.GetFolderPath(Environment.SpecialFolder.LocalApplicationData), "ELO Digital Office"), Path.Combine(arcName, "Checkout"));
                    }
                    catch (Exception)
                    {
                        // Konto "Local System" unter Windows 2003 kann nicht auf APPDATA zugreifen.

                        tempDirVal     = makeTempDir(Path.Combine(Path.GetTempPath(), "ELO Digital Office"), Path.Combine(arcName, "Temp"));
                        checkoutDirVal = makeTempDir(Path.Combine(Path.GetTempPath(), "ELO Digital Office"), Path.Combine(arcName, "Checkout"));
                    }
                }
            }


            // Initialize the FWDownloadManager object
            downloadManagerVal = ClassFactory.NewDownloadManager(
                tempDirVal,
                connProps.Get(FWConnFactory.PROP_CACHE_DOCUMENT_LIFETIME_SECONDS,
                              FWConnFactory.PROP_CACHE_DOCUMENT_LIFETIME_DEFAULT));

            checkedOutDocumentsManagerVal = ClassFactory.NewCheckedOutDocumentsManager(checkoutDirVal);
        }
コード例 #16
0
        public void run()
        {
            IXConnFactory connFact = null;
            IXConnection  conn     = null;

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                conn     = connFact.Create(userName, userPwd, "myComputer", null);
                Logger.instance().log("login OK");

                Logger.instance().log("Check whether OCR is available...");
                bool avail = checkOcrAvail(conn);
                Logger.instance().log("OCR is available=" + avail);

                if (avail)
                {
                    Logger.instance().log("Query languages:");
                    OcrInfo ocrInfo = new OcrInfo();
                    ocrInfo.queryLanguages = new OcrInfoQueryLanguages();

                    // Extenal language names should be returned in this language
                    ocrInfo.messagesLanguage = OcrInfoC.MESSAGES_LANGUAGE_GERMAN;

                    OcrResult ocrResult = conn.Ix.processOcr(ocrInfo);
                    for (int i = 0; i < ocrResult.queryLanguages.externalLangs.Length; i++)
                    {
                        Logger.instance().log("external=" + ocrResult.queryLanguages.externalLangs[i]);
                        Logger.instance().log("internal=" + ocrResult.queryLanguages.internalLangs[i]);
                    }
                }
            }
            catch (Exception e)
            {
                throw e;
            }
            finally
            {
                // Logout
                if (conn != null)
                {
                    Logger.instance().log("IX logout...");
                    conn.Logout();
                    Logger.instance().log("IX logout OK");
                }
            }
        }
コード例 #17
0
        /// <summary>
        /// Read LoginResult object from login.properties.
        /// </summary>
        /// <param name="lprops">Map that contains login.properties</param>
        /// <returns>LoginResult object</returns>
        protected static LoginResult readLoginResult(IXProperties lprops)
        {
            LoginResult loginResult = new LoginResult();

            loginResult.clientInfo          = new ClientInfo();
            loginResult.clientInfo.ticket   = lprops["loginResult.clientInfo.ticket"];
            loginResult.clientInfo.language = lprops["loginResult.clientInfo.language"];
            loginResult.clientInfo.country  = lprops["loginResult.clientInfo.country"];
            loginResult.ticketLifetime      = lprops.Get("loginResult.ticketLifetime", 120);
            loginResult.user       = new UserInfo();
            loginResult.user.id    = lprops.Get("loginResult.user.id", -1);
            loginResult.user.name  = lprops["loginResult.user.name"];
            loginResult.user.flags = lprops.Get("loginResult.user.flags", 0);
            return(loginResult);
        }
コード例 #18
0
        private static IXProperties ReadConfigProperties()
        {
            IXProperties props = null;

            String appDir = GetAppdataDir();

            props = ReadConfigPropertiesInDir(appDir);

            if (props == null)
            {
                String instDir = GetElofsInstDirFromRegistry();
                props = ReadConfigPropertiesInDir(instDir);
            }

            return(props);
        }
コード例 #19
0
ファイル: FSConnFactory.cs プロジェクト: ThomasEcherer/elo
        /// <summary>
        /// Creates a connection to IndexServer that is initialized by the
        /// session ticket of ELOFS.
        /// </summary>
        /// <param name="arcName">Archive name</param>
        /// <returns>Connection to IndexServer</returns>
        protected virtual FSConnection CreateConnection(String arcName)
        {
            String       login_properties = getLoginPropertiesFileName(arcName);
            IXProperties lprops           = new IXProperties();

            lprops.Read(login_properties);

            String   url      = lprops["url"];
            IXClient ixClient = new IXClient(url, nbOfConnections, timeoutSeconds);

            FSConnLogin connLogin = new FSConnLogin(ixClient, login_properties);

            IXProperties connProps = new IXProperties();

            FSConnection conn = new FSConnection(config, arcName, new IXConnection(ixClient, connLogin, connProps));

            return(conn);
        }
コード例 #20
0
ファイル: SelectKeyword.cs プロジェクト: ThomasEcherer/elo
        public void run()
        {
            IXConnFactory connFact = null;
            IXConnection  ix       = null;

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                Logger.instance().log("create IXConnFactory OK");

                // Prepare ClientInfo object with language and country
                // ClientInfo ci = new ClientInfo();
                // ci.language = "de";
                // ci.country = "DE";

                // LOGIN
                Logger.instance().log("login...");
                ix = connFact.Create(userName, userPwd, "myComputer", null);
                // ci = ix.Login.ci
                Logger.instance().log("login OK");

                SelectKeywordDlg dlg = new SelectKeywordDlg(ix);
                dlg.ShowDialog();
            }
            catch (Exception e)
            {
                throw e;
            }
            finally
            {
                // Logout
                // --
                if (ix != null)
                {
                    Logger.instance().log("IX logout...");
                    ix.Logout();
                    Logger.instance().log("IX logout OK");
                }
            }
        }
コード例 #21
0
        private static IXProperties ReadConfigPropertiesInDir(String dir)
        {
            IXProperties props = null;

            if (dir.Length != 0 && Directory.Exists(dir))
            {
                String confFile = Path.Combine(dir, "conf.properties");
                if (File.Exists(confFile))
                {
                    props = new IXProperties();
                    props.Read(confFile);
                    String localFile = Path.Combine(dir, "local.properties");
                    if (File.Exists(localFile))
                    {
                        props.Read(localFile);
                    }
                }
            }
            return(props);
        }
コード例 #22
0
        public void run()
        {
            IXConnFactory connFact = null;
            IXConnection  conn     = null;

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                conn     = connFact.Create(userName, userPwd, "myComputer", null);
                Logger.instance().log("login OK");

                Logger.instance().log("Check whether OCR is available...");
                bool avail = checkOcrAvail(conn);
                Logger.instance().log("OCR is available=" + avail);

                if (avail)
                {
                    String fileName = "..\\..\\sample.tif";

                    Logger.instance().log("Recognize file asynchronously");
                    String text = recognizeFileAsync(conn, fileName, 30);
                    Logger.instance().log("text=" + text.Substring(0, 100) + "...");
                }
            }
            catch (Exception e)
            {
                throw e;
            }
            finally
            {
                // Logout
                if (conn != null)
                {
                    Logger.instance().log("IX logout...");
                    conn.Logout();
                    Logger.instance().log("IX logout OK");
                }
            }
        }
コード例 #23
0
        public void run()
        {
            IXConnFactory connFact = null;
            IXConnection  ix1      = null;

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                Logger.instance().log("create IXConnFactory OK");

                // LOGIN
                Logger.instance().log("login connections...");
                ix1 = connFact.Create(userName, userPwd, "myComputer-conn1", null);
                // ci = ix.Login.ci
                Logger.instance().log("login OK");

                EventBusWatchFolderEventsDlg dlg = new EventBusWatchFolderEventsDlg(ix1);
                dlg.ShowDialog();
            }
            catch (Exception e)
            {
                throw e;
            }
            finally
            {
                // Logout
                // --
                if (ix1 != null)
                {
                    Logger.instance().log("IX logout...");
                    ix1.Logout();
                    Logger.instance().log("IX logout OK");
                }
            }
        }
コード例 #24
0
ファイル: CreateDeleteKeys.cs プロジェクト: ThomasEcherer/elo
        public void run()
        {
            IXConnFactory connFact = null;
            IXConnection  ix       = null;

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                Logger.instance().log("create IXConnFactory OK");

                // Prepare ClientInfo object with language and country
                // ClientInfo ci = new ClientInfo();
                // ci.language = "de";
                // ci.country = "DE";

                // LOGIN
                Logger.instance().log("login...");
                ix = connFact.Create(userName, userPwd, "myComputer", null);
                // ci = ix.Login.ci
                Logger.instance().log("login OK");

                // get constants
                Logger.instance().log("get const...");
                IXServicePortC CONST = ix.CONST;
                Logger.instance().log("get const OK");

                // lock key data
                // This is optional since checkinKeys and
                // deleteKeys check the lock too.
                Logger.instance().log("lock key data...");
                ix.Ix.checkoutKeys(null, LockC.YES);
                Logger.instance().log("lock key data OK");

                // create key
                // - be aware to set KeyInfo.id = -1 to create a new key!
                Logger.instance().log("create key...");
                KeyInfo ki = new KeyInfo();
                ki.id   = -1;
                ki.name = "C# Example Key";
                ki.id   = ix.Ix.checkinKeys(new KeyInfo[] { ki }, LockC.NO)[0];
                Logger.instance().log("create key OK, name=" + ki.name + ", id=" + ki.id);

                // delete key and unlock
                Logger.instance().log("delete key...");
                ix.Ix.deleteKeys(new String[] { ki.name }, LockC.YES);
                Logger.instance().log("delete key OK");
            }
            catch (Exception e)
            {
                throw e;
            }
            finally
            {
                // Logout
                // --
                if (ix != null)
                {
                    Logger.instance().log("IX logout...");
                    ix.Logout();
                    Logger.instance().log("IX logout OK");
                }
            }
        }
コード例 #25
0
        public void run()
        {
            IXConnFactory connFact = null;
            IXConnection  ix       = null;

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                Logger.instance().log("create IXConnFactory OK");

                // Prepare ClientInfo object with language and country
                // ClientInfo ci = new ClientInfo();
                // ci.language = "de";
                // ci.country = "DE";

                // LOGIN
                Logger.instance().log("login...");
                ix = connFact.Create(userName, userPwd, "myComputer", null);
                // ci = ix.Login.ci
                Logger.instance().log("login OK");

                // get constants
                Logger.instance().log("get const...");
                IXServicePortC CONST = ix.CONST;
                Logger.instance().log("get const OK");

                // Example for initializing an encryption set with a new internal password.
                // If you uncomment this lines, aready encrypted documents of this encryption set
                // cannot be decrypted anymore since the internal key is lost!
                // Logger.instance().log("init encryption set ...");
                //initializeNewEncryptionSet(ix, CONST, 13, "CS-TEST", encryptionPassword);
                // Logger.instance().log("init encryption set OK");

                // checkin example document and encrypt it
                string objId = checkinDocEncrypted(ix, CONST);

                // checkout example document
                checkoutDocDecryptedUsingSessionOption(ix, CONST, objId);

                // checkout example document
                checkoutDocDecryptedUsingUrlExt(ix, CONST, objId);

                bool cleanUp = true;
                if (cleanUp)
                {
                    // Delete Document
                    DeleteOptions delOpts = new DeleteOptions();
                    delOpts.deleteFinally = true;
                    ix.Ix.deleteSord(null, objId, LockC.NO, null);
                    ix.Ix.deleteSord(null, objId, LockC.NO, delOpts);
                }
            }
            catch (Exception e)
            {
                throw e;
            }
            finally
            {
                // Logout
                // --
                if (ix != null)
                {
                    Logger.instance().log("IX logout...");
                    ix.Logout();
                    Logger.instance().log("IX logout OK");
                }
            }
        }
コード例 #26
0
        public void run()
        {
            IXConnFactory connFact = null;
            IXConnection  ix       = null;

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                Logger.instance().log("create IXConnFactory OK");

                // LOGIN
                Logger.instance().log("login...");
                ix = connFact.Create(userName, userPwd, "myComputer", null);
                // ci = ix.Login.ci
                Logger.instance().log("login OK");

                // Create a document
                EditInfo ed = ix.Ix.createDoc("1", null, null, EditInfoC.mbSordDoc);
                ed.sord.name     = "document with annotations";
                ed.document      = new Document();
                ed.document.docs = new DocVersion[1] {
                    new DocVersion()
                };
                ed.document.docs[0].ext           = "tif";
                ed.document.docs[0].pathId        = ed.sord.path;
                ed.document.docs[0].encryptionSet = ed.sord.details.encryptionSet;
                ed.document = ix.Ix.checkinDocBegin(ed.document);
                ed.document.docs[0].uploadResult = ix.Upload(ed.document.docs[0].url, @"..\..\00000001.TIF");
                ed.document = ix.Ix.checkinDocEnd(ed.sord, SordC.mbAll, ed.document, LockC.NO);

                List <Note> notes = new List <Note>();

                // -------------------------------------------------------
                // Do not use the member Note.desc for annotations because
                // it contains position and formatting information.
                // -------------------------------------------------------

                // Text on a opaque rectangle
                if (true)
                {
                    Note note = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_NOTE_WITHFONT, null);
                    note.noteText.text = "This is an annotation with font=" + note.noteText.fontInfo.faceName;

                    note.color = NetColorToEloColor(System.Drawing.Color.RosyBrown);
                    note.noteText.fontInfo.height *= 2;
                    note.noteText.fontInfo.bold    = true;
                    note.noteText.fontInfo.italic  = true;
                    note.noteText.fontInfo.RGB     = NetColorToEloColor(System.Drawing.Color.SkyBlue);

                    note.XPos   = 100;
                    note.YPos   = 200;
                    note.width  = 1000;
                    note.height = 500;

                    notes.Add(note);
                }

                // Horizontal line
                if (true)
                {
                    Note      note = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_HORIZONTAL_LINE, null);
                    PointInfo p1   = new PointInfo();
                    p1.x = 100;
                    p1.y = 750;
                    PointInfo p2 = new PointInfo();
                    p2.x = p1.x + 900;
                    p2.y = p1.y;
                    note.noteFreehand.points = new PointInfo[] { p1, p2 };

                    note.noteFreehand.width = 20; // Pen width

                    note.color = NetColorToEloColor(System.Drawing.Color.Violet);

                    notes.Add(note);
                }

                // Freehand line (this example draws a circle)
                if (true)
                {
                    Note             note   = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_FREEHAND, null);
                    List <PointInfo> points = new List <PointInfo>();
                    for (int i = 0; i < 360; i += 5)
                    {
                        double    alpha = 2 * Math.PI * (double)i / 360.0;
                        PointInfo p     = new PointInfo();
                        p.x = 200 + (int)(Math.Sin(alpha) * 100);
                        p.y = 900 + (int)(Math.Cos(alpha) * 100);
                        points.Add(p);
                    }
                    note.noteFreehand.points = points.ToArray();

                    note.noteFreehand.width = 50; // Pen width

                    note.color = NetColorToEloColor(System.Drawing.Color.Tomato);

                    notes.Add(note);
                }

                // Draws a half-transparent rectangle
                if (true)
                {
                    Note note = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_MARKER, null);
                    note.XPos   = 400;
                    note.YPos   = 800;
                    note.width  = 300;
                    note.height = 200;
                    note.color  = NetColorToEloColor(System.Drawing.Color.YellowGreen);

                    notes.Add(note);
                }

                // Draws a filled (opaque) rectangle
                if (true)
                {
                    Note note = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_FILLEDRECTANGLE, null);
                    note.XPos   = 800;
                    note.YPos   = 800;
                    note.width  = 300;
                    note.height = 200;
                    note.color  = NetColorToEloColor(System.Drawing.Color.YellowGreen);

                    notes.Add(note);
                }

                // Draws a strikeout line
                if (true)
                {
                    Note note = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_STRIKEOUT, null);

                    PointInfo p1 = new PointInfo();
                    p1.x = 100;
                    p1.y = 1100;
                    PointInfo p2 = new PointInfo();
                    p2.x = p1.x + 900;
                    p2.y = p1.y;
                    note.noteFreehand.points = new PointInfo[] { p1, p2 };

                    note.noteFreehand.width          = 100;
                    note.noteFreehand.strikeoutWidth = 20;
                    note.noteFreehand.strikeoutColor = NetColorToEloColor(System.Drawing.Color.Red);

                    note.color = NetColorToEloColor(System.Drawing.Color.Yellow);

                    notes.Add(note);
                }


                int[] noteIds = ix.Ix.checkinNotes(null, notes.ToArray(), NoteC.mbAll, LockC.NO);
                Logger.instance().log("noteIds=" + noteIds);
            }
            finally
            {
                ix.Logout();
            }
        }
コード例 #27
0
ファイル: FindChildren.cs プロジェクト: ThomasEcherer/elo
        public void run()
        {
            IXConnFactory connFact = null;
            IXConnection  ix       = null;

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                Logger.instance().log("create IXConnFactory OK");

                // Prepare ClientInfo object with language and country
                // ClientInfo ci = new ClientInfo();
                // ci.language = "de";
                // ci.country = "DE";

                // LOGIN
                Logger.instance().log("login...");
                ix = connFact.Create(userName, userPwd, "myComputer", null);
                // ci = ix.Login.ci
                Logger.instance().log("login OK");

                // get constants
                Logger.instance().log("get const...");
                IXServicePortC CONST = ix.CONST;
                Logger.instance().log("get const OK");

                // 1. Create archive hirarchie

                // root folder
                Sord sordRoot = ix.Ix.createSord("1", null, EditInfoC.mbSord).sord;
                sordRoot.name = "C# example FindFirstFindNext";
                sordRoot.id   = ix.Ix.checkinSord(sordRoot, SordC.mbAll, LockC.NO);

                // create sords
                Logger.instance().log("create sords...");
                for (int i = 0; i < nbOfChildren; i++)
                {
                    String namePrefix = "" + i;
                    while (namePrefix.Length < 4)
                    {
                        namePrefix = "0" + namePrefix;
                    }
                    Sord sord = ix.Ix.createSord(sordRoot.guid, null, EditInfoC.mbSord).sord;
                    sord.name = namePrefix + "-o-" + namePrefix;
                    sord.id   = ix.Ix.checkinSord(sord, SordC.mbAll, LockC.NO);
                }
                Logger.instance().log("create sords OK");

                // 2. List hirarchie
                Logger.instance().log("find...");

                // Prepare FindInfo object
                FindInfo findInfo = new FindInfo();
                findInfo.findChildren          = new EloixClient.IndexServer.FindChildren();
                findInfo.findChildren.parentId = sordRoot.guid;

                // find
                FindResult findResult = ix.Ix.findFirstSords(findInfo, 1000, SordC.mbAll);
                Logger.instance().log("found #=" + findResult.sords.Length);
                for (int i = 0; i < findResult.sords.Length; i++)
                {
                    Logger.instance().log("sord.id=" + findResult.sords[i].id + ", sord.name=" + findResult.sords[i].name);
                }
                ix.Ix.findClose(findResult.searchId);
                Logger.instance().log("find OK");

                bool cleanUp = true;
                if (cleanUp)
                {
                    Logger.instance().log("clean up...");
                    DeleteOptions delOpts = new DeleteOptions();
                    delOpts.deleteFinally = true;
                    ix.Ix.deleteSord(null, sordRoot.guid, LockC.NO, null);
                    ix.Ix.deleteSord(null, sordRoot.guid, LockC.NO, delOpts);
                    Logger.instance().log("clean up OK");
                }
            }
            catch (Exception e)
            {
                throw e;
            }
            finally
            {
                // Logout
                // --
                if (ix != null)
                {
                    Logger.instance().log("IX logout...");
                    ix.Logout();
                    Logger.instance().log("IX logout OK");
                }
            }
        }
コード例 #28
0
        public void run()
        {
            IXConnFactory connFact = null;
            IXConnection  ix1      = null;
            IXConnection  ix2      = null;

            // generate an event type that is most likely only used by me.
            myEventType = computeMyEventType();

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                Logger.instance().log("create IXConnFactory OK");

                // LOGIN
                Logger.instance().log("login connections...");
                ix1 = connFact.Create(userName, userPwd, "myComputer-conn1", null);
                ix2 = connFact.Create(userName, userPwd, "myComputer-conn2", null);
                // ci = ix.Login.ci
                Logger.instance().log("login OK");

                // Add event bus handlers.
                // This handlers are called for the received events from a background thread.
                // Thus we cannot update the user interfache in this threads directly.
                // The handlers will add the received events to the list receivedMessages and
                // the items of the list are printed from the main thread.
                ix1.EventBusApi.EventBusHandler += new EventBusApi.ProcessEventBusEvents(EventBusApi_EventBusHandler1);
                ix2.EventBusApi.EventBusHandler += new EventBusApi.ProcessEventBusEvents(EventBusApi_EventBusHandler2);

                // Add listeners to our private event.
                ix1.EventBusApi.BroadcastBus.AddListener(myEventType);
                ix2.EventBusApi.BroadcastBus.AddListener(myEventType);

                Logger.instance().log("conn1.subsId=" + ix1.EventBusApi.SubscriberId);
                Logger.instance().log("conn2.subsId=" + ix2.EventBusApi.SubscriberId);

                // Each connection sends 3 events to the other connection.
                // Here, the event data is a simple string. But it could be a Sord e.g. too.
                Logger.instance().log("send events");
                for (int i = 0; i < 3; i++)
                {
                    EventBusApi.Bus bbus1 = ix1.EventBusApi.BroadcastBus;
                    bbus1.Send(myEventType, "Hello conn2 - " + i);

                    EventBusApi.Bus bbus2 = ix2.EventBusApi.BroadcastBus;
                    bbus2.Send(myEventType, "Hello conn1 - " + i);
                }

                // Wait for the events and print them.
                Logger.instance().log("wait 1");
                Thread.Sleep(1 * 1000);

                // Print received messages
                Logger.instance().log("received:");
                foreach (String s in receivedMessages)
                {
                    Logger.instance().log(s);
                }

                if (receivedMessages.Count != 6)
                {
                    Logger.instance().log("Error: 6 events should have been received");
                }
            }
            catch (Exception e)
            {
                throw e;
            }
            finally
            {
                // Logout
                // --
                if (ix1 != null && ix2 != null)
                {
                    Logger.instance().log("IX logout...");
                    ix1.Logout();
                    ix2.Logout();
                    Logger.instance().log("IX logout OK");
                }
            }
        }
コード例 #29
0
ファイル: FindByIndexRange.cs プロジェクト: ThomasEcherer/elo
        public void run()
        {
            IXConnFactory connFact = null;
            IXConnection  ix       = null;

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                Logger.instance().log("create IXConnFactory OK");

                // Prepare ClientInfo object with language and country
                // ClientInfo ci = new ClientInfo();
                // ci.language = "de";
                // ci.country = "DE";

                // LOGIN
                Logger.instance().log("login...");
                ix = connFact.Create(userName, userPwd, "myComputer", null);
                // ci = ix.Login.ci
                Logger.instance().log("login OK");

                // get constants
                Logger.instance().log("get const...");
                IXServicePortC CONST = ix.CONST;
                Logger.instance().log("get const OK");

                // 1. Create archive structure
                Logger.instance().log("create structure...");

                // create root folder s1
                EditInfo ed = ix.Ix.createSord("1", "0", EditInfoC.mbAll);
                Sord     s1 = ed.sord;
                s1.name = "s1 C# example FindByIndexValues";
                s1.id   = ix.Ix.checkinSord(s1, SordC.mbAll, LockC.NO);

                ///     d1, name=The Inner Circle,		AUTHOR=T. Coraghessan Boyle,	PRICE=039
                ///     d2  name=The Shifting Tide,		AUTHOR=Anne Perry,				PRICE=037
                ///     d3  name=Feel,					AUTHOR=Robbie Williams,			PRICE=142
                ///     d4	name=The Da Vinci Code,     AUTHOR=Dan Brown,				PRICE=032
                ///
                Sord d1 = internalCreateBook(ix, CONST, s1.guid, "The Inner Circle", "T. Coraghessan Boyle", "039");
                Sord d2 = internalCreateBook(ix, CONST, s1.guid, "The Shifting Tide", "Anne Perry", "037");
                Sord d3 = internalCreateBook(ix, CONST, s1.guid, "Feel", "Robbie Williams", "142");
                Sord d4 = internalCreateBook(ix, CONST, s1.guid, "The Da Vinci Code", "Dan Brown", "032");

                Logger.instance().log("create structure OK");

                // 2. Find books from Authors with names from "A" to "J"
                internalFindBooks(ix, CONST, s1.guid, "A* ... J*", "");
                // Finds: The Da Vinci Code,The Shifting Tide

                // 3. Find books from Authors with names from "J"
                internalFindBooks(ix, CONST, s1.guid, "J*...*", "");
                // Finds: Feel,The Inner Circle

                // 4. Find books from Authors with names from "J" and price higher than 100
                internalFindBooks(ix, CONST, s1.guid, "J*...", "100...*");
                // Finds: Feel

                bool cleanUp = true;
                if (cleanUp)
                {
                    Logger.instance().log("clean up...");
                    ix.Ix.deleteSord(null, s1.guid, LockC.NO, null);
                    Logger.instance().log("clean up OK");
                }
            }
            catch (Exception e)
            {
                throw e;
            }
            finally
            {
                // Logout
                // --
                if (ix != null)
                {
                    Logger.instance().log("IX logout...");
                    ix.Logout();
                    Logger.instance().log("IX logout OK");
                }
            }
        }
コード例 #30
0
        public void run()
        {
            IXConnFactory connFact = null;
            IXConnection  ix       = null;

            try
            {
                IXProperties connProps = IXConnFactory.CreateConnProperties(url);
                IXProperties sessOpts  = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
                connFact = new IXConnFactory(connProps, sessOpts);
                Logger.instance().log("create IXConnFactory OK");

                // Prepare ClientInfo object with language and country
                // ClientInfo ci = new ClientInfo();
                // ci.language = "de";
                // ci.country = "DE";

                // LOGIN
                Logger.instance().log("login...");
                ix = connFact.Create(userName, userPwd, "myComputer", null);
                // ci = ix.Login.ci
                Logger.instance().log("login OK");

                // get constants
                Logger.instance().log("get const...");
                IXServicePortC CONST = ix.CONST;
                Logger.instance().log("get const OK");

                // 1. Create sord for document without version

                // Initialize Sord object
                EditInfo ed = ix.Ix.createDoc("1", "0", null, EditInfoC.mbSordDocAtt);
                ed.sord.name = "C# example CheckinAttachment";

                // Create attachment file
                String attFile = internalCreateTestFile("CheckinNewAttachment attachment file", "txt");

                // Supply the extension of the document
                ed.document.atts           = new DocVersion[1];
                ed.document.atts[0]        = new DocVersion();
                ed.document.atts[0].ext    = ix.GetFileExt(attFile);
                ed.document.atts[0].pathId = ed.sord.path;
                // ed.document.atts[0].encryptionSet = ignored

                // CheckinDocBegin: let IndexServer generate an URL to upload the document
                ed.document = ix.Ix.checkinDocBegin(ed.document);
                Logger.instance().log("prepared upload URL=" + ed.document.atts[0].url + ", att-guid=" + ed.document.atts[0].guid);

                // Upload the document
                String uploadResult = ix.Upload(ed.document.atts[0].url, attFile);
                ed.document.atts[0].uploadResult = uploadResult;
                Logger.instance().log("upload succeeded");
                System.IO.File.Delete(attFile);

                // CheckinDocEnd: uploadResult contains the document information from ELODM.
                // Pass this information to
                ed.document = ix.Ix.checkinDocEnd(ed.sord, SordC.mbAll, ed.document, LockC.NO);
                Logger.instance().log("inserted document:");
                Logger.instance().log("  objId=" + ed.document.objId);
                Logger.instance().log("  attId=" + ed.document.atts[0].id);
                Logger.instance().log("  att-guid=" + ed.document.atts[0].guid);
                Logger.instance().log("  URL=" + ed.document.atts[0].url);

                // 2. Checkout and show document
                ed = ix.Ix.checkoutDoc(ed.sord.guid, null, EditInfoC.mbAll, LockC.NO);
                String tempName2 = internalMakeTempFileName(ed.document.atts[0].ext);
                ix.Download(ed.document.atts[0].url, tempName2);

                // Uncomment this to show document in notepad:
                // System.Diagnostics.Process.Start("notepad.exe", tempName2);
                // System.Threading.Thread.Sleep(3000);

                System.IO.File.Delete(tempName2);

                bool cleanUp = true;
                if (cleanUp)
                {
                    // Delete Document
                    DeleteOptions delOpts = new DeleteOptions();
                    delOpts.deleteFinally = true;
                    ix.Ix.deleteSord(null, ed.sord.guid, LockC.NO, null);
                    ix.Ix.deleteSord(null, ed.sord.guid, LockC.NO, delOpts);
                }
            }
            catch (Exception e)
            {
                throw e;
            }
            finally
            {
                // Logout
                // --
                if (ix != null)
                {
                    Logger.instance().log("IX logout...");
                    ix.Logout();
                    Logger.instance().log("IX logout OK");
                }
            }
        }