public Player(string name, Color color, float scale, string pos) { Name = name; Color = new SolidColorBrush(color); Scale = scale; Pos = pos; }
public CustomTextRenderer(Direct2DFactory factory, WindowRenderTarget renderTarget, SolidColorBrush outlineBrush, BitmapBrush fillBrush) { _factory = factory; _renderTarget = renderTarget; _outlineBrush = outlineBrush; _fillBrush = fillBrush; }
/// <summary> /// In a derived class, implements logic to initialize the sample. /// </summary> protected override void OnInitialize() { DeviceSettings2D settings = new DeviceSettings2D { Width = WindowWidth, Height = WindowHeight }; InitializeDevice(settings); geometry = new PathGeometry(Context2D.RenderTarget.Factory); using (GeometrySink sink = geometry.Open()) { PointF p0 = new PointF(0.50f * WindowWidth, 0.25f * WindowHeight); PointF p1 = new PointF(0.75f * WindowWidth, 0.75f * WindowHeight); PointF p2 = new PointF(0.25f * WindowWidth, 0.75f * WindowHeight); sink.BeginFigure(p0, FigureBegin.Filled); sink.AddLine(p1); sink.AddLine(p2); sink.EndFigure(FigureEnd.Closed); // Note that Close() and Dispose() are not equivalent like they are for // some other IDisposable() objects. sink.Close(); } brush = new SolidColorBrush(Context2D.RenderTarget, new Color4(0.93f, 0.40f, 0.08f)); }
partial void Initialize() { Background = new SolidColorBrush(Colors.Transparent); Clip = new RectangleGeometry(); SizeChanged += OnRenderSizeChanged; }
protected internal void ColorChanging(Color color) { Color = color; SolidColorBrush = new SolidColorBrush(Color); if (ColorChanged != null) ColorChanged(this, Color); }
public void TestSerialization() { var solidColorBrush = new SolidColorBrush { Color = Colors.Aqua }; var writer = new StringWriter(); _serializer.Serialize(writer, solidColorBrush); var reader = new StringReader(writer.ToString()); Assert.AreEqual(solidColorBrush, _serializer.Deserialize(reader)); }
public override void OnApplyTemplate() { WatermarkBrush = new SolidColorBrush(Colors.DarkGray); #endif base.OnApplyTemplate(); _textBox = (TextBox)GetTemplateChild("_textBox"); _textBox.GotFocus += TextBoxOnGotFocus; _textBox.LostFocus += TextBoxOnLostFocus; _textBox.TextChanged += TextBoxOnTextChanged; originalForeground = _textBox.Foreground; UpdateText(); }
/// <summary> /// Creates a new instance of VpaidImageAdPlayer. /// </summary> /// <param name="skippableOffset">The position in the ad at which the ad can be skipped. If null, the ad cannot be skipped.</param> /// <param name="suggestedDuration">The duration of the ad. If not specified, the ad is closed when the next ad is played.</param> /// <param name="clickThru">The Uri to navigate to when the ad is clicked or tapped. Can be null of no action should take place.</param> public VpaidImageAdPlayer(FlexibleOffset skippableOffset, TimeSpan? suggestedDuration, Uri clickThru) { IsHitTestVisible = false; image = new Image(); Background = new SolidColorBrush(Colors.Transparent); image.Stretch = Stretch.None; Opacity = 0; State = AdState.None; AdLinear = false; SkippableOffset = skippableOffset; SuggestedDuration = suggestedDuration; ClickThru = clickThru; this.NavigateUri = ClickThru; }
/** * Render with or without texture **/ protected override void _render() { if (this._bitmap == null) { // Render in solid color if (_brush == null) _brush = new SolidColorBrush(Device.RenderTarget, Color); Device.RenderTarget.FillRectangle(_brush, _rectangle); return; } if (this._d2dBitmap == null) { // Load the texture var bitmapData = this._bitmap.LockBits( new Rectangle(new Point(0, 0), this._bitmap.Size), System.Drawing.Imaging.ImageLockMode.ReadOnly, System.Drawing.Imaging.PixelFormat.Format32bppPArgb ); var dataStream = new SlimDX.DataStream( bitmapData.Scan0, bitmapData.Stride * bitmapData.Height, true, false ); var d2dPixelFormat = new SlimDX.Direct2D.PixelFormat( SlimDX.DXGI.Format.B8G8R8A8_UNorm, SlimDX.Direct2D.AlphaMode.Premultiplied ); var d2dBitmapProperties = new SlimDX.Direct2D.BitmapProperties(); d2dBitmapProperties.PixelFormat = d2dPixelFormat; _d2dBitmap = new SlimDX.Direct2D.Bitmap( Device.RenderTarget, new Size(this._bitmap.Width, this._bitmap.Height), dataStream, bitmapData.Stride, d2dBitmapProperties ); this._bitmap.UnlockBits(bitmapData); } // Render the texture Device.RenderTarget.DrawBitmap(_d2dBitmap, _rectangle); }
/// <summary> /// Creates a new instance of VpaidVideoAdPlayer. /// </summary> /// <param name="skippableOffset">The position in the ad at which the ad can be skipped. If null, the ad cannot be skipped.</param> /// <param name="maxDuration">The max duration of the ad. If not specified, the length of the video is assumed.</param> /// <param name="clickThru">The Uri to navigate to when the ad is clicked or tapped. Can be null of no action should take place.</param> public VpaidVideoAdPlayer(FlexibleOffset skippableOffset, TimeSpan? maxDuration, Uri clickThru) { IsHitTestVisible = false; mediaElement = new MediaElement(); Background = new SolidColorBrush(Colors.Black); #if !WINDOWS80 Opacity = 0.01; // HACK: Win8.1 won't load the video if opacity = 0 #else Opacity = 0; #endif State = AdState.None; AdLinear = true; SkippableOffset = skippableOffset; MaxDuration = maxDuration; this.NavigateUri = clickThru; }
/// <summary> /// This method creates the render target and all associated D2D and DWrite resources /// </summary> void CreateDeviceResources() { // Only calls if resources have not been initialize before if (renderTarget == null) { // The text format textFormat = dwriteFactory.CreateTextFormat("Bodoni MT", 24, DWrite.FontWeight.Normal, DWrite.FontStyle.Italic, DWrite.FontStretch.Normal); // Create the render target SizeU size = new SizeU((uint)host.ActualWidth, (uint)host.ActualHeight); RenderTargetProperties props = new RenderTargetProperties(); HwndRenderTargetProperties hwndProps = new HwndRenderTargetProperties(host.Handle, size, PresentOptions.None); renderTarget = d2dFactory.CreateHwndRenderTarget(props, hwndProps); // A black brush to be used for drawing text ColorF cf = new ColorF(0, 0, 0, 1); blackBrush = renderTarget.CreateSolidColorBrush(cf); // Create a linear gradient. GradientStop[] stops = { new GradientStop(1, new ColorF(1f, 0f, 0f, 0.25f)), new GradientStop(0, new ColorF(0f, 0f, 1f, 1f)) }; GradientStopCollection pGradientStops = renderTarget.CreateGradientStopCollection(stops, Gamma.Linear, ExtendMode.Wrap); LinearGradientBrushProperties gradBrushProps = new LinearGradientBrushProperties(new Point2F(50, 25), new Point2F(25, 50)); linearGradientBrush = renderTarget.CreateLinearGradientBrush(gradBrushProps, pGradientStops); gridPatternBitmapBrush = CreateGridPatternBrush(renderTarget); solidBrush1 = renderTarget.CreateSolidColorBrush(new ColorF(0.3F, 0.5F, 0.65F, 0.25F)); solidBrush2 = renderTarget.CreateSolidColorBrush(new ColorF(0.0F, 0.0F, 0.65F, 0.5F)); solidBrush3 = renderTarget.CreateSolidColorBrush(new ColorF(0.9F, 0.5F, 0.3F, 0.75F)); // Create a linear gradient. stops[0] = new GradientStop(1, new ColorF(0f, 0f, 0f, 0.25f)); stops[1] = new GradientStop(0, new ColorF(1f, 1f, 0.2f, 1f)); GradientStopCollection radiantGradientStops = renderTarget.CreateGradientStopCollection(stops, Gamma.Linear, ExtendMode.Wrap); RadialGradientBrushProperties radialBrushProps = new RadialGradientBrushProperties(new Point2F(25, 25), new Point2F(0, 0), 10, 10); radialGradientBrush = renderTarget.CreateRadialGradientBrush(radialBrushProps, radiantGradientStops); } }
/// <summary> /// Renders a UI control into an image. /// </summary> /// <param name="control"></param> /// <param name="isWideTile"></param> /// <returns></returns> public static void CreateImage(UIElement control, string imagePath, int width, int height, SolidColorBrush tileBackgroundColor) { // 1. Setup dimensions for wide tile. var bmp = new WriteableBitmap(width, height); // 2. Get the name of the background image based on theme var canvas = new System.Windows.Controls.Canvas(); canvas.Width = width; canvas.Height = height; canvas.Background = tileBackgroundColor; canvas.Children.Add(control); canvas.Measure(new Size(width, height)); canvas.Arrange(new Rect(0, 0, width, height)); canvas.UpdateLayout(); // 4. Now output the control as text. bmp.Render(canvas, null); bmp.Invalidate(); // 8. Now save the image to local folder. using (var store = IsolatedStorageFile.GetUserStoreForApplication()) { // FileMode.Open, FileAccess.Read, FileShare.Read, using (var st = new IsolatedStorageFileStream(imagePath, FileMode.OpenOrCreate, FileAccess.ReadWrite, FileShare.ReadWrite, store)) { bmp.SaveJpeg(st, width, height, 0, 100); st.Close(); } } try { bmp = null; canvas.Children.Clear(); GC.Collect(); GC.WaitForPendingFinalizers(); } catch (Exception ex) { Slate.Core.Logging.Logger.Error("Create image", "Warning, attempt to clear up memory for tile image failed", ex); } }
/// <summary> /// Initializes a new instance of the <see cref="Pen"/> class. /// </summary> /// <param name="color">The stroke color.</param> /// <param name="thickness">The stroke thickness.</param> /// <param name="dashStyle">The dash style.</param> /// <param name="dashCap">The dash cap.</param> /// <param name="startLineCap">The start line cap.</param> /// <param name="endLineCap">The end line cap.</param> /// <param name="lineJoin">The line join.</param> /// <param name="miterLimit">The miter limit.</param> public Pen( uint color, double thickness = 1.0, DashStyle dashStyle = null, PenLineCap dashCap = PenLineCap.Flat, PenLineCap startLineCap = PenLineCap.Flat, PenLineCap endLineCap = PenLineCap.Flat, PenLineJoin lineJoin = PenLineJoin.Miter, double miterLimit = 10.0) { Brush = new SolidColorBrush(color); Thickness = thickness; StartLineCap = startLineCap; EndLineCap = endLineCap; LineJoin = lineJoin; MiterLimit = miterLimit; DashStyle = dashStyle; DashCap = dashCap; }
public TextRenderTarget(RenderTargetTexture renderTargetTexture) { var surface = renderTargetTexture.AsSurface(); var factory2D = new SlimDX.Direct2D.Factory(SlimDX.Direct2D.FactoryType.SingleThreaded); var renderTargetProperties = new RenderTargetProperties { PixelFormat = new PixelFormat(Format.Unknown, AlphaMode.Premultiplied), Usage = RenderTargetUsage.None, HorizontalDpi = 96, VerticalDpi = 96, MinimumFeatureLevel = FeatureLevel.Direct3D10, Type = RenderTargetType.Default }; mRenderTarget = RenderTarget.FromDXGI(factory2D, surface, renderTargetProperties); mBrush = new SolidColorBrush(mRenderTarget, new Color4(1, 1, 1)); CreateTextFormat(); }
public object InternalConvert(object value, Type targetType, object parameter) { if (value == null) { return null; } string colorName = value.ToString(); SolidColorBrush scb = new SolidColorBrush(); switch (colorName as string) { case "Magenta": scb.Color = Colors.Magenta; return scb; case "Purple": scb.Color = Colors.Purple; return scb; case "Brown": scb.Color = Colors.Brown; return scb; case "Orange": scb.Color = Colors.Orange; return scb; case "Blue": scb.Color = Colors.Blue; return scb; case "Red": scb.Color = Colors.Red; return scb; case "Yellow": scb.Color = Colors.Yellow; return scb; case "Green": scb.Color = Colors.Green; return scb; default: return null; } }
public MapGraticule() { IsHitTestVisible = false; Stroke = new SolidColorBrush(Color.FromArgb(127, 0, 0, 0)); path = new Path { Data = new PathGeometry() }; path.SetBinding(Shape.StrokeProperty, new Binding { Source = this, Path = new PropertyPath("Stroke") }); path.SetBinding(Shape.StrokeThicknessProperty, new Binding { Source = this, Path = new PropertyPath("StrokeThickness") }); Children.Add(path); }
public AppItemViewModel(IAudioMixerViewModelCallback callback, EarTrumpetAudioSessionModelGroup sessions) { _sessions = sessions; // select a session at random as sndvol does. var session = _sessions.Sessions.First(); IconHeight = IconWidth = 24; SessionId = session.SessionId; ProcessId = session.ProcessId; ExeName = GetExeName(session.DisplayName); IsDesktop = session.IsDesktop; _volume = Convert.ToInt32(Math.Round((session.Volume * 100), MidpointRounding.AwayFromZero)); _isMuted = session.IsMuted; _callback = callback; if (session.IsDesktop) { try { if (Path.GetExtension(session.IconPath) == ".dll") { Icon = IconService.GetIconFromFileAsImageSource(session.IconPath); } else { // override for SpeechRuntime.exe (Repo -> HEY CORTANA) if (session.IconPath.ToLowerInvariant().Contains("speechruntime.exe")) { var sysType = Environment.Is64BitOperatingSystem ? "SysNative" : "System32"; Icon = IconService.GetIconFromFileAsImageSource(Path.Combine("%windir%", sysType, "Speech\\SpeechUX\\SpeechUXWiz.exe"), 0); } else { Icon = System.Drawing.Icon.ExtractAssociatedIcon(session.IconPath).ToImageSource(); } } } catch { // ignored } if (Icon == null) { Background = new SolidColorBrush(AccentColorService.GetColorByTypeName("ImmersiveSystemAccent")); } else { Background = new SolidColorBrush(Colors.Transparent); } } else { if (File.Exists(session.IconPath)) //hack until we invoke the resource manager correctly. { Icon = new BitmapImage(new Uri(session.IconPath)); } Background = new SolidColorBrush(AccentColorService.FromABGR(session.BackgroundColor)); } }
private static Brush BrushForColor(String colorName) { if (colorName == null) return null; if (brushCache == null) { brushCache = new Dictionary<string, Brush> { { "black", new SolidColorBrush(Colors.Black) }, { "white", new SolidColorBrush(Colors.White) }, { "lightgray", new SolidColorBrush(Colors.LightGray) }, { "yellow", new SolidColorBrush(Colors.Yellow) }, { "none", null }, }; } Brush ret = null; if (brushCache.TryGetValue(colorName, out ret)) { return ret; } else { if (colorName.StartsWith("#")) { string opacityPart = (colorName.Length == 7 ? "FF" : colorName.Substring(1, 2)); string colorPart = colorName.Substring((colorName.Length == 7 ? 1 : 3), 6); byte a = (byte)Convert.ToInt32(opacityPart, 16); byte r = (byte)Convert.ToInt32(colorPart.Substring(0, 2), 16); byte g = (byte)Convert.ToInt32(colorPart.Substring(2, 2), 16); byte b = (byte)Convert.ToInt32(colorPart.Substring(4, 2), 16); Color c = Color.FromArgb(a, r, g, b); var scb = new SolidColorBrush(c); brushCache.Add(colorName, scb); return scb; } throw new ArgumentOutOfRangeException("Color not supported: " + colorName); } }
/// <summary>Arranges the contents of a <see cref="T:System.Windows.Controls.Border" /> element.</summary> /// <param name="finalSize">The <see cref="T:System.Windows.Size" /> this element uses to arrange its child element.</param> /// <returns>The <see cref="T:System.Windows.Size" /> that represents the arranged size of this <see cref="T:System.Windows.Controls.Border" /> element and its child element.</returns> // Token: 0x06004265 RID: 16997 RVA: 0x0012F998 File Offset: 0x0012DB98 protected override Size ArrangeOverride(Size finalSize) { Thickness borderThickness = this.BorderThickness; if (base.UseLayoutRounding && !FrameworkAppContextSwitches.DoNotApplyLayoutRoundingToMarginsAndBorderThickness) { DpiScale dpi = base.GetDpi(); borderThickness = new Thickness(UIElement.RoundLayoutValue(borderThickness.Left, dpi.DpiScaleX), UIElement.RoundLayoutValue(borderThickness.Top, dpi.DpiScaleY), UIElement.RoundLayoutValue(borderThickness.Right, dpi.DpiScaleX), UIElement.RoundLayoutValue(borderThickness.Bottom, dpi.DpiScaleY)); } Rect rect = new Rect(finalSize); Rect rect2 = Border.HelperDeflateRect(rect, borderThickness); UIElement child = this.Child; if (child != null) { Rect finalRect = Border.HelperDeflateRect(rect2, this.Padding); child.Arrange(finalRect); } CornerRadius cornerRadius = this.CornerRadius; Brush borderBrush = this.BorderBrush; bool flag = Border.AreUniformCorners(cornerRadius); this._useComplexRenderCodePath = !flag; if (!this._useComplexRenderCodePath && borderBrush != null) { SolidColorBrush solidColorBrush = borderBrush as SolidColorBrush; bool isUniform = borderThickness.IsUniform; this._useComplexRenderCodePath = (solidColorBrush == null || (solidColorBrush.Color.A < byte.MaxValue && !isUniform) || (!DoubleUtil.IsZero(cornerRadius.TopLeft) && !isUniform)); } if (this._useComplexRenderCodePath) { Border.Radii radii = new Border.Radii(cornerRadius, borderThickness, false); StreamGeometry streamGeometry = null; if (!DoubleUtil.IsZero(rect2.Width) && !DoubleUtil.IsZero(rect2.Height)) { streamGeometry = new StreamGeometry(); using (StreamGeometryContext streamGeometryContext = streamGeometry.Open()) { Border.GenerateGeometry(streamGeometryContext, rect2, radii); } streamGeometry.Freeze(); this.BackgroundGeometryCache = streamGeometry; } else { this.BackgroundGeometryCache = null; } if (!DoubleUtil.IsZero(rect.Width) && !DoubleUtil.IsZero(rect.Height)) { Border.Radii radii2 = new Border.Radii(cornerRadius, borderThickness, true); StreamGeometry streamGeometry2 = new StreamGeometry(); using (StreamGeometryContext streamGeometryContext2 = streamGeometry2.Open()) { Border.GenerateGeometry(streamGeometryContext2, rect, radii2); if (streamGeometry != null) { Border.GenerateGeometry(streamGeometryContext2, rect2, radii); } } streamGeometry2.Freeze(); this.BorderGeometryCache = streamGeometry2; } else { this.BorderGeometryCache = null; } } else { this.BackgroundGeometryCache = null; this.BorderGeometryCache = null; } return(finalSize); }
public CustomTextRenderer(Direct2DFactory factory, WindowRenderTarget renderTarget, SolidColorBrush outlineBrush, BitmapBrush fillBrush) { _factory = factory; _renderTarget = renderTarget; _outlineBrush = outlineBrush; _fillBrush = fillBrush; }
public static void Init(RenderTarget renderTarget) { // Generate common brushes DefaultBrushes = new Brush[DefaultColors.Length]; for (int i = 0; i < DefaultColors.Length; i++) DefaultBrushes[i] = new SolidColorBrush(renderTarget, DefaultColors[i]); ChannelBrushes = new Brush[ChannelColors.Length]; for (int i = 0; i < ChannelColors.Length; i++) ChannelBrushes[i] = new SolidColorBrush(renderTarget, ChannelColors[i]); // Generate common gradients KeyboardGradient = new LinearGradientBrush(renderTarget, new GradientStopCollection(renderTarget, new[] { new GradientStop() { Color = new Color4(Color.White),Position = 0 }, new GradientStop() { Color = new Color4(Color.DarkGray), Position = 1 } }), new LinearGradientBrushProperties() { StartPoint = new PointF(0, renderTarget.Size.Height), EndPoint = new PointF(0, renderTarget.Size.Height - KEY_HEIGHT) }); BackgroundGradient = new LinearGradientBrush(renderTarget, new GradientStopCollection(renderTarget, new[] { new GradientStop() { Color = Color.Black, Position = 1f }, new GradientStop() { Color = Color.FromArgb(30, 30, 30), Position = 0f } }), new LinearGradientBrushProperties() { StartPoint = new PointF(0, renderTarget.Size.Height), EndPoint = new PointF(0, 0) }); ChannelGradientBrushes = new LinearGradientBrush[ChannelColors.Length]; for (int i = 0; i < ChannelGradientBrushes.Length; i++) { ChannelGradientBrushes[i] = new LinearGradientBrush(renderTarget, new GradientStopCollection(renderTarget, new[] { new GradientStop() { Color = ChannelColors[i], Position = 1f }, new GradientStop() { Color = ControlPaint.Light(ChannelColors[i], .8f), Position = 0f } }), new LinearGradientBrushProperties() { StartPoint = new PointF(0, renderTarget.Size.Height), EndPoint = new PointF(0, 0) }); } // Generate common fonts using (var textFactory = new Factory()) { DebugFormat = new TextFormat(textFactory, "Consolas", FontWeight.UltraBold, SlimDX.DirectWrite.FontStyle.Normal, FontStretch.Normal, 18, "en-us"); HugeFormat = new TextFormat(textFactory, "Consolas", FontWeight.UltraBold, SlimDX.DirectWrite.FontStyle.Normal, FontStretch.Normal, 50, "en-us") { TextAlignment = TextAlignment.Center, ParagraphAlignment = ParagraphAlignment.Center }; } }
private System.Windows.Media.DrawingVisual CreateDrawingVisualProvince(Prov prov, MapColorModes mapColor = MapColorModes.Provs) { var drawingVisual = new System.Windows.Media.DrawingVisual(); var dc = drawingVisual.RenderOpen(); Brush brush = null; if (mapColor == MapColorModes.Provs) { var color1 = System.Drawing.Color.FromArgb(prov.Color); brush = new SolidColorBrush(Color.FromRgb(color1.R, color1.G, color1.B)); } else if (mapColor == MapColorModes.Country) { var color = Logic.GetCountryColor(prov.Owner); if (color == null) { if (prov.IsLake || prov.IsSea) { var color1 = System.Drawing.Color.FromArgb(prov.Color); brush = new SolidColorBrush(Color.FromRgb(color1.R, color1.G, color1.B)); } else if (!prov.IsWaste) { brush = new SolidColorBrush(Colors.LightGray); } else { brush = new SolidColorBrush(Colors.DimGray); } } else { brush = new SolidColorBrush(color.Value); } } //dc.DrawGeometry(brush,new Pen(Brushes.Red,0),prov.Geometry ); dc.DrawGeometry(brush, new Pen(brush, 0.45), prov.Geometry); ////////////////////////////////////////// // FormattedText formattedText = new FormattedText( //"11", //CultureInfo.GetCultureInfo("en-us"), //FlowDirection.LeftToRight, //new Typeface(new FontFamily("宋体"), FontStyles.Normal, FontWeights.Normal, FontStretches.Normal), //12, //Brushes.Red); // Geometry textGeometry = formattedText.BuildGeometry(new Point(0, 0)); // var rect = prov.Geometry.Bounds; // var rect1 = textGeometry.Bounds; // var w = rect.Width/rect1.Width; // var h = rect.Height/rect1.Height; // var scale = Math.Min(w, h); // //var max=t // var translateTransform = new ScaleTransform(); // //translateTransform.X = -textGeometry.Bounds.Left; // //translateTransform.Y = -textGeometry.Bounds.Top; // dc.PushTransform(translateTransform); // dc.DrawGeometry(Brushes.Red, new Pen(Brushes.Red, 1.0), textGeometry); dc.Close(); return(drawingVisual); }
private void SetupAccountPage() { ResourceLoader loader = ResourceLoader.GetForCurrentView("Salesforce.SDK.Core/Resources"); SalesforceConfig config = SDKManager.ServerConfiguration; bool titleMissing = true; if (!String.IsNullOrWhiteSpace(config.ApplicationTitle) && config.IsApplicationTitleVisible) { ApplicationTitle.Visibility = Visibility.Visible; ApplicationTitle.Text = config.ApplicationTitle; titleMissing = false; } else { ApplicationTitle.Visibility = Visibility.Collapsed; } if (config.LoginBackgroundLogo != null) { if (ApplicationLogo.Items != null) { ApplicationLogo.Items.Clear(); ApplicationLogo.Items.Add(config.LoginBackgroundLogo); } if (titleMissing) { var padding = new Thickness(10, 24, 10, 24); ApplicationLogo.Margin = padding; } } // set background from config if (config.LoginBackgroundColor != null) { var background = new SolidColorBrush((Color)config.LoginBackgroundColor); Background = background; ServerFlyoutPanel.Background = background; AddServerFlyoutPanel.Background = background; } // set foreground from config if (config.LoginForegroundColor != null) { var foreground = new SolidColorBrush((Color)config.LoginForegroundColor); Foreground = foreground; ApplicationTitle.Foreground = foreground; LoginToSalesforce.Foreground = foreground; LoginToSalesforce.BorderBrush = foreground; ChooseConnection.Foreground = foreground; ChooseConnection.BorderBrush = foreground; AddServerFlyoutLabel.Foreground = foreground; AddCustomHostBtn.Foreground = foreground; AddCustomHostBtn.BorderBrush = foreground; CancelCustomHostBtn.Foreground = foreground; CancelCustomHostBtn.BorderBrush = foreground; ServerFlyoutLabel.Foreground = foreground; AddConnection.Foreground = foreground; AddConnection.BorderBrush = foreground; } if (Accounts == null || Accounts.Length == 0) { _currentState = SingleUserViewState; SetLoginBarVisibility(Visibility.Collapsed); AuthStorageHelper.WipePincode(); VisualStateManager.GoToState(this, SingleUserViewState, true); } else { _currentState = MultipleUserViewState; SetLoginBarVisibility(Visibility.Visible); ListTitle.Text = loader.GetString("select_account"); VisualStateManager.GoToState(this, MultipleUserViewState, true); } ListboxServers.ItemsSource = Servers; AccountsList.ItemsSource = Accounts; ServerFlyout.Opening += ServerFlyout_Opening; ServerFlyout.Closed += ServerFlyout_Closed; AddServerFlyout.Opened += AddServerFlyout_Opened; AddServerFlyout.Closed += AddServerFlyout_Closed; AccountsList.SelectionChanged += accountsList_SelectionChanged; AddConnection.Visibility = (SDKManager.ServerConfiguration.AllowNewConnections ? Visibility.Visible : Visibility.Collapsed); }
/** * Constructor */ public EditBox() { mEditBox = new System.Windows.Controls.TextBox(); mPasswordBox = new System.Windows.Controls.PasswordBox(); // by default, the password box is not visible mPasswordBox.Visibility = Visibility.Collapsed; CreateTheEditBoxGrid(); View = mEditBoxGrid; mIsPasswordMode = false; mIsWatermarkMode = false; mPlaceholderText = ""; // by default, the placeholder font color is gray mWaterMarkBrush = new SolidColorBrush(); mWaterMarkBrush.Color = Colors.Gray; mForegroundColor = mEditBox.Foreground; /** * @brief Sent from the Edit box when it gains focus(the user selects the widget). * The virtual keyboard is shown. * MAW_EVENT_EDIT_BOX_EDITING_DID_BEGIN */ mEditBox.GotFocus += new RoutedEventHandler( delegate(object from, RoutedEventArgs args) { /** * simulating the placeholder/watermark */ // if watermark present and no user char has been entered if (mIsWatermarkMode && mFirstChar) { // move the cursor to the first position mEditBox.Select(0, 0); SetWatermarkMode(false); } /** * post the event to MoSync runtime */ Memory eventData = new Memory(8); const int MAWidgetEventData_eventType = 0; const int MAWidgetEventData_widgetHandle = 4; eventData.WriteInt32(MAWidgetEventData_eventType, MoSync.Constants.MAW_EVENT_EDIT_BOX_EDITING_DID_BEGIN); eventData.WriteInt32(MAWidgetEventData_widgetHandle, mHandle); mRuntime.PostCustomEvent(MoSync.Constants.EVENT_TYPE_WIDGET, eventData); } ); // end of mEditBox.GotFocus /** * @brief Sent from the Edit box when it loses focus. * The virtual keyboard is hidden. * MAW_EVENT_EDIT_BOX_EDITING_DID_END */ mEditBox.LostFocus += new RoutedEventHandler( delegate(object from, RoutedEventArgs args) { /** * simulating the placeholder/watermark */ // if no text has been entered by the user than leave the watermark text if (mEditBox.Text.Equals("")) { SetWatermarkMode(true); } /** * post the event to MoSync runtime */ Memory eventData = new Memory(8); const int MAWidgetEventData_eventType = 0; const int MAWidgetEventData_widgetHandle = 4; eventData.WriteInt32(MAWidgetEventData_eventType, MoSync.Constants.MAW_EVENT_EDIT_BOX_EDITING_DID_END); eventData.WriteInt32(MAWidgetEventData_widgetHandle, mHandle); mRuntime.PostCustomEvent(MoSync.Constants.EVENT_TYPE_WIDGET, eventData); } ); // end of mEditBox.LostFocus /** * @brief Sent from the Edit box when the text was changed. * MAW_EVENT_EDIT_BOX_TEXT_CHANGED */ mFirstChar = true; mEditBox.TextInputStart += new TextCompositionEventHandler( delegate(object from, TextCompositionEventArgs args) { /** * simulating the placeholder/watermark */ if (mFirstChar) { SetWatermarkMode(false); } /** * post the event to MoSync runtime */ Memory eventData = new Memory(8); const int MAWidgetEventData_eventType = 0; const int MAWidgetEventData_widgetHandle = 4; eventData.WriteInt32(MAWidgetEventData_eventType, MoSync.Constants.MAW_EVENT_EDIT_BOX_TEXT_CHANGED); eventData.WriteInt32(MAWidgetEventData_widgetHandle, mHandle); mRuntime.PostCustomEvent(MoSync.Constants.EVENT_TYPE_WIDGET, eventData); } ); // end of TextInputStart /** * @brief Sent from the Password box when it gains focus(the user selects the widget). * The virtual keyboard is shown. * MAW_EVENT_EDIT_BOX_EDITING_DID_BEGIN */ mPasswordBox.GotFocus += new RoutedEventHandler( delegate(object from, RoutedEventArgs args) { /** * post the event to MoSync runtime */ Memory eventData = new Memory(8); const int MAWidgetEventData_eventType = 0; const int MAWidgetEventData_widgetHandle = 4; eventData.WriteInt32(MAWidgetEventData_eventType, MoSync.Constants.MAW_EVENT_EDIT_BOX_EDITING_DID_BEGIN); eventData.WriteInt32(MAWidgetEventData_widgetHandle, mHandle); mRuntime.PostCustomEvent(MoSync.Constants.EVENT_TYPE_WIDGET, eventData); } ); // end of mPasswordBox.GotFocus /** * @brief Sent from the Password box when it loses focus. * The virtual keyboard is hidden. * MAW_EVENT_EDIT_BOX_EDITING_DID_END */ mPasswordBox.LostFocus += new RoutedEventHandler( delegate(object from, RoutedEventArgs args) { /** * post the event to MoSync runtime */ Memory eventData = new Memory(8); const int MAWidgetEventData_eventType = 0; const int MAWidgetEventData_widgetHandle = 4; eventData.WriteInt32(MAWidgetEventData_eventType, MoSync.Constants.MAW_EVENT_EDIT_BOX_EDITING_DID_END); eventData.WriteInt32(MAWidgetEventData_widgetHandle, mHandle); mRuntime.PostCustomEvent(MoSync.Constants.EVENT_TYPE_WIDGET, eventData); } ); // end of mPasswordBox.LostFocus /** * @brief Sent from the Password box when the text was changed. * MAW_EVENT_EDIT_BOX_TEXT_CHANGED */ mPasswordBox.TextInputStart += new TextCompositionEventHandler( delegate(object from, TextCompositionEventArgs args) { /** * post the event to MoSync runtime */ Memory eventData = new Memory(8); const int MAWidgetEventData_eventType = 0; const int MAWidgetEventData_widgetHandle = 4; eventData.WriteInt32(MAWidgetEventData_eventType, MoSync.Constants.MAW_EVENT_EDIT_BOX_TEXT_CHANGED); eventData.WriteInt32(MAWidgetEventData_widgetHandle, mHandle); mRuntime.PostCustomEvent(MoSync.Constants.EVENT_TYPE_WIDGET, eventData); } ); // end of mPasswordBox.TextInputStart /** * @brief Sent from the Edit box when the return button was pressed. * On iphone platform the virtual keyboard is not closed after receiving this event. * EDIT_BOX_RETURN */ // Not available on Windows Phone 7.1 }
private void SetColors(SolidColorBrush foregroundColor, SolidColorBrush backgroundColor) { this.Background = backgroundColor; this.Foreground = foregroundColor; }
/// <summary> /// Response for Branding Info /// </summary> /// <param name="sender"></param> /// <param name="e"></param> private void pharmacyinfoforbrandingwebservicecall_UploadStringCompleted(object sender, UploadStringCompletedEventArgs e) { GetPharmacyInformationResponse objPhBrandingInfoResponse = null; try { if (e.Result != null) { var response = e.Result.ToString(); objPhBrandingInfoResponse = Utils.JsonHelper.Deserialize <GetPharmacyInformationResponse>(response); if ((objPhBrandingInfoResponse.payload != null) && (objPhBrandingInfoResponse.status == 0)) { App.ObjBrandingResponse = objPhBrandingInfoResponse; App.BrandingHash = objPhBrandingInfoResponse.payload.branding_hash; App.AdvtHash = objPhBrandingInfoResponse.payload.advert_hash; App.DrugsData = objPhBrandingInfoResponse.payload.drugs_data; App.DrugDBHash = objPhBrandingInfoResponse.payload.drugs_hash; App.AddImages = null; foreach (var item in objPhBrandingInfoResponse.payload.advert_data) { if (App.AddImages == null) { App.AddImages = new List <BitmapImage>(); App.ImagesUrl = new List <string>(); App.ImagesName = new List <string>(); } if (item.image_url != null) { Uri uri = new Uri(item.image_url.Replace("https", "http")); BitmapImage bmi = new BitmapImage(uri); App.ImagesUrl.Add(item.url); App.ImagesName.Add(item.name); App.AddImages.Add(bmi); } else { Color backgroundColor = ConvertStringToColor(item.image_builder.background_color); Color foreroundColor2 = ConvertStringToColor(item.image_builder.font_color); SolidColorBrush backgroundBrush = new SolidColorBrush(backgroundColor); SolidColorBrush foregroundBrush = new SolidColorBrush(foreroundColor2); string text = item.image_builder.line1 + Environment.NewLine + Environment.NewLine + item.image_builder.line2; WriteableBitmap bmpSmall = new WriteableBitmap(200, 120); Grid grid = new Grid(); grid.Width = bmpSmall.PixelWidth; grid.Height = bmpSmall.PixelHeight; var background = new Canvas(); background.Width = bmpSmall.PixelWidth; background.Height = bmpSmall.PixelHeight; background.Background = backgroundBrush; var textBlock = new TextBlock(); textBlock.Width = bmpSmall.PixelWidth; textBlock.FontFamily = new FontFamily("Segoe WP Light"); textBlock.Text = text; textBlock.HorizontalAlignment = HorizontalAlignment.Stretch; textBlock.VerticalAlignment = VerticalAlignment.Center; textBlock.FontSize = 12; textBlock.TextWrapping = TextWrapping.Wrap; textBlock.Foreground = foregroundBrush; textBlock.TextAlignment = TextAlignment.Center; grid.Children.Add(background); grid.Children.Add(textBlock); grid.Measure(new Size(bmpSmall.PixelWidth, bmpSmall.PixelHeight)); grid.Arrange(new Rect(0, 0, bmpSmall.PixelWidth, bmpSmall.PixelHeight)); grid.UpdateLayout(); bmpSmall.Render(grid, null); bmpSmall.Invalidate(); using (MemoryStream ms = new MemoryStream()) { bmpSmall.SaveJpeg(ms, 200, 120, 0, 100); BitmapImage bmp = new BitmapImage(); bmp.SetSource(ms); App.ImagesUrl.Add(item.url); App.ImagesName.Add(item.name); App.AddImages.Add(bmp); } } } } LoginUserDetailsWebService(); } } catch (Exception ex) { objSignUpViewModel.ProgressBarVisibilty = Visibility.Collapsed; objSignUpViewModel.HitVisibility = true; MessageBox.Show("Sorry, Unable to process your request."); } }
private ImageSource PlatedImage(BitmapImage image) { if (!string.IsNullOrEmpty(BackgroundColor)) { string currentBackgroundColor; if (BackgroundColor == "transparent") { currentBackgroundColor = SystemParameters.WindowGlassBrush.ToString(CultureInfo.InvariantCulture); } else { currentBackgroundColor = BackgroundColor; } var padding = 8; var width = image.Width + (2 * padding); var height = image.Height + (2 * padding); var x = 0; var y = 0; var group = new DrawingGroup(); var converted = ColorConverter.ConvertFromString(currentBackgroundColor); if (converted != null) { var color = (Color)converted; var brush = new SolidColorBrush(color); var pen = new Pen(brush, 1); var backgroundArea = new Rect(0, 0, width, height); var rectangleGeometry = new RectangleGeometry(backgroundArea); var rectDrawing = new GeometryDrawing(brush, pen, rectangleGeometry); group.Children.Add(rectDrawing); var imageArea = new Rect(x + padding, y + padding, image.Width, image.Height); var imageDrawing = new ImageDrawing(image, imageArea); group.Children.Add(imageDrawing); // http://stackoverflow.com/questions/6676072/get-system-drawing-bitmap-of-a-wpf-area-using-visualbrush var visual = new DrawingVisual(); var context = visual.RenderOpen(); context.DrawDrawing(group); context.Close(); var bitmap = new RenderTargetBitmap( Convert.ToInt32(width), Convert.ToInt32(height), _dpiScale100, _dpiScale100, PixelFormats.Pbgra32); bitmap.Render(visual); return(bitmap); } else { ProgramLogger.Exception($"Unable to convert background string {BackgroundColor} to color for {Package.Location}", new InvalidOperationException(), GetType(), Package.Location); return(new BitmapImage(new Uri(Constant.ErrorIcon))); } } else { // todo use windows theme as background return(image); } }
/// <summary> /// Adds DocFX Note Support on top of Quote Formatting. /// </summary> /// <param name="element">QuoteBlock Element</param> /// <param name="context">Render Context</param> protected override void RenderQuote(QuoteBlock element, IRenderContext context) { // Grab the Local context and cast it. var localContext = context as UIElementCollectionRenderContext; var collection = localContext?.BlockUIElementCollection; // Store these, they will be changed temporarily. var originalQuoteForeground = QuoteForeground; var originalLinkForeground = LinkForeground; DocFXNote noteType = null; string header = null; SolidColorBrush localforeground = null; SolidColorBrush localbackground = null; string symbolglyph = string.Empty; // Check the required structure of the Quote is correct. Determine if it is a DocFX Note. if (element.Blocks.First() is ParagraphBlock para) { if (para.Inlines.First() is TextRunInline textinline) { // Find the matching DocFX note style and header. foreach (var style in styles) { // Search between stylisticly matching notes with different headers. foreach (var identifier in style.Identifiers) { // Match the identifier with the start of the Quote to match. if (textinline.Text.StartsWith(identifier.Key)) { noteType = style; header = identifier.Value; symbolglyph = style.Glyph; // Removes the identifier from the text textinline.Text = textinline.Text.Replace(identifier.Key, string.Empty); localforeground = style.LightForeground; localbackground = style.LightBackground; } } } // Apply special formatting context. if (noteType != null) { if (localContext?.Clone() is UIElementCollectionRenderContext newcontext) { localContext = newcontext; localContext.TrimLeadingWhitespace = true; QuoteForeground = Foreground; LinkForeground = localforeground; } } } } // Begins the standard rendering. base.RenderQuote(element, localContext); // Add styling to render if DocFX note. if (noteType != null) { // Restore original formatting properties. QuoteForeground = originalQuoteForeground; LinkForeground = originalLinkForeground; if (localContext == null || collection?.Any() != true) { return; } // Gets the current Quote Block UI from the UI Collection, and then styles it. Adds a header. if (collection.Last() is Border border) { border.CornerRadius = new CornerRadius(6); border.BorderThickness = new Thickness(0); border.Padding = new Thickness(20); border.Margin = new Thickness(0, 5, 0, 5); border.Background = localbackground; var headerPanel = new StackPanel { Orientation = Orientation.Horizontal, Margin = new Thickness(0, 0, 0, 10) }; headerPanel.Children.Add(new TextBlock { FontSize = 18, Foreground = localforeground, Text = symbolglyph, FontFamily = new FontFamily("Segoe MDL2 Assets"), }); headerPanel.Children.Add(new TextBlock { FontSize = 16, Foreground = localforeground, Margin = new Thickness(5, 0, 0, 0), Text = header, VerticalAlignment = VerticalAlignment.Center, TextLineBounds = TextLineBounds.Tight, FontWeight = FontWeights.SemiBold }); if (border.Child is StackPanel panel) { panel.Children.Insert(0, headerPanel); } } } }
public MyModel() { ClickRed = new ClickCommand(() => { Text = "青ボタンをクリック"; FillColor = new SolidColorBrush(Colors.Red); }); ClickBlue = new ClickCommand(() => { Text = "赤ボタンをクリック"; FillColor = new SolidColorBrush(Colors.Blue); }); ClickYellow = new ClickCommand(() => { Text = "黄色ボタンをクリック"; FillColor = new SolidColorBrush(Colors.Yellow); }); }
/// <summary> /// Get the brush with <paramref name="color"/> color. /// </summary> /// <param name="color">The color.</param> /// <returns>Return the brush.</returns> private Brush GetBrush(OxyColor color) { if (!color.IsVisible()) { return null; } Brush brush; if (!this.brushCache.TryGetValue(color, out brush)) { brush = new SolidColorBrush(this.renderTarget, color.ToDXColor()); this.brushCache.Add(color, brush); } return brush; }
private static void Main() { matrix = new Matrix2D <Cell>(Program.MATRIX_SIZE_X, Program.MATRIX_SIZE_Y); Parallel.For(0, matrix.XSize, x => { for (int y = 0; y < matrix.YSize; y++) { matrix.SetNodeData(new Cell(false), x, y); } }); var form = new RenderForm("Game Of Life"); form.Size = new System.Drawing.Size(MATRIX_SIZE_X, MATRIX_SIZE_Y); form.Icon = null; form.KeyDown += Form_KeyDown; SharpDxHelper sharpDxHelper = new SharpDxHelper(); RenderTarget d2dRenderTarget = sharpDxHelper.CreateRenderTarget(form); SwapChain swapChain = sharpDxHelper.swapChain; var solidColorBrush = new SolidColorBrush(d2dRenderTarget, Color.White); Stopwatch stopwatch = new Stopwatch(); d2dRenderTarget.AntialiasMode = AntialiasMode.Aliased; var _memory = new byte[MATRIX_SIZE_X * MATRIX_SIZE_Y * 4]; var _backBufferBmp = new Bitmap(d2dRenderTarget, new Size2(MATRIX_SIZE_X, MATRIX_SIZE_Y), new BitmapProperties(d2dRenderTarget.PixelFormat)); RenderLoop.Run(form, () => { stopwatch.Restart(); IterateEnergyCalculations(); d2dRenderTarget.BeginDraw(); stopwatch.Restart(); Parallel.For(0, MATRIX_SIZE_X, x => { for (int y = 0; y < MATRIX_SIZE_Y; y++) { Color color = matrix.GetNodeData(x, y).ConvertToColor32(); var i = MATRIX_SIZE_X * 4 * y + x * 4; _memory[i] = color.B; _memory[i + 1] = color.G; _memory[i + 2] = color.R; _memory[i + 3] = color.A; } }); _backBufferBmp.CopyFromMemory(_memory, MATRIX_SIZE_X * 4); d2dRenderTarget.DrawBitmap(_backBufferBmp, 1f, BitmapInterpolationMode.Linear); d2dRenderTarget.EndDraw(); swapChain.Present(0, PresentFlags.None); FinalizeEnergyCalculations(); long calculationTime = stopwatch.ElapsedMilliseconds; form.Text = "Calculation Time: " + calculationTime.ToString() + "ms Live Cells: " + LivePixels.ToString(); }); sharpDxHelper.Destroy(); }
public override void SetupCustomUIElements(Controls.dynNodeView NodeUI) { //add a text box to the input grid of the control tb = new TextBox(); tb.HorizontalAlignment = System.Windows.HorizontalAlignment.Stretch; tb.VerticalAlignment = System.Windows.VerticalAlignment.Center; NodeUI.inputGrid.Children.Add(tb); System.Windows.Controls.Grid.SetColumn(tb, 0); System.Windows.Controls.Grid.SetRow(tb, 0); //turn off the border SolidColorBrush backgroundBrush = new SolidColorBrush(System.Windows.Media.Color.FromArgb(0, 0, 0, 0)); tb.Background = backgroundBrush; tb.BorderThickness = new Thickness(0); tb.DataContext = this; var bindingSymbol = new System.Windows.Data.Binding("Symbol") { Mode = BindingMode.TwoWay }; tb.SetBinding(TextBox.TextProperty, bindingSymbol); tb.TextChanged += new TextChangedEventHandler(tb_TextChanged); }
/// <summary> /// The main update loop, happens every frame /// </summary> /// <param name="skeleton">the skeleton data of the player</param> private void Update(Skeleton skeleton) { CalculateDist(skeleton); UpdateGraphs(); ChangeInstrument(skeleton); armLength = CalculateArmLength(skeleton); foreach (Peak p in leftArmPeaks) { p.TimeStep(); } //check if right leg stomped if (LegStomp(false, skeleton)) { if (isCalculatingBPM) { bpmCalculatingLabel.Text = "BPM"; var greyBrush = new SolidColorBrush((Color)ColorConverter.ConvertFromString("#6e6e6e")); bpmCalculatingLabel.Foreground = greyBrush; bpmCounterLabel.Foreground = greyBrush; } else { bpmCalculatingLabel.Text = "BPM (Calculating...)"; bpmCalculatingLabel.Foreground = new SolidColorBrush(Colors.Red); bpmCounterLabel.Foreground = new SolidColorBrush(Colors.Red); } isCalculatingBPM = !isCalculatingBPM; //Console.WriteLine("Right leg stomp"); } //check if left leg stomped else if (LegStomp(true, skeleton)) { //Console.WriteLine("Left leg stomp"); //if currently recording and new record message comes in then wipe and start again if (isRecording) { recordedNotes.RemoveAt(recordedNotes.Count - 1); } if (shouldRecord) { shouldRecord = false; recordingLabel.Text = "Not Recording"; var greyBrush = new SolidColorBrush((Color)ColorConverter.ConvertFromString("#6e6e6e")); recordingLabel.Foreground = greyBrush; recordingCounter.Foreground = greyBrush; } else { recordedNotes.Add(new Note[numberOfBeats]); shouldRecord = true; isRecording = false; recordingLabel.Text = "Will Record"; recordingLabel.Foreground = new SolidColorBrush(Colors.Orange); recordingCounter.Foreground = new SolidColorBrush(Colors.Orange); } } if (isCalculatingBPM) { UpdatePeaks(); CalculateBPM(); } else { int noteValue = currentNoteValue; if (typeSlider.Value == 0) { var wasArmMoved = WasArmMoved(skeleton); if (wasArmMoved != ArmPos.Normal) { //Console.WriteLine("Arm moved!"); prevArmPos = ArmPos.Normal; if (wasArmMoved == ArmPos.Raised) { currentNoteValue++; } else { currentNoteValue--; } currentNoteValue = Math.Max(24, Math.Min(currentNoteValue, 127)); noteValue = currentNoteValue; if (useScale) { var newNoteVal = Math.Floor(Convert.ToDouble(currentNoteValue) / currentScale.Length) * currentScale.Length; //Console.WriteLine("New Note Val: " + newNoteVal); var octave = newNoteVal / currentScale.Length; //Console.WriteLine("Octave: " + octave); var leftOver = currentNoteValue - newNoteVal; //Console.WriteLine("Leftover: " + leftOver); var tempNote = (int)(12 * octave + currentScale[(int)leftOver]); //Console.WriteLine("Old note val: " + noteValue); noteValue = Math.Max(24, tempNote); } //Console.WriteLine(currentNoteValue); //Console.WriteLine("Note value: " + noteValue); } } var shouldTick = bpm.ShouldTick(); if (shouldTick > 0) { //remove playing notes while (playingNotes.Count > 0 && playingNotes.Min().GetTimeEnd() < currentTime) { Note endingNote = playingNotes.ExtractDominating().getNote(); endingNote = endingNote.EndNote(); EndNote(handle, endingNote); } int duration = 3; var dist = skeleton.Joints[JointType.ShoulderLeft].Position.X - skeleton.Joints[JointType.WristLeft].Position.X; //play a note if (typeSlider.Value == 1) { double armHeight = CalculateJointHeight(skeleton.Joints[JointType.WristLeft], skeleton.Joints[JointType.ShoulderLeft], armLength); duration = (int)((dist / Convert.ToDouble(armLength)) * 12); if (useScale) { var newNoteVal = Math.Floor(armHeight / currentScale.Length) * currentScale.Length; //Console.WriteLine("New Note Val: " + newNoteVal); var octave = newNoteVal / currentScale.Length; //Console.WriteLine("Octave: " + octave); var leftOver = armHeight - newNoteVal; //Console.WriteLine("Leftover: " + leftOver); noteValue = (int)(12 * octave + currentScale[(int)leftOver]); noteLabel.Text = noteList[currentScale[(int)leftOver]]; //Console.WriteLine("Old note val: " + noteValue); noteValue = Math.Max(0, noteValue); } else { noteValue = (int)armHeight; } noteValue += 24; //Console.WriteLine("New Note: " + noteValue); } if (duration > 0) { Note thisNote = new Note(noteValue, currentInstrument, duration); //Console.WriteLine("Playing note! " + currentTime + " Duration: "+duration); PlayNote(handle, thisNote); if (isRecording) { recordedNotes[recordedNotes.Count - 1][beatCounter] = thisNote; //Console.WriteLine("Recording note at " + beatCounter + " " + recordedNotes[recordedNotes.Count - 1][beatCounter]); } } var maxRecordings = recordedNotes.Count; if (maxRecordings > 0) { if (isRecording) { maxRecordings--; } for (int i = 0; i < maxRecordings; i++) { if (recordedNotes[i][beatCounter] != null) { PlayNote(handle, recordedNotes[i][beatCounter]); //Console.WriteLine("Playing recorded note at: " + beatCounter + " out of " + recordedNotes[i].Count()); } } } currentTime++; if (shouldTick == 1) { //play drum beat, needs to take what type if (currentDrum.GetType() != typeof(Rest)) { currentDrum.UpdateProbabilites(energy); if (currentDrum.GetType() == typeof(HiHat)) { PlayNote(handle, new Note(currentDrum.GetNote(), 99, 90)); } else { PlayNote(handle, new Note(currentDrum.GetNote(), 99, 117)); } } currentDrum = currentDrum.GetNextNode(); } // update recording. // shouldTick == 2 else { if (currentTick > 1) { currentTick--; } else { currentTick = loopLength; if (shouldRecord) { shouldRecord = false; isRecording = true; recordingLabel.Text = "Recording"; recordingLabel.Foreground = new SolidColorBrush(Colors.Red); recordingCounter.Foreground = new SolidColorBrush(Colors.Red); } else if (isRecording) { isRecording = false; recordingLabel.Text = "Not Recording"; var greyBrush = new SolidColorBrush((Color)ColorConverter.ConvertFromString("#6e6e6e")); recordingLabel.Foreground = greyBrush; recordingCounter.Foreground = greyBrush; } } recordingCounter.Text = currentTick.ToString(); } beatCounter++; if (beatCounter >= numberOfBeats) { beatCounter = 0; } if (beatCounter % 2 == 0) { currentDrum = new Kick(); if (playKick) { PlayNote(handle, new Note(currentDrum.GetNote(), 99, 127)); } else { PlayNote(handle, new Note(38, 99, 127)); } playKick = !playKick; energy = GetEnergy(); currentDrum.UpdateProbabilites(energy); currentDrum = currentDrum.GetNextNode(); } } } }
void MainWindow_Load(object sender, EventArgs e) { DirectWriteFactory f = DirectWriteFactory.Create(DirectWriteFactoryType.Shared); _textFormat = f.CreateTextFormat("Verdana", null, FontWeight.Normal, FontStyle.Normal, FontStretch.Normal, 110, null); _textFormat.ParagraphAlignment = ParagraphAlignment.Far; _textFormat.TextAlignment = TextAlignment.Center; this.ClientSize = new System.Drawing.Size(600, 600); this._factory = Direct2DFactory.CreateFactory(FactoryType.SingleThreaded, DebugLevel.None); this._renderTarget = this._factory.CreateWindowRenderTarget(this, PresentOptions.None, RenderTargetProperties.Default); AntialiasMode amode = this._renderTarget.AntialiasMode; TextAntialiasMode tamode = this._renderTarget.TextAntialiasMode; this._strokeBrush = this._renderTarget.CreateSolidColorBrush(Color.FromARGB(Colors.Cyan, 1)); this._strokeStyle = this._factory.CreateStrokeStyle(new StrokeStyleProperties(LineCapStyle.Flat, LineCapStyle.Flat, LineCapStyle.Round, LineJoin.Miter, 10, DashStyle.Dot, 0), null); this.Resize += new EventHandler(MainWindow_Resize); }
public object Convert(object value, Type targetType, object parameter, CultureInfo culture) { var mod = value as ItemMod; if (mod == null) { return(null); } var inlines = new List <Inline>(); var backrep = ItemAttributes.Attribute.Backreplace; var matches = backrep.Matches(mod.Attribute).Cast <Match>().ToArray(); int from = 0; string istring; Run r; for (int i = 0; i < matches.Length && i < mod.Values.Count; i++) { var m = matches[i]; istring = mod.Attribute.Substring(from, m.Index - from); var prefix = ""; if (parameter != null && !string.IsNullOrEmpty(istring) && istring.Last() == '+') { istring = istring.Substring(0, istring.Length - 1); prefix = "+"; } r = new Run(istring); SolidColorBrush clr = GetColoringFor(mod, i); if ((istring == "-" || istring == "/" || istring == "+") && parameter != null) { r.Foreground = clr; } if (parameter != null && !string.IsNullOrEmpty(istring) && istring[0] == '%') { r.Foreground = GetColoringFor(mod, i - 1); } inlines.Add(r); r = new Run(prefix + mod.Values[i].ToString("###0.##")); if (parameter != null) { r.Foreground = clr; } inlines.Add(r); from = m.Index + m.Length; } istring = mod.Attribute.Substring(from, mod.Attribute.Length - from); r = new Run(istring); if (parameter != null && !string.IsNullOrEmpty(istring) && istring[0] == '%') { r.Foreground = GetColoringFor(mod, matches.Length - 1); } inlines.Add(r); return(inlines); }
// public EventHandler<AddressResult> addressChooserTask_Completed { get; set; } private void updateMyLocationPushPin(GeoCoordinate loc) { Grid ret = new Grid(); ret.Height = 29.284; ret.Width = 29.284; ret.Visibility = System.Windows.Visibility.Visible; // Colors SolidColorBrush yellow = new SolidColorBrush(); yellow.Color = Color.FromArgb(255, 255, 255, 0); SolidColorBrush black = new SolidColorBrush(); black.Color = Color.FromArgb(255, 0, 0, 0); SolidColorBrush white = new SolidColorBrush(); white.Color = Color.FromArgb(255, 255, 255, 255); // Rectangle Point rectPoint = new Point(0.5, 0.5); CompositeTransform rectRotate = new CompositeTransform(); rectRotate.Rotation = 45; System.Windows.Shapes.Rectangle rect = new System.Windows.Shapes.Rectangle(); rect.Height = 20; rect.Width = 20; rect.StrokeLineJoin = PenLineJoin.Miter; rect.RenderTransformOrigin = rectPoint; rect.Fill = black; rect.Stroke = white; rect.UseLayoutRounding = true; rect.RenderTransform = rectRotate; // Circle Ellipse circ = new Ellipse(); circ.Width = 10; circ.Height = 10; circ.Stretch = Stretch.Fill; circ.StrokeLineJoin = PenLineJoin.Miter; circ.Stroke = yellow; circ.Fill = yellow; // Add elements to the grid ret.Children.Add(rect); ret.Children.Add(circ); // Remove current location icon //current_position_layer.Children.Remove(curLoc); //curLoc = ret; //current_position_layer.AddChild(ret, loc); if (Map.Children.Contains(ret) != true) { Map.Children.Add(ret); } else { Map.Children.Remove(ret); Map.Children.Add(ret); } }
private void TextByGlyph(RectangleF rect, string text, TextInfo info, SolidColorBrush brush) { FontFace fontFace; if (!m_faceMap.TryGetValue(info.Font, out fontFace)) { using (var f = new SharpDX.DirectWrite.Factory()) using (var collection = f.GetSystemFontCollection(false)) { int familyIndex; if (!collection.FindFamilyName(info.Font.FamilylName, out familyIndex)) { return; } using (var family = collection.GetFontFamily(familyIndex)) using (var font = family.GetFont(0)) { fontFace = new FontFace(font); m_faceMap.Add(info.Font, fontFace); } } } var codePoints = EnumCodePoints(text).ToArray(); var indices = fontFace.GetGlyphIndices(codePoints); // Get glyph var metrices = fontFace.GetDesignGlyphMetrics(indices, false); // draw var glyphRun = new GlyphRun { FontFace = fontFace, Indices = indices, FontSize = info.Font.Size, }; bool done = false; using (var f = new SharpDX.DirectWrite.Factory()) using (var ff = f.QueryInterface <SharpDX.DirectWrite.Factory4>()) { var desc = new GlyphRunDescription { }; ColorGlyphRunEnumerator it; var result = ff.TryTranslateColorGlyphRun(0, 0, glyphRun, null, MeasuringMode.Natural, null, 0, out it); if (result.Code == DWRITE_E_NOCOLORLOR) { m_device.D2DDeviceContext.DrawGlyphRun(rect.TopLeft + new Vector2(0, info.Font.Size), glyphRun, brush, MeasuringMode.Natural); } else { while (true) { var colorBrush = GetOrCreateBrush(new Color4( it.CurrentRun.RunColor.R, it.CurrentRun.RunColor.G, it.CurrentRun.RunColor.B, it.CurrentRun.RunColor.A)); m_device.D2DDeviceContext.DrawGlyphRun(rect.TopLeft + new Vector2(0, info.Font.Size), it.CurrentRun.GlyphRun, colorBrush, MeasuringMode.Natural); done = true; SharpDX.Mathematics.Interop.RawBool hasNext; it.MoveNext(out hasNext); if (!hasNext) { break;; } } } } }
protected override void OnRender(DrawingContext drawingContext) { base.OnRender(drawingContext); // how much space we got for cells var maxWidth = ((int)viewport.Width / CellWidth) + 1; var maxHeight = ((int)viewport.Height / CellHeight) + 1; // how many cells we will draw var cellsHorizontally = maxWidth > matrixWidth ? matrixWidth : maxWidth; var cellsVertically = maxHeight > matrixHeight ? matrixHeight : maxHeight; // number of cell which will be drawn var scaledOffsetX = (int)offset.X / CellWidth; var scaledOffsetY = (int)offset.Y / CellHeight; // sets how much of cell on border should be drawn var offsetDiffX = offset.X - scaledOffsetX * CellWidth; var offsetDiffY = offset.Y - scaledOffsetY * CellHeight; // background var background = new Rect(0, 0, cellsHorizontally * CellWidth, cellsVertically * CellHeight); var backgroundColor = new SolidColorBrush(Colors.Yellow); drawingContext.DrawRectangle(backgroundColor, null, background); // hovering if (currentCell.X >= 0 || currentCell.Y >= 0) { // hover x line var rect = new Rect(0, (currentCell.Y - scaledOffsetY) * CellHeight - offsetDiffY, CellWidth * cellsVertically, CellHeight); var brush = new SolidColorBrush(Colors.GreenYellow); drawingContext.DrawRectangle(brush, null, rect); // hover y line rect = new Rect((currentCell.X - scaledOffsetX) * CellWidth - offsetDiffX, 0, CellWidth, CellHeight * cellsHorizontally); brush = new SolidColorBrush(Colors.GreenYellow); drawingContext.DrawRectangle(brush, null, rect); // hover cell rect = new Rect( (currentCell.X - scaledOffsetX) * CellWidth - offsetDiffX, (currentCell.Y - scaledOffsetY) * CellHeight - offsetDiffY, CellWidth, CellHeight); brush = new SolidColorBrush(Colors.Red); drawingContext.DrawRectangle(brush, null, rect); } // grid var pen = new Pen(Brushes.Black, 1); // grid x for (int i = 0; i <= cellsHorizontally; i++) { drawingContext.DrawLine(pen, new Point(i * CellWidth - offsetDiffX, 0), new Point(i * CellWidth - offsetDiffX, cellsVertically * CellWidth)); } // grid y for (int i = 0; i <= cellsVertically; i++) { drawingContext.DrawLine(pen, new Point(0, i * CellHeight - offsetDiffY), new Point(cellsHorizontally * CellHeight, i * CellHeight - offsetDiffY)); } // sometimes happens when half of cell is hidden in scroll so text isnt drawn // so lets drawn one more cell cellsHorizontally = maxWidth > matrixWidth ? matrixWidth : maxWidth + 1; cellsVertically = maxHeight > matrixHeight ? matrixHeight : maxHeight + 1; // text for (int i = 0; i < cellsHorizontally; i++) { for (int j = 0; j < cellsVertically; j++) { drawingContext.DrawImage( CreateText((i + scaledOffsetX) * (j + scaledOffsetY)), new Rect(i * CellWidth - offsetDiffX, j * CellHeight - offsetDiffY, CellWidth, CellHeight)); } } }
private FrameworkElement GetCourseElement(Course course, int time, int day = -1) { var textBlock = new TextBlock(); textBlock.Text = course.Name; //for (int i = 0, count = course.ClassRooms.Count; i < count; i++) //textBlock.Text += (i == 0 ? "\n" : "") + course.ClassRooms[i] + (i < count - 1 ? "、" : ""); textBlock.TextAlignment = TextAlignment.Center; textBlock.TextWrapping = TextWrapping.Wrap; textBlock.FontSize = 16; textBlock.VerticalAlignment = VerticalAlignment.Center; Border border = new Border(); border.MinHeight = 50; border.Child = textBlock; border.Tapped += async(object sender, Windows.UI.Xaml.Input.TappedRoutedEventArgs e) => { string content = ""; if (course.ClassRooms.Count > 0) { foreach (string classRoom in course.ClassRooms) { content += classRoom + " "; } content += "\n"; } string timeString = Course.GetTimeString(time); if (timeString != null) { content += timeString + "\n"; } content += string.Format("學分: {0} 時數: {1}\n", course.Credit, course.Hours); if (course.Teachers.Count > 0) { foreach (string teacher in course.Teachers) { content += teacher + " "; } content += "\n"; } if (!string.IsNullOrWhiteSpace(course.Note)) { content += course.Note; } var dialog = new MessageDialog(content, course.Name); if (!(string.IsNullOrWhiteSpace(course.IdForSelect) || course.IdForSelect == "0")) { dialog.Commands.Add(new UICommand("詳細資料", (command) => { Frame.Navigate(typeof(CourseDetailPage), course.IdForSelect); })); } dialog.Commands.Add(new UICommand("關閉")); //Send GA Event App.Current.GATracker.SendEvent("Other", "Tap on Course", null, 0); await dialog.ShowAsync(); }; Brush backColor, hoverColor; if (DateTime.Today.DayOfWeek == (DayOfWeek)(day + 1 % 7)) { backColor = new SolidColorBrush(Color.FromArgb(255, 209, 52, 56)); hoverColor = new SolidColorBrush(Color.FromArgb(255, 180, 52, 56)); } else { backColor = new SolidColorBrush(Color.FromArgb(128, 128, 128, 128)); hoverColor = new SolidColorBrush(Color.FromArgb(255, 128, 128, 128)); } border.Background = backColor; border.Padding = new Thickness(5); border.Margin = new Thickness(1); border.PointerEntered += (sender, e) => { border.Background = hoverColor; }; border.PointerExited += (sender, e) => { border.Background = backColor; }; return(border); }
public void Should_Not_Alter_Lines_After_TextStyleSpan_Was_Applied() { using (Start()) { const string text = "אחד !\ntwo !\nשְׁלוֹשָׁה !"; var red = new SolidColorBrush(Colors.Red).ToImmutable(); var black = Brushes.Black.ToImmutable(); var expected = new TextLayout( text, Typeface.Default, 12.0f, black, textWrapping: TextWrapping.Wrap); var expectedGlyphs = expected.TextLines.Select(x => string.Join('|', x.TextRuns.Cast <ShapedTextCharacters>().SelectMany(x => x.ShapedBuffer.GlyphIndices))).ToList(); var outer = new GraphemeEnumerator(text.AsMemory()); var inner = new GraphemeEnumerator(text.AsMemory()); var i = 0; var j = 0; while (true) { while (inner.MoveNext()) { j += inner.Current.Text.Length; if (j + i > text.Length) { break; } var spans = new[] { new ValueSpan <TextRunProperties>(i, j, new GenericTextRunProperties(Typeface.Default, 12, foregroundBrush: red)) }; var actual = new TextLayout( text, Typeface.Default, 12.0f, black, textWrapping: TextWrapping.Wrap, textStyleOverrides: spans); var actualGlyphs = actual.TextLines.Select(x => string.Join('|', x.TextRuns.Cast <ShapedTextCharacters>().SelectMany(x => x.ShapedBuffer.GlyphIndices))).ToList(); Assert.Equal(expectedGlyphs.Count, actualGlyphs.Count); for (var k = 0; k < expectedGlyphs.Count; k++) { Assert.Equal(expectedGlyphs[k], actualGlyphs[k]); } } if (!outer.MoveNext()) { break; } inner = new GraphemeEnumerator(text.AsMemory()); i += outer.Current.Text.Length; } } }
private static bool LoadChartSettings() { SeriesConfigurations = new List <SeriesConfig>(); try { var chartSettingsPath = ConfigurationManager.AppSettings["chartSettingsPath"]; chartSettingsPath = string.IsNullOrEmpty(chartSettingsPath) ? @".\" : chartSettingsPath; var chartSettings = File.ReadAllText(chartSettingsPath + "ChartSettings.json"); var settingsJObj = JObject.Parse(chartSettings); UserName = (string)settingsJObj["userName"]; Password = (string)settingsJObj["password"]; ChartTitle = (string)settingsJObj["chart"]["title"]; TimezoneOffset = int.TryParse((string)settingsJObj["chart"]["timezoneOffset"], out int tzOffset) ? tzOffset : 0; ChartTimeFormat = (string)settingsJObj["chart"]["timeFormat"] ?? "HH:mm:ss"; SampleCount = int.TryParse((string)settingsJObj["chart"]["sampleCount"], out int sampleCount) ? sampleCount : SampleCount; DeviceId = (string)settingsJObj["stream"]["deviceId"]; Filter = (string)settingsJObj["stream"]["filter"]; PrefetchMinutes = int.TryParse((string)settingsJObj["stream"]["samplePrefetchMinutes"], out int prefetchMin) ? prefetchMin : PrefetchMinutes; SampleIntervalSeconds = int.TryParse((string)settingsJObj["stream"]["sampleIntervalSeconds"], out int intervalSec) ? intervalSec : SampleIntervalSeconds; var seriesConfig = (JArray)settingsJObj["seriesConfig"]; foreach (var series in seriesConfig) { if (ValidatePath((string)series["path"])) { Brush strokeColor; try { strokeColor = new SolidColorBrush((Color)ColorConverter.ConvertFromString((string)series["color"])); } catch (Exception) { strokeColor = null; } var config = new SeriesConfig() { Name = (string)series["name"], Units = (string)(series["units"] ?? ""), Path = (string)series["path"], StrokeColor = strokeColor, LineSmoothness = (double)(series["lineSmoothness"] ?? defaultLineSmoothness) }; config.Name = (string.IsNullOrEmpty(config.Name)) ? config.Path.Split('.').Last() : config.Name; SeriesConfigurations.Add(config); if (series["min"] != null) { LimitsMinPath = (string)series["path"]; } if (series["max"] != null) { LimitsMaxPath = (string)series["path"]; } } else { var dialogBoxResult = MessageBox.Show( string.Format("Data series path: {0} is empty or invalid. No data for this series will be processed", (string)series["path"]), "CloudChart: ChartSettings.json Invalid", MessageBoxButton.OK, MessageBoxImage.Asterisk ); } } ChartDurationSeconds = (SampleCount * SampleIntervalSeconds); return(true); } catch (Exception) // just suck up any exceptions, app init will detect problems in chart settings { return(false); } }
public Ellipse theBody() { playerCanv.Children.Remove(refreshedbody); Ellipse body = new Ellipse(); TransformGroup bodyTransGroup = new TransformGroup(); TranslateTransform bodyTranslate = new TranslateTransform(); Point bodyLocation = new Point(); body.Width = 50; body.Height = 50; SolidColorBrush sb = new SolidColorBrush(Colors.Black); body.Fill = sb; bodyTranslate.X = X + bodyTranslate.X + velocityMovementx; bodyTranslate.Y = Y + bodyTranslate.Y + velocityMovementy; //Sets the body to stay inside the boundaries bodyLocation.X = bodyLocation.X + bodyTranslate.X; bodyLocation.Y = bodyLocation.Y + bodyTranslate.Y; Point aTempPoint = new Point(); aTempPoint = bodyLocation; int lastPointIndex = 0; savebODYLocation(aTempPoint); //Saves the locations of the player if (bodyLocation.X <= 1) { lastPointIndex = locBodySaved.LastIndexOf(aTempPoint); checkBodyBoundaries = true; bodyTranslate.X = 1; bodyLocation.X = 1; } else if ((bodyLocation.X >= playerCanv.ActualWidth - 50) && playerCanv.ActualWidth - 50 > 0) { lastPointIndex = locBodySaved.LastIndexOf(aTempPoint); checkBodyBoundaries = true; bodyTranslate.X = playerCanv.ActualWidth - 50; bodyLocation.X = playerCanv.ActualWidth - 50; } if (bodyLocation.Y <= 1) { lastPointIndex = locBodySaved.LastIndexOf(aTempPoint); checkBodyBoundaries = true; bodyTranslate.Y = 1 /*locBodySaved[locBodySaved.Count-3].X*/; bodyLocation.Y = 1; //bodyTranslate.Y = locBodySaved[lastPointIndex - 1].Y; //bodyLocation.Y = locBodySaved[lastPointIndex - 1].Y; } else if ((bodyLocation.Y >= playerCanv.ActualHeight - 50) && playerCanv.ActualHeight - 50 > 0) { savebODYLocation(aTempPoint); checkBodyBoundaries = true; bodyTranslate.Y = playerCanv.ActualHeight - 50 /*locBodySaved[locBodySaved.Count-3].X*/; bodyLocation.Y = playerCanv.ActualHeight - 50; //bodyTranslate.Y = locBodySaved[lastPointIndex - 1].Y; //bodyLocation.Y = locBodySaved[lastPointIndex - 1].Y; } bodyTransGroup.Children.Add(bodyTranslate); body.RenderTransform = bodyTransGroup; //player Redrawn playerCanv.Children.Add(body); return(body); }
public void StrokeColor(Color color) { LineColor = new SolidColorBrush(color); }
protected override void OnCreateDeviceResources(WindowRenderTarget renderTarget) { base.OnCreateDeviceResources(renderTarget); this._blackBrush = renderTarget.CreateSolidColorBrush(Color.FromARGB(Colors.Black, 1)); this._customRenderer = new CustomTextRendererWithEffects(this.Direct2DFactory, renderTarget, this._blackBrush); }
void BuildPrimaryPlane(InspectTreeState state) { var displayMode = state.Mode; Brush brush = new SolidColorBrush(EmptyColor); var view = Node.View; var parent = Node.View.Parent; var matrix = Matrix3D.Identity; if (view.Layer != null) { view = view.Layer; } var zFightOffset = childIndex * zFightIncrement; var zOffset = ZSpacing + zFightOffset; if (view.Transform != null) { var render = view.Transform; matrix = new Matrix3D { M11 = render.M11, M12 = render.M12, M13 = render.M13, M14 = render.M14, M21 = render.M21, M22 = render.M22, M23 = render.M23, M24 = render.M24, M31 = render.M31, M32 = render.M32, M33 = render.M33, M34 = render.M34, OffsetX = render.OffsetX, OffsetY = render.OffsetY, OffsetZ = render.OffsetZ + zOffset }; } var size = new Size(view.Width, view.Height); var visual = new DrawingVisual(); using (var context = visual.RenderOpen()) { if (view.BestCapturedImage != null && displayMode.HasFlag(DisplayMode.Content)) { var bitmap = new BitmapImage(); bitmap.BeginInit(); bitmap.StreamSource = new MemoryStream(view.BestCapturedImage); bitmap.EndInit(); context.DrawImage(bitmap, new Rect(size)); } if (displayMode.HasFlag(DisplayMode.Frames)) { context.DrawRectangle( null, new Pen(new SolidColorBrush(Color.FromRgb(0xd3, 0xd3, 0xd3)), 0.5), new Rect(size)); } } brush = new ImageBrush { ImageSource = new DrawingImage(visual.Drawing) }; var geometry = new MeshGeometry3D() { Positions = new Point3DCollection { new Point3D(0, 0, 0), new Point3D(0, -size.Height, 0), new Point3D(size.Width, -size.Height, 0), new Point3D(size.Width, 0, 0) }, TextureCoordinates = new PointCollection { new Point(0, 0), new Point(0, 1), new Point(1, 1), new Point(1, 0) }, TriangleIndices = new Int32Collection { 0, 1, 2, 0, 2, 3 }, }; var backGeometry = new MeshGeometry3D() { Positions = geometry.Positions, TextureCoordinates = geometry.TextureCoordinates, TriangleIndices = geometry.TriangleIndices, Normals = new Vector3DCollection { new Vector3D(0, 0, -1), new Vector3D(0, 0, -1), new Vector3D(0, 0, -1), new Vector3D(0, 0, -1) } }; material = new DiffuseMaterial(brush) { Color = BlurColor }; Content = new Model3DGroup() { Children = new Model3DCollection { new GeometryModel3D { Geometry = geometry, Material = material }, new GeometryModel3D { Geometry = backGeometry, BackMaterial = material, }, }, Transform = new ScaleTransform3D { ScaleX = Math.Ceiling(view.Width) / size.Width, ScaleY = -Math.Ceiling(view.Height) / size.Height, ScaleZ = 1 } }; var group = new Transform3DGroup(); if ((parent == null && !Node.View.IsFakeRoot) || (parent?.IsFakeRoot ?? false)) { var unitScale = 1.0 / Math.Max(view.Width, view.Height); group.Children = new Transform3DCollection { new TranslateTransform3D { OffsetX = -view.Width / 2.0, OffsetY = -view.Height / 2.0, OffsetZ = zOffset }, new ScaleTransform3D(unitScale, -unitScale, 1), expandTransform }; } else { if (view.Transform != null) { group.Children = new Transform3DCollection { new MatrixTransform3D() { Matrix = matrix }, expandTransform }; } else { group.Children = new Transform3DCollection { new TranslateTransform3D(view.X, view.Y, zOffset), expandTransform }; } } Transform = group; }
public dynSymbol() { //add a text box to the input grid of the control tb = new TextBox(); tb.HorizontalAlignment = System.Windows.HorizontalAlignment.Stretch; tb.VerticalAlignment = System.Windows.VerticalAlignment.Center; NodeUI.inputGrid.Children.Add(tb); System.Windows.Controls.Grid.SetColumn(tb, 0); System.Windows.Controls.Grid.SetRow(tb, 0); tb.Text = ""; //tb.KeyDown += new System.Windows.Input.KeyEventHandler(tb_KeyDown); //tb.LostFocus += new System.Windows.RoutedEventHandler(tb_LostFocus); //turn off the border SolidColorBrush backgroundBrush = new SolidColorBrush(System.Windows.Media.Color.FromArgb(0, 0, 0, 0)); tb.Background = backgroundBrush; tb.BorderThickness = new Thickness(0); OutPortData.Add(new PortData("", "Symbol", typeof(object))); NodeUI.RegisterAllPorts(); }
public void ColorFigures() { var brightness = 1.0; var delta = brightness / numberOfLevels; MakeFiguresBlack(Net.Nodes, Net.arcs); foreach (var figure in Net.Nodes) { (GetKeyByValueForFigures(figure) as Shape).Fill.Opacity = 1.0; var brush = new SolidColorBrush { Color = Colors.White }; (GetKeyByValueForFigures(figure) as Shape).Fill = brush; } var counter = 0; var quantity = 0; var reset = true; for (var i = colored.Count - 1; i >= 0; i--) { var temp = GetKeyByValueForFigures(colored[i]) as Shape; var brush = new SolidColorBrush(Colors.Blue) { Opacity = brightness }; counter++; temp.Fill = brush; if (reset) { if (colored[i] is VPlace) { var arcs = GetIngoingArcs(colored[i]); if (arcs.Count != 0) { quantity = GetOutgoingArcs(arcs[0].From).Count; } else { var j = i + 1; if (j < colored.Count) { while ((colored[j] is VPlace)) { j++; } quantity = GetIngoingArcs(colored[j]).Count; } else { quantity = 1; } } } else { quantity = 1; } reset = false; } if (counter != quantity) { continue; } counter = 0; brightness -= delta; reset = true; } }
/// <summary> /// This method creates the render target and all associated D2D and DWrite resources /// </summary> void CreateDeviceResources() { // Only calls if resources have not been initialize before if (renderTarget == null) { // Create the render target SizeU size = new SizeU((uint)host.ActualWidth, (uint)host.ActualHeight); RenderTargetProperties props = new RenderTargetProperties(); HwndRenderTargetProperties hwndProps = new HwndRenderTargetProperties(host.Handle, size, PresentOptions.None); renderTarget = d2dFactory.CreateHwndRenderTarget(props, hwndProps); // Create the black brush for text blackBrush = renderTarget.CreateSolidColorBrush(new ColorF(0 ,0, 0, 1)); inlineImage = new ImageInlineObject(renderTarget, wicFactory, "TextInlineImage.img1.jpg"); TextRange textRange = new TextRange(14, 1); textLayout.SetInlineObject(inlineImage, textRange); } }
public bool SimulateOneStep() { isSomethingChanged = true; if (isItFirstStep) { weights.Clear(); foreach (var place in Net.places) { weights.Add(place.Id, place.NumberOfTokens); } isItFirstStep = false; } List <VPlace> initialPlaces = new List <VPlace>(); foreach (VPlace place in Net.places) { int numberOfOutgoingArcs = place.ThisArcs.Count(t => place != t.To); //todo вот здесь если токены не кружками, то будет плохо if (place.TokensList.Count != 0 && numberOfOutgoingArcs != 0) { initialPlaces.Add(place); } foreach (Ellipse ellipse in place.TokensList) { ellipse.Fill = Brushes.Black; } } var outgoingTransitions = new List <VTransition>(); foreach (var place in initialPlaces) { foreach (var arc1 in place.ThisArcs) { if (arc1.From != place) { continue; } foreach (var arc2 in arc1.To.ThisArcs) { var mayBeEnabled = true; if (arc2.To != arc1.To) { continue; } foreach (var arc in arc1.To.ThisArcs) { if (arc.To != arc1.To) { continue; } int numberOfRequiredTokens; int.TryParse(arc.Weight, out numberOfRequiredTokens); var numberOfExistingTokens = (arc.From as VPlace).NumberOfTokens; if (numberOfRequiredTokens <= numberOfExistingTokens) { continue; } mayBeEnabled = false; break; } if (!outgoingTransitions.Contains(arc1.To as VTransition) && mayBeEnabled) { outgoingTransitions.Add(arc1.To as VTransition); } } } } if (outgoingTransitions.Count != 0) { foreach (VTransition transition in outgoingTransitions) { (GetKeyByValueForFigures(transition) as Shape).Stroke = Brushes.Black; } if (_isTransitionSelected == false) { if (_modeChoice == Choice.Forced) { if (outgoingTransitions.Count > 1) { _leftMouseButtonMode = LeftMouseButtonMode.ChooseTransition; foreach (VTransition transition in outgoingTransitions) { SolidColorBrush brush = new SolidColorBrush(); brush.Color = Color.FromRgb(255, 0, 51); (GetKeyByValueForFigures(transition) as Shape).Stroke = brush; } return(false); } else { enabledTransition = outgoingTransitions[0]; } } else { var transitionsWithTopPriority = new List <VTransition>(); outgoingTransitions.Sort(new Comparison <VTransition>((VTransition a, VTransition b) => (a.Priority - b.Priority))); var transitionWithTopPriority = outgoingTransitions.Find(new Predicate <VTransition>((VTransition t) => t.Priority > 0)); int topPriority = 0; if (transitionWithTopPriority != null) { topPriority = transitionWithTopPriority.Priority; } outgoingTransitions = outgoingTransitions.FindAll(new Predicate <VTransition>((VTransition a) => (a.Priority == topPriority || a.Priority == 0))); int indexOfEnabledTransition = MainRandom.Next(0, outgoingTransitions.Count); enabledTransition = outgoingTransitions[indexOfEnabledTransition]; } } _isTransitionSelected = false; _leftMouseButtonMode = LeftMouseButtonMode.Select; var isFirstRemove = true; foreach (var arc in enabledTransition.ThisArcs) { if (arc.From == enabledTransition) { continue; } if (colored.Contains(arc.From)) { colored.Remove(arc.From); if (isFirstRemove) { numberOfLevels--; } isFirstRemove = false; } colored.Add(arc.From); } numberOfLevels++; if (colored.Contains(enabledTransition)) { colored.Remove(enabledTransition); numberOfLevels--; } colored.Add(enabledTransition); numberOfLevels++; isFirstRemove = true; foreach (VArc arc in enabledTransition.ThisArcs) { VPlace changedPlace; if (arc.From != enabledTransition) { changedPlace = (arc.From as VPlace); if (changedPlace.NumberOfTokens != 0) { if (changedPlace.NumberOfTokens < 5) { RemoveTokens(changedPlace); } else { MainModelCanvas.Children.Remove(changedPlace.NumberOfTokensLabel); } } int delta; int.TryParse(arc.Weight, out delta); changedPlace.NumberOfTokens -= delta; } else { changedPlace = (arc.To as VPlace); if (changedPlace.NumberOfTokens != 0) { if (changedPlace.NumberOfTokens < 5) { RemoveTokens(changedPlace); } else { MainModelCanvas.Children.Remove(changedPlace.NumberOfTokensLabel); } } int delta; int.TryParse(arc.Weight, out delta); changedPlace.NumberOfTokens += delta; if (colored.Contains(changedPlace)) { colored.Remove(changedPlace); if (isFirstRemove) { numberOfLevels--; } isFirstRemove = false; } colored.Add(changedPlace); } AddTokens(changedPlace); if (arc.From != enabledTransition) { continue; } var placeToColor = (arc.To as VPlace); foreach (var ellepse in placeToColor.TokensList) { var brush = new SolidColorBrush { Color = Color.FromRgb(153, 255, 102) }; ellepse.Fill = brush; ellepse.Stroke = Brushes.Black; } } numberOfLevels++; if (simulationMode == SimulationMode.wave) { ColorFigures(); } if (marking.Count <= 0) { return(false); } oneStepMarking = new int[Net.places.Count]; for (int j = 0; j < Net.places.Count; j++) { oneStepMarking[j] = Net.places[j].NumberOfTokens; } marking.Push(oneStepMarking); maxMarking++; textBoxSimulationCurrentMarking.Text += "M_" + (maxMarking - 1) + " = { "; for (int j = 0; j < oneStepMarking.Length - 1; j++) { textBoxSimulationCurrentMarking.Text += oneStepMarking[j] + " | "; } textBoxSimulationCurrentMarking.Text += oneStepMarking[oneStepMarking.Length - 1] + " }\n"; textBoxSimulationCurrentMarking.ScrollToEnd(); return(false); } else { return(true); } }
protected override void OnCreateDeviceResources(WindowRenderTarget renderTarget) { base.OnCreateDeviceResources(renderTarget); // Create an array of gradient stops to put in the gradient stop // collection that will be used in the gradient brush. GradientStop[] stops = new GradientStop[] { new GradientStop(0, Color.FromARGB(Colors.Gold, 1)), new GradientStop(0.85f, Color.FromARGB(Colors.Orange, 1)), new GradientStop(1, Color.FromARGB(Colors.OrangeRed, 1)) }; using (GradientStopCollection gradiendStops = renderTarget.CreateGradientStopCollection(stops, Gamma.Gamma22, ExtendMode.Clamp)) { // The center of the gradient is in the center of the box. // The gradient origin offset was set to zero(0, 0) or center in this case. this._radialGradientBrush = renderTarget.CreateRadialGradientBrush( new RadialGradientBrushProperties( new PointF(330, 330), new PointF(140, 140), 140, 140), BrushProperties.Default, gradiendStops); } this._sceneBrush = renderTarget.CreateSolidColorBrush(Color.FromARGB(Colors.Black, 1)); this._gridPatternBrush = renderTarget.CreateGridPatternBrush(new SizeF(10, 10), Color.FromARGB(1, 0.93f, 0.94f, 0.96f)); }
/// <summary> /// 获得焦点时边框的颜色 /// </summary> /// <param name="sender"></param> /// <param name="e"></param> private void txtbox_GotFocus(object sender, RoutedEventArgs e) { SolidColorBrush brush = new SolidColorBrush(Color.FromRgb(232, 116, 57)); b1.BorderBrush = brush; }
//int i = 1; private async void GetConnectCassandras(Object source, EventArgs e) // Метод в таймере для casmon и создания всех соединений по SSH { DispatcherTimer timer = (DispatcherTimer)source; if (null != timer.Tag) { return; } try { Task <List <Casmon> > t = Task <List <Casmon> > .Run(get_cass); timer.Tag = t; await t; } catch (Exception ass) { return; } finally { timer.Tag = null; } // получение файла casmon из начального соединения и извлечение всех доступных адресов List <Casmon> get_cass() { casmon_list.Clear(); try { using (SshCommand ddd = global.sshClients[0].RunCommand("cd /etc/cassandra/; /opt/rust-bin/casmon")) { string res = ddd.Result; JObject eee = JObject.Parse(res); JArray list = (JArray)eee["seeds"]; global.NameClasterCassandra = (string)eee["clusetr_name"]; string node = ""; string check = ""; foreach (JObject content in list.Children <JObject>()) { foreach (JProperty prop in content.Properties()) { if (prop.Name.ToString() == "node") { node = prop.Value.ToString(); } else { check = prop.Value.ToString(); } } casmon_list.Add(new Casmon(node, check)); } } // Проверяем доступность и меняем цвет this.Dispatcher.BeginInvoke(DispatcherPriority.Normal, (ThreadStart) delegate() { if (global.casmons.Count == 0) { global.casmons = casmon_list; radius_Elipse_Casmon(global.casmons); } else { foreach (Casmon cas in global.casmons) { if (cas.check == "False") { //string tag = cas.node; foreach (UIElement uI in cnv.Children) { if (uI is Border) { Border border = (Border)uI; SolidColorBrush red = new SolidColorBrush(Color.FromRgb(r_Red, g_Red, b_Red)); SolidColorBrush border_color = (SolidColorBrush)border.Background; if (border.Tag.ToString() == cas.node.ToString() && red.Color != border_color.Color) { border.Background = new SolidColorBrush(Color.FromRgb(r_Yellow, g_Yellow, b_Yellow)); //global.casmons = t.Result; } } } } else { foreach (UIElement uI in cnv.Children) { if (uI is Border) { Border border = (Border)uI; SolidColorBrush red = new SolidColorBrush(Color.FromRgb(r_Red, g_Red, b_Red)); SolidColorBrush border_color = (SolidColorBrush)border.Background; if (border.Tag.ToString() == cas.node.ToString() && red.Color != border_color.Color) { border.Background = new SolidColorBrush(Color.FromRgb(r_GreenE, g_GreenE, b_GreenE)); //global.casmons = t.Result; } } } } } } }); } catch (Exception ass) { global.sshErrors.Add(new SshError(DateTime.Now.ToLocalTime().ToString(), ass.ToString())); this.Dispatcher.BeginInvoke(DispatcherPriority.Normal, (ThreadStart) delegate() { datagrid_system.ItemsSource = null; datagrid_system.SelectedItem = null; datagrid_system.ItemsSource = global.sshErrors; datagrid_system.SelectedItem = global.sshErrors; }); } // делаем остальные соединения по ssh если их еще не сделали int m = global.sshClients.Count - 1; if (global.sshClients.Count < casmon_list.Count) // если количество соединений меньше возможных { foreach (Casmon casmon in casmon_list) { if (casmon.node != global.host) { m++; try { global.sshClients.Add(new SshClient(casmon.node, global.login, global.password)); Dispatcher.BeginInvoke(DispatcherPriority.Normal, (ThreadStart) delegate() { progressBar.Visibility = Visibility.Visible; }); global.sshClients[m].Connect(); Dispatcher.BeginInvoke(DispatcherPriority.Normal, (ThreadStart) delegate() { progressBar.Visibility = Visibility.Hidden; }); if (global.sshClients[m].IsConnected != true) { //MessageBox.Show($"Соединение SSH по адресу {cassss[i].node} не получилось установить!"); /*this.Dispatcher.BeginInvoke(DispatcherPriority.Normal, (ThreadStart)delegate () * { * error_text.Text = $"Соединение SSH по адресу {casmon.node} не получилось установить! \n{COUNT}"; * }); * COUNT++;*/ } } catch (Exception ee) { //string host = global.sshClients[m].ConnectionInfo.Host; string host = casmon.node; Dispatcher.BeginInvoke(DispatcherPriority.Normal, (ThreadStart) delegate() { foreach (UIElement uI in cnv.Children) { if (uI is Border) { Border border = (Border)uI; if (border.Tag.ToString() == host.ToString()) { border.Background = new SolidColorBrush(Color.FromRgb(r_Red, g_Red, b_Red)); } } } }); global.sshErrors.Add(new SshError(DateTime.Now.ToLocalTime().ToString(), ee.ToString())); this.Dispatcher.BeginInvoke(DispatcherPriority.Normal, (ThreadStart) delegate() { progressBar.Visibility = Visibility.Hidden; datagrid_system.ItemsSource = null; datagrid_system.SelectedItem = null; datagrid_system.ItemsSource = global.sshErrors; datagrid_system.SelectedItem = global.sshErrors; }); } } } } else if (global.sshClients.Count == casmon_list.Count) // проверка на IsConnected { foreach (SshClient ssh_client in global.sshClients) { if (ssh_client.IsConnected == false) { try { Dispatcher.BeginInvoke(DispatcherPriority.Normal, (ThreadStart) delegate() { text_Gif_System.Visibility = Visibility.Visible; image_Gif_System.Visibility = Visibility.Visible; }); ssh_client.Connect(); // Если соединение установлено то красим в желтый string host = ssh_client.ConnectionInfo.Host; Dispatcher.BeginInvoke(DispatcherPriority.Normal, (ThreadStart) delegate() { foreach (UIElement uI in cnv.Children) { if (uI is Border) { Border border = (Border)uI; if (border.Tag.ToString() == host.ToString()) { border.Background = new SolidColorBrush(Color.FromRgb(r_Yellow, g_Yellow, b_Yellow)); } } } }); Dispatcher.BeginInvoke(DispatcherPriority.Normal, (ThreadStart) delegate() { text_Gif_System.Visibility = Visibility.Hidden; image_Gif_System.Visibility = Visibility.Hidden; }); } catch (Exception ass) { //====================================================================================================================== string host = ssh_client.ConnectionInfo.Host; Dispatcher.BeginInvoke(DispatcherPriority.Normal, (ThreadStart) delegate() { foreach (UIElement uI in cnv.Children) { if (uI is Border) { Border border = (Border)uI; if (border.Tag.ToString() == host.ToString()) { border.Background = new SolidColorBrush(Color.FromRgb(r_Red, g_Red, b_Red)); } } } }); global.sshErrors.Add(new SshError(DateTime.Now.ToLocalTime().ToString(), ass.ToString())); this.Dispatcher.BeginInvoke(DispatcherPriority.Normal, (ThreadStart) delegate() { text_Gif_System.Visibility = Visibility.Hidden; image_Gif_System.Visibility = Visibility.Hidden; datagrid_system.ItemsSource = null; datagrid_system.SelectedItem = null; datagrid_system.ItemsSource = global.sshErrors; datagrid_system.SelectedItem = global.sshErrors; }); } } } } global.sysmons.Clear(); // получение всех sysmon файлов foreach (SshClient ssh in global.sshClients) { disks.Clear(); try { using (SshCommand ddd = ssh.RunCommand("cd /etc/cassandra/; /opt/rust-bin/sysmon")) { string res = ddd.Result; JObject eee = JObject.Parse(res); string host = (string)eee["host"]; string ip = (string)eee["ip"]; string os = (string)eee["os"]; string version = (string)eee["version"]; int mem_total = (int)eee["mem_total"]; int mem_used = (int)eee["mem_used"]; JArray list = (JArray)eee["disks"]; string name = ""; string mount_point = ""; double total = 0; double used = 0; foreach (JObject content in list.Children <JObject>()) { foreach (JProperty prop in content.Properties()) { if (prop.Name.ToString() == "name") { name = prop.Value.ToString(); } else if (prop.Name.ToString() == "mount_point") { mount_point = prop.Value.ToString(); } else if (prop.Name.ToString() == "total") { total = (double)prop.Value; } else if (prop.Name.ToString() == "used") { used = (double)prop.Value; } } disks.Add(new Disk(name, mount_point, total.ToString(), used.ToString())); } global.sysmons.Add(new Sysmon(host, ip, os, version, mem_total, mem_used, disks)); if (!setBoolNameClaster) // устанавливаем имя кластера { nameClaster = global.sysmons[0].host; this.Dispatcher.BeginInvoke(DispatcherPriority.Normal, (ThreadStart) delegate() { cassandra_Name(nameClaster); }); setBoolNameClaster = true; } } } catch (Exception ass) { global.sshErrors.Add(new SshError(DateTime.Now.ToLocalTime().ToString(), ass.ToString())); this.Dispatcher.BeginInvoke(DispatcherPriority.Normal, (ThreadStart) delegate() { datagrid_system.ItemsSource = null; datagrid_system.SelectedItem = null; datagrid_system.ItemsSource = global.sshErrors; datagrid_system.SelectedItem = global.sshErrors; }); } } return(casmon_list); } }
/// <summary> /// 失去焦点时边框的颜色 /// </summary> /// <param name="sender"></param> /// <param name="e"></param> private void txtbox_LostFocus(object sender, RoutedEventArgs e) { SolidColorBrush brush = new SolidColorBrush(Color.FromRgb(0xCA, 0xC3, 0xBA)); b1.BorderBrush = brush; }
public static SolidColorBrush GetBrush(this Color color) { var b = color.Tag as SolidColorBrush; if (b == null) { b = new SolidColorBrush ( NativeColor.FromArgb ( (byte)color.Alpha, (byte)color.Red, (byte)color.Green, (byte)color.Blue)); color.Tag = b; } return b; }
// ------------------------- CreateFirstVisual ------------------------ /// <summary> /// Creates content for the first visual sample.</summary> /// <param name="shouldMeasure"> /// true to remeasure the layout.</param> /// <returns> /// The canvas containing the visual.</returns> public Canvas CreateFirstVisual(bool shouldMeasure) { Canvas canvas1 = new Canvas(); canvas1.Width = 96 * 8.5; canvas1.Height = 96 * 11; // Top-Left TextBlock label = new TextBlock(); label.Foreground = Brushes.DarkBlue; label.FontFamily = new System.Windows.Media.FontFamily("Arial"); label.FontSize = 36.0; label.Text = "TopLeft"; Canvas.SetTop(label, 0); Canvas.SetLeft(label, 0); canvas1.Children.Add(label); // Bottom-Right label = new TextBlock(); label.Foreground = Brushes.Bisque; label.Text = "BottomRight"; label.FontFamily = new System.Windows.Media.FontFamily("Arial"); label.FontSize = 56.0; Canvas.SetTop(label, 750); Canvas.SetLeft(label, 520); canvas1.Children.Add(label); // Top-Right label = new TextBlock(); label.Foreground = Brushes.BurlyWood; label.Text = "TopRight"; label.FontFamily = new System.Windows.Media.FontFamily("CASTELLAR"); label.FontSize = 32.0; Canvas.SetTop(label, 0); Canvas.SetLeft(label, 520); canvas1.Children.Add(label); // Bottom-Left label = new TextBlock(); label.Foreground = Brushes.Cyan; label.Text = "BottomLeft"; label.FontFamily = new System.Windows.Media.FontFamily("Arial"); label.FontSize = 18.0; Canvas.SetTop(label, 750); Canvas.SetLeft(label, 0); canvas1.Children.Add(label); // Adding a rectangle to the page Rectangle firstRectangle = new Rectangle(); firstRectangle.Fill = new SolidColorBrush(Colors.Red); Thickness thick = new Thickness(); thick.Left = 150; thick.Top = 150; firstRectangle.Margin = thick; firstRectangle.Width = 300; firstRectangle.Height = 300; canvas1.Children.Add(firstRectangle); //Add a button to the page Button firstButton = new Button(); firstButton.Background = Brushes.LightYellow; firstButton.BorderBrush = new SolidColorBrush(Colors.Black); firstButton.BorderThickness = new Thickness(4); firstButton.Content = "I am button 1..."; firstButton.FontSize = 16.0; thick.Left = 80; thick.Top = 250; firstButton.Margin = thick; canvas1.Children.Add(firstButton); // Add an Ellipse Ellipse firstEllipse = new Ellipse(); SolidColorBrush firstSolidColorBrush = new SolidColorBrush(Colors.DarkCyan); firstSolidColorBrush.Opacity = 0.7; firstEllipse.Fill = firstSolidColorBrush; SetEllipse(firstEllipse, 500, 350, 120, 250); canvas1.Children.Add(firstEllipse); // Add a Polygon Polygon polygon = new Polygon(); polygon.Fill = Brushes.Bisque; polygon.Opacity = 0.2; PointCollection points = new PointCollection(); points.Add(new Point(50, 0)); points.Add(new Point(10, 30)); points.Add(new Point(30, 170)); points.Add(new Point(90, 40)); points.Add(new Point(230, 180)); points.Add(new Point(200, 60)); points.Add(new Point(240, 10)); points.Add(new Point(70, 130)); polygon.Points = points; polygon.Stroke = Brushes.Navy; Canvas.SetTop(polygon, 300); Canvas.SetLeft(polygon, 160); canvas1.Children.Add(polygon); if (shouldMeasure) { Size sz = new Size(8.5 * 96, 11 * 96); canvas1.Measure(sz); canvas1.Arrange(new Rect(new Point(), sz)); canvas1.UpdateLayout(); } return(canvas1); }// end:CreateFirstVisual()
private void AddSeries(GearedValues <long> values, string title, Color color, double strokeThickness, SolidColorBrush fillBrush, DoubleCollection strokeDashArray = null) { cartesianChart1.Series.Add(new GLineSeries { Values = values, Title = title, Stroke = new SolidColorBrush(color), Fill = fillBrush, StrokeThickness = strokeThickness, StrokeDashArray = strokeDashArray, PointGeometry = null //use a null geometry when you have many series }); }
public void FillColor(Color color) { ShapeColor = new SolidColorBrush(color); }
/// <summary> /// Initializes static members of the <see cref="Brushes"/> class. /// </summary> static Brushes() { AliceBlue = new SolidColorBrush(Colors.AliceBlue); AntiqueWhite = new SolidColorBrush(Colors.AntiqueWhite); Aqua = new SolidColorBrush(Colors.Aqua); Aquamarine = new SolidColorBrush(Colors.Aquamarine); Azure = new SolidColorBrush(Colors.Azure); Beige = new SolidColorBrush(Colors.Beige); Bisque = new SolidColorBrush(Colors.Bisque); Black = new SolidColorBrush(Colors.Black); BlanchedAlmond = new SolidColorBrush(Colors.BlanchedAlmond); Blue = new SolidColorBrush(Colors.Blue); BlueViolet = new SolidColorBrush(Colors.BlueViolet); Brown = new SolidColorBrush(Colors.Brown); BurlyWood = new SolidColorBrush(Colors.BurlyWood); CadetBlue = new SolidColorBrush(Colors.CadetBlue); Chartreuse = new SolidColorBrush(Colors.Chartreuse); Chocolate = new SolidColorBrush(Colors.Chocolate); Coral = new SolidColorBrush(Colors.Coral); CornflowerBlue = new SolidColorBrush(Colors.CornflowerBlue); Cornsilk = new SolidColorBrush(Colors.Cornsilk); Crimson = new SolidColorBrush(Colors.Crimson); Cyan = new SolidColorBrush(Colors.Cyan); DarkBlue = new SolidColorBrush(Colors.DarkBlue); DarkCyan = new SolidColorBrush(Colors.DarkCyan); DarkGoldenrod = new SolidColorBrush(Colors.DarkGoldenrod); DarkGray = new SolidColorBrush(Colors.DarkGray); DarkGreen = new SolidColorBrush(Colors.DarkGreen); DarkKhaki = new SolidColorBrush(Colors.DarkKhaki); DarkMagenta = new SolidColorBrush(Colors.DarkMagenta); DarkOliveGreen = new SolidColorBrush(Colors.DarkOliveGreen); DarkOrange = new SolidColorBrush(Colors.DarkOrange); DarkOrchid = new SolidColorBrush(Colors.DarkOrchid); DarkRed = new SolidColorBrush(Colors.DarkRed); DarkSalmon = new SolidColorBrush(Colors.DarkSalmon); DarkSeaGreen = new SolidColorBrush(Colors.DarkSeaGreen); DarkSlateBlue = new SolidColorBrush(Colors.DarkSlateBlue); DarkSlateGray = new SolidColorBrush(Colors.DarkSlateGray); DarkTurquoise = new SolidColorBrush(Colors.DarkTurquoise); DarkViolet = new SolidColorBrush(Colors.DarkViolet); DeepPink = new SolidColorBrush(Colors.DeepPink); DeepSkyBlue = new SolidColorBrush(Colors.DeepSkyBlue); DimGray = new SolidColorBrush(Colors.DimGray); DodgerBlue = new SolidColorBrush(Colors.DodgerBlue); Firebrick = new SolidColorBrush(Colors.Firebrick); FloralWhite = new SolidColorBrush(Colors.FloralWhite); ForestGreen = new SolidColorBrush(Colors.ForestGreen); Fuchsia = new SolidColorBrush(Colors.Fuchsia); Gainsboro = new SolidColorBrush(Colors.Gainsboro); GhostWhite = new SolidColorBrush(Colors.GhostWhite); Gold = new SolidColorBrush(Colors.Gold); Goldenrod = new SolidColorBrush(Colors.Goldenrod); Gray = new SolidColorBrush(Colors.Gray); Green = new SolidColorBrush(Colors.Green); GreenYellow = new SolidColorBrush(Colors.GreenYellow); Honeydew = new SolidColorBrush(Colors.Honeydew); HotPink = new SolidColorBrush(Colors.HotPink); IndianRed = new SolidColorBrush(Colors.IndianRed); Indigo = new SolidColorBrush(Colors.Indigo); Ivory = new SolidColorBrush(Colors.Ivory); Khaki = new SolidColorBrush(Colors.Khaki); Lavender = new SolidColorBrush(Colors.Lavender); LavenderBlush = new SolidColorBrush(Colors.LavenderBlush); LawnGreen = new SolidColorBrush(Colors.LawnGreen); LemonChiffon = new SolidColorBrush(Colors.LemonChiffon); LightBlue = new SolidColorBrush(Colors.LightBlue); LightCoral = new SolidColorBrush(Colors.LightCoral); LightCyan = new SolidColorBrush(Colors.LightCyan); LightGoldenrodYellow = new SolidColorBrush(Colors.LightGoldenrodYellow); LightGray = new SolidColorBrush(Colors.LightGray); LightGreen = new SolidColorBrush(Colors.LightGreen); LightPink = new SolidColorBrush(Colors.LightPink); LightSalmon = new SolidColorBrush(Colors.LightSalmon); LightSeaGreen = new SolidColorBrush(Colors.LightSeaGreen); LightSkyBlue = new SolidColorBrush(Colors.LightSkyBlue); LightSlateGray = new SolidColorBrush(Colors.LightSlateGray); LightSteelBlue = new SolidColorBrush(Colors.LightSteelBlue); LightYellow = new SolidColorBrush(Colors.LightYellow); Lime = new SolidColorBrush(Colors.Lime); LimeGreen = new SolidColorBrush(Colors.LimeGreen); Linen = new SolidColorBrush(Colors.Linen); Magenta = new SolidColorBrush(Colors.Magenta); Maroon = new SolidColorBrush(Colors.Maroon); MediumAquamarine = new SolidColorBrush(Colors.MediumAquamarine); MediumBlue = new SolidColorBrush(Colors.MediumBlue); MediumOrchid = new SolidColorBrush(Colors.MediumOrchid); MediumPurple = new SolidColorBrush(Colors.MediumPurple); MediumSeaGreen = new SolidColorBrush(Colors.MediumSeaGreen); MediumSlateBlue = new SolidColorBrush(Colors.MediumSlateBlue); MediumSpringGreen = new SolidColorBrush(Colors.MediumSpringGreen); MediumTurquoise = new SolidColorBrush(Colors.MediumTurquoise); MediumVioletRed = new SolidColorBrush(Colors.MediumVioletRed); MidnightBlue = new SolidColorBrush(Colors.MidnightBlue); MintCream = new SolidColorBrush(Colors.MintCream); MistyRose = new SolidColorBrush(Colors.MistyRose); Moccasin = new SolidColorBrush(Colors.Moccasin); NavajoWhite = new SolidColorBrush(Colors.NavajoWhite); Navy = new SolidColorBrush(Colors.Navy); OldLace = new SolidColorBrush(Colors.OldLace); Olive = new SolidColorBrush(Colors.Olive); OliveDrab = new SolidColorBrush(Colors.OliveDrab); Orange = new SolidColorBrush(Colors.Orange); OrangeRed = new SolidColorBrush(Colors.OrangeRed); Orchid = new SolidColorBrush(Colors.Orchid); PaleGoldenrod = new SolidColorBrush(Colors.PaleGoldenrod); PaleGreen = new SolidColorBrush(Colors.PaleGreen); PaleTurquoise = new SolidColorBrush(Colors.PaleTurquoise); PaleVioletRed = new SolidColorBrush(Colors.PaleVioletRed); PapayaWhip = new SolidColorBrush(Colors.PapayaWhip); PeachPuff = new SolidColorBrush(Colors.PeachPuff); Peru = new SolidColorBrush(Colors.Peru); Pink = new SolidColorBrush(Colors.Pink); Plum = new SolidColorBrush(Colors.Plum); PowderBlue = new SolidColorBrush(Colors.PowderBlue); Purple = new SolidColorBrush(Colors.Purple); Red = new SolidColorBrush(Colors.Red); RosyBrown = new SolidColorBrush(Colors.RosyBrown); RoyalBlue = new SolidColorBrush(Colors.RoyalBlue); SaddleBrown = new SolidColorBrush(Colors.SaddleBrown); Salmon = new SolidColorBrush(Colors.Salmon); SandyBrown = new SolidColorBrush(Colors.SandyBrown); SeaGreen = new SolidColorBrush(Colors.SeaGreen); SeaShell = new SolidColorBrush(Colors.SeaShell); Sienna = new SolidColorBrush(Colors.Sienna); Silver = new SolidColorBrush(Colors.Silver); SkyBlue = new SolidColorBrush(Colors.SkyBlue); SlateBlue = new SolidColorBrush(Colors.SlateBlue); SlateGray = new SolidColorBrush(Colors.SlateGray); Snow = new SolidColorBrush(Colors.Snow); SpringGreen = new SolidColorBrush(Colors.SpringGreen); SteelBlue = new SolidColorBrush(Colors.SteelBlue); Tan = new SolidColorBrush(Colors.Tan); Teal = new SolidColorBrush(Colors.Teal); Thistle = new SolidColorBrush(Colors.Thistle); Tomato = new SolidColorBrush(Colors.Tomato); Transparent = new SolidColorBrush(Colors.Transparent); Turquoise = new SolidColorBrush(Colors.Turquoise); Violet = new SolidColorBrush(Colors.Violet); Wheat = new SolidColorBrush(Colors.Wheat); White = new SolidColorBrush(Colors.White); WhiteSmoke = new SolidColorBrush(Colors.WhiteSmoke); Yellow = new SolidColorBrush(Colors.Yellow); YellowGreen = new SolidColorBrush(Colors.YellowGreen); }
public XamlCanvas() { Background = new SolidColorBrush (NativeColors.Transparent); MinFps = 4; MaxFps = 30; Continuous = true; _drawTimer = new DispatcherTimer(); _drawTimer.Tick += DrawTick; Unloaded += HandleUnloaded; Loaded += HandleLoaded; LayoutUpdated += delegate { HandleLayoutUpdated (); }; }
public PDirect2DRenderer(IntPtr winHandle) { fWindowHandle = winHandle; CreateFactories(); CreateDeviceResources(); Graphics = hwndRenderTarget; fStrokeBrush = Graphics.CreateSolidColorBrush(new ColorF(0, 0, 0, 1)); fFillBrush = Graphics.CreateSolidColorBrush(new ColorF(1, 1, 1, 1)); }