/// <summary>
/// Dumps the node information of the workflow to Logger object.
/// </summary>
/// <param name="ix">IndexServer connection</param>
/// <param name="CONST">IndexServer constants</param>
/// <param name="ci">Client information (ticket)</param>
/// <param name="flowId">Workflow ID</param>
/// <param name="testUserId">ID of user which started the test.</param>
/// <param name="wfUserIds">IDs of users which receive the workflow.</param>
private void dumpWFNodes(IXConnection ix,
IXServicePortC CONST,
int flowId, int testUserId, String[] wfUserIds)
{
// add current user to userIds
String[] userIds = new String[wfUserIds.Length + 1];
userIds[0] = Convert.ToString(testUserId);
for (int i = 0; i < wfUserIds.Length; i++)
{
userIds[i + 1] = wfUserIds[i];
}
// collect nodes
WFCollectNode[] nodes = ix.Ix.collectWorkFlowNodes("" + flowId,
WFTypeC.ACTIVE, null, WFNodeC.TYPE_NOTHING, null,
null, null, userIds, false, false);
// dump
Logger.instance().log("Workflow Nodes, #nodes=" + nodes.Length);
for (int i = 0; i < nodes.Length; i++)
{
Logger.instance().log(" " +
(nodes[i].active ? "*" : " ") +
"nodes[" + i + "]: id=" + nodes[i].nodeId +
", name=" + nodes[i].nodeName +
", userId=" + nodes[i].userId +
", inUseDate=" + nodes[i].inUseDateIso);
}
}
/// <summary>
/// Checkin workflow scripts.
/// </summary>
/// <param name="ix">IndexServer connection</param>
/// <param name="CONST">IndexServer constants</param>
/// <param name="ci">Client information (ticket)</param>
/// <param name="scriptNames">Array of script names</param>
private void internalCheckinScripts(IXConnection ix,
IXServicePortC CONST,
String[] scriptNames)
{
Logger.instance().log("internalCheckinScripts(");
ConfigFile[] currentScripts = ix.Ix.checkoutConfigFiles(
new String[] { myServerScriptDir + "/*" }, ConfigFileC.mbNoFileData, LockC.NO);
Logger.instance().log("read script files...");
ConfigFile[] ixScripts = new ConfigFile[scriptNames.Length];
for (int i = 0; i < ixScripts.Length; i++)
{
ixScripts[i] = new ConfigFile();
ixScripts[i].name = scriptNames[i];
ixScripts[i].dir = myServerScriptDir;
String fileName = "..\\..\\" + ixScripts[i].name;
FileStream fstrm = new FileStream(fileName, FileMode.Open, FileAccess.Read);
ixScripts[i].fileData = new FileData();
ixScripts[i].fileData.data = new byte[(int)fstrm.Length];
fstrm.Read(ixScripts[i].fileData.data, 0, (int)fstrm.Length);
fstrm.Close();
}
Logger.instance().log("read script files OK");
Logger.instance().log("checkin...");
ix.Ix.checkinConfigFiles(ixScripts, LockC.NO);
Logger.instance().log("checkin OK");
currentScripts = ix.Ix.checkoutConfigFiles(
new String[] { myServerScriptDir + "/*" }, ConfigFileC.mbNoFileData, LockC.NO);
Logger.instance().log(")internalCheckinScripts");
}
private void internalFindBooks(IXConnection ix,
IXServicePortC CONST, String parentId,
String author, String price)
{
Logger.instance().log("find author=" + author + ", price=" + price);
// select names only
SordZ mbName = new SordZ();
mbName.bset = SordC.mbName;
// find
FindInfo findInfo = internalMakeFindInfo(parentId, author, price);
Sord[] sords = ix.Ix.findFirstSords(findInfo, 1000, mbName).sords;
String nameList = "";
for (int i = 0; i < sords.Length; i++)
{
if (i != 0)
{
nameList += ",";
}
nameList += sords[i].name;
}
Logger.instance().log("find OK, sords=" + nameList);
}
/// <summary>
/// Create users with given names if they do not already exist.
/// </summary>
/// <param name="ix">IndexServer connection</param>
/// <param name="CONST">IndexServer constants</param>
/// <param name="ci">Client information (ticket)</param>
/// <param name="userNames">Names of users to create</param>
/// <returns>User IDs as String array</returns>
private String[] internalCreateSomeUsers(IXConnection ix,
IXServicePortC CONST, String[] userNames)
{
String[] uids = new String[userNames.Length];
// Try to create users
UserInfo[] users = new UserInfo[userNames.Length];
try
{
for (int i = 0; i < userNames.Length; i++)
{
users[i] = ix.Ix.createUser("0");
users[i].name = userNames[i];
users[i].pwd = "elo";
}
ix.Ix.checkinUsers(users, CheckinUsersC.WRITE_PASSWORD, LockC.NO);
}
catch (Exception e)
{
Logger.instance().log("exception=" + e);
throw e;
}
// checkout users to get their IDs
users = ix.Ix.checkoutUsers(userNames, CheckoutUsersC.BY_IDS, LockC.NO);
for (int i = 0; i < users.Length; i++)
{
uids[i] = Convert.ToString(users[i].id);
Logger.instance().log("uids[" + i + "]=" + uids[i]);
}
return(uids);
}
private void dumpSordTypes(SordType[] sordTypes)
{
for (int i = 0; i < sordTypes.Length; i++)
{
Logger.instance().log("sordTypes[" + i + "], id=" + sordTypes[i].id + ", name=" + sordTypes[i].name);
}
}
/// <summary>
/// This function shows how to checkout a document using encryption functionality of
/// It does not set the ix.Ix.cryptDocuments session option. It assigns "&crypt=true"
/// to the URL to direct IndexServer to decrypt the document.
/// Using this method does not require an extra call to DM. But the file size and file extension
/// in the DocVersion object comes from the encrypted document (ETF-file) rather the
/// original document.
/// </summary>
/// <param name="ix"></param>
/// <param name="CONST"></param>
/// <param name="ci"></param>
/// <param name="objId"></param>
private void checkoutDocDecryptedUsingUrlExt(IXConnection ix, IXServicePortC CONST, string objId)
{
// Tell IndexServer not to encrypt/decrypt.
setSessionOptionEncrypt(ix, false);
// Provide external password of encryption set.
string encrPwd = ix.EncryptPassword(encryptionPassword);
ix.Ix.provideCryptPassword("" + encryptionSet, encrPwd);
EditInfo ed = ix.Ix.checkoutDoc(objId, null, EditInfoC.mbSordDoc, LockC.NO);
Logger.instance().log("encrypted.ext=" + ed.document.docs[0].ext);
Logger.instance().log("encrypted.size=" + ed.document.docs[0].size);
String tempName2 = internalMakeTempFileName(".tmp");
// append the special parameter to the URL
String urlDecr = ed.document.docs[0].url + "&crypt=true";
Logger.instance().log("prepared download URL=" + urlDecr);
// -------------------------------------------------------------------------------
// The URL to download the document should be a HTTPS URL in production environments!
// IndexServer configuration option "ixUrlBase" might be helpful here.
// -------------------------------------------------------------------------------
ix.Download(urlDecr, tempName2);
// Show document in notepad:
System.Diagnostics.Process.Start("notepad.exe", tempName2);
System.Threading.Thread.Sleep(3000);
System.IO.File.Delete(tempName2);
}
public void run()
{
lockKey = "mykey";
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// Prepare ClientInfo object with language and country
// ClientInfo ci = new ClientInfo();
// ci.language = "de";
// ci.country = "DE";
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
// get constants
Logger.instance().log("get const...");
IXServicePortC CONST = ix.CONST;
Logger.instance().log("get const OK");
// Get the current archive key
int keyIdBeforeLock = ix.Ix.lockArchive(null);
Logger.instance().log("key before lock=" + keyIdBeforeLock);
// LOCK
int keyIdBeforeLock2 = ix.Ix.lockArchive(lockKey);
// Get the current archive key
int keyIdAfterLock = ix.Ix.lockArchive(null);
Logger.instance().log("key after lock=" + keyIdAfterLock);
// UNLOCK
int keyIdBeforeUnlock = ix.Ix.lockArchive("0");
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
Logger.instance().log("IX logout OK");
}
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// Prepare ClientInfo object with language and country
// ClientInfo ci = new ClientInfo();
// ci.language = "de";
// ci.country = "DE";
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
// get constants
Logger.instance().log("get const...");
IXServicePortC CONST = ix.CONST;
Logger.instance().log("get const OK");
// Create a root folder based on keywording form "Email".
// Parent is the "imaginary" archive entry with object ID = 1.
String parentId = "1";
String maskId = "email";
EditInfo ed = ix.Ix.createSord(parentId, maskId, EditInfoC.mbAll);
ed.sord.name = "New Sord";
ViewAndEditSordDlg dlg = new ViewAndEditSordDlg();
dlg.init(ix, ed);
dlg.ShowDialog(null);
// CHECKIN
int objId = ix.Ix.checkinSord(dlg.getSord(), SordC.mbAll, LockC.NO);
Logger.instance().log("Created sord successfully, objId=" + objId);
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
Logger.instance().log("IX logout OK");
}
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
Logger.instance().log("Version=" + connFact.Version);
Logger.instance().log("ImplVersion=" + ix.ImplVersion);
Logger.instance().log("InterfaceVersion=" + ix.InterfaceVersion);
Logger.instance().log("ClientVersion=" + ix.ClientVersion);
LoginResult loginResult = ix.LoginResult;
// If successfully logged on, you can find the ticket here:
// loginResult.clientInfo.ticket.
Logger.instance().log("login successfully, ticket=" + loginResult.clientInfo.ticket);
Logger.instance().log("ticket lifetime seconds=" + loginResult.ticketLifetime);
Logger.instance().log("user ID=" + loginResult.user.id);
// Otherwise an exception was thrown in ix.Ix.login() and you will not
// reach this lines.
// Use in subsequent calls always the returned ClientInfo object (contains ticket).
// ci = ix.Login.ci
ix.Ix.checkoutWorkflowTemplate("6439", "", WFDiagramC.mbAll, LockC.NO);
FindWorkflowInfo findInfo = new FindWorkflowInfo();
findInfo.type = WFTypeC.TEMPLATE;
FindResult findResult = ix.Ix.findFirstWorkflows(findInfo, 100, WFDiagramC.mbLean);
Logger.instance().log("wfs=" + findResult.workflows);
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
ix.Dispose();
Logger.instance().log("IX logout OK");
}
}
}
private void dumpUserNames(String indent, IXServicePortC CONST, UserName[] uns)
{
for (int i = 0; i < uns.Length; i++)
{
String type = (uns[i].type == UserInfoC.TYPE_GROUP) ? "group" : "user";
Logger.instance().log(indent + type + ": name=" + uns[i].name + ", id=" + uns[i].id);
}
}
/// <summary>
/// This function shows how to checkin a document using encryption functionality of
/// </summary>
/// <param name="ix"></param>
/// <param name="CONST"></param>
/// <param name="ci"></param>
/// <returns></returns>
private string checkinDocEncrypted(IXConnection ix, IXServicePortC CONST)
{
// Tell IndexServer to encrypt/decrypt.
setSessionOptionEncrypt(ix, true);
// Provide external password of encryption set.
// This password must be encrpyted for security reasons.
// Administrators should not know it!
string encrPwd = ix.EncryptPassword(encryptionPassword);
ix.Ix.provideCryptPassword("" + encryptionSet, encrPwd);
// Create document
EditInfo ed = ix.Ix.createDoc("1", "0", null, EditInfoC.mbSordDoc);
ed.sord.name = "C# example CheckinOutDocEncrypted";
ed.sord.details.encryptionSet = encryptionSet;
// Create file for document version
String testFile = internalCreateTestFile("CheckinDocEncrypted example file", "txt");
// Supply the extension of the document
ed.document.docs = new DocVersion[1];
ed.document.docs[0] = new DocVersion();
ed.document.docs[0].ext = ix.GetFileExt(testFile);
ed.document.docs[0].pathId = ed.sord.path;
ed.document.docs[0].encryptionSet = ed.sord.details.encryptionSet;
// CheckinDocBegin: let IndexServer generate an URL to upload the document
// This URL addresses always the IndexServer and not the Document Manager.
ed.document = ix.Ix.checkinDocBegin(ed.document);
// -------------------------------------------------------------------------------
// The URL to upload the document should be a HTTPS URL in production environments!
// IndexServer configuration option "ixUrlBase" might be helpful here.
// -------------------------------------------------------------------------------
Logger.instance().log("prepared upload URL=" + ed.document.docs[0].url + ", doc-guid=" + ed.document.docs[0].guid);
// Upload document version.
// IndexServer encrypts the document.
ed.document.docs[0].uploadResult = ix.Upload(ed.document.docs[0].url, testFile);
Logger.instance().log("upload document version succeeded");
// CheckinDocEnd: uploadResult contains the document information from ELODM.
// Pass this information to
ed.document = ix.Ix.checkinDocEnd(ed.sord, SordC.mbAll, ed.document, LockC.NO);
Logger.instance().log("inserted document:");
Logger.instance().log(" objId=" + ed.document.objId);
Logger.instance().log(" docId=" + ed.document.docs[0].id);
Logger.instance().log(" doc-guid=" + ed.document.docs[0].guid);
Logger.instance().log(" URL=" + ed.document.docs[0].url);
System.IO.File.Delete(testFile);
return(ed.document.objId);
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
// Create a document
EditInfo ed = ix.Ix.createDoc("1", null, null, EditInfoC.mbSordDoc);
ed.sord.name = "document with sticky notes";
ed.document = new Document();
ed.document.docs = new DocVersion[1] {
new DocVersion()
};
ed.document.docs[0].ext = "tif";
ed.document.docs[0].pathId = ed.sord.path;
ed.document.docs[0].encryptionSet = ed.sord.details.encryptionSet;
ed.document = ix.Ix.checkinDocBegin(ed.document);
ed.document.docs[0].uploadResult = ix.Upload(ed.document.docs[0].url, @"..\..\00000001.TIF");
ed.document = ix.Ix.checkinDocEnd(ed.sord, SordC.mbAll, ed.document, LockC.NO);
Note[] notes = new Note[3];
// Create a normal sticky note
notes[0] = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_NORMAL, null);
notes[0].desc = "This is a normal sticky note";
// Create a personal note
notes[1] = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_PERSONAL, null);
notes[1].desc = "This is a personal note";
// Create a stamp note
notes[2] = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_STAMP, null);
notes[2].desc = "This is a stamp note";
int[] noteIds = ix.Ix.checkinNotes(null, notes, NoteC.mbAll, LockC.NO);
Logger.instance().log("noteIds=" + noteIds);
}
finally
{
ix.Logout();
}
}
private Sord internalCreateEmail(IXConnection ix,
IXServicePortC CONST, String parentId, String name, String from, String to)
{
Sord d1 = ix.Ix.createDoc(parentId, "Email", null, EditInfoC.mbSord).sord;
d1.name = name;
d1.objKeys[0].data = new String[] {from};
d1.objKeys[1].data = new String[] {to};
d1.id = ix.Ix.checkinSord(d1, SordC.mbAll, LockC.NO);
Logger.instance().log("name=" + name + ", from=" + from + ", to=" + to);
return d1;
}
private void logTimeValues(String actionName, double dt, int n)
{
double ns100 = 1000L * 1000L * 10;
dt /= ns100;
double secondsPerAction = dt / (double)n;
double actionsPerSecond = 1.0 / secondsPerAction;
Logger.instance().log("action=" + actionName + ": dt=" + dt);
Logger.instance().log(" secondsPerAction=" + secondsPerAction);
Logger.instance().log(" actionsPerSecond=" + actionsPerSecond);
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// Prepare ClientInfo object with language and country
// ClientInfo ci = new ClientInfo();
// ci.language = "de";
// ci.country = "DE";
// LOGIN
Logger.instance().log("login ...");
ClientInfo ci = new ClientInfo();
ci.timeZone = "GMT+01:00"; // "Europe/Berlin";
ix = connFact.CreateSso(ci, Environment.MachineName);
LoginResult loginResult = ix.LoginResult;
// If successfully logged on, you can find the ticket here:
// loginResult.clientInfo.ticket.
Logger.instance().log("login successfully, ticket=" + loginResult.clientInfo.ticket);
Logger.instance().log("ticket lifetime seconds=" + loginResult.ticketLifetime);
Logger.instance().log("user ID=" + loginResult.user.id);
// Otherwise an exception was thrown in ix.Ix.login() and you will not
// reach this lines.
// Use in subsequent calls always the returned ClientInfo object (contains ticket).
// ci = ix.Login.ci
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
Logger.instance().log("IX logout OK");
}
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection conn = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
conn = connFact.Create(userName, userPwd, "myComputer", null);
Logger.instance().log("login OK");
Logger.instance().log("Check whether OCR is available...");
bool avail = checkOcrAvail(conn);
Logger.instance().log("OCR is available=" + avail);
if (avail)
{
String fileName = "..\\..\\sample.tif";
Logger.instance().log("Recognize file synchronously");
String text = recognizeFileSync(conn, fileName);
Logger.instance().log("text=" + text.Substring(0, 100) + "...");
// Recognize rectangle.
// Rectangle units are given in per thousand of document width resp. height.
Logger.instance().log("Recognize rect ");
int pmLeft = 50, pmTop = 100, pmRight = 200, pmBottom = 1000;
text = recognizeRect(conn, fileName, pmLeft, pmTop, pmRight, pmBottom);
Logger.instance().log("text=" + text.Substring(0, 100) + "...");
// Return character positions
Logger.instance().log("Recognize file return character positions");
recognizeFileCharPos(conn, fileName);
}
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
if (conn != null)
{
Logger.instance().log("IX logout...");
conn.Logout();
Logger.instance().log("IX logout OK");
}
}
}
public Form1()
{
//
// Erforderlich für die Windows Form-Designerunterstützung
//
InitializeComponent();
//
// TODO: Fügen Sie den Konstruktorcode nach dem Aufruf von InitializeComponent hinzu
//
Logger.instance().init(rtxLog);
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
FindInfo findInfo = new FindInfo();
findInfo.findDirect = new FindDirect();
findInfo.findDirect.query = "buch sord.type:[254 TO 255]";
findInfo.findDirect.searchInFulltext = true;
findInfo.findDirect.searchInIndex = true;
findInfo.findDirect.searchInMemo = true;
findInfo.findDirect.searchInSordName = true;
FindResult findResult = ix.Ix.findFirstSords(findInfo, 100, SordC.mbAll);
for (int i = 0; i < findResult.sords.Length; i++)
{
Logger.instance().log(findResult.sords[i].name + "," + findResult.sords[i].type);
}
ix.Ix.findClose(findResult.searchId);
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
Logger.instance().log("IX logout OK");
}
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection conn = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
conn = connFact.Create(userName, userPwd, "myComputer", null);
Logger.instance().log("login OK");
Logger.instance().log("Check whether OCR is available...");
bool avail = checkOcrAvail(conn);
Logger.instance().log("OCR is available=" + avail);
if (avail)
{
Logger.instance().log("Query languages:");
OcrInfo ocrInfo = new OcrInfo();
ocrInfo.queryLanguages = new OcrInfoQueryLanguages();
// Extenal language names should be returned in this language
ocrInfo.messagesLanguage = OcrInfoC.MESSAGES_LANGUAGE_GERMAN;
OcrResult ocrResult = conn.Ix.processOcr(ocrInfo);
for (int i = 0; i < ocrResult.queryLanguages.externalLangs.Length; i++)
{
Logger.instance().log("external=" + ocrResult.queryLanguages.externalLangs[i]);
Logger.instance().log("internal=" + ocrResult.queryLanguages.internalLangs[i]);
}
}
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
if (conn != null)
{
Logger.instance().log("IX logout...");
conn.Logout();
Logger.instance().log("IX logout OK");
}
}
}
private void dumpKeyword(Keyword kw, String indent)
{
Logger.instance().log(indent + "kw.id=" + kw.id);
Logger.instance().log(indent + " text=" + kw.text);
Logger.instance().log(indent + " add=" + kw.add);
Logger.instance().log(indent + " enabled=" + kw.enabled);
Logger.instance().log(indent + " raw=" + kw.raw);
Logger.instance().log(indent + " hasChildren=" + (kw.children != null) + ", #children=" + ((kw.children != null) ? kw.children.Length : 0));
if (kw.children != null)
{
for (int i = 0; i < kw.children.Length; i++)
{
dumpKeyword(kw.children[i], indent + " ");
}
}
}
private Sord internalCreateBook(IXConnection ix,
IXServicePortC CONST, String parentId, String name, String author, String price)
{
Sord d1 = ix.Ix.createDoc(parentId, "0", null, EditInfoC.mbSord).sord;
d1.name = name;
d1.objKeys = new ObjKey[2];
d1.objKeys[0] = new ObjKey();
d1.objKeys[0].id = 0;
d1.objKeys[0].name = "AUTHOR";
d1.objKeys[0].data = new String[] { author };
d1.objKeys[1] = new ObjKey();
d1.objKeys[1].id = 1;
d1.objKeys[1].name = "PRICE";
d1.objKeys[1].data = new String[] { price };
d1.id = ix.Ix.checkinSord(d1, SordC.mbAll, LockC.NO);
Logger.instance().log("name=" + name + ", author=" + author);
return(d1);
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// Prepare ClientInfo object with language and country
// ClientInfo ci = new ClientInfo();
// ci.language = "de";
// ci.country = "DE";
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
SelectKeywordDlg dlg = new SelectKeywordDlg(ix);
dlg.ShowDialog();
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
Logger.instance().log("IX logout OK");
}
}
}
private void internalFindEmailsFromTo(IXConnection ix,
IXServicePortC CONST, String parentId, String from, String to)
{
Logger.instance().log("find from=" + from + ", to=" + to + "...");
// select names only
SordZ mbName = new SordZ();
mbName.bset = SordC.mbName;
// find
FindInfo findInfo = internalMakeFindInfo(parentId, from, to);
Sord[] sords = ix.Ix.findFirstSords(findInfo, 1000, mbName).sords;
String nameList = "";
for (int i = 0; i < sords.Length; i++)
{
if (i != 0) nameList += ",";
nameList += sords[i].name;
}
Logger.instance().log("find OK, sords=" + nameList);
}
public void run()
{
IXConnFactory connFact = null;
IXConnection conn = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
conn = connFact.Create(userName, userPwd, "myComputer", null);
Logger.instance().log("login OK");
Logger.instance().log("Check whether OCR is available...");
bool avail = checkOcrAvail(conn);
Logger.instance().log("OCR is available=" + avail);
if (avail)
{
String fileName = "..\\..\\sample.tif";
Logger.instance().log("Recognize file asynchronously");
String text = recognizeFileAsync(conn, fileName, 30);
Logger.instance().log("text=" + text.Substring(0, 100) + "...");
}
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
if (conn != null)
{
Logger.instance().log("IX logout...");
conn.Logout();
Logger.instance().log("IX logout OK");
}
}
}
private void internalDumpLinks(IXConnection ix, IXServicePortC CONST,
String guid)
{
// Checkout sord to get the new links
Sord sord = ix.Ix.checkoutSord(guid, EditInfoC.mbSord, LockC.NO).sord;
Logger.instance().log("links of " + sord.name + " {");
for (int i = 0; i < sord.linksGoOut.Length; i++)
{
Sord linkToSord = ix.Ix.checkoutSord(sord.linksGoOut[i].id,
EditInfoC.mbSordLean, LockC.NO).sord;
Logger.instance().log(" ->" + linkToSord.name); // + ", guid=" + sord.linksGoOut[i].id + ", linkId=" + sord.linksGoOut[i].linkId);
}
for (int i = 0; i < sord.linksComeIn.Length; i++)
{
Sord linkFromSord = ix.Ix.checkoutSord(sord.linksComeIn[i].id,
EditInfoC.mbSordLean, LockC.NO).sord;
Logger.instance().log(" <-" + linkFromSord.name); // + ", guid=" + sord.linksComeIn[i].id + ", linkId=" + sord.linksComeIn[i].linkId);
}
Logger.instance().log("}");
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix1 = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// LOGIN
Logger.instance().log("login connections...");
ix1 = connFact.Create(userName, userPwd, "myComputer-conn1", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
EventBusWatchFolderEventsDlg dlg = new EventBusWatchFolderEventsDlg(ix1);
dlg.ShowDialog();
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix1 != null)
{
Logger.instance().log("IX logout...");
ix1.Logout();
Logger.instance().log("IX logout OK");
}
}
}
/// <summary>
/// This function calls cookKeyword to evaluate the resulting keyword text with substituted
/// placeholders and concatinated upper nodes.
/// </summary>
/// <param name="ix"></param>
/// <param name="ci"></param>
/// <param name="kw"></param>
/// <returns></returns>
private String selectKeyword(IXConnection ix, Keyword kw)
{
String keywordText = "";
// cookKeyword throws an exception, if the keyword is not enabled
if (kw.enabled)
{
// cookKeyword need only be called for raw keywords
if (kw.raw)
{
keywordText = ix.Ix.cookKeyword(kw.id);
}
else
{
keywordText = kw.text;
}
Logger.instance().log("cooked keyword: id=" + kw.id + ", raw-text=" + kw.text + ", cooked-text=" + keywordText);
}
else
{
Logger.instance().log("cannot select disabled keyword: id=" + kw.id);
}
return(keywordText);
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// Prepare ClientInfo object with language and country
// ClientInfo ci = new ClientInfo();
// ci.language = "de";
// ci.country = "DE";
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
// get constants
Logger.instance().log("get const...");
IXServicePortC CONST = ix.CONST;
Logger.instance().log("get const OK");
// lock key data
// This is optional since checkinKeys and
// deleteKeys check the lock too.
Logger.instance().log("lock key data...");
ix.Ix.checkoutKeys(null, LockC.YES);
Logger.instance().log("lock key data OK");
// create key
// - be aware to set KeyInfo.id = -1 to create a new key!
Logger.instance().log("create key...");
KeyInfo ki = new KeyInfo();
ki.id = -1;
ki.name = "C# Example Key";
ki.id = ix.Ix.checkinKeys(new KeyInfo[] { ki }, LockC.NO)[0];
Logger.instance().log("create key OK, name=" + ki.name + ", id=" + ki.id);
// delete key and unlock
Logger.instance().log("delete key...");
ix.Ix.deleteKeys(new String[] { ki.name }, LockC.YES);
Logger.instance().log("delete key OK");
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
Logger.instance().log("IX logout OK");
}
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// Prepare ClientInfo object with language and country
// ClientInfo ci = new ClientInfo();
// ci.language = "de";
// ci.country = "DE";
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
// get constants
Logger.instance().log("get const...");
IXServicePortC CONST = ix.CONST;
Logger.instance().log("get const OK");
// Example for initializing an encryption set with a new internal password.
// If you uncomment this lines, aready encrypted documents of this encryption set
// cannot be decrypted anymore since the internal key is lost!
// Logger.instance().log("init encryption set ...");
//initializeNewEncryptionSet(ix, CONST, 13, "CS-TEST", encryptionPassword);
// Logger.instance().log("init encryption set OK");
// checkin example document and encrypt it
string objId = checkinDocEncrypted(ix, CONST);
// checkout example document
checkoutDocDecryptedUsingSessionOption(ix, CONST, objId);
// checkout example document
checkoutDocDecryptedUsingUrlExt(ix, CONST, objId);
bool cleanUp = true;
if (cleanUp)
{
// Delete Document
DeleteOptions delOpts = new DeleteOptions();
delOpts.deleteFinally = true;
ix.Ix.deleteSord(null, objId, LockC.NO, null);
ix.Ix.deleteSord(null, objId, LockC.NO, delOpts);
}
}
catch (Exception e)
{
throw e;
}
finally
{
// Logout
// --
if (ix != null)
{
Logger.instance().log("IX logout...");
ix.Logout();
Logger.instance().log("IX logout OK");
}
}
}
public void run()
{
IXConnFactory connFact = null;
IXConnection ix = null;
try
{
IXProperties connProps = IXConnFactory.CreateConnProperties(url);
IXProperties sessOpts = IXConnFactory.CreateSessionOptions("IX-Examples", "1.0");
connFact = new IXConnFactory(connProps, sessOpts);
Logger.instance().log("create IXConnFactory OK");
// LOGIN
Logger.instance().log("login...");
ix = connFact.Create(userName, userPwd, "myComputer", null);
// ci = ix.Login.ci
Logger.instance().log("login OK");
// Create a document
EditInfo ed = ix.Ix.createDoc("1", null, null, EditInfoC.mbSordDoc);
ed.sord.name = "document with annotations";
ed.document = new Document();
ed.document.docs = new DocVersion[1] {
new DocVersion()
};
ed.document.docs[0].ext = "tif";
ed.document.docs[0].pathId = ed.sord.path;
ed.document.docs[0].encryptionSet = ed.sord.details.encryptionSet;
ed.document = ix.Ix.checkinDocBegin(ed.document);
ed.document.docs[0].uploadResult = ix.Upload(ed.document.docs[0].url, @"..\..\00000001.TIF");
ed.document = ix.Ix.checkinDocEnd(ed.sord, SordC.mbAll, ed.document, LockC.NO);
List <Note> notes = new List <Note>();
// -------------------------------------------------------
// Do not use the member Note.desc for annotations because
// it contains position and formatting information.
// -------------------------------------------------------
// Text on a opaque rectangle
if (true)
{
Note note = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_NOTE_WITHFONT, null);
note.noteText.text = "This is an annotation with font=" + note.noteText.fontInfo.faceName;
note.color = NetColorToEloColor(System.Drawing.Color.RosyBrown);
note.noteText.fontInfo.height *= 2;
note.noteText.fontInfo.bold = true;
note.noteText.fontInfo.italic = true;
note.noteText.fontInfo.RGB = NetColorToEloColor(System.Drawing.Color.SkyBlue);
note.XPos = 100;
note.YPos = 200;
note.width = 1000;
note.height = 500;
notes.Add(note);
}
// Horizontal line
if (true)
{
Note note = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_HORIZONTAL_LINE, null);
PointInfo p1 = new PointInfo();
p1.x = 100;
p1.y = 750;
PointInfo p2 = new PointInfo();
p2.x = p1.x + 900;
p2.y = p1.y;
note.noteFreehand.points = new PointInfo[] { p1, p2 };
note.noteFreehand.width = 20; // Pen width
note.color = NetColorToEloColor(System.Drawing.Color.Violet);
notes.Add(note);
}
// Freehand line (this example draws a circle)
if (true)
{
Note note = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_FREEHAND, null);
List <PointInfo> points = new List <PointInfo>();
for (int i = 0; i < 360; i += 5)
{
double alpha = 2 * Math.PI * (double)i / 360.0;
PointInfo p = new PointInfo();
p.x = 200 + (int)(Math.Sin(alpha) * 100);
p.y = 900 + (int)(Math.Cos(alpha) * 100);
points.Add(p);
}
note.noteFreehand.points = points.ToArray();
note.noteFreehand.width = 50; // Pen width
note.color = NetColorToEloColor(System.Drawing.Color.Tomato);
notes.Add(note);
}
// Draws a half-transparent rectangle
if (true)
{
Note note = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_MARKER, null);
note.XPos = 400;
note.YPos = 800;
note.width = 300;
note.height = 200;
note.color = NetColorToEloColor(System.Drawing.Color.YellowGreen);
notes.Add(note);
}
// Draws a filled (opaque) rectangle
if (true)
{
Note note = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_FILLEDRECTANGLE, null);
note.XPos = 800;
note.YPos = 800;
note.width = 300;
note.height = 200;
note.color = NetColorToEloColor(System.Drawing.Color.YellowGreen);
notes.Add(note);
}
// Draws a strikeout line
if (true)
{
Note note = ix.Ix.createNote2(ed.document.objId, NoteC.TYPE_ANNOTATION_STRIKEOUT, null);
PointInfo p1 = new PointInfo();
p1.x = 100;
p1.y = 1100;
PointInfo p2 = new PointInfo();
p2.x = p1.x + 900;
p2.y = p1.y;
note.noteFreehand.points = new PointInfo[] { p1, p2 };
note.noteFreehand.width = 100;
note.noteFreehand.strikeoutWidth = 20;
note.noteFreehand.strikeoutColor = NetColorToEloColor(System.Drawing.Color.Red);
note.color = NetColorToEloColor(System.Drawing.Color.Yellow);
notes.Add(note);
}
int[] noteIds = ix.Ix.checkinNotes(null, notes.ToArray(), NoteC.mbAll, LockC.NO);
Logger.instance().log("noteIds=" + noteIds);
}
finally
{
ix.Logout();
}
}
