//Color picked event handler
void ColorPicked(object sender, Windows.UI.Color color)
{
//Get the source InkColor instance
InkColor pressed = sender as InkColor;
//Check if the instance is valid
if (pressed != null)
{
//Iterate over all of the pickers InkColors and update their border color to highlight the active one
foreach (InkColor inkcolor in m_colors)
{
if (inkcolor == pressed)
{
inkcolor.BorderColor = this.MainBorder.BorderBrush;
}
else
{
inkcolor.BorderColor = m_inActiveBrush;
}
}
}
//Raise the InkColorPicked event
if (InkColorPicked != null)
{
InkColorPicked(this, color);
}
}
/// <summary>
/// Changes font color of main application banner
/// </summary>
/// <returns>None</returns>
private void ChangeTextBlockFontColor(TextBlock textBlock, Windows.UI.Color color)
{
var ignored = this.Dispatcher.RunAsync(Windows.UI.Core.CoreDispatcherPriority.Normal, () =>
{
textBlock.Foreground = new SolidColorBrush(color);
});
}
//绘制颜色选择区rectColor
private void DrawDoubleLinearGradient()
{
cvsDoubleLinear.Children.Clear();
int nRect = (int)Height;
Windows.UI.Xaml.Shapes.Rectangle[] rectLinearGradient = new Windows.UI.Xaml.Shapes.Rectangle[nRect];
LinearGradientBrush[] linearBrush = new LinearGradientBrush[nRect];
for (int i = 0; i < nRect; ++i)
{
Windows.UI.Color clr1 = new Windows.UI.Color(), clr2 = new Windows.UI.Color();
clr1.A = clr2.A = 255;
clr2.R = clr2.G = clr2.B = (Byte)((nRect - 1 - i) * 255 / (nRect - 1));
clr1.R = (Byte)((nRect - i - 1) * colorPure.R / (nRect - 1));
clr1.G = (Byte)((nRect - i - 1) * colorPure.G / (nRect - 1));
clr1.B = (Byte)((nRect - i - 1) * colorPure.B / (nRect - 1));
GradientStop gradientStop1 = new GradientStop(), gradientStop2 = new GradientStop();
gradientStop1.Offset = 0;
gradientStop1.Offset = 1;
gradientStop1.Color = clr1;
gradientStop2.Color = clr2;
linearBrush[i] = new LinearGradientBrush();
linearBrush[i].StartPoint = new Point(0, 0);
linearBrush[i].EndPoint = new Point(1, 0);
linearBrush[i].GradientStops.Add(gradientStop2);
linearBrush[i].GradientStops.Add(gradientStop1);
rectLinearGradient[i] = new Windows.UI.Xaml.Shapes.Rectangle();
rectLinearGradient[i].Width = 0.8 * Width;
rectLinearGradient[i].Height = 1;
rectLinearGradient[i].StrokeThickness = 0;
rectLinearGradient[i].Fill = linearBrush[i];
cvsDoubleLinear.Children.Add(rectLinearGradient[i]);
Canvas.SetTop(rectLinearGradient[i], i);
}
}
public VectorInkStroke(Stroke stroke, Wacom.Ink.Geometry.VectorBrush vectorBrush, PipelineData pipelineData)
{
Id = stroke.Id;
PathPointProperties ppp = stroke.Style.PathPointProperties;
Color = MediaColor.FromArgb(
ppp.Alpha.HasValue ? (byte)(ppp.Alpha * 255.0f) : byte.MinValue,
ppp.Red.HasValue ? (byte)(ppp.Red * 255.0f) : byte.MinValue,
ppp.Green.HasValue ? (byte)(ppp.Green * 255.0f) : byte.MinValue,
ppp.Blue.HasValue ? (byte)(ppp.Blue * 255.0f) : byte.MinValue);
Spline = stroke.Spline;
Layout = stroke.Layout;
VectorBrush = vectorBrush;
Polygon = PolygonUtil.ConvertPolygon(pipelineData.Merged.Addition);
SimplPoly = pipelineData.Merged.Addition;
SensorDataOffset = stroke.SensorDataOffset;
SensorDataMappings = stroke.SensorDataMappings;
SensorDataId = stroke.SensorDataId;
Attributes attribs = new Attributes(Color);
if (ppp.Size.HasValue)
{
attribs.Size = ppp.Size.Value;
}
Constants = attribs;
}
public static void RichEditBoxSetText(RichEditBox richEditBox, String msg, Windows.UI.Color color, bool fReadOnly)
{
richEditBox.IsReadOnly = false;
richEditBox.Document.SetText(Windows.UI.Text.TextSetOptions.None, msg);
richEditBox.Foreground = new SolidColorBrush(color);
richEditBox.IsReadOnly = fReadOnly;
}
private async Task <MethodResponse> ChangeColor(MethodRequest req, object userContext)
{
var colorReq = Newtonsoft.Json.JsonConvert.DeserializeObject <ChangeColorRequest>(req.DataAsJson);
onColor = Windows.UI.Color.FromArgb(255, colorReq.R, colorReq.G, colorReq.B);
return(new MethodResponse(new byte[0], 200));
}
private ClassBreaksRenderer CreateClassBreaksRenderer()
{
// Define the colors that will be used by the unique value renderer.
Colors gray = Colors.FromArgb(255, 153, 153, 153);
Colors blue1 = Colors.FromArgb(255, 227, 235, 207);
Colors blue2 = Colors.FromArgb(255, 150, 194, 191);
Colors blue3 = Colors.FromArgb(255, 97, 166, 181);
Colors blue4 = Colors.FromArgb(255, 69, 125, 150);
Colors blue5 = Colors.FromArgb(255, 41, 84, 120);
// Create a gray outline and five fill symbols with different shades of blue.
SimpleLineSymbol outlineSimpleLineSymbol = new SimpleLineSymbol(SimpleLineSymbolStyle.Solid, gray, 1);
SimpleFillSymbol simpleFileSymbol1 = new SimpleFillSymbol(SimpleFillSymbolStyle.Solid, blue1, outlineSimpleLineSymbol);
SimpleFillSymbol simpleFileSymbol2 = new SimpleFillSymbol(SimpleFillSymbolStyle.Solid, blue2, outlineSimpleLineSymbol);
SimpleFillSymbol simpleFileSymbol3 = new SimpleFillSymbol(SimpleFillSymbolStyle.Solid, blue3, outlineSimpleLineSymbol);
SimpleFillSymbol simpleFileSymbol4 = new SimpleFillSymbol(SimpleFillSymbolStyle.Solid, blue4, outlineSimpleLineSymbol);
SimpleFillSymbol simpleFileSymbol5 = new SimpleFillSymbol(SimpleFillSymbolStyle.Solid, blue5, outlineSimpleLineSymbol);
// Create a list of five class breaks for different population ranges.
List <ClassBreak> listClassBreaks = new List <ClassBreak>
{
new ClassBreak("-99 to 8560", "-99 to 8560", -99, 8560, simpleFileSymbol1),
new ClassBreak("> 8,560 to 18,109", "> 8,560 to 18,109", 8560, 18109, simpleFileSymbol2),
new ClassBreak("> 18,109 to 35,501", "> 18,109 to 35,501", 18109, 35501, simpleFileSymbol3),
new ClassBreak("> 35,501 to 86,100", "> 35,501 to 86,100", 35501, 86100, simpleFileSymbol4),
new ClassBreak("> 86,100 to 10,110,975", "> 86,100 to 10,110,975", 86100, 10110975, simpleFileSymbol5)
};
// Create and return the a class break renderer for use with the POP2007 field in the counties sub-layer.
return(new ClassBreaksRenderer("POP2007", listClassBreaks));
}
private Color Win10ColorToMediaColor(UISettings uiSettings, UIColorType colorType)
{
Windows.UI.Color win10Color = uiSettings.GetColorValue(colorType);
Color mediaColor = Color.FromArgb(win10Color.A, win10Color.R, win10Color.G, win10Color.B);
return(mediaColor);
}
private void setTitleBarColor(Windows.UI.Color bgColor, Windows.UI.Color btnHoverColor)
{
var titleBar = ApplicationView.GetForCurrentView().TitleBar;
titleBar.BackgroundColor = bgColor;
titleBar.ButtonBackgroundColor = bgColor;
titleBar.ButtonHoverBackgroundColor = btnHoverColor;
}
public async void DrawFaceRectangleStream(DetectedFace[] faceResult, InMemoryRandomAccessStream imageStream)
{
ImageCanvas.Children.Clear();
if (faceResult != null && faceResult.Length > 0)
{
BitmapDecoder decoder = await BitmapDecoder.CreateAsync(imageStream);
double resizeFactorH = ImageCanvas.Height / decoder.PixelHeight;
double resizeFactorW = ImageCanvas.Width / decoder.PixelWidth;
foreach (var face in faceResult)
{
FaceRectangle faceRect = face.FaceRectangle;
var rectangle1 = new Rectangle();
Windows.UI.Color faceColor = Windows.UI.Color.FromArgb(50, 255, 255, 255);
Windows.UI.Color borderColor = Windows.UI.Colors.Blue;
rectangle1.Fill = new SolidColorBrush(faceColor);
rectangle1.Width = faceRect.Width;
rectangle1.Height = faceRect.Height;
rectangle1.Stroke = new SolidColorBrush(borderColor);
rectangle1.StrokeThickness = 1;
rectangle1.RadiusX = 10;
rectangle1.RadiusY = 10;
ImageCanvas.Children.Add(rectangle1);
Canvas.SetLeft(rectangle1, faceRect.Left);
Canvas.SetTop(rectangle1, faceRect.Top);
}
}
}
protected override void OnAttached()
{
var color = (Color)Element.GetValue(RoutingEffects.PickerChangeColor.ColorProperty);
this.color = ConvertColor(color);
(Control as ComboBox).Foreground = new SolidColorBrush(this.color);
}
private void ColorsMenuFlyout_Opening(object sender, object e)
{
MenuFlyout colorsMenu = sender as MenuFlyout;
colorsMenu.Items.Clear();
var colors = typeof(Windows.UI.Colors).GetRuntimeProperties();
foreach (var color in colors)
{
var item = new MenuFlyoutItem();
item.Text = color.Name;
Windows.UI.Color c = (Windows.UI.Color)color.GetValue(null);
item.DataContext = string.Format("#{0}{1}{2}", c.R.ToString("x2"), c.G.ToString("x2"), c.B.ToString("x2"));
item.Background = new SolidColorBrush(c);
item.FontFamily = new FontFamily("Segoe UI");
item.FontSize = 15;
item.Height = 40;
item.Margin = new Thickness(0, 1, 0, 0);
item.Click += ColorMenu_Click;
colorsMenu.Items.Add(item);
}
}
private async Task ChangeColorOfPicture(Color color)
{
_color = color;
var svg = "";
var file = await StorageFile.GetFileFromApplicationUriAsync(new Uri(@"ms-appx:///Assets/CarPics/car.svg"));
using (var inputStream = await file.OpenReadAsync())
using (var classicStream = inputStream.AsStreamForRead())
using (var streamReader = new StreamReader(classicStream))
{
svg = await streamReader.ReadToEndAsync();
}
var newSvg = Regex.Replace(svg, "white", CreateHexFromColor(color));
var storageFolder =
ApplicationData.Current.LocalFolder;
var storageFile =
await storageFolder.CreateFileAsync($"Image{_num}.svg",
CreationCollisionOption.ReplaceExisting);
//Write data to the file
await FileIO.WriteTextAsync(storageFile, newSvg);
var svgImage = await StorageFileToSvgImage(storageFile);
svgImage.RasterizePixelHeight = 200;
svgImage.RasterizePixelWidth = 500;
CarImage.Source = svgImage;
CarImage.Width = 100;
CarImage.Height = 100;
CarImage.Margin = new Thickness(0, -10, 0, 0);
await storageFile.DeleteAsync(StorageDeleteOption.Default);
}
public MasterDetailPageContentDemoViewModel()
{
SplitterMode = MasterDetailPageContentSplitterMode.OverlayVisible;
EnableSplitter = true;
Dictionary <string, Color> colors = new Dictionary <string, Color>();
Random rnd = new Random();
foreach (Message message in DataStorage.Messages)
{
Color color;
if (colors.ContainsKey(message.From))
{
color = colors[message.From];
}
else
{
byte[] rgb = new byte[3];
rnd.NextBytes(rgb);
color = Color.FromArgb(0xFF, rgb[0], rgb[1], rgb[2]);
colors.Add(message.From, color);
}
Messages.Add(new MessageViewModel(message, color));
}
SelectedMessage = Messages[0];
}
//SortedList<string, Conversation> listContact = new SortedList<string, Conversation>(); //联系人列表
#endregion
#region Init
public MainPage()
{
this.InitializeComponent();
instance = this;
//将应用界面扩展至 Titlebar 区域
CoreApplication.GetCurrentView().TitleBar.ExtendViewIntoTitleBar = true;
//修改标题栏颜色
var titleBar = Windows.UI.ViewManagement.ApplicationView.GetForCurrentView().TitleBar;
Windows.UI.Color color = new Windows.UI.Color();
color.R = 245;
color.G = 245;
color.B = 245;
//titleBar.BackgroundColor = color;
titleBar.ButtonBackgroundColor = color;
//自定义标题栏控件：
//可以将界面中任意控件指定为标题栏，指定后该控件将具有标题栏的行为特性，如拖动窗口、右键弹出窗口操作菜单等。
//Window.Current.SetTitleBar(grid);
//CoreApplication.MainView.CoreWindow.Dispatcher.RunAsync(
//CoreDispatcherPriority.High,
//new DispatchedHandler(() =>
//{
// btnUserImage.Source = LoginPage.instance.userImageSource;
// btnSessionList.Focus(FocusState.Pointer);
//}));
textBoxInput.SendClick += TextBoxInput_SendClick;
}
/// <summary>
/// This method returns a Border representing the shadow of the box
/// </summary>
/// <param name="shadowColour">Colour of the shadow</param>
/// <param name="cornerRadius">Corner radius of the box</param>
/// <param name="boxBorderThickness">Thickness of the box border</param>
/// <param name="xDeltaPosition">X Translation of the shadow from the box</param>
/// <param name="yDeltaPosition">Y Translation of the shadow from the box</param>
/// <param name="boxColourAlpha">Alpha (opacity) of the box colour</param>
/// <param name="boxBorderAlpha">Alpha (opacity) of the box border colour</param>
/// <returns>Border</returns>
private Border CreateShadow(XFColor shadowColour, CornerRadius cornerRadius, double boxBorderThickness,
double xDeltaPosition, double yDeltaPosition, double boxColourAlpha, double boxBorderAlpha)
{
// Create a rectangle representing the shadow
//Adjust the shadow color to account for any transparency in the box.
XFColor clr = new XFColor(shadowColour.R, shadowColour.G, shadowColour.B, shadowColour.A * boxColourAlpha);
XFColor borderClr = new XFColor(shadowColour.R, shadowColour.G, shadowColour.B, shadowColour.A * boxBorderAlpha);
UWPColor shdwColour = UWPColor.FromArgb((byte)(255 * (clr.A < 0f ? 0 : clr.A)),
(byte)(255 * (clr.R < 0f ? 0 : clr.R)),
(byte)(255 * (clr.G < 0f ? 0 : clr.G)),
(byte)(255 * (clr.B < 0f ? 0 : clr.B)));
UWPColor shadowBorderColour = UWPColor.FromArgb((byte)(255 * (borderClr.A < 0f ? 0 : borderClr.A)),
(byte)(255 * (borderClr.R < 0f ? 0 : borderClr.R)),
(byte)(255 * (borderClr.G < 0f ? 0 : borderClr.G)),
(byte)(255 * (borderClr.B < 0f ? 0 : borderClr.B)));
return(new Border
{
Background = new SolidColorBrush(shdwColour),
BorderBrush = new SolidColorBrush(shadowBorderColour),
BorderThickness = new UWPThickness(boxBorderThickness),
CornerRadius = CornerRadiusConverter.Convert(cornerRadius),
RenderTransform = new CompositeTransform {
TranslateX = xDeltaPosition, TranslateY = yDeltaPosition
}
});
}
public static void EnableBGImage()
{
//#80161616 = 128,22,22,22
//#64161616 = 100,22,22,22
//((SolidColorBrush)App.Current.Resources["UserListFontColor"]).Color = Windows.UI.Colors.White;
string path = ApplicationSettingsHelper.ReadSettingsValue(AppConstants.BackgroundImagePath) as string;
if (path != null && path != "")
{
((ImageBrush)App.Current.Resources["BgImage"]).ImageSource = new BitmapImage(new Uri(path, UriKind.RelativeOrAbsolute));
Windows.UI.Color color = Windows.UI.Color.FromArgb(128, 22, 22, 22);
((SolidColorBrush)App.Current.Resources["TransparentBGImageColor"]).Color = color;
color = Windows.UI.Color.FromArgb(100, 22, 22, 22);
((SolidColorBrush)App.Current.Resources["TransparentMainPageBGImageColor"]).Color = color;
}
else
{
}
if (App.Current.RequestedTheme == ApplicationTheme.Light)
{
App.Current.Resources["UserListFontColor"] = new SolidColorBrush(Windows.UI.Colors.White);
}
ChangeAlbumViewTransparency();
}
void UpdateBrushColor(string resourceKey, Windows.UI.Color color)
{
if (Resources[resourceKey] is Windows.UI.Xaml.Media.SolidColorBrush sb)
{
sb.Color = color;
}
}
/// <summary>
/// Creates a circular solid colored brush that we can apply to a visual
/// </summary>
private CompositionEffectBrush CreateCircleBrushWithColor(Windows.UI.Color color)
{
var colorBrush = _compositor.CreateColorBrush(color);
//
// Because Windows.UI.Composition does not have a Circle visual, we will
// work around by using a circular opacity mask
// Create a simple Composite Effect, using DestinationIn (S * DA),
// with a color source and a named parameter source.
//
var effect = new CompositeEffect
{
Mode = CanvasComposite.DestinationIn,
Sources =
{
new ColorSourceEffect()
{
Color = color
},
new CompositionEffectSourceParameter("mask")
}
};
var factory = _compositor.CreateEffectFactory(effect);
var brush = factory.CreateBrush();
//
// Create the mask brush using the circle mask
//
CompositionSurfaceBrush maskBrush = _compositor.CreateSurfaceBrush();
maskBrush.Surface = _circleMaskSurface.Surface;
brush.SetSourceParameter("mask", maskBrush);
return(brush);
}
private void OnTinct(object sender, RoutedEventArgs e)
{
MenuFlyoutItem item = sender as MenuFlyoutItem;
string tinct = item.Tag as string;
Windows.UI.Color color = new Windows.UI.Color();
switch (tinct)
{
case "黑色":
color = Windows.UI.Colors.Black;
break;
case "蓝色":
color = Windows.UI.Colors.Blue;
break;
case "白色":
color = Windows.UI.Colors.White;
break;
default:
break;
}
redit.Document.Selection.CharacterFormat.BackgroundColor = color;
}
void createChatsView(int howMany)
{
for (int i = 0; i < howMany; i++)
{
ListBoxItem newItem = new ListBoxItem();
newItem.Content = "aaaaa";
newItem.Name = "item" + i;
// newItem.PointerPressed += rectan1.Command;
Windows.UI.Xaml.Media.SolidColorBrush colorForChat = new Windows.UI.Xaml.Media.SolidColorBrush();
Windows.UI.Color actualColors = new Windows.UI.Color();
if (i == 0)
{
actualColors.R = 125;
actualColors.G = 255;
actualColors.B = 0;
}
else
{
actualColors.R = 125;
actualColors.G = 0;
actualColors.B = 255;
}
actualColors.A = 255;
colorForChat.Color = actualColors;
newItem.Background = colorForChat;
newItem.AddHandler(PointerReleasedEvent, new PointerEventHandler(toolStripClick), true);
chatList.Items.Add(newItem);
Debug.WriteLine(newItem.Background);
}
// ((ListBox)chatList).Items
}
public object Convert(object value, Type targetType, object parameter, string language)
{
Windows.UI.Color rgb = new Windows.UI.Color();
Windows.UI.Color[] colorScheme = new Windows.UI.Color[5];
colorScheme[0] = new Windows.UI.Color();
for(int i = 0; i < colorScheme.Length; i++){
colorScheme[i] = new Windows.UI.Color();
colorScheme[i].A = 200;
}
colorScheme[0].R = 0;
colorScheme[0].G = 75;
colorScheme[0].B = 139;
colorScheme[1].R = 3;
colorScheme[1].G = 159;
colorScheme[1].B = 223;
colorScheme[2].R = 1;
colorScheme[2].G = 91;
colorScheme[2].B = 118;
colorScheme[3].R = 129;
colorScheme[3].G = 168;
colorScheme[3].B = 9;
colorScheme[4].R = 169;
colorScheme[4].G = 218;
colorScheme[4].B = 16;
return new SolidColorBrush(colorScheme[value.GetHashCode() % 5]);
}
private void CreateBars(int[] genArray)
{
int[] array = genArray;
double maxWidth = Canvas.Width;
double maxHeight = Canvas.Height;
double barWidth = maxWidth / array.Length;
double heightIncrement = maxHeight / array.Length;
for (int i = 0; i < array.Length; i++)
{
double barHeight = (array[i] * heightIncrement);
var bar = new Rectangle();
Windows.UI.Color barColor = new Windows.UI.Color();
barColor.R = Convert.ToByte((barHeight / maxHeight) * 255);
barColor.B = Convert.ToByte(((maxHeight - barHeight) / maxHeight) * 255);
barColor.A = 255;
Canvas.Children.Add(bar);
bar.Name = "Bar" + i;
bar.Fill = new SolidColorBrush(barColor);
bar.Stroke = new SolidColorBrush(barColor);
bar.Margin = new Thickness(i * barWidth, maxHeight - barHeight, 0, 0);
bar.Width = barWidth;
bar.Height = barHeight;
}
}
public void SetAppColors(Windows.UI.Color bg, Windows.UI.Color fg)
{
foreach (var(item, value) in AppColors)
{
value.SetAppColors(bg, fg);
}
}
private void DisablePomodoroTask()
{
done = true;
Windows.UI.Color color = new Windows.UI.Color();
color.A = 0;
rootBackgroundEnabled = root.Background;
root.Background = new SolidColorBrush(color);
root.BorderThickness = new Thickness(1);
Windows.UI.Color borderColor = new Windows.UI.Color();
borderColor.A = Color.White.A;
borderColor.R = Color.White.R;
borderColor.G = Color.White.G;
borderColor.B = Color.White.B;
root.BorderBrush = new SolidColorBrush(borderColor);
TimerValueBar.Visibility = Visibility.Collapsed;
pomDotForegroundEnabled = PomOne.Foreground;
PomOne.Foreground = new SolidColorBrush(borderColor);
PomTwo.Foreground = new SolidColorBrush(borderColor);
PomThree.Foreground = new SolidColorBrush(borderColor);
PomFour.Foreground = new SolidColorBrush(borderColor);
DiscriptionTextForegroundEnabled = DiscriptionBlock.Foreground;
DiscriptionBlock.Foreground = new SolidColorBrush(borderColor);
}
private async void ThemeSettingsService_OnAccentColorChanged(object sender, Windows.UI.Color e)
{
await Dispatcher.RunAsync(CoreDispatcherPriority.Normal, () =>
{
SetSelectionHighlightColor();
});
}
async Task CreateTintEffectBrushAsync(Uri uri)
{
Xamarin.Forms.Image element = this.Element as Xamarin.Forms.Image;
if (Control == null || Element == null || element.Width < 0 || element.Height < 0)
{
return;
}
SetupCompositor();
spriteVisual = compositor.CreateSpriteVisual();
spriteVisual.Size = new Vector2((float)element.Width, (float)element.Height);
imageSurface = await generator.CreateImageSurfaceAsync(uri, new Windows.Foundation.Size(element.Width, element.Height), ImageSurfaceOptions.DefaultOptimized);
CompositionSurfaceBrush surfaceBrush = compositor.CreateSurfaceBrush(imageSurface.Surface);
CompositionBrush targetBrush = surfaceBrush;
if (this.TintColor == Color.Transparent)
{
// Don't apply tint effect
effectBrush = null;
}
else
{
// Set target brush to tint effect brush
Windows.UI.Color nativeColor = GetNativeColor(this.TintColor);
IGraphicsEffect graphicsEffect = new CompositeEffect
{
Mode = CanvasComposite.DestinationIn,
Sources =
{
new ColorSourceEffect
{
Name = "colorSource",
Color = nativeColor
},
new CompositionEffectSourceParameter("mask")
}
};
CompositionEffectFactory effectFactory = compositor.CreateEffectFactory(graphicsEffect,
new[] { "colorSource.Color" });
effectBrush = effectFactory.CreateBrush();
effectBrush.SetSourceParameter("mask", surfaceBrush);
SetTint(nativeColor);
targetBrush = effectBrush;
}
spriteVisual.Brush = targetBrush;
ElementCompositionPreview.SetElementChildVisual(Control, spriteVisual);
}
public SolidColorBrush ColorConverter(string hex)
{
var r = (byte)System.Convert.ToUInt32(hex.Substring(0, 2), 16);
var g = (byte)System.Convert.ToUInt32(hex.Substring(2, 2), 16);
var b = (byte)System.Convert.ToUInt32(hex.Substring(4, 2), 16);
return(new SolidColorBrush(Color.FromArgb(255, r, g, b)));
}
/// <summary>
/// Invert color
/// </summary>
/// <param name="defaultColor">Color to inversion</param>
/// <returns>Inverted color</returns>
public static Windows.UI.Color InvertColor(Windows.UI.Color defaultColor)
{
return(Windows.UI.Color.FromArgb(
defaultColor.A,
(byte)(255 - defaultColor.R),
(byte)(255 - defaultColor.G),
(byte)(255 - defaultColor.B)));
}
public static UWPColor ToColor(this Color target)
{
return(UWPColor.FromArgb(
(byte)(255 * target.A),
(byte)(255 * target.R),
(byte)(255 * target.G),
(byte)(255 * target.B)));
}
public static NativeColor ToWindows(this Color color)
{
return(NativeColor.FromArgb(
(byte)(color.A * 255),
(byte)(color.R * 255),
(byte)(color.G * 255),
(byte)(color.B * 255)));
}
//Function used in toggeling the Export button.
public void ResetExportButton()
{
Window.Current.CoreWindow.PointerCursor = new CoreCursor(CoreCursorType.Arrow, 0);
var color = new Windows.UI.Color();
color.A = 255;
color.R = 236;
color.B = 236;
color.G = 236;
Eksporter.Background = new SolidColorBrush(color);
}
public object Convert(object value, Type targetType, object parameter, string language)
{
String color = (String)value;
Windows.UI.Color rgb = new Windows.UI.Color();
rgb.R = byte.Parse(color.Substring(0, 2), System.Globalization.NumberStyles.HexNumber);
rgb.G = byte.Parse(color.Substring(2, 2), System.Globalization.NumberStyles.HexNumber);
rgb.B = byte.Parse(color.Substring(4, 2), System.Globalization.NumberStyles.HexNumber);
rgb.A = 255;
return new SolidColorBrush(rgb);
}
private void Export_Click(object sender, RoutedEventArgs e)
{
if (MainPage.mainPage.clickedExport)
{
ResetExportButton();
MainPage.mainPage.clickedExport = false;
}
else
{
Window.Current.CoreWindow.PointerCursor = new CoreCursor(CoreCursorType.Hand, 1);
var color = new Windows.UI.Color();
color.R = 160;
color.B = 160;
color.G = 160;
color.A = 255;
Eksporter.Background = new SolidColorBrush(color);
MainPage.mainPage.clickedExport = true;
}
}
private void OnSelectedColorChanged(object sender, EventArgs e)
{
vinegetteColor = Windows.UI.Color.FromArgb(0xff, PickerButton.SelectedColor.R, PickerButton.SelectedColor.G, PickerButton.SelectedColor.B);
UpdatePreviewAsync();
}
private void ContentDialog_PrimaryButtonClick( ContentDialog sender, ContentDialogButtonClickEventArgs args )
{
Canceled = false;
UserChoice = SectionData.CColor.TColor;
}
private void EditBilde_Click(object sender, RoutedEventArgs e)
{
if ((string)EditBilde.Tag == "1")
{
ResetEditButton();
}
else
{
Window.Current.CoreWindow.PointerCursor = new CoreCursor(CoreCursorType.Hand, 1);
EditBilde.Tag = "1";
var color = new Windows.UI.Color();
color.R = 160;
color.B = 160;
color.G = 160;
color.A = 255;
EditBilde.Background = new SolidColorBrush(color);
}
}
/// <summary>
/// Creates an XColor structure from the specified Windows.UI.Color.
/// </summary>
public static XColor FromArgb(UwpColor color)
{
return new XColor(color);
}
public void SetColor(Color c)
{
lastColor = NativeColor.FromArgb ((byte)c.Alpha, (byte)c.Red, (byte)c.Green, (byte)c.Blue);
}
XColor(UwpColor color)
: this(color.A, color.R, color.G, color.B)
{ }
/// <summary>
/// Creates an XColor structure from the specified alpha value and color.
/// </summary>
public static XColor FromArgb(int alpha, UwpColor color)
{
// Cast required to use correct constructor.
return new XColor((byte)alpha, color.R, color.G, color.B);
}
