static void InitStyle(ShapeStyle ss, Windows.UI.Color clr, bool dark)
{
SolidColorBrush fill = ss.Fill as SolidColorBrush;
if (fill == null)
{
try
{
ss.FillAuto = ss.Fill = new SolidColorBrush(clr);
}
catch { }
}
else
{
fill.Color = clr;
}
fill = ss.Stroke as SolidColorBrush;
Windows.UI.Color color = dark ? ColorPalette.Darken(clr) : clr;
if (fill == null)
{
ss.StrokeAuto = ss.Stroke = new SolidColorBrush(color);
}
else
{
fill.Color = color;
}
}
/// <summary>
/// Creates a circular solid colored brush that we can apply to a visual
/// </summary>
private CompositionEffectBrush CreateCircleBrushWithColor(Windows.UI.Color color)
{
var colorBrush = _compositor.CreateColorBrush(color);
//
// Because Windows.UI.Composition does not have a Circle visual, we will
// work around by using a circular opacity mask
// Create a simple Composite Effect, using DestinationIn (S * DA),
// with a color source and a named parameter source.
//
var effect = new CompositeEffect
{
Mode = CanvasComposite.DestinationIn,
Sources =
{
new ColorSourceEffect()
{
Color = color
},
new CompositionEffectSourceParameter("mask")
}
};
var factory = _compositor.CreateEffectFactory(effect);
var brush = factory.CreateBrush();
//
// Create the mask brush using the circle mask
//
CompositionSurfaceBrush maskBrush = _compositor.CreateSurfaceBrush();
maskBrush.Surface = _circleMaskSurface.Surface;
brush.SetSourceParameter("mask", maskBrush);
return(brush);
}
public ShapeStyle Next(bool dark)
{
ShapeStyle style2;
ShapeStyle ss = new ShapeStyle();
if ((CustomBrushes != null) && (_colorGen == Dt.Charts.Palette.Default))
{
InitStyle(ss, GetCustomBrush(_list.Count), dark);
}
else
{
Dt.Charts.Palette colorGenTheme = (_colorGen == Dt.Charts.Palette.Default) ? Dt.Charts.Palette.Apex : _colorGen;
Windows.UI.Color clr = ColorPalette.GetOfficePalette(colorGenTheme).GetColor(_list.Count);
InitStyle(ss, clr, dark);
}
ss.DarkOutline = dark;
ss.StrokeThickness = 2.0;
_list.Add(ss);
style2 = new ShapeStyle {
FillAuto = ss.FillAuto,
Fill = ss.FillAuto,
StrokeAuto = ss.StrokeAuto,
Stroke = ss.StrokeAuto,
StrokeThickness = 2.0
};
_list2.Add(style2);
return(ss);
}
void SetColors(Dt.Charts.Palette cg)
{
int num = _list.Count;
if (cg == Dt.Charts.Palette.Default)
{
if (CustomBrushes != null)
{
for (int j = 0; j < num; j++)
{
Brush customBrush = GetCustomBrush(j);
InitStyle(_list[j], customBrush, _list[j].DarkOutline);
SyncStyle(j);
}
return;
}
cg = Dt.Charts.Palette.Apex;
}
for (int i = 0; i < num; i++)
{
Windows.UI.Color clr = ColorPalette.GetOfficePalette(cg).GetColor(i);
InitStyle(_list[i], clr, _list[i].DarkOutline);
SyncStyle(i);
}
}
private void UpdateGrid()
{
if (myMapView.Grid != null && myMapView.Grid.LevelCount > 0)
{
//Get proper color
Windows.UI.Color defaultColor = new Windows.UI.Color();
System.Drawing.Color convertedDefaultColor = new System.Drawing.Color();
if (Application.Current.Resources[resourceNameGridColor] != null)
{
defaultColor = (Color)Application.Current.Resources[resourceNameGridColor];
convertedDefaultColor = System.Drawing.Color.FromArgb(defaultColor.A, defaultColor.R, defaultColor.G, defaultColor.B);
}
//Create line symbol for grid
SimpleLineSymbol lineSym = new SimpleLineSymbol();
lineSym.Color = convertedDefaultColor;
lineSym.Style = SimpleLineSymbolStyle.Solid;
lineSym.Width = 1;
//Update for each level of grid
for (int levels = 0; levels < myMapView.Grid.LevelCount; levels++)
{
TextSymbol currentSymbol = (TextSymbol)myMapView.Grid.GetTextSymbol(levels);
currentSymbol.Color = convertedDefaultColor;
myMapView.Grid.SetTextSymbol(levels, (Esri.ArcGISRuntime.Symbology.Symbol)currentSymbol);
myMapView.Grid.SetLineSymbol(levels, (Esri.ArcGISRuntime.Symbology.Symbol)lineSym);
}
}
}
/// <summary>
/// Will set the background grid of the map view
/// NOTE: Since we can't add this code inside XAML, thanks to ESRI sdk, we need to force it here.
/// </summary>
public void SetBackgroundGrid()
{
if (myMapView.BackgroundGrid.GridLineWidth != 0)
{
Services.SettingsServices.SettingsService _settings = Services.SettingsServices.SettingsService.Instance;
CustomResource customColors = new CustomResource();
customColors.InitializeComponent();
if (customColors.ContainsKey("MapViewBackgroundGridLightColor"))
{
var appT = _settings.AppTheme;
if (_settings.AppTheme == ApplicationTheme.Light)
{
Windows.UI.Color lightDefault = (Windows.UI.Color)customColors["MapViewBackgroundGridLightColor"];
myMapView.BackgroundGrid.Color = System.Drawing.Color.FromArgb(lightDefault.A, lightDefault.R, lightDefault.G, lightDefault.B);
//myMapView.BackgroundGrid.GridLineColor = (Windows.UI.Color)customColors["MapViewBackgroundGridDarkColor"];
//myMapView.BackgroundGrid.GridLineWidth = 5;
}
else
{
Windows.UI.Color darkDefault = (Windows.UI.Color)customColors["MapViewBackgroundGridDarkColor"];
myMapView.BackgroundGrid.Color = System.Drawing.Color.FromArgb(darkDefault.A, darkDefault.R, darkDefault.G, darkDefault.B);
//myMapView.BackgroundGrid.GridLineColor = (Windows.UI.Color)customColors["MapViewBackgroundGridLightColor"];
//myMapView.BackgroundGrid.GridLineWidth = 5;
}
}
myMapView.BackgroundGrid.GridLineWidth = 0;
myMapView.UpdateLayout();
}
}
internal static Brush GetRichTextFill(List <TextParagraph> richText, Workbook workbook)
{
TextRun firstRun = GetFirstRun(richText);
TextParagraph firstParagraph = GetFirstParagraph(richText);
Brush brush = null;
IFillFormat fillFormat = null;
if (firstRun != null)
{
fillFormat = firstRun.FillFormat;
}
if ((fillFormat == null) && (firstParagraph != null))
{
fillFormat = firstParagraph.FillFormat;
}
if (fillFormat != null)
{
object fill = ExcelChartExtension.GetFill(fillFormat, workbook);
SpreadDrawingColorSettings spreadDrawingColorSettings = ExcelChartExtension.GetSpreadDrawingColorSettings(fillFormat);
if (fill is string)
{
if (workbook != null)
{
Windows.UI.Color color = Dt.Cells.Data.ColorHelper.UpdateColor(workbook.GetThemeColor((string)(fill as string)), spreadDrawingColorSettings, false);
return(new SolidColorBrush(color));
}
return(brush);
}
if (fill is Brush)
{
brush = fill as Brush;
}
}
return(brush);
}
/// <summary>
/// Converts a <see cref="Color"/> to a premultiplied Int32 - 4 byte ARGB structure.
/// </summary>
/// <param name="color">The color to convert.</param>
/// <returns>The int representation of the color.</returns>
public static int ToInt(this Color color)
{
var a = color.A + 1;
var col = (color.A << 24) | ((byte)((color.R * a) >> 8) << 16) | ((byte)((color.G * a) >> 8) << 8) | (byte)((color.B * a) >> 8);
return(col);
}
public static IColorSequence Dipolar(Color negativeColor, Color positiveColor, int halfStepCount)
{
return new Ir1ColorSequence(
new ColorSequenceImpl(positiveColor.LessFadingSpread(halfStepCount)),
new ColorSequenceImpl(negativeColor.LessFadingSpread(halfStepCount))
);
}
/// <summary>
/// Returns a drawing object based on a specified parameter.
/// </summary>
/// <param name="evaluator">The evaluator.</param>
/// <param name="baseRow">The base row.</param>
/// <param name="baseColumn">The base column.</param>
/// <param name="actual">The current value.</param>
/// <returns>The data bar object.</returns>
public override object Evaluate(ICalcEvaluator evaluator, int baseRow, int baseColumn, IActualValue actual)
{
this.lastActualValue = actual;
object val = actual.GetValue(baseRow, baseColumn);
if (val != null)
{
double?nullable = ConditionValueConverter.TryDouble(val);
if (!nullable.HasValue)
{
return(null);
}
double currentValue = nullable.Value;
double?nullable2 = this.CalcuteMinValue(evaluator, baseRow, baseColumn, 0, actual);
double?nullable3 = this.CalcuteMaxValue(evaluator, baseRow, baseColumn, 2, actual);
if (nullable2.HasValue && nullable3.HasValue)
{
double?nullable5 = nullable2;
double?nullable6 = nullable3;
if ((((double)nullable5.GetValueOrDefault()) > ((double)nullable6.GetValueOrDefault())) && (nullable5.HasValue & nullable6.HasValue))
{
double?nullable4 = nullable3;
nullable3 = nullable2;
nullable2 = nullable4;
}
double axisScale = -1.0;
double scale = this.EvaluateScale(currentValue, nullable2.Value, nullable3.Value, out axisScale);
Windows.UI.Color fillColor = ((currentValue < 0.0) && this.useNegativeFillColor) ? this.negativeFillColor : this.color;
return(new DataBarDrawingObject(baseRow, baseColumn, fillColor, ((currentValue < 0.0) && this.useNegativeBorderColor) ? this.negativeBorderColor : this.borderColor, this.showBorder, this.axisColor, this.gradient, this.direction, axisScale, scale, this.showBarOnly));
}
}
return(null);
}
public static Color GetApplicationColor(ColoringBookColors Color)
{
Color color = new Windows.UI.Color();
switch (Color)
{
case ColoringBookColors.Red:
color = GetApplicationColor(RED);
break;
case ColoringBookColors.Blue:
color = GetApplicationColor(BLUE);
break;
case ColoringBookColors.Teal:
color = GetApplicationColor(TEAL);
break;
case ColoringBookColors.Orange:
color = GetApplicationColor(ORANGE);
break;
case ColoringBookColors.Purple:
color = GetApplicationColor(PURPLE);
break;
default:
break;
}
return(color);
}
/// <summary>
/// Constructor. Creates rendering brush; initializes graphics
/// </summary>
/// <param name="swapChainPanel">SwapChainPanel on which to render captured ink</param>
/// <param name="brushType">Type of brush to use</param>
/// <param name="thickness">Relative thickness of brush</param>
/// <param name="color">Color of ink</param>
/// <param name="style">Shape of brush (VectorBrush only)</param>
public Renderer(SwapChainPanel swapChainPanel, VectorBrushStyle style, MediaColor color)
{
StrokeHandler = new VectorStrokeHandler(this, style, color);
mSwapChainPanel = swapChainPanel;
Graphics.GraphicsReady += OnGraphicsReady;
Graphics.Initialize(mSwapChainPanel, false);
}
public void SetColor(SolidColorBrush brush, Windows.UI.Color color)
{
if (color != _cachedColor)
{
_cachedColor = color;
_line.Stroke = brush;
}
}
public static Windows.UI.Color GetContrastingColor(this Windows.UI.Color color)
{
var nThreshold = 105;
int bgLuminance = Convert.ToInt32(color.R * 0.2 + color.G * 0.7 + color.B * 0.1);
Windows.UI.Color contrastingColor = 255 - bgLuminance < nThreshold ? Colors.Black : Colors.White;
return(contrastingColor);
}
public static Windows.UI.Color Darken(Windows.UI.Color clr)
{
float hue = GetHue(clr);
float saturation = GetSaturation(clr);
float num3 = GetBrightness(clr) * 0.5f;
return(ColorFromHSL((double)hue, (double)saturation, (double)num3));
}
public void Start(Windows.UI.Color color, Rect initialBounds, Rect finalBounds)
{
var colorVisual = CreateVisualWithColorAndPosition(color, initialBounds, finalBounds);
_containerForVisuals.Children.InsertAtTop(colorVisual);
TriggerBloomAnimation(colorVisual);
}
/// <summary>
/// Creates a border line with a specified color and style.
/// </summary>
/// <param name="color">The border color.</param>
/// <param name="styleType">The border style type.</param>
public BorderLine(Windows.UI.Color color, BorderLineStyle styleType)
{
this._context = null;
this._themeColor = null;
this._color = color;
this._style = styleType;
this._builtIn = false;
}
/// <summary>
/// Caution, only use for built-in borders creating.
/// </summary>
internal BorderLine(Windows.UI.Color color, BorderLineData style)
{
this._context = null;
this._style = BorderLineStyle.None;
this._color = color;
this._styleData = style;
this._builtIn = true;
}
public static void ChangeTitlebarButtonColor(Color backGround,Color foreGround)
{
var view = ApplicationView.GetForCurrentView();
var otherB = backGround;
var otherF = foreGround;
view.TitleBar.ButtonBackgroundColor = backGround;
view.TitleBar.ButtonForegroundColor = foreGround;
}
public static Windows.UI.Color GetIdealForegroundForBackgroundColor(this Windows.UI.Color backgroundColor)
{
var nThreshold = 105;
int bgLuminance = Convert.ToInt32(backgroundColor.R * 0.2 + backgroundColor.G * 0.7 + backgroundColor.B * 0.1);
Windows.UI.Color foregroundColor = 255 - bgLuminance < nThreshold ? Colors.Black : Colors.White;
return(foregroundColor);
}
public InkingPreference()
{
penSize = 1;
highlighterSize = 10;
penColor = Colors.Red;
highlighterColor = Colors.Yellow;
drawingDevice = CoreInputDeviceTypes.Mouse | CoreInputDeviceTypes.Pen;
this.version = CURRENT_INKING_PREF_VERSION;
}
private CompositionMaskBrush CreateMaskBrush(int width, int height, Windows.UI.Color rateColor)
{
var _maskBrush = compositor.CreateMaskBrush();
LoadedImageSurface loadedSurface = LoadedImageSurface.StartLoadFromUri(new Uri("ms-appx:///Assets/CircleMask.png"), new Windows.Foundation.Size(width, height));
_maskBrush.Source = compositor.CreateColorBrush(rateColor);
_maskBrush.Mask = compositor.CreateSurfaceBrush(loadedSurface);
return(_maskBrush);
}
public void SetLEDColor(int index, String cssColor)
{
byte r = byte.Parse(cssColor.Substring(1, 2), NumberStyles.HexNumber);
byte g = byte.Parse(cssColor.Substring(3, 2), NumberStyles.HexNumber);
byte b = byte.Parse(cssColor.Substring(5, 2), NumberStyles.HexNumber);
Windows.UI.Color color = Color.FromArgb(0, r, g, b);
SetLEDColor(index, color);
}
public Block(float x1, float y1, Windows.UI.Color color1, int height1, int width1)
{
x = x1;
y = y1;
color = color1;
height = height1;
width = width1;
rect = new Rectangle((int)x1 - 20, (int)y1 - 20, height1 + 40, width1 + 40);
}
/// <summary>
/// Creates a <see cref="Color"/> from the specified hue, saturation, value, and alpha values.
/// </summary>
/// <param name="hue">0..360 range hue</param>
/// <param name="saturation">0..1 range saturation</param>
/// <param name="value">0..1 range value</param>
/// <param name="alpha">0..1 alpha</param>
/// <returns>The created <see cref="Color"/>.</returns>
public static Color FromHsv(double hue, double saturation, double value, double alpha = 1.0)
{
if (hue < 0 || hue > 360)
{
throw new ArgumentOutOfRangeException(nameof(hue));
}
double chroma = value * saturation;
double h1 = hue / 60;
double x = chroma * (1 - Math.Abs((h1 % 2) - 1));
double m = value - chroma;
double r1, g1, b1;
if (h1 < 1)
{
r1 = chroma;
g1 = x;
b1 = 0;
}
else if (h1 < 2)
{
r1 = x;
g1 = chroma;
b1 = 0;
}
else if (h1 < 3)
{
r1 = 0;
g1 = chroma;
b1 = x;
}
else if (h1 < 4)
{
r1 = 0;
g1 = x;
b1 = chroma;
}
else if (h1 < 5)
{
r1 = x;
g1 = 0;
b1 = chroma;
}
else
{
r1 = chroma;
g1 = 0;
b1 = x;
}
byte r = (byte)(255 * (r1 + m));
byte g = (byte)(255 * (g1 + m));
byte b = (byte)(255 * (b1 + m));
byte a = (byte)(255 * alpha);
return(Color.FromArgb(a, r, g, b));
}
/// <summary>
/// Assigns the default values to core.
/// </summary>
/// <param name="core">The core.</param>
protected override void AssignDefaultValuesToSceneNode(SceneNode core)
{
material.Width = (float)Size.Width;
material.Height = (float)Size.Height;
material.Figure = Figure;
material.FigureRatio = (float)FigureRatio;
material.PointColor = Color.ToColor4();
material.FixedSize = FixedSize;
base.AssignDefaultValuesToSceneNode(core);
}
public static Block GenerateBlock(Windows.UI.Color color)
{
Random random = new Random();
int x = random.Next(700);
int y = random.Next(700);
Block block = new Block(x, y, color, 60, 60);
return(block);
}
public static Color AsColor(ColorARGB colorArgb)
{
Color color = new Color();
color.A = colorArgb.A;
color.R = colorArgb.R;
color.G = colorArgb.G;
color.B = colorArgb.B;
return color;
}
/// <summary>
/// Starts the color bloom transition using the specified color and boundary sizes.
///
/// The bloom is achieved by creating a circular solid colored visual whose scale is progressively
/// animated to fully flood a given area.
///
/// <param name="color">Using the specified color</param>
/// <param name="initialBounds">The transition begins with a visual with these bounds and position</param>
/// <param name="finalBounds">The transition ends when the visual has "bloomed" to an area of this bounding size</param>
/// </summary>
public void Start(Windows.UI.Color color, Rect initialBounds, Rect finalBounds)
{
var colorVisual = CreateVisualWithColorAndPosition(color, initialBounds, finalBounds);
// add our solid colored circle visual to the live visual tree via the container
_containerForVisuals.Children.InsertAtTop(colorVisual);
// now that we have a visual, let's run the animation
TriggerBloomAnimation(colorVisual);
}
public Blob(Blob source)
{
id = source.id;
rect = source.rect;
cog = source.cog;
area = source.area;
fullness = source.fullness;
colorMean = source.colorMean;
colorStdDev = source.colorStdDev;
}
public override void StopSelectionMode()
{
if (IsSelecting)
{
mActiveTool = null;
BrushColor = mSavedColor;
mSelectTool = null;
mRenderer.InvokeRedrawAllStrokes();
}
}
//颜色选择器变化
private void ColorPicker_ColorChanged(Windows.UI.Color Color, SolidColorBrush Brush)
{
isSalf = true;
this.Color = Color.FromArgb(Color.A, Color.R, Color.G, Color.B); //改变颜色
ColorChanged?.Invoke(this.Color);
isSalf = false;
Border.Background = Brush;
}
public PathInfo(ICanvasResourceCreator rc, Windows.UI.Color color, System.Single strokeWidth, CanvasStrokeStyle strokeStyle) //Pen pen, bool fill, int shapeType)
{
Vector2 offset = new Vector2(0.0f, 0.0f);
_cpb = new CanvasPathBuilder(rc);
//_cpb.SetSegmentOptions(CanvasFigureSegmentOptions.ForceRoundLineJoin);
_color = color;
//_fill = fill;
//_type = shapeType;
}
public void FillEllipse(Vector2 center, float radiusX, float radiusY, Color color)
{
if (m_renderingType == TestSceneRenderingType.Default)
{
m_drawingSession.FillEllipse(center, radiusX, radiusY, color);
}
else
{
m_drawingSession.DrawEllipse(center, radiusX, radiusY, Colors.Black);
}
}
public void FillRectangle(Rect rect, Color color)
{
if (m_renderingType == TestSceneRenderingType.Default)
{
m_drawingSession.FillRectangle(rect, color);
}
else
{
m_drawingSession.DrawRectangle(rect, Colors.Black);
}
}
public void Clear(Color color)
{
if (m_renderingType == TestSceneRenderingType.Default)
{
m_drawingSession.Clear(color);
}
else
{
m_drawingSession.Clear(Colors.White);
}
}
public static ColorAnimation CreateColor(Color to, Duration duration, string targetProperty)
{
var animation = new ColorAnimation
{
To = to,
Duration = duration,
EnableDependentAnimation = true
};
Storyboard.SetTargetProperty(animation, targetProperty);
return animation;
}
public void DrawLine(Vector2 p1, Vector2 p2, Color color, float strokeWidth, CanvasStrokeStyle strokeStyle)
{
if (m_renderingType == TestSceneRenderingType.Default)
{
m_drawingSession.DrawLine(p1, p2, color, strokeWidth, strokeStyle);
}
else
{
m_drawingSession.DrawLine(p1, p2, Colors.Black);
}
}
public ImageMarkupPage()
{
this.InitializeComponent();
this._inkManager = new InkManager();
//#FF003f82
this._brushColor = Colors.Blue;
this.Loaded += DrawImageView_Loaded;
}
public Brush(int oldX, int oldY, int currentX, int currentY, Windows.UI.Color brushColor, int brushSize, WriteableBitmap bmp, BrushModifierPanel mod)
{
OldX = oldX;
OldY = oldY;
CurrentX = currentX;
CurrentY = currentY;
BrushColor = brushColor;
BrushSize = brushSize;
Bmp = bmp;
Mod = mod;
}
public static Color Lerp(this Color color, Color target, float amount)
{
float sr = color.R,
sg = color.G,
sb = color.B;
float er = target.R,
eg = target.G,
eb = target.B;
byte r = (byte)sr.Lerp(er, amount),
g = (byte)sg.Lerp(eg, amount),
b = (byte)sb.Lerp(eb, amount);
return Color.FromArgb(255, r, g, b);
}
/// <summary>
/// Outputs text with formating.
/// </summary>
/// <param name="target">The target <see cref="TextBlock"/>.</param>
/// <param name="toOutput">String to output.</param>
/// <param name="fontStyle">The font style.</param>
/// <param name="fontWeight">The font weight.</param>
/// <param name="fontColor">Color of the font.</param>
public static void OutputWithFormat(this TextBlock target, string toOutput,
FontStyle fontStyle = FontStyle.Normal,
FontWeight fontWeight = default(FontWeight),
Color fontColor = default(Color))
{
var formatted = new Run
{
Text = toOutput,
FontStyle = fontStyle,
FontWeight = fontWeight.Equals(default(FontWeight)) ? FontWeights.Normal : fontWeight,
Foreground = fontColor.Equals(default(Color)) ? new SolidColorBrush(Colors.Black) : new SolidColorBrush(fontColor)
};
target.Inlines.Add(formatted);
}
static int ToInt(Color color)
{
var col = 0;
if (color.A != 0)
{
var a = color.A + 1;
col = (color.A << 24)
| ((byte)((color.R * a) >> 8) << 16)
| ((byte)((color.G * a) >> 8) << 8)
| ((byte)((color.B * a) >> 8));
}
return col;
}
public static IColorSequence Quadrupolar(
Color color1,
Color color2,
Color color3,
Color color4,
int quarterStepCount)
{
return new ColorSequenceImpl
(
ColorEx.UniformSpread(color1, color2, quarterStepCount)
.Concat(ColorEx.UniformSpread(color2, color3, quarterStepCount))
.Concat(ColorEx.UniformSpread(color3, color4, quarterStepCount))
.Concat(ColorEx.UniformSpread(color4, color1, quarterStepCount))
);
}
public static MapPolygon DrawCircle(List<BasicGeoposition> points, Color fillColor, Color strokeColor, int strokeThickness = 2, byte alpha = 80)
{
fillColor.A = alpha;
strokeColor.A = alpha;
var circle = new MapPolygon
{
StrokeThickness = strokeThickness,
FillColor = fillColor,
StrokeColor = strokeColor,
Path = new Geopath(points)
};
return circle;
}
public static void SetThemeColor(Color color)
{
foreach (var brushKey in brushKeys)
{
if (Application.Current.Resources.ContainsKey(brushKey))
{
var solidColorBrush = Application.Current.Resources[brushKey] as SolidColorBrush;
if (solidColorBrush != null)
solidColorBrush.Color = color;
}
}
#if WINDOWS_PHONE_APP
var statusBar = StatusBar.GetForCurrentView();
statusBar.ForegroundColor = color;
#endif
}
static Color ChangeColorBrightness(Color color, float correctionFactor)
{
float red = (float)color.R;
float green = (float)color.G;
float blue = (float)color.B;
if (correctionFactor < 0)
{
correctionFactor = 1 + correctionFactor;
red *= correctionFactor;
green *= correctionFactor;
blue *= correctionFactor;
}
else
{
red = (255 - red) * correctionFactor + red;
green = (255 - green) * correctionFactor + green;
blue = (255 - blue) * correctionFactor + blue;
}
return Color.FromArgb(color.A, (byte)red, (byte)green, (byte)blue);
}
public override void DrawOrMove(ChartPoint previousDrawn, ChartPoint current, int index, ChartCore chart)
{
Canvas.SetTop(Rectangle, current.ChartLocation.Y);
Canvas.SetLeft(Rectangle, current.ChartLocation.X);
Rectangle.Width = Width;
Rectangle.Height = Height;
if (IsNew)
{
Rectangle.Fill = new SolidColorBrush(Colors.Transparent);
}
if (HoverShape != null)
{
HoverShape.Width = Width;
HoverShape.Height = Height;
Canvas.SetLeft(HoverShape, current.ChartLocation.X);
Canvas.SetTop(HoverShape, current.ChartLocation.Y);
}
if (DataLabel != null)
{
DataLabel.UpdateLayout();
Canvas.SetTop(DataLabel, current.ChartLocation.Y + (Height/2) - DataLabel.ActualHeight*.5);
Canvas.SetLeft(DataLabel, current.ChartLocation.X + (Width/2) - DataLabel.ActualWidth*.5);
}
var targetColor = new Color
{
A = ColorComponents.A,
R = ColorComponents.R,
G = ColorComponents.G,
B = ColorComponents.B
};
if (chart.View.DisableAnimations)
{
Rectangle.Fill = new SolidColorBrush(targetColor);
return;
}
var animSpeed = chart.View.AnimationsSpeed;
Rectangle.Fill.BeginColorAnimation(nameof(SolidColorBrush.Color), targetColor, animSpeed);
}
private Windows.UI.Xaml.UIElement CreateSymbol(string symbol, Color colour)
{
return new TextBlock
{
Text = symbol,
FontSize = 40,
Foreground = new Windows.UI.Xaml.Media.SolidColorBrush(colour),
HorizontalAlignment = Windows.UI.Xaml.HorizontalAlignment.Center,
VerticalAlignment = Windows.UI.Xaml.VerticalAlignment.Center
};
}
private void FireSelectedColorChangingEvent(Color selectedColor)
{
if (SelectedColorChanging != null)
{
SelectedColorEventArgs args = new SelectedColorEventArgs(selectedColor);
SelectedColorChanging(this, args);
}
}
private static WordRenderData CreateText(PageRenderData context, TextElement element, bool bold, bool italic,
double fontSize, double left, double top, Color? color)
{
return new WordRenderData
{
Text = element.Text,
Bold = bold,
Italic = italic,
FontSize = fontSize,
Left = left + context.OffsetX,
Top = top + context.OffsetY,
Color = color
};
}
private static Color darkerColor(Color oldColor)
{
Color newColor = new Color();
newColor.A = 255;
if (oldColor.R > 80) newColor.R = (byte)(oldColor.R - 32); else newColor.R = 0;
if (oldColor.G > 80) newColor.G = (byte)(oldColor.G - 32); else newColor.G = 0;
if (oldColor.B > 80) newColor.B = (byte)(oldColor.B - 32); else newColor.B = 0;
return newColor;
}
private Windows.UI.Xaml.UIElement CreateHighLightedSymbol(string symbol, Color colour)
{
return new Border
{
CornerRadius = new Windows.UI.Xaml.CornerRadius(40),
BorderThickness = new Windows.UI.Xaml.Thickness(1),
BorderBrush = new Windows.UI.Xaml.Media.SolidColorBrush(Colors.Red),
Background = new Windows.UI.Xaml.Media.SolidColorBrush(Color.FromArgb(255, 96, 96, 96)),
Padding = new Windows.UI.Xaml.Thickness(2, 5, 2, 2),
Width = 80,
Height = 80,
Child = CreateSymbol(symbol, colour)
};
}
/// <summary>
/// Occurs when the range value of one of the color sliders changes.
/// </summary>
/// <param name="sender">The object where the event handler is attached.</param>
/// <param name="e">The event data.</param>
private void ColorSlider_ValueChanged(object sender, RangeBaseValueChangedEventArgs e)
{
if (this.ignoreScreenColorListBoxSelectionChanging)
{
return;
}
var color = new Color()
{
R = (byte)this.RedSlider.Value,
G = (byte)this.GreenSlider.Value,
B = (byte)this.BlueSlider.Value,
A = 255,
};
ListBoxItem item = (ListBoxItem)this.ScreenColorListBox.SelectedItem;
((SolidColorBrush)item.BorderBrush).Color = color;
((SolidColorBrush)this.ColorPreviewRectangle.Fill).Color = color;
int screenColor = this.ScreenColorListBox.SelectedIndex - 4;
if (this.customTheme.ColorTable[(ScreenColor)screenColor] == color)
{
return;
}
this.customTheme.ColorTable[(ScreenColor)screenColor] = color;
TerminalPageForceRender(fontChanged: false);
}
public ColorRange(Color from, Color to)
{
this.From = from;
this.To = to;
}
public RichStringPart(string str, Color color)
{
String = str;
Color = color;
}
private RadialMenuButton CreateColorRadialMenuButtonWithSubMenu(Color sourceColor, double subMenuButtonCount)
{
var colorButton = CreateColorRadialMenuButton(sourceColor);
colorButton.Submenu = new RadialMenu();
for (var i = 0; i < subMenuButtonCount; i++)
{
var lightenFactor = (float) i/10;
colorButton.Submenu.AddButton(CreateColorRadialMenuButton(sourceColor.Lighten(lightenFactor)));
}
return colorButton;
}
public void SetPixel(int x, int y, Color color)
{
SetPixel(x, y, ToInt(color));
}
/// <summary>${core_RawTheme_constructor_None_D}</summary>
public RawTheme( )
{
this.Fill = new SolidColorBrush(new Color() { A = 0x40 , R = 0x42 , G = 0x72 , B = 0xd7 });
this.Stroke = new SolidColorBrush(new Color() { A = 0xff , R = 0x50 , G = 0x82 , B = 0xe5 });
this.StrokeThickness = 2;
this.Opacity = 1;
this.Size = 8;
this.Color = new SolidColorBrush(new Color() { A = 0xff , R = 0x42 , G = 0x72 , B = 0xd7 });
this.HoverVertexStyle = new PredefinedMarkerStyle()
{
Size = 12 ,
Symbol = PredefinedMarkerStyle.MarkerSymbol.Circle ,
//暂时找不到RadialGradientBrush的API，暂时设置为单一颜色
Color=new SolidColorBrush(Colors.Red)
//Color = new RadialGradientBrush()
//{
// GradientStops = new GradientStopCollection()
// {
// new GradientStop(){ Color=new Color(){ A=0xff,R=0xc2,G=0xc2,B=0xc2}, Offset=0.45},
// new GradientStop(){ Color=new Color(){ A=0xff,R=0x42,G=0x42,B=0x42}, Offset=0.703},
// new GradientStop(){ Color=new Color(){ A=0xff,R=0x8f,G=0x8e,B=0x8e}, Offset=0.687},
// new GradientStop(){ Color=new Color(){ A=0x00,R=0xff,G=0xff,B=0xff}, Offset=1},
// }
//}
};
this.SnapStyle = new PredefinedMarkerStyle()
{
Size = 12 ,
Symbol = PredefinedMarkerStyle.MarkerSymbol.Circle ,
//暂时找不到RadialGradientBrush的API，暂时设置为单一颜色
Color = new SolidColorBrush(Colors.Red)
//Color = new RadialGradientBrush()
// {
// GradientStops = new GradientStopCollection()
// {
// new GradientStop(){ Color=new Color(){ A=0xff,R=0x2f,G=0x61,B=0xb2}, Offset=1},
// new GradientStop(){ Color=new Color(){ A=0xff,R=0x70,G=0xce,B=0x71}, Offset=0.631},
// new GradientStop(){ Color=new Color(){ A=0xff,R=0xe5,G=0xe4,B=0xe4}, Offset=0.558},
// new GradientStop(){ Color=new Color(){ A=0xff,R=0x9c,G=0xb1,B=0xd3}, Offset=0.944},
// }
// }
};
this.HoverCenterStyle = new PredefinedMarkerStyle
{
Size = 12 ,
Symbol = PredefinedMarkerStyle.MarkerSymbol.Circle ,
//暂时找不到RadialGradientBrush的API，暂时设置为单一颜色
Color = new SolidColorBrush(Colors.Red)
//Color = new RadialGradientBrush()
//{
// GradientStops = new GradientStopCollection()
// {
// new GradientStop(){ Color=new Color(){ A=0xff,R=0xea,G=0xee,B=0xf0}, Offset=0},
// new GradientStop(){ Color=new Color(){ A=0xff,R=0xf4,G=0xf6,B=0xf0}, Offset=0.66},
// new GradientStop(){ Color=new Color(){ A=0xff,R=0x4c,G=0xd5,B=0xef}, Offset=0.45},
// new GradientStop(){ Color=new Color(){ A=0xff,R=0x64,G=0xc8,B=0xf0}, Offset=0.65},
// new GradientStop(){ Color=new Color(){ A=0xff,R=0xef,G=0xf5,B=0xea}, Offset=0.44},
// new GradientStop(){ Color=new Color(){ A=0xff,R=0x64,G=0xc8,B=0xf0}, Offset=1},
// new GradientStop(){ Color=new Color(){ A=0xff,R=0xf3,G=0xf3,B=0xf3}, Offset=0.89},
// new GradientStop(){ Color=new Color(){ A=0xff,R=0x64,G=0xc8,B=0xf0}, Offset=0.9},
// }
//}
};
FCGreen = new Color { A = 0xff , R = 0x99 , G = 0xcc , B = 0x66 };
FCOrange = new Color { A = 0xff , R = 0xd9 , G = 0x82 , B = 0x57 };
FCBlue = new Color { A = 0xff , R = 0x95 , G = 0xd1 , B = 0xe5 };
FCYollew = new Color { A = 0xff , R = 0xe5 , G = 0xe5 , B = 0x45 };
}
private void SetOption(string symbol, Color colour, bool cellFixed = false)
{
if (!isSet)
{
isSet = true;
Border border = new Border
{
Margin = margin,
Background = background,
Child = cellFixed ? CreateHighLightedSymbol(symbol, colour) : CreateSymbol(symbol, colour)
};
this.Children.Add(border);
Grid.SetColumnSpan(border, columns);
Grid.SetRowSpan(border, rows);
}
}
