/// <summary>
/// Draws content on a page using colors created from a calibrated ICC colorspace.
/// </summary>
/// <param name="page">The page to draw to.</param>
private static void DrawICCColorSpace(PDFPage page)
{
PDFRgbColor black = new PDFRgbColor(0, 0, 0);
PDFBrush blackBrush = new PDFBrush(black);
//PDF4NET v5: PDFFont font = new PDFFont(PDFFontFace.Helvetica, 16);
PDFStandardFont font = new PDFStandardFont(PDFStandardFontFace.Helvetica, 16);
//PDF4NET v5: page.Canvas.DrawText("ICC colorspace", font, null, blackBrush, 50, 50);
page.Canvas.DrawString("ICC colorspace", font, blackBrush, 50, 50);
// Read the ICC profile from disk.
FileStream fs = new FileStream("..\\..\\..\\..\\..\\SupportFiles\\rgb.icc", FileMode.Open, FileAccess.Read);
byte[] profileData = new byte[fs.Length];
fs.Read(profileData, 0, profileData.Length);
fs.Close();
//PDF4NET v5: PDFICCColorSpace iccCS = new PDFICCColorSpace();
PDFIccColorSpace iccCS = new PDFIccColorSpace();
iccCS.IccProfile = profileData;
//PDF4NET v5: PDFICCColor red = new PDFICCColor(iccCS);
PDFIccColor red = new PDFIccColor(iccCS);
red.ColorComponents = new double[] { 192, 0, 0 };
//PDF4NET v5: PDFICCColor blue = new PDFICCColor(iccCS);
PDFIccColor blue = new PDFIccColor(iccCS);
blue.ColorComponents = new double[] { 0, 0, 192 };
PDFBrush blueBrush = new PDFBrush(blue);
PDFPen redPen = new PDFPen(red, 5);
page.Canvas.DrawRoundRectangle(redPen, blueBrush, 50, 100, 400, 150, 20, 20);
}
private static PDFFixedDocument CreatePDFA1bDocument(Stream iccInput, Stream ttfInput)
{
iccInput.Position = 0;
ttfInput.Position = 0;
PDFFixedDocument document = new PDFFixedDocument();
// Setup the document by creating a PDF/A output intent, based on a RGB ICC profile,
// and document information and metadata
PDFIccColorSpace icc = new PDFIccColorSpace();
byte[] profilePayload = new byte[iccInput.Length];
iccInput.Read(profilePayload, 0, profilePayload.Length);
icc.IccProfile = profilePayload;
PDFOutputIntent oi = new PDFOutputIntent();
oi.Type = PDFOutputIntentType.PDFA1;
oi.Info = "sRGB IEC61966-2.1";
oi.OutputConditionIdentifier = "Custom";
oi.DestinationOutputProfile = icc;
document.OutputIntents = new PDFOutputIntentCollection();
document.OutputIntents.Add(oi);
document.DocumentInformation = new PDFDocumentInformation();
document.DocumentInformation.Author = "O2 Solutions";
document.DocumentInformation.Title = "PDF4NET PDF/A-1B Demo";
document.DocumentInformation.Creator = "PDF4NET PDF/A-1B Demo Application";
document.DocumentInformation.Producer = "PDF4NET";
document.DocumentInformation.Keywords = "pdf/a";
document.DocumentInformation.Subject = "PDF/A-1B Sample produced by PDF4NET";
document.XmpMetadata = new PDFXmpMetadata();
PDFPage page = document.Pages.Add();
page.Rotation = 90;
// All fonts must be embedded in a PDF/A document.
PDFStringAppearanceOptions sao = new PDFStringAppearanceOptions();
sao.Font = new PDFAnsiTrueTypeFont(ttfInput, 24, true);
sao.Brush = new PDFBrush(new PDFRgbColor(0, 0, 128));
PDFStringLayoutOptions slo = new PDFStringLayoutOptions();
slo.HorizontalAlign = PDFStringHorizontalAlign.Center;
slo.VerticalAlign = PDFStringVerticalAlign.Bottom;
slo.X = page.Width / 2;
slo.Y = page.Height / 2 - 10;
page.Canvas.DrawString("PDF4NET", sao, slo);
slo.Y = page.Height / 2 + 10;
slo.VerticalAlign = PDFStringVerticalAlign.Top;
sao.Font.Size = 16;
page.Canvas.DrawString("This is a sample PDF/A-1B document that shows the PDF/A-1B capabilities in PDF4NET library", sao, slo);
return(document);
}
private static PDFFixedDocument CreatePDFA2uDocument(Stream iccInput, Stream ttfInput)
{
iccInput.Position = 0;
ttfInput.Position = 0;
PDFFixedDocument document = new PDFFixedDocument();
document.OptionalContentProperties = new PDFOptionalContentProperties();
// Setup the document by creating a PDF/A output intent, based on a RGB ICC profile,
// and document information and metadata
PDFIccColorSpace icc = new PDFIccColorSpace();
byte[] profilePayload = new byte[iccInput.Length];
iccInput.Read(profilePayload, 0, profilePayload.Length);
icc.IccProfile = profilePayload;
PDFOutputIntent oi = new PDFOutputIntent();
oi.Type = PDFOutputIntentType.PDFA1;
oi.Info = "sRGB IEC61966-2.1";
oi.OutputConditionIdentifier = "Custom";
oi.DestinationOutputProfile = icc;
document.OutputIntents = new PDFOutputIntentCollection();
document.OutputIntents.Add(oi);
document.DocumentInformation = new PDFDocumentInformation();
document.DocumentInformation.Author = "O2 Solutions";
document.DocumentInformation.Title = "PDF4NET PDF/A-2B/U Demo";
document.DocumentInformation.Creator = "PDF4NET PDF/A-2B/U Demo Application";
document.DocumentInformation.Producer = "PDF4NET";
document.DocumentInformation.Keywords = "pdf/a";
document.DocumentInformation.Subject = "PDF/A-2B/U Sample produced by PDF4NET";
document.XmpMetadata = new PDFXmpMetadata();
PDFPage page = document.Pages.Add();
page.Rotation = 90;
// All fonts must be embedded in a PDF/A document.
PDFStringAppearanceOptions sao = new PDFStringAppearanceOptions();
sao.Font = new PDFAnsiTrueTypeFont(ttfInput, 24, true);
sao.Brush = new PDFBrush(new PDFRgbColor(0, 0, 128));
PDFStringLayoutOptions slo = new PDFStringLayoutOptions();
slo.HorizontalAlign = PDFStringHorizontalAlign.Center;
slo.VerticalAlign = PDFStringVerticalAlign.Bottom;
slo.X = page.Width / 2;
slo.Y = page.Height / 2 - 10;
page.Canvas.DrawString("PDF4NET", sao, slo);
slo.Y = page.Height / 2 + 10;
slo.VerticalAlign = PDFStringVerticalAlign.Top;
sao.Font.Size = 14;
page.Canvas.DrawString("This is a sample PDF/A-2B/U document that shows the PDF/A-2B/U capabilities in PDF4NET library", sao, slo);
// PDF/A-2 documents support optional content and transparency.
PDFOptionalContentGroup ocgPage1 = new PDFOptionalContentGroup();
ocgPage1.Name = "Green Rectangle";
page.Canvas.BeginOptionalContentGroup(ocgPage1);
page.Canvas.SaveGraphicsState();
PDFExtendedGraphicState gs = new PDFExtendedGraphicState();
gs.FillAlpha = 0.8;
gs.StrokeAlpha = 0.2;
gs.BlendMode = PDFBlendMode.Luminosity;
page.Canvas.SetExtendedGraphicState(gs);
PDFBrush greenBrush = new PDFBrush(PDFRgbColor.DarkGreen);
PDFPen bluePen = new PDFPen(PDFRgbColor.DarkBlue, 5);
page.Canvas.DrawRectangle(bluePen, greenBrush, 20, 20, page.Width - 40, page.Height - 40);
page.Canvas.RestoreGraphicsState();
page.Canvas.EndOptionalContentGroup();
// Build the display tree for the optional content,
// how its structure and relationships between optional content groups are presented to the user.
PDFOptionalContentDisplayTreeNode ocgPage1Node = new PDFOptionalContentDisplayTreeNode(ocgPage1);
document.OptionalContentProperties.DisplayTree.Nodes.Add(ocgPage1Node);
return(document);
}
private static void DrawColorsAndColorSpaces(PDFPage page, PDFFont titleFont, PDFFont sectionFont, Stream iccStream)
{
PDFBrush brush = new PDFBrush();
page.Canvas.DrawString("Colors and colorspaces", titleFont, brush, 20, 50);
page.Canvas.DrawString("DeviceRGB", sectionFont, brush, 20, 70);
PDFPen rgbPen = new PDFPen(PDFRgbColor.DarkRed, 4);
PDFBrush rgbBrush = new PDFBrush(PDFRgbColor.LightGoldenrodYellow);
page.Canvas.DrawRectangle(rgbPen, rgbBrush, 20, 85, 250, 100);
page.Canvas.DrawString("DeviceCMYK", sectionFont, brush, 340, 70);
PDFPen cmykPen = new PDFPen(new PDFCmykColor(1, 0.5, 0, 0.1), 4);
PDFBrush cmykBrush = new PDFBrush(new PDFCmykColor(0, 0.5, 0.43, 0));
page.Canvas.DrawRectangle(cmykPen, cmykBrush, 340, 85, 250, 100);
page.Canvas.DrawString("DeviceGray", sectionFont, brush, 20, 200);
PDFPen grayPen = new PDFPen(new PDFGrayColor(0.1), 4);
PDFBrush grayBrush = new PDFBrush(new PDFGrayColor(0.75));
page.Canvas.DrawRectangle(grayPen, grayBrush, 20, 215, 250, 100);
page.Canvas.DrawString("Indexed", sectionFont, brush, 340, 200);
PDFIndexedColorSpace indexedColorSpace = new PDFIndexedColorSpace();
indexedColorSpace.ColorCount = 2;
indexedColorSpace.BaseColorSpace = new PDFRgbColorSpace();
indexedColorSpace.ColorTable = new byte[] { 192, 0, 0, 0, 0, 128 };
PDFIndexedColor indexedColor0 = new PDFIndexedColor(indexedColorSpace);
indexedColor0.ColorIndex = 0;
PDFIndexedColor indexedColor1 = new PDFIndexedColor(indexedColorSpace);
indexedColor1.ColorIndex = 1;
PDFPen indexedPen = new PDFPen(indexedColor0, 4);
PDFBrush indexedBrush = new PDFBrush(indexedColor1);
page.Canvas.DrawRectangle(indexedPen, indexedBrush, 340, 215, 250, 100);
page.Canvas.DrawString("CalGray", sectionFont, brush, 20, 330);
PDFCalGrayColorSpace calGrayColorSpace = new PDFCalGrayColorSpace();
PDFCalGrayColor calGrayColor1 = new PDFCalGrayColor(calGrayColorSpace);
calGrayColor1.Gray = 0.6;
PDFCalGrayColor calGrayColor2 = new PDFCalGrayColor(calGrayColorSpace);
calGrayColor2.Gray = 0.2;
PDFPen calGrayPen = new PDFPen(calGrayColor1, 4);
PDFBrush calGrayBrush = new PDFBrush(calGrayColor2);
page.Canvas.DrawRectangle(calGrayPen, calGrayBrush, 20, 345, 250, 100);
page.Canvas.DrawString("CalRGB", sectionFont, brush, 340, 330);
PDFCalRgbColorSpace calRgbColorSpace = new PDFCalRgbColorSpace();
PDFCalRgbColor calRgbColor1 = new PDFCalRgbColor(calRgbColorSpace);
calRgbColor1.Red = 0.1;
calRgbColor1.Green = 0.5;
calRgbColor1.Blue = 0.25;
PDFCalRgbColor calRgbColor2 = new PDFCalRgbColor(calRgbColorSpace);
calRgbColor2.Red = 0.6;
calRgbColor2.Green = 0.1;
calRgbColor2.Blue = 0.9;
PDFPen calRgbPen = new PDFPen(calRgbColor1, 4);
PDFBrush calRgbBrush = new PDFBrush(calRgbColor2);
page.Canvas.DrawRectangle(calRgbPen, calRgbBrush, 340, 345, 250, 100);
page.Canvas.DrawString("L*a*b", sectionFont, brush, 20, 460);
PDFLabColorSpace labColorSpace = new PDFLabColorSpace();
PDFLabColor labColor1 = new PDFLabColor(labColorSpace);
labColor1.L = 90;
labColor1.A = -40;
labColor1.B = 120;
PDFLabColor labColor2 = new PDFLabColor(labColorSpace);
labColor2.L = 45;
labColor2.A = 90;
labColor2.B = -34;
PDFPen labPen = new PDFPen(labColor1, 4);
PDFBrush labBrush = new PDFBrush(labColor2);
page.Canvas.DrawRectangle(labPen, labBrush, 20, 475, 250, 100);
page.Canvas.DrawString("Icc", sectionFont, brush, 340, 460);
PDFIccColorSpace iccColorSpace = new PDFIccColorSpace();
byte[] iccData = new byte[iccStream.Length];
iccStream.Read(iccData, 0, iccData.Length);
iccColorSpace.IccProfile = iccData;
iccColorSpace.AlternateColorSpace = new PDFRgbColorSpace();
iccColorSpace.ColorComponents = 3;
PDFIccColor iccColor1 = new PDFIccColor(iccColorSpace);
iccColor1.ColorComponents = new double[] { 0.45, 0.1, 0.22 };
PDFIccColor iccColor2 = new PDFIccColor(iccColorSpace);
iccColor2.ColorComponents = new double[] { 0.21, 0.76, 0.31 };
PDFPen iccPen = new PDFPen(iccColor1, 4);
PDFBrush iccBrush = new PDFBrush(iccColor2);
page.Canvas.DrawRectangle(iccPen, iccBrush, 340, 475, 250, 100);
page.Canvas.DrawString("Separation", sectionFont, brush, 20, 590);
PDFExponentialFunction tintTransform = new PDFExponentialFunction();
tintTransform.Domain = new double[] { 0, 1 };
tintTransform.Range = new double[] { 0, 1, 0, 1, 0, 1, 0, 1 };
tintTransform.Exponent = 1;
tintTransform.C0 = new double[] { 0, 0, 0, 0 };
tintTransform.C1 = new double[] { 1, 0.5, 0, 0.1 };
PDFSeparationColorSpace separationColorSpace = new PDFSeparationColorSpace();
separationColorSpace.AlternateColorSpace = new PDFCmykColorSpace();
separationColorSpace.Colorant = "Custom Blue";
separationColorSpace.TintTransform = tintTransform;
PDFSeparationColor separationColor1 = new PDFSeparationColor(separationColorSpace);
separationColor1.Tint = 0.23;
PDFSeparationColor separationColor2 = new PDFSeparationColor(separationColorSpace);
separationColor2.Tint = 0.74;
PDFPen separationPen = new PDFPen(separationColor1, 4);
PDFBrush separationBrush = new PDFBrush(separationColor2);
page.Canvas.DrawRectangle(separationPen, separationBrush, 20, 605, 250, 100);
page.Canvas.DrawString("Pantone", sectionFont, brush, 340, 590);
PDFPen pantonePen = new PDFPen(PDFPantoneColor.ReflexBlue, 4);
PDFBrush pantoneBrush = new PDFBrush(PDFPantoneColor.RhodamineRed);
page.Canvas.DrawRectangle(pantonePen, pantoneBrush, 340, 605, 250, 100);
page.Canvas.CompressAndClose();
}