//The constructor.
public Screen()
{
//The container is a grid with 1 or 2 row definitions, and 1 column.
//It may have 2 row definitions when an application bar is visible.
mPage = new Grid();
mPage.ColumnDefinitions.Add(new ColumnDefinition { Width = new GridLength(1, GridUnitType.Star) });
mPage.RowDefinitions.Add(new RowDefinition { Height = new GridLength( 1, GridUnitType.Star) });
mView = mPage;
//Initialize the application bar and set its visibility to false.
mApplicationBar = new Microsoft.Phone.Shell.ApplicationBar();
mApplicationBar.IsVisible = false;
ApplicationBarVisible = false;
mApplicationBarItemsIndexes = new Dictionary<Object, int>();
/**
* This will add a BackKeyPress event handler to the Application.Current.RootVisual, this is application wide.
*/
(Application.Current.RootVisual as Microsoft.Phone.Controls.PhoneApplicationFrame).BackKeyPress += new EventHandler<System.ComponentModel.CancelEventArgs>(BackKeyPressHandler);
/**
* This will add a BackKeyPress event handler to the Application.Current.RootVisual, this is application wide.
*/
(Application.Current.RootVisual as Microsoft.Phone.Controls.PhoneApplicationFrame).OrientationChanged += new EventHandler<Microsoft.Phone.Controls.OrientationChangedEventArgs>(OrientationChangedHandler);
}
private void UpdateVisibleControls(Grid targetGrid)
{
var window = Application.Current.MainWindow as IMainWindow;
foreach (var locus in window.World.GeneBank.Loci)
{
var controls = locus.AlleleManager.Controls;
if (!locus.isVisibleLocus)
{
foreach (var control in controls)
{
control.StackPanel.Visibility = Visibility.Collapsed;
}
}
else
{
var currentRow = 1;
foreach (var control in controls)
{
control.UpdateControlValue();
var totalRows = targetGrid.RowDefinitions.Count;
Grid.SetColumn(control.StackPanel, 0);
if (currentRow >= totalRows)
{
var rd = new RowDefinition { Height = GridLength.Auto };
targetGrid.RowDefinitions.Add(rd);
}
Grid.SetRow(control.StackPanel, currentRow);
currentRow++;
control.StackPanel.Visibility = Visibility.Visible;
}
}
}
}
public Issue1097 ()
{
Grid grid = new Grid {
RowSpacing = 0,
ColumnSpacing = 0,
};
grid.AddRowDef(count: 2);
grid.AddColumnDef(count : 2);
grid.Children.Add(new BoxView() { Color = Color.Red });
var v2 = new BoxView { Color = Color.Blue };
Grid.SetColumn(v2, 1);
grid.Children.Add(v2);
var v3 = new BoxView { Color = Color.Green };
Grid.SetRow(v3, 1);
grid.Children.Add(v3);
var v4 = new BoxView { Color = Color.Purple };
Grid.SetRow(v4, 1);
Grid.SetColumn(v4, 1);
grid.Children.Add(v4);
Content = grid;
}
public HeatMapUpdater(int _index,Node[] _nodes,Grid _grid){
index = _index;
nodes = _nodes;
grid = _grid;
a = new Thread(UpdateHeatMap);
a.Start();
}
public Vector3 wloc; // 3D location coordinates in Unity's world units
#endregion Fields
#region Constructors
public Square(Grid gr, Vector2 loc, Vector3 wloc)
{
this.plane = GameObject.CreatePrimitive(PrimitiveType.Plane);
plane.name = "Grid plane";
plane.transform.position = wloc;
plane.transform.localScale = new Vector3(0.1f, 1.0f, 0.1f);
plane.transform.Rotate(-90.0f, 0.0f, 0.0f);
plane.renderer.material.mainTexture = Resources.Load("Textures/Tile2") as Texture;
plane.renderer.material.color = Color.white;
colors = new Dictionary<Color, int>();
colors[Color.red] = 0;
colors[Color.green] = 0;
colors[Color.blue] = 0;
colors[Color.yellow] = 0;
this.loc = loc;
this.wloc = wloc;
objects = new List<GameObject>();
board = new Square[8];
int count = 0;
for(int xof = -1; xof <= 1; xof++) {
for(int yof = -1; yof <= 1; yof++) {
int x = (int)loc.x;
int y = (int)loc.y;
if(!(xof == 0 && yof == 0)) {
if(x+xof >= 0 && x+xof < gr.width && y+yof >= 0 && y+yof < gr.height)
board[count] = gr.grid[x+xof, y+yof];
count++;
}
}
}
}
public virtual void Init(Grid grid, int x, int y, float scale = 1, Sprite asset = null)
{
sfx = AudioManager.instance;
container = transform.Find("Sprites");
outline = transform.Find("Sprites/Outline").GetComponent<SpriteRenderer>();
img = transform.Find("Sprites/Sprite").GetComponent<SpriteRenderer>();
shadow = transform.Find("Sprites/Shadow").GetComponent<SpriteRenderer>();
shadow.gameObject.SetActive(false);
label = transform.Find("Label").GetComponent<TextMesh>();
label.GetComponent<Renderer>().sortingLayerName = "Ui";
label.gameObject.SetActive(Debug.isDebugBuild);
this.grid = grid;
this.x = x;
this.y = y;
this.asset = asset;
this.walkable = true;
transform.localPosition = new Vector3(x, y, 0);
SetAsset(asset);
SetImages(scale, Vector3.zero, 0);
SetSortingOrder(0);
visible = false;
explored = false;
}
public void Init(Legs legs,Grid grid)
{
base.Init(legs);
this.grid = grid;
this.auxiliarySteering = new Arrive();
this.auxiliarySteering.Init(getLegs());
}
public PathFinder(Grid graph, Cell start, Cell goal)
{
// Priority Queue which contains cells that are candidates for examining, lowest priority to the node with the lowest f value
var frontier = new PriorityQueue<Cell>();
frontier.Enqueue(start, 0);
cameFrom[start] = start;
costSoFar[start] = 0;
while (frontier.Count > 0)
{
var current = frontier.Dequeue();
// Exit the search if goal have discovered
if (current.Equals(goal)) { break; }
// discovers the neighbours
foreach (var next in graph.Neighbors(current))
{
int newCost = costSoFar[current] + graph.Cost(current, next);
if (!costSoFar.ContainsKey(next) || newCost < costSoFar[next])
{
costSoFar[next] = newCost;
// f = g + h
int priority = newCost + Heuristic(next, goal);
frontier.Enqueue(next, priority);
cameFrom[next] = current;
}
}
}
}
//FOR N_Back!
public void GenerateGrounds(Grid grid, TerrainChunk tc, int y = 0,
bool ceiling = false)
{
// Generate ground and potholes
//First and last cannot be a hole.
for (int i = 0; i < grid.numCellsX; ++i) {
if (grid.containsObject(i, y)) {
continue;
}
//level is chance that there is a hole! Do not spawnground!
//int rand = Random.Range (0, 101);
//if(!(i ==0 || i == grid.numCellsX))
//{
if (initCeiling == 0) {
initCeiling++;
continue;
}
//}
// Generate random width ground pieces varying from 1-3
int cap, roll;
do {
//cap = Mathf.Min (4, grid.numCellsX - i + 1);
roll = 3;
} while (!GenerateWideGround(i, y, roll, grid, tc, ceiling));
}
}
public override HashSet<Vector> Find(TerrainGrid terrain)
{
var interestPoints = new HashSet<Vector>();
var blocking = new Grid<bool>(terrain.Size);
foreach (var point in terrain.GetPoints())
{
var terrainType = terrain[point];
blocking[point] = TerrainTypes.Blocking.Contains(terrainType);
}
blocking = _filters.Close(blocking);
var areas = _areaFinder.Find(blocking).ToList();
areas.RemoveAll((area) => area.Count <= 20);
foreach (var area in areas)
{
var areaList = area.ToList();
int xMean = (int)areaList.Average((p) => p.x);
int yMean = (int)areaList.Average((p) => p.y);
Vector centroid = new Vector(xMean, yMean);
interestPoints.Add(centroid);
}
return interestPoints;
}
/// <summary>Creates the UI elements for the given HTML node and HTML view.</summary>
/// <param name="node">The HTML node.</param>
/// <param name="htmlView">The HTML view.</param>
/// <returns>The UI elements.</returns>
public DependencyObject[] CreateControls(HtmlNode node, IHtmlView htmlView)
{
var controls = new List<Grid>();
foreach (var child in node.Children.OfType<HtmlTagNode>().Where(c => c.Name == "li"))
{
var grid = new Grid();
grid.ColumnDefinitions.Add(new ColumnDefinition { Width = new GridLength(20)});
grid.ColumnDefinitions.Add(new ColumnDefinition { Width = new GridLength(1, GridUnitType.Star) });
var textBlock = CreateBulletSymbol(htmlView);
grid.Children.Add(textBlock);
Grid.SetColumn(textBlock, 0);
var panel = new StackPanel();
child.WrapWithHtmlTag();
foreach (var c in child.GetChildControls(htmlView).OfType<UIElement>())
{
var frameworkElement = c as FrameworkElement;
if (frameworkElement != null)
frameworkElement.HorizontalAlignment = HorizontalAlignment.Stretch;
panel.Children.Add(c);
}
grid.Children.Add(panel);
Grid.SetColumn(panel, 1);
controls.Add(grid);
}
AdjustMargins(htmlView, controls);
return controls.OfType<DependencyObject>().ToArray();
}
protected override void Init()
{
var label = new Label { Text = "Label" };
var entry = new Entry { AutomationId = "entry" };
var grid = new Grid();
grid.Children.Add(label, 0, 0);
grid.Children.Add(entry, 1, 0);
var tableView = new TableView
{
Root = new TableRoot
{
new TableSection
{
new ViewCell
{
View = grid
}
}
}
};
Content = new StackLayout
{
Children = { tableView }
};
}
public void Calling_AutoGenerateColumns_should_add_columns()
{
IGrid<Person> grid = new Grid<Person>(new Person[0], new ViewContext());
grid.AutoGenerateColumns();
((Grid<Person>)grid).Model.Columns.Count.ShouldEqual(2);
}
public void Grid_Key()
{
Grid g = new Grid(256, 256);
Assert.AreEqual("__id__", g.Key);
g.Key = "key";
Assert.AreEqual("key", g.Key);
}
public void GetVisualParents() {
#endif
Grid grid = new Grid();
ContentControl contentControl = new ContentControl();
TextBox textBox;
Window.Content = grid;
grid.Children.Add(contentControl);
contentControl.ContentTemplate = textBoxTemplate;
#if NETFX_CORE
await
#endif
EnqueueShowWindow();
EnqueueCallback(() => {
textBox = (TextBox)LayoutHelper.FindElement(contentControl, x => x is TextBox);
Assert.AreSame(contentControl, LayoutTreeHelper.GetVisualParents(textBox).Where(x => x is ContentControl).First());
Assert.AreSame(grid, LayoutTreeHelper.GetVisualParents(textBox).Where(x => x is Grid).First());
Assert.AreSame(Window, LayoutTreeHelper.GetVisualParents(textBox).Where(x => x.GetType() == Window.GetType()).First());
Assert.AreSame(contentControl, LayoutTreeHelper.GetVisualParents(textBox, contentControl).Where(x => x is ContentControl).First());
Assert.IsNull(LayoutTreeHelper.GetVisualParents(textBox, contentControl).Where(x => x is Grid).FirstOrDefault());
var presenter = LayoutTreeHelper.GetVisualChildren(contentControl).First();
Assert.IsTrue(new[] { presenter }.SequenceEqual(LayoutTreeHelper.GetVisualParents(textBox, presenter)));
});
EnqueueTestComplete();
}
public static bool ColumnJunction(Grid grid)
{
Contract.Requires(grid != null);
var ret = false;
for (int i = 0; i < Grid.LENGTH; i++)
{
var column = grid.Columns[i];
var bloks = FindPairs(column).Union(FindTriads(column));
foreach (var block in bloks)
{
int row;
if (block.Value.Select(z => (z.Row / 3) * 3).AllEqual(out row))
{
foreach (var cell in grid.Blocks[row, i].Where(z => z.IsEmpty).Where(z => !block.Value.Contains(z, ReferenceEqualityComparer<Cell>.Default)))
{
if (cell.RemoveVariants(block.Key))
{
ret = true;
}
}
}
}
}
return ret;
}
public void Grid_Encode()
{
Mapnik.RegisterDatasource(Path.Combine(Mapnik.Paths["InputPlugins"], "shape.input"));
Map m = new Map(256, 256);
m.Load(@".\data\test.xml");
m.ZoomAll();
Grid g = new Grid(256, 256);
var options = new Dictionary<string, object>()
{
{"Fields", new List<string>() { "FIPS" } },
{"Layer", "world" }
};
m.Render(g, options);
Dictionary<string, object> UTFGridDict = g.Encode();
Assert.AreEqual(UTFGridDict.Keys.Count, 3);
//Test for keys
List<string> keyList = (List<string>)UTFGridDict["keys"];
Assert.AreNotEqual(keyList.Count, 0);
//Test for data
Dictionary<string, object> dataDict = (Dictionary<string, object>)UTFGridDict["data"];
Assert.AreNotEqual(dataDict.Count, 0);
//data count should equal keys + 1
Assert.AreEqual(keyList.Count, dataDict.Count + 1);
}
public WindowImpl(string title)
{
Background = Brushes.HotPink;
UseLayoutRounding = true;
Title = title;
Grid = new Grid()
{
UseLayoutRounding = true,
HorizontalAlignment = HorizontalAlignment.Stretch,
VerticalAlignment = VerticalAlignment.Stretch,
};
this.AddChild(Grid);
KeyDownEvents = Observable.FromEvent<KeyEventArgs>(this, "KeyDown").Select(e => e.EventArgs);
KeyUpEvents = Observable.FromEvent<KeyEventArgs>(this, "KeyUp").Select(e => e.EventArgs);
MouseMoveEvents = Observable.FromEvent<MouseEventArgs>(this, "MouseMove").Select(e => e.EventArgs.GetPosition(Grid).ToXna());
MouseDownEvents = Observable.FromEvent<MouseButtonEventArgs>(this, "MouseDown").Select(e => e.EventArgs.GetPosition(Grid).ToXna());
MouseUpEvents = Observable.FromEvent<MouseButtonEventArgs>(this, "MouseUp").Select(e => e.EventArgs.GetPosition(Grid).ToXna());
KeyDownEvents.Where(e => e.Key == Key.F).Subscribe(ie => this.Fullscreen = this.Fullscreen == null ? Screen.PrimaryScreen : null);
MaybeFullscreen = null;
Hwnd = new WindowInteropHelper(this).EnsureHandle();
Show();
}
public void Calling_AutoGenerateColumns_should_set_gridmodel()
{
IGrid<Person> grid = new Grid<Person>(new Person[0], new StringWriter(), new ViewContext());
grid.AutoGenerateColumns();
((Grid<Person>)grid).Model.ShouldBe<AutoColumnGridModel<Person>>();
}
public static void AddPages(TabControl tabControl, string tabName, bool maxSize, params Page[] pages)
{
Grid grid = new Grid();
grid.Width = double.NaN;
grid.Height = double.NaN;
grid.Margin = new Thickness(0);
grid.VerticalAlignment = VerticalAlignment.Top;
if (maxSize)
{
grid.HorizontalAlignment = HorizontalAlignment.Stretch;
grid.VerticalAlignment = VerticalAlignment.Stretch;
}
int index = 0;
foreach (var item in pages)
{
ColumnDefinition col = new ColumnDefinition();
col.Width = GridLength.Auto;
grid.ColumnDefinitions.Add(col);
SetPageToGrid(item, grid, 0, index);
index++;
}
TabItem tabItem = new TabItem();
tabItem.Header = tabName;
tabItem.Content = grid;
tabControl.Items.Add(tabItem);
}
public IGrid Create()
{
var grid = new Grid();
grid.Initialize(_setting, _groupFactory);
return grid;
}
public void GridCellInstantiationTest()
{
Grid grid;
// Assert each cell in grid is instantiated and initialized with expected default chemical concentrations
grid = new Grid(4);
for (int column = 0; column < grid.Size; column++)
{
for (int row = 0; row < grid.Size; row++)
{
Assert.AreEqual(grid[column, row]["A"], 0);
Assert.AreEqual(grid[column, row]["B"], 0);
}
}
// Assert each cell in grid is instantiated and initialized with given chemical concentrations
Cell cell = new Cell
{
{ "A", 0.25 },
{ "B", 0.75 }
};
grid = new Grid(4, cell);
for (int column = 0; column < grid.Size; column++)
{
for (int row = 0; row < grid.Size; row++)
{
Assert.AreEqual(grid[column, row]["A"], 0.25);
Assert.AreEqual(grid[column, row]["B"], 0.75);
}
}
}
public void Grid_SetsName()
{
String actual = new Grid<GridModel>(new GridModel[0]).Name;
String expected = "Grid";
Assert.Equal(expected, actual);
}
void Start()
{
_root = (Grid)GetComponent<NoesisGUIPanel>().GetContent();
_root.ManipulationStarting += this.ManipulationStarting;
_root.ManipulationInertiaStarting += this.ManipulationInertiaStarting;
_root.ManipulationDelta += this.ManipulationDelta;
}
public void Grid_SetsSource()
{
IQueryable<GridModel> expected = new GridModel[2].AsQueryable();
IQueryable<GridModel> actual = new Grid<GridModel>(expected).Source;
Assert.Same(expected, actual);
}
protected override void Init ()
{
var rootGrid = new Grid {
RowDefinitions = new RowDefinitionCollection
{
new RowDefinition { Height = new GridLength(1, GridUnitType.Star) },
new RowDefinition { Height = new GridLength(1, GridUnitType.Auto) },
},
};
_mainContent = new ContentView { Content = new ScrollView { Content = new Label { Text = Description } } };
rootGrid.AddChild (_mainContent, 0, 0);
var buttons = new StackLayout { Orientation = StackOrientation.Horizontal };
var button1A = new Button { Text = "View 1A" };
button1A.Clicked += (sender, args) => ShowView (_view1A);
buttons.Children.Add (button1A);
var button1B = new Button { Text = "View 1B" };
button1B.Clicked += (sender, args) => ShowView (_view1B);
buttons.Children.Add (button1B);
var button2 = new Button { Text = "View 2" };
button2.Clicked += (sender, args) => ShowView (_view2);
buttons.Children.Add (button2);
rootGrid.AddChild (buttons, 0, 1);
Content = rootGrid;
}
public void StartLevel()
{
m_grid = new DungeonGenerator().Generate(SizeX, SizeY);
// Change two random floor tiles to stairs
var position = GetRandomTileOfType(TileType.Floor);
m_grid[(int)position.x, (int)position.y] = TileType.StairsUp;
position = GetRandomTileOfType(TileType.Floor);
m_grid[(int)position.x, (int)position.y] = TileType.StairsDown;
// Set all tiles
for (int y = 0; y < m_grid.SizeY; y++)
{
for (int x = 0; x < m_grid.SizeX; x++)
{
var type = m_grid[x, y];
if (type == TileType.Empty)
m_tileMap.PaintTile(x, y, new Color(0, 0, 0, 0));
else
m_tileMap[x, y] = m_tiles.GetId(type);
}
}
// Move player to stairs
var stairs = FindTile(TileType.StairsUp);
var playerBehaviour = GameObject.Find("Player").GetComponent<PlayerBehaviour>();
playerBehaviour.SetTilePosition((int)stairs.x, (int)stairs.y);
}
public override TerrainGrid Generate(Vector size, FreqDict freqs = null, Random rand = null)
{
freqs = freqs ?? _defaultFreqs;
UpdateFreqs(ref freqs);
NormalizeFreqs(ref freqs);
rand = rand ?? new Random();
var terrain = new Grid<TerrainType>(size);
var heightGrid = _topographyGenerator.Generate(terrain.Size, rand);
heightGrid = _filters.OpenClose(heightGrid);
var sortedPoints = heightGrid.GetPoints().ToList();
sortedPoints.Sort((lhs, rhs) => (heightGrid[lhs] - heightGrid[rhs]));
int numTiles = size.x * size.y;
int numWaterTiles = (int)(numTiles * freqs[TerrainTypes.Water]);
var waterTiles = sortedPoints.Take(numWaterTiles);
foreach (var point in waterTiles)
terrain[point] = TerrainTypes.Water;
int numMountainTiles = (int)(numTiles * freqs[TerrainTypes.Mountain]);
var mountainTiles = sortedPoints.Skip(numTiles - numMountainTiles);
foreach (var point in mountainTiles)
terrain[point] = TerrainTypes.Mountain;
var landTiles = new HashSet<Vector>(terrain.GetPoints());
landTiles.ExceptWith(waterTiles);
landTiles.ExceptWith(mountainTiles);
AddLandTiles(ref terrain, landTiles.ToList(), freqs, rand);
return terrain;
}
protected void AddDetailGrid(Grid grid)
{
DetailGrid detail = new DetailGrid();
detail.ID = "grid" + level.ToString();
detail.AutoGenerateColumns = false;
detail.Serialize = false;
detail.AllowPageSizeSelection = false;
detail.AllowPaging = false;
detail.PageSize = -1;
detail.AllowAddingRecords = true;
detail.Width = Unit.Percentage(97);
detail.ForeignKeys = "CategoryID";
detail.ClientSideEvents.ExposeSender = true;
detail.ClientSideEvents.OnClientPopulateControls = "onPopulateControls";
detail.ClientSideEvents.OnBeforeClientDelete = "onBeforeClientDelete";
foreach (Column column in grid.Columns)
{
Column newColumn = column.Clone() as Column;
newColumn.SortOrder = SortOrderType.None;
detail.Columns.Add(newColumn);
}
detail.MasterDetailSettings = grid.MasterDetailSettings;
detail.DataSourceNeeded += Grid1_DataSourceNeeded;
detail.InsertCommand += Grid1_InsertCommand;
detail.UpdateCommand += Grid1_UpdateCommand;
detail.DeleteCommand += Grid1_DeleteCommand;
grid.DetailGrids.Add(detail);
}
public override void Click(float mouseX, float mouseY, int gridX, int gridY, Grid grid, GridPiece piece)
{
if (piece == null)
{
grid.AddPiece(new Battery(new ChargeColor(R, G, B)), gridX, gridY);
}
}
public DisplayAdapter(IGameViewModel viewModel)
{
myViewModel = viewModel;
myCanvas = viewModel.Canvas;
}
private void AddPeriod(CIPeriod i, Grid mainGrid, bool addToList)
{
mainGrid.RowDefinitions.Add(new RowDefinition {
Height = new GridLength(40)
});
Image img = new Image()
{
Source = "close_circle.png",
HeightRequest = BlankWidth - 10,
WidthRequest = BlankWidth - 10,
};
var t = new TapGestureRecognizer();
t.Tapped += (s, e) =>
{
DeletePeriod(i, addToList);
};
img.GestureRecognizers.Add(t);
mainGrid.Children.Add(img, 0, rowCount);
Entry indexEntry = new Entry()
{
Text = i.Index + "",
FontSize = Device.GetNamedSize(NamedSize.Small, typeof(Label)),
Keyboard = Keyboard.Numeric
};
mainGrid.Children.Add(indexEntry, 1, rowCount);
Entry nameEntry = new Entry()
{
Text = i.Name + "",
FontSize = Device.GetNamedSize(NamedSize.Small, typeof(Label)),
};
mainGrid.Children.Add(nameEntry, 2, rowCount);
Entry intervalEntry = new Entry()
{
Text = Math.Round(i.Interval.TotalMinutes, 2) + "",
FontSize = Device.GetNamedSize(NamedSize.Small, typeof(Label)),
Keyboard = Keyboard.Numeric
};
indexEntry.TextChanged += (s, e) =>
{
var entry = (Entry)s;
List <Entry> periodToCascade = null;
try
{
periodToCascade = _addedPeriods.First(_ => _.ElementAt(0).Text == entry.Text && _.ElementAt(1).Text != nameEntry.Text);
}
catch { }
if (entry.Text != "" && periodToCascade != null)
{
var indexToCascade = int.Parse(entry.Text);
if (indexToCascade == _addedPeriods.Count)
{
indexToCascade = 0;
}
periodToCascade.ElementAt(0).Text = ++indexToCascade + "";
}
else if (entry.Text != "" && periodToCascade == null)
{
}
};
mainGrid.Children.Add(intervalEntry, 3, rowCount++);
if (_addedPeriods == null)
{
_addedPeriods = new List <List <Entry> >();
}
List <Entry> addedPeriod = new List <Entry>()
{
indexEntry, nameEntry, intervalEntry
};
if (true)
{
_addedPeriods.Add(addedPeriod);
}
}
private static Grid SingBlock(string name)
{
var grid = new Grid();
grid.RowDefinitions.Add(new RowDefinition());
grid.RowDefinitions.Add(new RowDefinition());
grid.ColumnDefinitions.Add(new ColumnDefinition {
Width = GridLength.Auto
});
grid.ColumnDefinitions.Add(new ColumnDefinition {
Width = GridLength.Auto
});
grid.ColumnDefinitions.Add(new ColumnDefinition {
Width = GridLength.Auto
});
grid.ColumnDefinitions.Add(new ColumnDefinition {
Width = new GridLength(1, GridUnitType.Star)
});
grid.Cell(0, 0, new Label {
Content = new TextBlock {
FontFamily = new FontFamily("Arial"),
FontSize = 12,
Text = name,
TextWrapping = TextWrapping.Wrap,
Width = 200
},
});
grid.Cell(0, 1, new Label {
Width = 100,
BorderBrush = Brushes.Black,
BorderThickness = new Thickness(0, 0, 0, 1),
SnapsToDevicePixels = true,
Margin = new Thickness(5, 0, 5, 0),
});
grid.Cell(1, 1, new Label {
FontFamily = new FontFamily("Arial"),
FontSize = 9,
Content = "(должность)",
HorizontalAlignment = HorizontalAlignment.Center,
});
grid.Cell(0, 2, new Label
{
Width = 87,
BorderBrush = Brushes.Black,
BorderThickness = new Thickness(0, 0, 0, 1),
SnapsToDevicePixels = true,
Margin = new Thickness(5, 0, 5, 0),
});
grid.Cell(1, 2, new Label
{
FontFamily = new FontFamily("Arial"),
FontSize = 9,
Content = "(подпись)",
HorizontalAlignment = HorizontalAlignment.Center,
});
grid.Cell(0, 3, new Label {
BorderBrush = Brushes.Black,
Width = 250,
BorderThickness = new Thickness(0, 0, 0, 1),
SnapsToDevicePixels = true,
Margin = new Thickness(5, 0, 5, 0),
});
grid.Cell(1, 3, new Label {
FontFamily = new FontFamily("Arial"),
FontSize = 9,
Content = "(ф.и.о.)",
HorizontalAlignment = HorizontalAlignment.Center,
});
return(grid);
}
//bool first = true;
protected override unsafe void OnUpdate()
{
var entityManager = World.Active.GetOrCreateManager <EntityManager>();
for (int danglingEnemyIndex = 0; danglingEnemyIndex < m_DanglingEnemyData.Length; ++danglingEnemyIndex)
{
m_PathManager.RemovePath(m_DanglingEnemyData.EnemyStates[danglingEnemyIndex].PathId);
PostUpdateCommands.RemoveComponent <EnemyState>(m_DanglingEnemyData.Entities[danglingEnemyIndex]);
}
s_Start = m_SpawnPointData.SpawnPoint[0].GridIndex;
s_Goal = m_GoalPointData.GoalPoint[0].GridIndex;
s_BlockedTerrainCardinal = new GridBitfield();
s_BlockedTerrainIntercardinal = new GridBitfield();
for (int turretIndex = 0; turretIndex < m_TurretData.Length; ++turretIndex)
{
int2 turretGridCoords = Grid.ConvertToGridIndex(m_TurretData.Positions[turretIndex].Value);
s_BlockedTerrainCardinal[turretGridCoords] = true;
s_BlockedTerrainIntercardinal[turretGridCoords] = true;
if (turretGridCoords.x > 0)
{
s_BlockedTerrainIntercardinal[turretGridCoords.x - 1, turretGridCoords.y] = true;
}
if (turretGridCoords.x < Grid.NumCells.x - 1)
{
s_BlockedTerrainIntercardinal[turretGridCoords.x + 1, turretGridCoords.y] = true;
}
if (turretGridCoords.y > 0)
{
s_BlockedTerrainIntercardinal[turretGridCoords.x, turretGridCoords.y - 1] = true;
}
if (turretGridCoords.y < Grid.NumCells.y - 1)
{
s_BlockedTerrainIntercardinal[turretGridCoords.x, turretGridCoords.y + 1] = true;
}
}
// clear out all previous paths to force path-recompute if the tower layour has changed
if (m_PreviousBlockedTerrain != null && m_PreviousBlockedTerrain != s_BlockedTerrainCardinal)
{
m_PathManager.ForcePathRecompute();
}
m_PreviousBlockedTerrain = s_BlockedTerrainCardinal;
for (int trackedEnemyIndex = 0; trackedEnemyIndex < m_TrackedEnemyData.Length; ++trackedEnemyIndex)
{
float3 currentPos = m_TrackedEnemyData.Positions[trackedEnemyIndex].Value;
int2 currentGridIndex = Grid.ConvertToGridIndex(currentPos);
float3 target = HandleLiveEnemy(currentGridIndex, m_TrackedEnemyData.EnemyStates[trackedEnemyIndex]);
if (currentPos.Equals(target))
{
List <float3> path = m_PathManager.GetPath(m_TrackedEnemyData.EnemyStates[trackedEnemyIndex].PathId);
path.RemoveAt(path.Count - 1);
target = HandleLiveEnemy(currentGridIndex, m_TrackedEnemyData.EnemyStates[trackedEnemyIndex]);
}
float3 delta = Time.deltaTime * m_TrackedEnemyData.Enemies[trackedEnemyIndex].Speed * math.normalize(target - currentPos);
while (WouldDeltaJumpTarget(currentPos, delta, target))
{
float3 toTarget = target - currentPos;
float magDelta = math.length(delta);
float normalizedTimeUsed = math.length(toTarget) / magDelta;
float distanceLeft = (1.0f - normalizedTimeUsed) * magDelta;
List <float3> path = m_PathManager.GetPath(m_TrackedEnemyData.EnemyStates[trackedEnemyIndex].PathId);
path.RemoveAt(path.Count - 1);
if (path.Count == 0)
{
if (m_PlayerData.Player[0].gameState.Equals(GameState.PLAYING))
{
for (int i = 0; i < m_PlayerData.Player.Length; i++)
{
var playerData = m_PlayerData.Player[i];
playerData.Health--;
m_PlayerData.Player[i] = playerData;
}
}
PostUpdateCommands.DestroyEntity(m_TrackedEnemyData.Entities[trackedEnemyIndex]);
return;
}
currentPos = target;
target = path[path.Count - 1];
delta = distanceLeft * math.normalize(target - currentPos);
}
m_TrackedEnemyData.Positions[trackedEnemyIndex] = new Position {
Value = currentPos + delta
};
}
for (int newEnemyIndex = 0; newEnemyIndex < m_NewEnemyData.Length; ++newEnemyIndex)
{
EnemyState enemyState = new EnemyState {
PathId = m_PathManager.AddPath()
};
PostUpdateCommands.AddComponent(m_NewEnemyData.Entities[newEnemyIndex], enemyState);
}
}
public PathingSystem()
{
Grid.Configure(new int2(24, 20), new float2(1.0f, 1.0f), new float3(0.0f, 0.0f, 0.0f));
m_PathManager = new PathManager();
}
public static void Launcher(Grid grid, int px, int py, int sx, int sy, string header, JObject data)
{
Microsoft.AppCenter.Analytics.Analytics.TrackEvent("Create Launcher Widget");
try
{
Models.Sitemap.Widget3 item = data.ToObject <Models.Sitemap.Widget3>();
Dictionary <string, string> widgetKeyValuePairs = Helpers.SplitCommand(item.Label);
CrossLogger.Current.Debug("Launcher", "Label: " + widgetKeyValuePairs["label"]);
//Master Grid for Widget
Grid Widget_Grid = new Grid
{
RowDefinitions = new RowDefinitionCollection {
new RowDefinition {
Height = new GridLength(1, GridUnitType.Star)
},
new RowDefinition {
Height = new GridLength(2, GridUnitType.Star)
},
},
ColumnDefinitions = new ColumnDefinitionCollection {
new ColumnDefinition {
Width = new GridLength(1, GridUnitType.Star)
},
},
RowSpacing = 0,
ColumnSpacing = 0,
BackgroundColor = App.Config.CellColor,
HorizontalOptions = LayoutOptions.FillAndExpand,
VerticalOptions = LayoutOptions.FillAndExpand,
Padding = new Thickness(0, 0, 0, 10),
};
//Header
Widget_Grid.Children.Add(new Forms9Patch.Label
{
Text = header.Replace("\"", " "),
FontSize = 100,
TextColor = App.Config.TextColor,
BackgroundColor = App.Config.CellColor,
HorizontalTextAlignment = TextAlignment.Center,
VerticalTextAlignment = TextAlignment.Start,
LineBreakMode = LineBreakMode.NoWrap,
Lines = 1,
AutoFit = Forms9Patch.AutoFit.Width,
}, 0, 0);
//Circle
SvgCachedImage svg = new SvgCachedImage
{
DownsampleToViewSize = false,
Aspect = Aspect.AspectFit,
BitmapOptimizations = false,
Source = SvgImageSource.FromSvgString(@"<svg viewBox=""0 0 100 100""><circle cx=""50"" cy=""50"" r=""50"" fill=""" + App.Config.ValueColor.ToHex().ToString() + @""" /></svg>"),
};
Widget_Grid.Children.Add(svg, 0, 1);
//Image
Widget_Grid.Children.Add(new Image
{
Source = widgetKeyValuePairs["icon"],
Aspect = Aspect.AspectFit,
BackgroundColor = Color.Transparent,
VerticalOptions = LayoutOptions.FillAndExpand,
HorizontalOptions = LayoutOptions.FillAndExpand,
}, 0, 1);
//Button must be last to be added to work
Button launcherButton = new Button
{
HorizontalOptions = LayoutOptions.FillAndExpand,
VerticalOptions = LayoutOptions.FillAndExpand,
BackgroundColor = Color.Transparent,
StyleId = widgetKeyValuePairs["url"] //StyleID is not used on buttons
};
Widget_Grid.Children.Add(launcherButton, 0, 1, 0, 2);
launcherButton.Clicked += OnLauncherButtonClicked;
CrossLogger.Current.Debug("Launcher", "Button ID: " + launcherButton.Id + " created.");
grid.Children.Add(Widget_Grid, px, px + sx, py, py + sy);
}
catch (Exception ex)
{
CrossLogger.Current.Error("Launcher", "Widgets.Launcher crashed: " + ex.ToString());
Error(grid, px, py, sx, sy, ex.ToString());
}
}
public void DrawField(List <IMapEntity> mapEntities, int totalRows, int totalColumns, ref IMapEntity[,] fieldMap)
{
mySubject = null;
myCanvas.Children.Clear();
myCanvas.RowDefinitions.Clear();
myCanvas.ColumnDefinitions.Clear();
Dictionary <IMapEntity, int> countMapping = new Dictionary <IMapEntity, int>();
mapEntities.ForEach(entity => countMapping.Add(entity, 0));
for (int i = 0; i < totalRows; i++)
{
myCanvas.RowDefinitions.Add(new RowDefinition {
Height = GridLength.Auto
});
}
for (int i = 0; i < totalColumns; i++)
{
myCanvas.ColumnDefinitions.Add(new ColumnDefinition {
Width = GridLength.Auto
});
}
Random random = new Random();
int mapEntityToPick = 0;
int lastEntityPicked = 0;
int totalEntitiesTypes = mapEntities.Count;
for (int x = 0; x < totalColumns; x++)
{
for (int y = 0; y < totalRows; y++)
{
var cell = new ContentControl();
if (x == 0 && y == 0)
{
cell.Content = new EmptyMapEnity();
}
else
{
lastEntityPicked = mapEntityToPick;
do
{
mapEntityToPick = random.Next(0, mapEntities.Count + 3);
} while (lastEntityPicked == mapEntityToPick);
lastEntityPicked = mapEntityToPick;
if (mapEntityToPick < mapEntities.Count)
{
var entityToCopy = mapEntities.ElementAt(mapEntityToPick);
int entityAddCount = countMapping[entityToCopy];
if ((entityToCopy.Multiplicity == MapEntityMultiplicity.Multiple || entityAddCount < 1))
{
while (entityToCopy.Multiplicity != MapEntityMultiplicity.Single && !IsCountUnderDistributionWeight(entityAddCount, entityToCopy.DistributionWeight, totalRows * totalColumns))
{
var tempMapEntityIndex = random.Next(0, mapEntities.Count);
var tempEntity = mapEntities.ElementAt(tempMapEntityIndex);
if (lastEntityPicked == tempMapEntityIndex || tempEntity.Multiplicity == MapEntityMultiplicity.Single)
{
continue;
}
entityToCopy = tempEntity;
entityAddCount = countMapping[entityToCopy];
mapEntityToPick = tempMapEntityIndex;
}
;
cell.Content = new DataBoundMapEntity
{
Description = entityToCopy.Description,
DisplayText = entityToCopy.DisplayText,
Icon = entityToCopy.Icon,
ScoringWeight = entityToCopy.ScoringWeight,
Row = y,
Column = x,
IsMoveAllowedOnThis = entityToCopy.IsMoveAllowedOnThis
};
countMapping[entityToCopy]++;
}
else
{
cell.Content = new EmptyMapEnity();
}
}
else
{
cell.Content = new EmptyMapEnity();
}
}
Grid.SetRow(cell, x);
Grid.SetColumn(cell, y);
myCanvas.Children.Add(cell);
fieldMap[x, y] = cell.Content as IMapEntity;
}
}
}
// Themes
private void loadTheme(int themeID)
{
switch (themeID)
{
case 0: // Light
{
bgColor = new SolidColorBrush(Color.FromRgb(255, 255, 255));
bgColor2 = new SolidColorBrush(Color.FromRgb(255, 255, 255));
textColor = new SolidColorBrush(Color.FromRgb(24, 24, 24));
textColor2 = new SolidColorBrush(Color.FromRgb(10, 10, 10));
break;
}
case 1: // Dark
{
bgColor = new SolidColorBrush(Color.FromRgb(24, 24, 24));
bgColor2 = new SolidColorBrush(Color.FromRgb(61, 61, 61));
textColor = new SolidColorBrush(Color.FromRgb(255, 255, 255));
textColor2 = new SolidColorBrush(Color.FromRgb(179, 179, 179));
break;
}
}
// Set colors
mainGrid.Background = bgColor;
menuGrid.Background = bgColor;
bodyGrid.Background = bgColor;
footerGrid.Background = bgColor;
songTitleLabel.Foreground = textColor;
artistLabel.Foreground = textColor2;
if (correctMarkBtnFlag.Visibility == Visibility.Collapsed)
{
correctMarkBtnText.Foreground = textColor2;
}
correctMarkDescriptionLabel.Foreground = textColor;
correctMarkDescriptionBtn.Foreground = textColor;
versionLabel.Foreground = textColor2;
smallerFontBtnText.Foreground = textColor2;
biggerFontBtnText.Foreground = textColor2;
fontSizeText.Foreground = textColor2;
if (!Properties.Settings.Default.boldFont)
{
boldFontBtnText.Foreground = textColor2;
}
if (themeID == 0)
{
darkModeBtnText.Foreground = textColor2;
}
if (!Properties.Settings.Default.topMost)
{
topModeBtnText.Foreground = textColor2;
}
if (!Properties.Settings.Default.launchFlag)
{
launchFlagBtnText.Foreground = textColor2;
}
settingsBtnText.Foreground = textColor2;
focusModeBtnText.Foreground = textColor2;
countLabel.Foreground = textColor2;
gradient0.Color = bgColor.Color;
gradient1.Color = Color.FromArgb(0, bgColor.Color.R, bgColor.Color.G, bgColor.Color.B);
gradient2.Color = Color.FromArgb(0, bgColor.Color.R, bgColor.Color.G, bgColor.Color.B);
gradient3.Color = bgColor.Color;
gradient4.Color = bgColor2.Color;
gradient5.Color = bgColor.Color;
foreach (ListViewItem s in lyricsView.Items)
{
Grid g = (Grid)s.Content;
foreach (UIElement u in g.Children)
{
TextBox t = (TextBox)u;
t.Foreground = textColor;
}
}
// Save settings
Properties.Settings.Default.theme = themeID;
Properties.Settings.Default.Save();
}
public WeatherForecast(Grid root, Config config) : base(root, "Weather", config, 250, 120, new Thickness(10, 10, 10, 10), HorizontalAlignment.Center, VerticalAlignment.Bottom, TimeSpan.FromMinutes(10))
{
httpClient = new HttpClient();
}
private void addToLyricsView(string s, bool error = false, bool topCenter = true)
{
ListViewItem lContainer = new ListViewItem();
lContainer.Style = (Style)Application.Current.FindResource("ListViewContainerStyle");
lContainer.IsEnabled = true;
lContainer.HorizontalAlignment = HorizontalAlignment.Center;
if (s.Contains("\r\n") && s.Length > 4)
{
if (s.Substring(s.Length - 2, 2) == "\r\n")
{
s = s.Substring(0, s.Length - 2);
}
}
Grid lGrid = new Grid();
lGrid.Width = this.ActualWidth - 50;
TextBox lString = new TextBox();
lString.Style = Properties.Settings.Default.boldFont ? (Style)Application.Current.FindResource("BoldFont") : (Style)Application.Current.FindResource("BookFont");
lString.Foreground = textColor;
lString.FontSize = Properties.Settings.Default.textSize;
lString.FontStretch = FontStretches.UltraExpanded;
lString.IsReadOnly = true;
lString.Background = new SolidColorBrush(Color.FromArgb(0, 0, 0, 0));
lString.BorderThickness = new Thickness(0);
lString.TextAlignment = TextAlignment.Center;
lString.Text = s;
lString.TextWrapping = TextWrapping.WrapWithOverflow;
lString.Padding = new Thickness(20, 0, 20, 0);
if (error)
{
lString.Text = "I can't find the lyrics, sorry.";
TextBox emoji = new TextBox();
emoji.Style = (Style)Application.Current.FindResource("IconFont");
emoji.FontSize = Properties.Settings.Default.textSize + 40;
emoji.Text = "";
emoji.IsReadOnly = true;
emoji.Background = new SolidColorBrush(Color.FromArgb(0, 0, 0, 0));
emoji.BorderThickness = new Thickness(0);
emoji.Foreground = textColor;
emoji.FontStretch = FontStretches.UltraExpanded;
emoji.TextAlignment = TextAlignment.Center;
emoji.Padding = new Thickness(20, 25, 20, 0);
lGrid.Children.Add(lString);
lGrid.Children.Add(emoji);
}
else
{
lGrid.Children.Add(lString);
}
lContainer.Content = lGrid;
if (topCenter)
{
lyricsView.VerticalAlignment = VerticalAlignment.Top;
}
else
{
lyricsView.VerticalAlignment = VerticalAlignment.Center;
}
lyricsView.Items.Add(lContainer);
}
public void GetEmployeesAccessMasterGridEditActiveSlaveGridThreeSlaveGrids()
{
Grid mastergrid = new Grid();
mastergrid.DataSourceId = "Employees";
mastergrid.ID = "test";
mastergrid.Page = Testpage;
mastergrid.CurrentId = "3";
mastergrid["Photo"].Visibility = Visibility.None; //HtmlForm is required for File columns.
mastergrid.Mode = Mode.Edit;
mastergrid.ConnectionString = ConnectionAccessOleDb;
Testpage.Controls.Add(mastergrid);
Grid slavegrid = new Grid();
slavegrid.DataSourceId = "EmployeeTerritories";
slavegrid.ID = "test2";
slavegrid.Page = Testpage;
slavegrid.MasterGrid = "test";
slavegrid.ConnectionString = ConnectionAccessOleDb;
Testpage.Controls.Add(slavegrid);
Grid slavegrid2 = new Grid();
slavegrid2.DataSourceId = "EmployeeTerritories";
slavegrid2.ID = "test3";
slavegrid2.Page = Testpage;
slavegrid2.MasterGrid = "test";
slavegrid2.ConnectionString = ConnectionAccessOleDb;
Testpage.Controls.Add(slavegrid2);
Grid slavegrid3 = new Grid();
slavegrid3.DataSourceId = "EmployeeTerritories";
slavegrid3.ID = "test3";
slavegrid3.Page = Testpage;
slavegrid3.MasterGrid = "test";
slavegrid3.ConnectionString = ConnectionAccessOleDb;
Testpage.Controls.Add(slavegrid3);
mastergrid.RaisePostBackEvent("SlaveGridClick!test2");
StringBuilder sb = new StringBuilder();
StringWriter sw = new StringWriter(sb);
HtmlTextWriter gridwriter = new HtmlTextWriter(sw);
mastergrid.RenderControl(gridwriter);
sb = new StringBuilder();
sw = new StringWriter(sb);
gridwriter = new HtmlTextWriter(sw);
slavegrid.RenderControl(gridwriter);
Assert.AreEqual(mastergrid.MasterTable.Rows.Count, 1);
Assert.Greater(slavegrid.MasterTable.Rows.Count, 1);
Assert.IsTrue(slavegrid.MasterTable.GotDataSourceSchema);
Assert.IsFalse(slavegrid2.MasterTable.GotDataSourceSchema);
Assert.IsFalse(slavegrid3.MasterTable.GotDataSourceSchema);
Assert.IsTrue(mastergrid.ActiveMenuSlaveGrid != null &&
mastergrid.ActiveMenuSlaveGrid.ID.Equals(slavegrid.ID));
}
public async override void update()
{
try
{
if (state)
{
Debug.WriteLine("Weather Forecast UPDATE");
Grid grid = new Grid();
Forecast forecast = await getForecast();
//Image
Image image = new Image();
BitmapImage bimage = new BitmapImage(new Uri("ms-appx:///Assets/" + forecast.icon + ".png"));
image.Source = bimage;
image.RenderTransformOrigin = new Point(0.5, 0.5);
image.Width = 50;
image.Height = 50;
image.Margin = new Thickness(0, 30, 0, 50);
TextBlock temp2 = new TextBlock();
temp2.Text = forecast.temp.Substring(0, 2) + "º";
temp2.FontSize = 30;
temp2.FontWeight = FontWeights.Bold;
temp2.Foreground = new SolidColorBrush(Colors.White);
temp2.Margin = new Thickness(150, 40, 0, 0);
TextBlock tb = new TextBlock();
tb.Text = "\t" + forecast.sunrise.Hour + ":" + forecast.sunrise.Minute + "\t" + forecast.sunset.Hour + ":" + forecast.sunset.Minute;
tb.FontSize = 14;
tb.Foreground = new SolidColorBrush(Colors.White);
tb.HorizontalAlignment = HorizontalAlignment.Center;
tb.Margin = new Thickness(0, 80, 0, 0);
Image sunrise = new Image();
BitmapImage _sunrise = new BitmapImage(new Uri("ms-appx:///Assets/SunSet.png"));
sunrise.Source = _sunrise;
sunrise.RenderTransformOrigin = new Point(0.5, 0.5);
sunrise.Width = 14;
sunrise.Height = 14;
sunrise.Margin = new Thickness(0, 57, 55, 0);
Image sunset = new Image();
BitmapImage _sunset = new BitmapImage(new Uri("ms-appx:///Assets/SunSet.png"));
CompositeTransform ts = new CompositeTransform();
ts.Rotation = Convert.ToDouble(180);
sunset.RenderTransform = ts;
sunset.Source = _sunset;
sunset.RenderTransformOrigin = new Point(0.5, 0.5);
sunset.Width = 14;
sunset.Height = 14;
sunset.Margin = new Thickness(55, 57, 0, 0);
/*
* //Temp
* TextBlock temp = new TextBlock();
* temp.Text = "Min: " + forecast.minTemp + " -- Max: " + forecast.maxTemp;
* temp.FontSize = 10;
* temp.Foreground = new SolidColorBrush(Colors.White);
* temp.Margin = new Thickness(105, 0, 0, 0);
*
*
*
* //WindSpeed
* Image wind = new Image();
* BitmapImage windbimage = new BitmapImage(new Uri("ms-appx:///Assets/wind.png"));
* CompositeTransform ts = new CompositeTransform();
* ts.Rotation = Convert.ToDouble(forecast.windDir);
* wind.Source = windbimage;
* wind.RenderTransform = ts;
* wind.RenderTransformOrigin = new Point(0.5, 0.5);
* wind.Width = 50;
* wind.Height = 50;
* wind.Margin = new Thickness(100, 50, 0, 0);
*
* TextBlock temp3 = new TextBlock();
* temp2.Text = "Location: " + forecast.location;
* temp2.FontSize = 10;
* temp2.Foreground = new SolidColorBrush(Colors.White);
* temp2.Margin = new Thickness(0,100, 0, 0);
*
* grid.Children.Add(temp);
* grid.Children.Add(temp2);
* grid.Children.Add(temp3);
* grid.Children.Add(wind);
*/
grid.Children.Add(tb);
grid.Children.Add(temp2);
grid.Children.Add(image);
grid.Children.Add(sunset);
grid.Children.Add(sunrise);
clearWidget();
addToWidget(grid);
}
else
{
clearWidget();
}
//Debug.WriteLine("Weather Forecast: " + Marshal.SizeOf(grid));
}
catch (Exception e)
{
Debug.WriteLine("You probly dont have internet");
}
}
void Update()
{
if (Input.GetKey("up") && Time.time - lastSlide >= maxSlideSpeed)
{
transform.Rotate(0, 0, -90);
if (!isValidPosition())
{
// undo move if invalid.
transform.Rotate(0, 0, 90);
}
else
{
updateGrid();
}
lastSlide = Time.time;
}
if (Input.GetKey("left") && Time.time - lastSlide >= maxSlideSpeed)
{
transform.position += Vector3.left;
if (!isValidPosition())
{
// undo move if invalid.
transform.position += Vector3.right;
}
else
{
updateGrid();
}
lastSlide = Time.time;
}
if (Input.GetKey("right") && Time.time - lastSlide >= maxSlideSpeed)
{
transform.position += Vector3.right;
if (!isValidPosition())
{
// undo move if invalid.
transform.position += Vector3.left;
}
else
{
updateGrid();
}
lastSlide = Time.time;
}
if (Input.GetKey("down") || Time.time - lastFall >= gravityTickSpeed)
{
transform.position += new Vector3(0, -1, 0);
if (!isValidPosition())
{
// undo move if invalid.
transform.position += new Vector3(0, 1, 0);
Grid.destroyFullRows();
// piece is done. Turn off update loop
enabled = false;
spawner.spawnNext();
}
else
{
updateGrid();
}
lastFall = Time.time;
}
}
public void UpdateForNewPosition()
{
const int duration = 400;
this.UpdatePieceSizes();
Storyboard animation = new Storyboard();
animation.Duration = TimeSpan.FromMilliseconds(duration + 25);
this.Resources.Add("tmpTimline" + this.currentAnimation++, animation);
for (int i = 0; i < this.position.PieceList.Length; i++)
{
byte oldPieceLocation = 0xFF;
if (this.oldPieceList != null)
{
oldPieceLocation = this.oldPieceList[i];
}
byte newPieceLocation = this.position.PieceList[i];
Piece oldPiece = oldPieceLocation != 0xFF ? this.pieces[this.oldBoard[oldPieceLocation]] : null;
Piece newPiece = newPieceLocation != 0xFF ? this.pieces[this.position.Board[newPieceLocation]] : null;
if (oldPieceLocation != newPieceLocation)
{
if (newPieceLocation == 0xFF)
{
// Piece was captured
DoubleAnimation opacityAnimation = new DoubleAnimation();
Storyboard.SetTarget(opacityAnimation, oldPiece);
Storyboard.SetTargetProperty(opacityAnimation, new PropertyPath("Opacity"));
opacityAnimation.Duration = TimeSpan.FromMilliseconds(duration);
opacityAnimation.To = 0;
animation.Children.Add(opacityAnimation);
}
else if (oldPieceLocation == 0xFF)
{
// Piece was created (game reset, undo)
DoubleAnimation opacityAnimation = new DoubleAnimation();
Storyboard.SetTarget(opacityAnimation, newPiece);
Storyboard.SetTargetProperty(opacityAnimation, new PropertyPath("Opacity"));
opacityAnimation.Duration = TimeSpan.FromMilliseconds(duration);
opacityAnimation.To = 1;
Grid.SetRow(newPiece, SquareHelper.GetRow(newPieceLocation));
Grid.SetColumn(newPiece, SquareHelper.GetColumn(newPieceLocation));
animation.Children.Add(opacityAnimation);
}
else
{
if (oldPiece == newPiece)
{
// Piece just moved
Grid.SetRow(newPiece, SquareHelper.GetRow(newPieceLocation));
Grid.SetColumn(newPiece, SquareHelper.GetColumn(newPieceLocation));
DoubleAnimation yAnimation = new DoubleAnimation();
Storyboard.SetTarget(yAnimation, ((TransformGroup)newPiece.RenderTransform).Children[0]);
Storyboard.SetTargetProperty(yAnimation, new PropertyPath("Y"));
yAnimation.Duration = TimeSpan.FromMilliseconds(duration);
yAnimation.From = (SquareHelper.GetRow(oldPieceLocation) - SquareHelper.GetRow(newPieceLocation)) * 100;
yAnimation.To = 0;
animation.Children.Add(yAnimation);
DoubleAnimation xAnimation = new DoubleAnimation();
Storyboard.SetTarget(xAnimation, ((TransformGroup)newPiece.RenderTransform).Children[0]);
Storyboard.SetTargetProperty(xAnimation, new PropertyPath("X"));
xAnimation.Duration = TimeSpan.FromMilliseconds(duration);
xAnimation.From = (SquareHelper.GetColumn(oldPieceLocation) - SquareHelper.GetColumn(newPieceLocation)) * 100;
xAnimation.To = 0;
animation.Children.Add(xAnimation);
}
else
{
// Promotion
DoubleAnimation opacityAnimation = new DoubleAnimation();
Storyboard.SetTarget(opacityAnimation, newPiece);
Storyboard.SetTargetProperty(opacityAnimation, new PropertyPath("Opacity"));
opacityAnimation.Duration = TimeSpan.FromMilliseconds(duration);
opacityAnimation.To = 1;
Grid.SetRow(newPiece, SquareHelper.GetRow(newPieceLocation));
Grid.SetColumn(newPiece, SquareHelper.GetColumn(newPieceLocation));
animation.Children.Add(opacityAnimation);
opacityAnimation = new DoubleAnimation();
Storyboard.SetTarget(opacityAnimation, oldPiece);
Storyboard.SetTargetProperty(opacityAnimation, new PropertyPath("Opacity"));
opacityAnimation.Duration = TimeSpan.FromMilliseconds(duration);
opacityAnimation.To = 0;
animation.Children.Add(opacityAnimation);
}
}
}
else
{
// TODO: what should be done here?
}
}
// Workaround layout bug.
this.LayoutRoot.Width--;
this.LayoutRoot.Height++;
animation.Completed += this.OnAnimationCompleted;
animation.Begin();
this.oldBoard = new List <byte>(this.position.Board);
this.oldPieceList = new List <byte>(this.position.PieceList);
this.oldPieces = new List <Piece>(this.pieces);
}
/*This function creates and displays a node cluster on the screen
* Parameters
* Int16[,] NodeProp- Node locations
* int top - Top or y coordinate of the cluster location on screen
* int left - Left or x coordinate of the cluster location on screen
* int fontsize - font size of text to be displayed on the nodes of the cluster (only valid for nodes in selected/zoomed states or the title nodes)
* bool zoomed - whether a node is zoomed or not (used for animatin code)
*/
public void displayCluster(Int16[,] NodeProp, int top, int left, int fontsize, bool zoomed)
{
//Due to the layout of a cluster on screen, currently we are only adding the first 7 nodes to a cluster. nCnt now stores the number of nodes inside this cluster.
int nCnt = nodes.Count < 7 ? nodes.Count : 7;
//Close all the media (if any) being played in other node
MainWindow.mp.Stop();
MainWindow.mp.Close();
Ellipse ellipse;
TextBlock txt;
Grid grid;
for (int i = 0; i < nCnt; i++)
{
//Create the ellipse to represent the node and display its content
ellipse = new Ellipse();
ellipse.Height = NodeProp[i, 2];
ellipse.Width = NodeProp[i, 2];
ellipse.StrokeThickness = 0;
BrushConverter bc = new BrushConverter();
Brush brush = (Brush)bc.ConvertFrom(nodes.ElementAt(i).color);
// store node's name in Textblock
txt = new TextBlock();
txt.HorizontalAlignment = System.Windows.HorizontalAlignment.Center;
txt.VerticalAlignment = System.Windows.VerticalAlignment.Center;
txt.TextTrimming = TextTrimming.CharacterEllipsis;
if (i == 0)
{
txt.FontSize = fontsize + 7;
}
else
{
txt.FontSize = fontsize;
ellipse.Fill = brush;
txt.Margin = new Thickness(15, 10, 15, 10);
}
txt.Foreground = (Brush)bc.ConvertFrom(nodes.ElementAt(i).textColor);
txt.FontWeight = System.Windows.FontWeights.Bold;
txt.TextWrapping = System.Windows.TextWrapping.Wrap;
txt.Text = nodes.ElementAt(i).name;
//Don't display the node name if it is in shrinked or default state. This is because the text will be unreadable
if ((nodes.ElementAt(i).state == "shrinked" || nodes.ElementAt(i).state == "default") && ellipse.Width < 100)
{
txt.Visibility = System.Windows.Visibility.Hidden;
}
// Assign values to Labels for storing node's parent ID,
//node's state, node's name, node's type,node's subject/discipline, and the node's fill color for the ellipse.
Label lbl = new Label();
lbl.Content = nodes.ElementAt(i).nodeID;
lbl.Visibility = System.Windows.Visibility.Hidden;
Label lbl1 = new Label();
lbl1.Content = nodes.ElementAt(i).state;
lbl1.Visibility = System.Windows.Visibility.Hidden;
Label lbl2 = new Label();
lbl2.Content = nodes.ElementAt(i).name;
lbl2.Visibility = System.Windows.Visibility.Hidden;
Label lbl3 = new Label();
lbl3.Content = nodes.ElementAt(i).type;
lbl3.Visibility = System.Windows.Visibility.Hidden;
Label lbl4 = new Label();
lbl4.Content = nodes.ElementAt(i).subject;
lbl4.Visibility = System.Windows.Visibility.Hidden;
Label lbl5 = new Label();
lbl5.Content = nodes.ElementAt(i).color;
lbl5.Visibility = System.Windows.Visibility.Hidden;
//Add the children to the node grid. Each node grid consists of ellipse to show content, Textblock to store textual content, Labels for storing node's parent ID,
//node's state, node's name, node's type,node's subject/discipline, and the node's fill color for the ellipse.
grid = new Grid();
grid.Height = NodeProp[i, 2];
grid.Width = NodeProp[i, 2];
grid.Children.Add(ellipse);
grid.Children.Add(txt);
grid.Children.Add(lbl);
grid.Children.Add(lbl1);
grid.Children.Add(lbl2);
grid.Children.Add(lbl3);
grid.Children.Add(lbl4);
grid.Children.Add(lbl5);
grid.MouseLeftButtonDown += new MouseButtonEventHandler(MainWindow.node_leftClick);
grid.MouseRightButtonDown += new MouseButtonEventHandler(MainWindow.node_rightClick);
grid.HorizontalAlignment = System.Windows.HorizontalAlignment.Stretch;
grid.VerticalAlignment = System.Windows.VerticalAlignment.Stretch;
//Add this node grid to the Paint Canvas and assign it a location
MainWindow.PaintCanvas.Children.Add(grid);
Canvas.SetLeft(grid, NodeProp[i, 1] + left);
Canvas.SetTop(grid, NodeProp[i, 0] + top);
//this code adds animation on a cluster node by zooming them gradually to the designated size
DoubleAnimation da = new DoubleAnimation(1.5, new Duration(TimeSpan.FromSeconds(2)));
ScaleTransform sc = new ScaleTransform();
grid.RenderTransform = sc;
grid.RenderTransformOrigin = new Point(0.5, 0.5);
if (!zoomed)
{
da.AutoReverse = true;
}
sc.BeginAnimation(ScaleTransform.ScaleXProperty, da);
sc.BeginAnimation(ScaleTransform.ScaleYProperty, da);
}
}
/// <summary>
/// 构造函数
/// </summary>
/// <param name="grid">表格实例</param>
/// <param name="dataItem">行对应的数据源（在回发时为null）</param>
/// <param name="rowIndex">行序号</param>
public GridRow(Grid grid, object dataItem, int rowIndex)
{
_grid = grid;
_dataItem = dataItem;
_rowIndex = rowIndex;
}
/// <summary>
/// Updates an active batched anim controller.
/// </summary>
/// <param name="instance">The controller to update.</param>
/// <param name="dt">The time since the last update.</param>
private static void UpdateActive(KBatchedAnimController instance, float dt)
{
Transform transform;
var batch = instance.batch;
var visType = instance.visibilityType;
bool visible = instance.IsVisible();
// Check if moved, do this even if offscreen as it may move the anim on screen
if (batch != null && (transform = instance.transform).hasChanged)
{
var lastChunk = instance.lastChunkXY;
Vector3 pos = transform.position, posWithOffset = pos + instance.Offset;
float z = pos.z;
Vector2I cellXY;
bool always = visType == KAnimControllerBase.VisibilityType.Always;
transform.hasChanged = false;
// If this is the only anim in the batch, and the Z coordinate changed,
// override the Z in the batch
if (batch.group.maxGroupSize == 1 && instance.lastPos.z != z)
{
batch.OverrideZ(z);
}
instance.lastPos = posWithOffset;
// This is basically GetCellXY() with less accesses to __instance.transform
if (Grid.CellSizeInMeters == 0.0f)
{
// Handle out-of-game
cellXY = new Vector2I((int)posWithOffset.x, (int)posWithOffset.y);
}
else
{
cellXY = Grid.PosToXY(posWithOffset);
}
if (!always && lastChunk != KBatchedAnimUpdater.INVALID_CHUNK_ID &&
KAnimBatchManager.CellXYToChunkXY(cellXY) != lastChunk)
{
// Re-register in a different batch
instance.DeRegister();
instance.Register();
}
else if (visible || always)
{
// Only set dirty if it is on-screen now - changing visible sets dirty
// If it moved into a different chunk, Register sets dirty
instance.SetDirty();
}
}
// If it has a batch, and is active
if (instance.batchGroupID != KAnimBatchManager.NO_BATCH)
{
var anim = instance.curAnim;
var mode = instance.mode;
bool force = instance.forceRebuild, stopped = instance.stopped;
float t = instance.elapsedTime, increment = dt * instance.playSpeed;
// Suspend updates if: not currently suspended, not force update, and one
// of (paused, stopped, no anim, one time and finished with no more to play)
if (!instance.suspendUpdates && !force && (mode == KAnim.PlayMode.Paused ||
stopped || anim == null || (mode == KAnim.PlayMode.Once && (t > anim.
totalTime || anim.totalTime <= 0f) && instance.animQueue.Count == 0)))
{
instance.SuspendUpdates(true);
}
if (visible || force)
{
var aem = instance.aem;
var handle = instance.eventManagerHandle;
instance.curAnimFrameIdx = instance.GetFrameIdx(t, true);
// Trigger anim event manager if time advanced more than 0.01s
if (handle.IsValid() && aem != null)
{
float elapsedTime = aem.GetElapsedTime(handle);
if (Math.Abs(t - elapsedTime) > 0.01f)
{
aem.SetElapsedTime(handle, t);
}
}
instance.UpdateFrame(t);
// Time can be mutated by UpdateFrame
if (!stopped && mode != KAnim.PlayMode.Paused)
{
instance.SetElapsedTime(instance.elapsedTime + increment);
}
instance.forceRebuild = false;
}
else if (visType == KAnimControllerBase.VisibilityType.OffscreenUpdate &&
!stopped && mode != KAnim.PlayMode.Paused)
{
// If invisible, only advance if offscreen update is enabled
instance.SetElapsedTime(t + increment);
}
}
}
private void StyleRadioButtons()
{
switch ((ALMIntegration.eALMType)WorkSpace.Instance.Solution.AlmType)
{
case ALMIntegration.eALMType.QC:
QCRadioButton.IsChecked = true;
QCRadioButton.FontWeight = FontWeights.ExtraBold;
QCRadioButton.Foreground = (SolidColorBrush)FindResource("$SelectionColor_Pink");
RQMLoadConfigPackageButton.Visibility = Visibility.Collapsed;
DownloadPackageLink.Visibility = Visibility.Collapsed;
Grid.SetColumnSpan(ServerURLTextBox, 2);
ExampleURLHint.Content = "Example: http://server:8080/almbin";
if (!isServerDetailsCorrect)
{
ServerURLTextBox.IsEnabled = true;
ServerURLTextBox.IsReadOnly = false;
}
else
{
ServerURLTextBox.IsEnabled = false;
ServerURLTextBox.IsReadOnly = true;
}
ServerURLTextBox.Cursor = null;
RQMRadioButton.FontWeight = FontWeights.Regular;
RQMRadioButton.Foreground = Brushes.Black;
RQMRadioButton.IsChecked = false;
RallyRadioButton.FontWeight = FontWeights.Regular;
RallyRadioButton.Foreground = Brushes.Black;
RallyRadioButton.IsChecked = false;
RestAPICheckBox.Visibility = Visibility.Visible;
JiraRadioButton.IsChecked = false;
JiraRadioButton.FontWeight = FontWeights.Regular;
JiraRadioButton.Foreground = Brushes.Black;
break;
case ALMIntegration.eALMType.RQM:
RQMRadioButton.IsChecked = true;
RQMRadioButton.FontWeight = FontWeights.ExtraBold;
RQMRadioButton.Foreground = (SolidColorBrush)FindResource("$SelectionColor_Pink");
RQMLoadConfigPackageButton.Visibility = Visibility.Visible;
DownloadPackageLink.Visibility = Visibility.Visible;
Grid.SetColumnSpan(ServerURLTextBox, 1);
SetLoadPackageButtonContent();
ServerURLTextBox.IsReadOnly = true;
ServerURLTextBox.IsEnabled = false;
ServerURLTextBox.Cursor = Cursors.Arrow;
QCRadioButton.FontWeight = FontWeights.Regular;
QCRadioButton.Foreground = Brushes.Black;
QCRadioButton.IsChecked = false;
RallyRadioButton.FontWeight = FontWeights.Regular;
RallyRadioButton.Foreground = Brushes.Black;
RallyRadioButton.IsChecked = false;
RestAPICheckBox.Visibility = Visibility.Hidden;
JiraRadioButton.IsChecked = false;
JiraRadioButton.FontWeight = FontWeights.Regular;
JiraRadioButton.Foreground = Brushes.Black;
break;
case ALMIntegration.eALMType.RALLY:
RallyRadioButton.IsChecked = true;
RallyRadioButton.FontWeight = FontWeights.ExtraBold;
RallyRadioButton.Foreground = (SolidColorBrush)FindResource("$SelectionColor_Pink");
RQMLoadConfigPackageButton.Visibility = Visibility.Collapsed;
DownloadPackageLink.Visibility = Visibility.Collapsed;
Grid.SetColumnSpan(ServerURLTextBox, 2);
ExampleURLHint.Content = "Example: http://server:8080/almbin";
if (!isServerDetailsCorrect)
{
ServerURLTextBox.IsEnabled = true;
ServerURLTextBox.IsReadOnly = false;
}
else
{
ServerURLTextBox.IsEnabled = false;
ServerURLTextBox.IsReadOnly = true;
}
ServerURLTextBox.Cursor = null;
QCRadioButton.FontWeight = FontWeights.Regular;
QCRadioButton.Foreground = Brushes.Black;
QCRadioButton.IsChecked = false;
RQMRadioButton.FontWeight = FontWeights.Regular;
RQMRadioButton.Foreground = Brushes.Black;
RQMRadioButton.IsChecked = false;
RestAPICheckBox.Visibility = Visibility.Hidden;
JiraRadioButton.IsChecked = false;
JiraRadioButton.FontWeight = FontWeights.Regular;
JiraRadioButton.Foreground = Brushes.Black;
break;
case ALMIntegration.eALMType.Jira:
JiraRadioButton.IsChecked = true;
JiraRadioButton.FontWeight = FontWeights.ExtraBold;
JiraRadioButton.Foreground = (SolidColorBrush)FindResource("$SelectionColor_Pink");
RQMLoadConfigPackageButton.Visibility = Visibility.Visible;
DownloadPackageLink.Visibility = Visibility.Visible;
Grid.SetColumnSpan(ServerURLTextBox, 2);
SetLoadJiraPackageButtonContent();
if (!isServerDetailsCorrect)
{
ServerURLTextBox.IsEnabled = true;
ServerURLTextBox.IsReadOnly = false;
}
else
{
ServerURLTextBox.IsEnabled = false;
ServerURLTextBox.IsReadOnly = true;
}
ServerURLTextBox.Cursor = null;
QCRadioButton.FontWeight = FontWeights.Regular;
QCRadioButton.Foreground = Brushes.Black;
QCRadioButton.IsChecked = false;
RQMRadioButton.FontWeight = FontWeights.Regular;
RQMRadioButton.Foreground = Brushes.Black;
RQMRadioButton.IsChecked = false;
RestAPICheckBox.Visibility = Visibility.Hidden;
RallyRadioButton.IsChecked = false;
RallyRadioButton.FontWeight = FontWeights.Regular;
RallyRadioButton.Foreground = Brushes.Black;
break;
}
}
private void AnchoringWithOffsetCoercion(bool reduceAnchorOffset)
{
using (ScrollPresenterTestHooksHelper scrollPresenterTestHooksHelper = new ScrollPresenterTestHooksHelper(
enableAnchorNotifications: true,
enableInteractionSourcesNotifications: true,
enableExpressionAnimationStatusNotifications: false))
{
ScrollPresenter scrollPresenter = null;
Border anchorElement = null;
AutoResetEvent scrollPresenterLoadedEvent = new AutoResetEvent(false);
AutoResetEvent scrollPresenterViewChangedEvent = new AutoResetEvent(false);
AutoResetEvent scrollPresenterAnchorRequestedEvent = new AutoResetEvent(false);
// This test validates that the ScrollPresenter accounts for maximum vertical offset (based on viewport and content extent)
// when calculating the vertical offset shift for anchoring. The vertical offset cannot exceed content extent - viewport.
RunOnUIThread.Execute(() =>
{
Log.Comment("Visual tree setup");
anchorElement = new Border
{
Width = 100,
Height = 100,
Background = new SolidColorBrush(Colors.Red),
Margin = new Thickness(0, 600, 0, 0),
VerticalAlignment = VerticalAlignment.Top
};
Grid grid = new Grid();
grid.Children.Add(anchorElement);
grid.Width = 200;
grid.Height = 1000;
grid.Background = new SolidColorBrush(Colors.Gray);
scrollPresenter = new ScrollPresenter
{
Content = grid,
Width = 200,
Height = 200
};
scrollPresenter.Loaded += (object sender, RoutedEventArgs e) =>
{
Log.Comment("ScrollPresenter.Loaded event handler");
scrollPresenterLoadedEvent.Set();
};
scrollPresenter.ViewChanged += delegate(ScrollPresenter sender, object args)
{
Log.Comment("ViewChanged - HorizontalOffset={0}, VerticalOffset={1}, ZoomFactor={2}",
sender.HorizontalOffset, sender.VerticalOffset, sender.ZoomFactor);
Log.Comment("ViewChanged - CurrentAnchor is " + (sender.CurrentAnchor == null ? "null" : "non-null"));
if ((reduceAnchorOffset && sender.VerticalOffset == 400) ||
(!reduceAnchorOffset && sender.VerticalOffset == 500))
{
scrollPresenterViewChangedEvent.Set();
}
};
scrollPresenter.AnchorRequested += delegate(ScrollPresenter sender, ScrollingAnchorRequestedEventArgs args)
{
Log.Comment("AnchorRequested - Forcing the red Border to be the ScrollPresenter anchor.");
args.AnchorElement = anchorElement;
scrollPresenterAnchorRequestedEvent.Set();
};
Log.Comment("Setting window content");
Content = scrollPresenter;
});
WaitForEvent("Waiting for ScrollPresenter.Loaded event", scrollPresenterLoadedEvent);
IdleSynchronizer.Wait();
ScrollTo(scrollPresenter, 0.0, 600.0, ScrollingAnimationMode.Disabled, ScrollingSnapPointsMode.Ignore);
RunOnUIThread.Execute(() =>
{
Verify.AreEqual(600, scrollPresenter.VerticalOffset);
Log.Comment("ScrollPresenter.Content height is reduced by 300px. ScrollPresenter.VerticalOffset is expected to be reduced by 100px (600 -> 500).");
(scrollPresenter.Content as Grid).Height = 700;
if (reduceAnchorOffset)
{
Log.Comment("Tracked element is shifted up by 200px within the ScrollPresenter.Content (600 -> 400). Anchoring is expected to reduce the VerticalOffset by half of that (500 -> 400).");
anchorElement.Margin = new Thickness(0, 400, 0, 0);
}
scrollPresenterViewChangedEvent.Reset();
});
WaitForEvent("Waiting for ScrollPresenter.ViewChanged event", scrollPresenterViewChangedEvent);
WaitForEvent("Waiting for ScrollPresenter.AnchorRequested event", scrollPresenterAnchorRequestedEvent);
IdleSynchronizer.Wait();
RunOnUIThread.Execute(() =>
{
Verify.AreEqual(reduceAnchorOffset ? 400 : 500, scrollPresenter.VerticalOffset);
Log.Comment("ScrollPresenter CurrentAnchor is " + (scrollPresenter.CurrentAnchor == null ? "null" : "non-null"));
Verify.IsNotNull(scrollPresenter.CurrentAnchor);
});
}
}
public Background(Grid grid)
{
_stars = new List <Star>();
_grid = grid;
}
// Method create board
private void CreateBoard()
{
// Create grid for the gameboard
#region gridBoard
Grid gridBoard = new Grid
{
Name = "GameBoard",
HorizontalAlignment = HorizontalAlignment.Center,
VerticalAlignment = VerticalAlignment.Top,
Height = 1000,
Width = 1000,
Background = new SolidColorBrush(Colors.MintCream),
Margin = new Thickness(5),
};
gridBoard.SetValue(Grid.RowProperty, 2);
gridBoard.SetValue(Grid.ColumnProperty, 2);
gridBoard.RowDefinitions.Add(new RowDefinition());
gridBoard.RowDefinitions.Add(new RowDefinition());
gridBoard.RowDefinitions.Add(new RowDefinition());
gridBoard.ColumnDefinitions.Add(new ColumnDefinition());
gridBoard.ColumnDefinitions.Add(new ColumnDefinition());
gridBoard.RowDefinitions[0].Height = new GridLength(100);
gridBoard.RowDefinitions[2].Height = new GridLength(400);
gridBoard.ColumnDefinitions[1].Width = new GridLength(250);
// Frame the grid
frame = new Border()
{
BorderBrush = new SolidColorBrush(Colors.Black),
BorderThickness = new Thickness(2)
};
frame.SetValue(Grid.RowSpanProperty, 3);
frame.SetValue(Grid.ColumnSpanProperty, 2);
gridBoard.Children.Add(frame);
parentGrid.Children.Add(gridBoard);
#endregion
// Create grid for the answer pegs
#region answerGrid
Grid answerGrid = new Grid
{
Name = "AnswerGrid",
HorizontalAlignment = HorizontalAlignment.Center,
VerticalAlignment = VerticalAlignment.Top,
Height = 100,
Width = 1000,
Margin = new Thickness(5)
};
answerGrid.SetValue(Grid.RowProperty, 0);
answerGrid.SetValue(Grid.ColumnSpanProperty, 2);
answerGrid.ColumnDefinitions.Add(new ColumnDefinition());
answerGrid.ColumnDefinitions.Add(new ColumnDefinition());
answerGrid.ColumnDefinitions.Add(new ColumnDefinition());
answerGrid.ColumnDefinitions.Add(new ColumnDefinition());
// Frame the grid
frame = new Border()
{
BorderBrush = new SolidColorBrush(Colors.Black),
BorderThickness = new Thickness(2)
};
frame.SetValue(Grid.ColumnSpanProperty, _columns);
answerGrid.Children.Add(frame);
PlaceAnswerPegs(answerGrid); // place answer pegs
gridBoard.Children.Add(answerGrid);
#endregion
// Create grid for the display pegs
#region displayGrid
Grid displayGrid = new Grid
{
Name = "DisplayGrid",
HorizontalAlignment = HorizontalAlignment.Left,
VerticalAlignment = VerticalAlignment.Top,
Height = 1000,
Width = 1000,
Margin = new Thickness(5)
};
displayGrid.SetValue(Grid.RowProperty, 1);
displayGrid.SetValue(Grid.ColumnProperty, 0);
for (i = 0; i < _rows; i++)
{
displayGrid.RowDefinitions.Add(new RowDefinition());
displayGrid.RowDefinitions[i].Height = new GridLength(90);
for (j = 0; j < _columns; j++)
{
displayGrid.ColumnDefinitions.Add(new ColumnDefinition());
displayGrid.ColumnDefinitions[j].Width = new GridLength(180);
} // for j
} // for i
// Frame the grid
frame = new Border()
{
BorderBrush = new SolidColorBrush(Colors.Black),
BorderThickness = new Thickness(2)
};
frame.SetValue(Grid.RowSpanProperty, _rows);
frame.SetValue(Grid.ColumnSpanProperty, _columns);
displayGrid.Children.Add(frame);
PlaceEmptyPegs(displayGrid); // Place empty pegs
gridBoard.Children.Add(displayGrid);
#endregion
// Create grid for the feedback pegs
#region feedbackGrid
Grid feedbackGrid = new Grid
{
Name = "FeedbackGrid",
HorizontalAlignment = HorizontalAlignment.Center,
VerticalAlignment = VerticalAlignment.Top,
Height = 1000,
Width = 1000,
Margin = new Thickness(5)
};
feedbackGrid.SetValue(Grid.RowProperty, 1);
feedbackGrid.SetValue(Grid.ColumnProperty, 2);
for (i = 0; i < _rows; i++)
{
feedbackGrid.RowDefinitions.Add(new RowDefinition());
feedbackGrid.RowDefinitions[i].Height = new GridLength(90);
} // for i
// Frame the grid
frame = new Border()
{
BorderBrush = new SolidColorBrush(Colors.Black),
BorderThickness = new Thickness(2)
};
frame.SetValue(Grid.RowSpanProperty, _rows);
feedbackGrid.Children.Add(frame);
PlaceEmptyFeedbackPegs(feedbackGrid); // Place empty feedback pegs
gridBoard.Children.Add(feedbackGrid);
#endregion
// Create grid for the choose pegs
#region chooseGrid
Grid chooseGrid = new Grid
{
Name = "ChooseGrid",
HorizontalAlignment = HorizontalAlignment.Center,
VerticalAlignment = VerticalAlignment.Top,
Height = 1000,
Width = 1000,
Margin = new Thickness(5)
};
chooseGrid.SetValue(Grid.RowProperty, 2);
chooseGrid.SetValue(Grid.ColumnSpanProperty, 2);
chooseGrid.RowDefinitions.Add(new RowDefinition());
chooseGrid.RowDefinitions.Add(new RowDefinition());
chooseGrid.RowDefinitions[0].Height = new GridLength(100);
chooseGrid.RowDefinitions[1].Height = new GridLength(100);
for (i = 0; i < _columns; i++)
{
chooseGrid.ColumnDefinitions.Add(new ColumnDefinition());
} // for
// Frame the grid
frame = new Border()
{
BorderBrush = new SolidColorBrush(Colors.Black),
BorderThickness = new Thickness(2)
};
frame.SetValue(Grid.RowSpanProperty, 2);
frame.SetValue(Grid.ColumnSpanProperty, _columns);
chooseGrid.Children.Add(frame);
PlaceChoosePegs(chooseGrid); // Place choose pegs
gridBoard.Children.Add(chooseGrid);
#endregion
} // CreateBoard()
public EventDialog(Campaign campaign, Event evt, Timestamp timestamp, String title, String player, Window owner = null)
{
InitializeComponent();
this.evt = evt;
this.timestamp = timestamp;
this.campaign = campaign;
this.Title = title;
if (owner != null)
{
this.Owner = owner;
}
bool canEdit = this.evt.canEdit(player);
ColumnDefinition cd;
RowDefinition rd;
Label lbl;
Grid g;
if (this.timestamp != null)
{
this.parentGrp.Header = "Date/Time";
if (this.evt.duration == null)
{
this.evt.duration = new TimeSpan(this.timestamp.calendar, 0);
}
cd = new ColumnDefinition();
cd.Width = GridLength.Auto;
this.parentGrid.ColumnDefinitions.Add(cd);
this.parentGrid.ColumnDefinitions.Add(new ColumnDefinition());
cd = new ColumnDefinition();
cd.Width = GridLength.Auto;
this.parentGrid.ColumnDefinitions.Add(cd);
this.parentGrid.ColumnDefinitions.Add(new ColumnDefinition());
rd = new RowDefinition();
rd.Height = GridLength.Auto;
this.parentGrid.RowDefinitions.Add(rd);
Button startBut = new Button();
startBut.Content = "Start:";
startBut.Click += this.setStart;
Grid.SetRow(startBut, 0);
Grid.SetColumn(startBut, 0);
this.parentGrid.Children.Add(startBut);
this.startBox = new TextBox();
this.startBox.IsReadOnly = true;
this.startBox.Text = (this.timestamp - this.evt.duration).toString(true, true);
Grid.SetRow(this.startBox, 0);
Grid.SetColumn(this.startBox, 1);
this.parentGrid.Children.Add(this.startBox);
Button endBut = new Button();
endBut.Content = "End:";
endBut.Click += this.setEnd;
Grid.SetRow(endBut, 0);
Grid.SetColumn(endBut, 2);
this.parentGrid.Children.Add(endBut);
this.endBox = new TextBox();
this.endBox.IsReadOnly = true;
this.endBox.Text = this.timestamp.toString(true, true);
Grid.SetRow(this.endBox, 0);
Grid.SetColumn(this.endBox, 3);
this.parentGrid.Children.Add(this.endBox);
rd = new RowDefinition();
rd.Height = GridLength.Auto;
this.parentGrid.RowDefinitions.Add(rd);
Button durBut = new Button();
durBut.Content = "Duration:";
durBut.Click += this.setDuration;
Grid.SetRow(durBut, 1);
Grid.SetColumn(durBut, 0);
this.parentGrid.Children.Add(durBut);
this.durBox = new TextBox();
this.durBox.IsReadOnly = true;
this.durBox.Text = this.evt.duration.toString(true);
Grid.SetRow(this.durBox, 1);
Grid.SetColumn(this.durBox, 1);
Grid.SetColumnSpan(this.durBox, 3);
this.parentGrid.Children.Add(this.durBox);
if (!canEdit)
{
startBut.IsEnabled = false;
endBut.IsEnabled = false;
durBox.IsEnabled = false;
}
}
else
{
this.parentGrp.Header = "Parent";
this.parentGrid.ColumnDefinitions.Add(new ColumnDefinition());
rd = new RowDefinition();
rd.Height = GridLength.Auto;
this.parentGrid.RowDefinitions.Add(rd);
lbl = new Label();
if (this.evt != null)
{
lbl.Content = this.evt.parent.parent.title;
}
else
{
lbl.Content = "Event is in vault";
}
Grid.SetRow(lbl, 0);
Grid.SetColumn(lbl, 0);
this.parentGrid.Children.Add(lbl);
}
g = new Grid();
rd = new RowDefinition();
rd.Height = GridLength.Auto;
this.parentGrid.RowDefinitions.Add(rd);
cd = new ColumnDefinition();
cd.Width = GridLength.Auto;
g.ColumnDefinitions.Add(cd);
g.ColumnDefinitions.Add(new ColumnDefinition());
rd = new RowDefinition();
rd.Height = GridLength.Auto;
g.RowDefinitions.Add(rd);
Button tsBut = new Button();
tsBut.Content = "Timestamp:";
/////
//
//button click handler
//
/////
Grid.SetRow(tsBut, 0);
Grid.SetColumn(tsBut, 0);
g.Children.Add(tsBut);
this.tsBox = new TextBox();
this.tsBox.IsReadOnly = true;
this.tsBox.Text = this.evt.timestamp.ToLocalTime().ToString();
Grid.SetRow(this.tsBox, 0);
Grid.SetColumn(this.tsBox, 1);
g.Children.Add(this.tsBox);
Grid.SetRow(g, this.parentGrid.RowDefinitions.Count);
Grid.SetColumn(g, 0);
Grid.SetColumnSpan(g, this.parentGrid.ColumnDefinitions.Count);
this.parentGrid.Children.Add(g);
/////
//
//this.descGrid:
//[notes label] if this.evt.canViewNotes(player)
//[notes box] if this.evt.canViewNotes(player) (deal with notesBox if not canEdit)
//anything dynamic for this.resGrid
//
/////
this.viewersLst.Items.SortDescriptions.Add(new SortDescription("", ListSortDirection.Ascending));
if (this.evt.viewers == null)
{
this.viewersLst.Items.Add("<Everyone>");
}
else
{
foreach (String p in this.evt.viewers)
{
this.viewersLst.Items.Add(this.getPlayer(p));
}
}
this.viewersLst.Items.Refresh();
this.editorsLst.Items.SortDescriptions.Add(new SortDescription("", ListSortDirection.Ascending));
if (this.evt.editors == null)
{
this.editorsLst.Items.Add("<Everyone>");
}
else
{
foreach (String p in this.evt.editors)
{
this.editorsLst.Items.Add(this.getPlayer(p));
}
}
this.editorsLst.Items.Refresh();
if (!canEdit)
{
tsBut.IsEnabled = false;
this.titleBox.IsReadOnly = true;
this.descBox.IsReadOnly = true;
/////
//
//disable results edit stuff
//
/////
this.virtBox.IsEnabled = false;
/////
//
//disable other edit stuff
//
/////
this.okBut.Visibility = Visibility.Hidden;
this.cancelBut.Content = "Done";
}
if ((!this.evt.canAssign(player)) && (!this.evt.canClaim(player)))
{
this.ownerBut.IsEnabled = false;
}
if (!this.evt.canSetPermissions(player))
{
this.viewerAddBut.IsEnabled = false;
this.viewerRemBut.IsEnabled = false;
this.viewerAllBut.IsEnabled = false;
this.viewerNoneBut.IsEnabled = false;
this.editorAddBut.IsEnabled = false;
this.editorRemBut.IsEnabled = false;
this.editorAllBut.IsEnabled = false;
this.editorNoneBut.IsEnabled = false;
}
}
} // CreateBoard()
#region Place Pegs on Boards Methods
// Method place pegs that user can choose
private void PlaceChoosePegs(Grid chooseGrid)
{
// Variables
Ellipse choosePeg;
StackPanel stackPanel;
// For loop 2 rows and 4 columns
for (i = 0; i < 2; i++)
{
for (j = 0; j < _columns; j++)
{
stackPanel = new StackPanel()
{
Height = 80,
Width = 80,
HorizontalAlignment = HorizontalAlignment.Center,
VerticalAlignment = VerticalAlignment.Center,
};
choosePeg = new Ellipse
{
Height = 80,
Width = 80,
HorizontalAlignment = HorizontalAlignment.Center,
VerticalAlignment = VerticalAlignment.Center,
Stroke = new SolidColorBrush(Colors.Black),
StrokeThickness = 2
};
// each pegs different colors
if (i == 0)
{
switch (j)
{
case 0:
choosePeg.Name = "red";
choosePeg.Fill = new SolidColorBrush(Colors.Red);
break;
case 1:
choosePeg.Name = "orange";
choosePeg.Fill = new SolidColorBrush(Colors.Orange);
break;
case 2:
choosePeg.Name = "yellow";
choosePeg.Fill = new SolidColorBrush(Colors.Yellow);
break;
case 3:
choosePeg.Name = "green";
choosePeg.Fill = new SolidColorBrush(Colors.Green);
break;
} // switch
} // if
else
{
switch (j)
{
case 0:
choosePeg.Name = "blue";
choosePeg.Fill = new SolidColorBrush(Colors.Blue);
break;
case 1:
choosePeg.Name = "indigo";
choosePeg.Fill = new SolidColorBrush(Colors.Indigo);
break;
case 2:
choosePeg.Name = "violet";
choosePeg.Fill = new SolidColorBrush(Colors.Violet);
break;
case 3:
choosePeg.Name = "pink";
choosePeg.Fill = new SolidColorBrush(Colors.Pink);
break;
} // switch
} // else
// Tapped event
choosePeg.Tapped += Choose_Tapped;
// Add to parent
stackPanel.Children.Add(choosePeg);
stackPanel.SetValue(Grid.RowProperty, i);
stackPanel.SetValue(Grid.ColumnProperty, j);
chooseGrid.Children.Add(stackPanel);
} // for j
} // for i
} // PlaceChoosePegs()
} // FeedbackPegs()
// Method Game Over
private void GameOver()
{
// Variables
Grid gameOverGrid;
StackPanel stackPanel;
TextBlock textBlock;
Button restartBtn;
Ellipse answerPeg;
// Reveal answer pegs
for (i = 0; i < _columns; i++)
{
answerPeg = FindName("questionPeg " + (i + 1).ToString()) as Ellipse;
switch (i)
{
case 0:
answerPeg.Fill = answerPeg1.Fill;
break;
case 1:
answerPeg.Fill = answerPeg2.Fill;
break;
case 2:
answerPeg.Fill = answerPeg3.Fill;
break;
case 3:
answerPeg.Fill = answerPeg4.Fill;
break;
} // switch
} // for
gameOverGrid = new Grid()
{
Name = "GameOverGrid",
HorizontalAlignment = HorizontalAlignment.Center,
VerticalAlignment = VerticalAlignment.Top,
Height = 1000,
Width = 1000,
Background = new SolidColorBrush(Colors.MintCream),
Margin = new Thickness(5)
};
gameOverGrid.RowDefinitions.Add(new RowDefinition());
gameOverGrid.SetValue(Grid.RowProperty, 2);
gameOverGrid.SetValue(Grid.ColumnProperty, 0);
stackPanel = new StackPanel()
{
Height = 1000,
Width = 1000,
HorizontalAlignment = HorizontalAlignment.Center,
VerticalAlignment = VerticalAlignment.Center
};
textBlock = new TextBlock()
{
Height = 500,
Width = 500,
Foreground = new SolidColorBrush(Colors.Red),
FontSize = 20,
TextAlignment = TextAlignment.Center,
HorizontalAlignment = HorizontalAlignment.Center,
VerticalAlignment = VerticalAlignment.Center,
};
if (win)
{
textBlock.Text = "Game Over! You Win!";
}
else
{
textBlock.Text = "Game Over! You Lose!";
} // if
restartBtn = new Button()
{
Content = "Play Again",
Tag = "restart",
Margin = new Thickness(10),
Width = 150,
HorizontalAlignment = HorizontalAlignment.Center,
VerticalAlignment = VerticalAlignment.Top
};
restartBtn.Click += Button_Click;
stackPanel.Children.Add(textBlock);
stackPanel.Children.Add(restartBtn);
stackPanel.SetValue(Grid.RowProperty, 0);
gameOverGrid.Children.Add(stackPanel);
parentGrid.Children.Add(gameOverGrid);
} // GameOver()
private void GenerateButton(AppSelectorData AppSelectorData, int index)
{
btnGrid = new Grid()
{
Margin = new Thickness(0),
Padding = new Thickness(0)
};
if (this.ShowMessages && this.MainOrientation == Orientation.Vertical)
{
btnGrid.ColumnDefinitions.Add(new ColumnDefinition()
{
Width = new GridLength(.5, GridUnitType.Star)
});
btnGrid.ColumnDefinitions.Add(new ColumnDefinition()
{
Width = new GridLength(.5, GridUnitType.Star)
});
btnGrid.ColumnSpacing = WIDTH_GRID_COLUMNSPACING;
}
ImagePair images = new ImagePair()
{
//ID = i,
Selected = new Image()
{
Width = this.ButtonWidth,
HorizontalAlignment = HorizontalAlignment.Center,
VerticalAlignment = VerticalAlignment.Center,
Opacity = 1.0
},
NotSelected = new Image()
{
Width = this.ButtonWidth,
HorizontalAlignment = HorizontalAlignment.Center,
VerticalAlignment = VerticalAlignment.Center,
Opacity = 1.0
}
};
if (!string.IsNullOrEmpty(AppSelectorData.Source_NotSelectedImage))
{
images.NotSelected.Source = new BitmapImage()
{
UriSource = new Uri(AppSelectorData.Source_NotSelectedImage), DecodePixelWidth = (int)this.ButtonWidth
};
}
else if (!string.IsNullOrEmpty(AppSelectorData.SourceSVG_NotSelectedImage))
{
images.NotSelected.Source = new SvgImageSource(new Uri(AppSelectorData.SourceSVG_NotSelectedImage));
}
if (!string.IsNullOrEmpty(AppSelectorData.Source_SelectedImage))
{
images.Selected.Source = new BitmapImage()
{
UriSource = new Uri(AppSelectorData.Source_SelectedImage), DecodePixelWidth = (int)this.ButtonWidth
};
}
else if (!string.IsNullOrEmpty(AppSelectorData.SourceSVG_SelectedImage))
{
images.Selected.Source = new SvgImageSource(new Uri(AppSelectorData.SourceSVG_SelectedImage));
}
//images.Selected.Source
Grid.SetRow(images.NotSelected, 0);
Grid.SetColumn(images.NotSelected, 0);
btnGrid.Children.Add(images.NotSelected);
Grid.SetRow(images.Selected, 0);
Grid.SetColumn(images.Selected, 0);
btnGrid.Children.Add(images.Selected);
if (this.MainOrientation == Orientation.Vertical && this.ShowMessages)
{
TextBlockEx tbMessage = new TextBlockEx()
{
Name = "Text",
Text = AppSelectorData.Message,
TextStyle = TextStyles.AppSelectorText,
FontSize = 20,
Opacity = 1,
VerticalAlignment = VerticalAlignment.Center,
TextStyleBold = TextStyles.AppSelectorTextBold
//TextStyleBold = (IsListView ? TextStyles.AppSelectorTextDarkBold: TextStyles.AppSelectorTextBold)
};
if (index == 0)
{
tbMessage.ShowBoldText(true);
}
Grid.SetRow(tbMessage, 0);
Grid.SetColumn(tbMessage, 1);// kk this isnt working just yet.
btnGrid.Children.Add(tbMessage);
}
if (!AppSelectorData.IsClearButton)
{
this.ImagePairs.Add(index, images);
}
HorizontalAlignment horizontalAlignment = HorizontalAlignment.Center;
// if we need to show messages then align left
if (this.MainOrientation == Orientation.Vertical && this.ShowMessages)
{
horizontalAlignment = HorizontalAlignment.Left;
}
AppSelectorButton sbButton = new AppSelectorButton()
{
ID = index,
Background = new SolidColorBrush(Colors.Transparent),
HorizontalAlignment = horizontalAlignment,
VerticalAlignment = VerticalAlignment.Center,
Content = btnGrid
};
//if (!IsListView)
//{
// sbButton.Background = new SolidColorBrush(Colors.Transparent);
//}
//else
//{
// sbButton.NormalBackground = (index % 2 == 0 ? BackGroundWhiteAcrylic : BackGroundGrayAcrylic);
// if (index == 0)
// {
// sbButton.Background = new SolidColorBrush(Colors.Blue);
// }
// else
// {
// sbButton.Background = sbButton.NormalBackground;
// }
//}
//only set the dimensions of the button if the control variables are passed in
// and the orientation is correct
if (this.ButtonHeight > 0)
{
sbButton.Height = this.ButtonHeight;
}
// if u need to show messages, dont set the width b/c theres no way to figure out the width
// if there is text
if (this.ButtonWidth > 0 && (!this.ShowMessages && !(this.MainOrientation == Orientation.Vertical)))
{
sbButton.Width = this.ButtonWidth;
}
if (null != _buttonStyle)
{
sbButton.Style = _buttonStyle;
}
;
if (AppSelectorData.IsClearButton)
{// these buttons get their own handler and dont change the selection of the app selector
sbButton.AddHandler(PointerReleasedEvent, new PointerEventHandler(Selector_ClearButtonClick), true);
}
else
{
sbButton.AddHandler(PointerReleasedEvent, new PointerEventHandler(Selector_ButtonClick), true);
}
btnGrid.PointerEntered += pointerEntered;
if (this.MainOrientation == Orientation.Horizontal)
{
Grid.SetRow(sbButton, 0);
Grid.SetColumn(sbButton, index);
}
else // vertical
{
Grid.SetColumn(sbButton, 0);
Grid.SetRow(sbButton, index);
}
if (!AppSelectorData.IsClearButton)
{// clear button is not a part of the regular buttons
this.Buttons.Add(sbButton);
}
_layoutRoot.Children.Add(sbButton);
_buttonList.Add(sbButton);
}
} // PlaceEmptyFeedbackPegs
// Method place answer pegs into the board
private void PlaceAnswerPegs(Grid answerGrid)
{
// Variables
Ellipse questionPeg;
StackPanel stackPanel;
// Image brush for the ellipse texture
ImageBrush ellipseBackground = new ImageBrush();
ellipseBackground.ImageSource = new BitmapImage(new Uri("ms-appx:/Assets/questionMark.png", UriKind.Absolute));
// For loop 4 columns
for (i = 0; i < _columns; i++)
{
stackPanel = new StackPanel()
{
Height = 80,
Width = 80,
HorizontalAlignment = HorizontalAlignment.Center,
VerticalAlignment = VerticalAlignment.Center,
};
questionPeg = new Ellipse
{
Name = "questionPeg " + (i + 1).ToString(),
Height = 80,
Width = 80,
HorizontalAlignment = HorizontalAlignment.Center,
VerticalAlignment = VerticalAlignment.Center,
Stroke = new SolidColorBrush(Colors.Black),
StrokeThickness = 2,
Fill = ellipseBackground
};
// Create answer pegs with while loop prevent duplicate colors
if (i == 0)
{
answerPeg1 = CreateAnswerPegs(i);
}
else if (i == 1)
{
answerPeg2 = CreateAnswerPegs(i);
while (((SolidColorBrush)answerPeg2.Fill).Color == ((SolidColorBrush)answerPeg1.Fill).Color)
{
answerPeg2 = CreateAnswerPegs(i);
}
}
else if (i == 2)
{
answerPeg3 = CreateAnswerPegs(i);
while (((SolidColorBrush)answerPeg3.Fill).Color == ((SolidColorBrush)answerPeg2.Fill).Color ||
((SolidColorBrush)answerPeg3.Fill).Color == ((SolidColorBrush)answerPeg1.Fill).Color)
{
answerPeg3 = CreateAnswerPegs(i);
}
}
else
{
answerPeg4 = CreateAnswerPegs(i);
while (((SolidColorBrush)answerPeg4.Fill).Color == ((SolidColorBrush)answerPeg3.Fill).Color ||
((SolidColorBrush)answerPeg4.Fill).Color == ((SolidColorBrush)answerPeg2.Fill).Color ||
((SolidColorBrush)answerPeg4.Fill).Color == ((SolidColorBrush)answerPeg1.Fill).Color)
{
answerPeg4 = CreateAnswerPegs(i);
}
} // if..else..if
// Add to parent
stackPanel.Children.Add(questionPeg);
stackPanel.SetValue(Grid.ColumnProperty, i);
answerGrid.Children.Add(stackPanel);
} // for i
} // PlaceAnswerPegs()
public void Init(ref Grid display)
{
_count = 0;
_state = RacerState.Select;
Layout(ref display);
}
private void GenerateButton(ImagePair imagePair, int i, int position)
{
Grid grid = new Grid()
{
Margin = new Thickness(0),
Padding = new Thickness(0)
};
if (this.ShowMessages && this.MainOrientation == Orientation.Vertical)
{
grid.ColumnDefinitions.Add(new ColumnDefinition()
{
Width = new GridLength(.5, GridUnitType.Star)
});
grid.ColumnDefinitions.Add(new ColumnDefinition()
{
Width = new GridLength(.5, GridUnitType.Star)
});
grid.ColumnSpacing = WIDTH_GRID_COLUMNSPACING;
}
Grid.SetRow(imagePair.NotSelected, 0);
Grid.SetColumn(imagePair.NotSelected, 0);
grid.Children.Add(imagePair.NotSelected);
Grid.SetRow(imagePair.Selected, 0);
Grid.SetColumn(imagePair.Selected, 0);
grid.Children.Add(imagePair.Selected);
HorizontalAlignment horizontalAlignment = HorizontalAlignment.Center;
// if we need to show messages then align left
if (this.MainOrientation == Orientation.Vertical && this.ShowMessages && !string.IsNullOrWhiteSpace(imagePair.Message))
{
horizontalAlignment = HorizontalAlignment.Left;
TextBlockEx tbMessage = new TextBlockEx()
{
Name = "TheText",
Text = imagePair.Message,
TextStyle = TextStyles.AppSelectorText,
FontSize = 20,
Opacity = 1,
VerticalAlignment = VerticalAlignment.Center,
TextStyleBold = TextStyles.AppSelectorTextBold
};
if (i == 0)
{
tbMessage.ShowBoldText(true);
}
Grid.SetRow(tbMessage, 0);
Grid.SetColumn(tbMessage, 1);// kk this isnt working just yet.
grid.Children.Add(tbMessage);
}
AppSelectorButton sbButton = new AppSelectorButton()
{
ID = i,
HorizontalAlignment = horizontalAlignment,
VerticalAlignment = VerticalAlignment.Center,
Content = grid
};
//if (!IsListView)
//{
// sbButton.Background = new SolidColorBrush(Colors.Transparent);
//}
//else
//{
// sbButton.NormalBackground = (i % 2 == 0 ? BackGroundWhiteAcrylic : BackGroundGrayAcrylic);
// if (i == 0)
// {
// sbButton.Background = new SolidColorBrush(Colors.Blue);
// }
// else
// {
// sbButton.Background = sbButton.NormalBackground;
// }
//}
//only set the dimensions of the button if the control variables are passed in
// and the orientation is correct
if (this.ButtonHeight > 0)
{
sbButton.Height = this.ButtonHeight;
}
// if u need to show messages, dont set the width b/c theres no way to figure out the width
// if there is text
if (this.ButtonWidth > 0 && (!this.ShowMessages && !(this.MainOrientation == Orientation.Vertical)))
{
sbButton.Width = this.ButtonWidth;
}
if (null != _buttonStyle)
{
sbButton.Style = _buttonStyle;
}
;
if (imagePair.IsClearButton)
{// these buttons get their own handler and dont change the selection of the app selector
sbButton.AddHandler(PointerReleasedEvent, new PointerEventHandler(Selector_ClearButtonClick), true);
}
else
{
sbButton.AddHandler(PointerReleasedEvent, new PointerEventHandler(Selector_ButtonClick), true);
}
grid.PointerEntered += pointerEntered;
if (this.MainOrientation == Orientation.Horizontal)
{
Grid.SetRow(sbButton, 0);
Grid.SetColumn(sbButton, position);
}
else // vertical
{
Grid.SetColumn(sbButton, 0);
Grid.SetRow(sbButton, position);
}
if (!imagePair.IsClearButton)
{// clear button is not a part of the regular buttons
this.Buttons.Add(sbButton);
}
_layoutRoot.Children.Add(sbButton);
_buttonList.Add(sbButton);
}
/// <summary>
/// When the commands text is clicked, switch to the commands CommandGrid panel in UI.
/// </summary>
/// <param name="sender"></param>
/// <param name="e"></param>
private void Commands_Click(object sender, RoutedEventArgs e)
{
lastPanel.Visibility = Visibility.Collapsed;
lastPanel = Commands;
Commands.Visibility = Visibility.Visible;
}
private void RenderUI()
{
// get the layout base (a canvas here)
_layoutRoot = (Grid)this.GetTemplateChild("LayoutRoot");
// if we can't get the layout root, we can't do anything
if (null == _layoutRoot)
{
return;
}
// update the grid
_layoutRoot.Name = "AppSelectorGrid";
// must construct additional columns or rows based on orientation and number
// keep 1.0 so it creates a ratio (double) for the width/height definitions
// coloring book will pass in image pairs, otherwise its a regular URI count from a normal app selector
int iButtonCount = this.ImagePairs.Count > 0 ? this.ImagePairs.Count + 1: URIs.Count;
double ratio = 1.0 / iButtonCount;
if (this.MainOrientation == Orientation.Horizontal)
{
_layoutRoot.ColumnSpacing = WIDTH_GRID_COLUMNSPACING;
_layoutRoot.RowDefinitions.Add(new RowDefinition());
for (int i = 0; i < iButtonCount; i++)
{
_layoutRoot.ColumnDefinitions.Add(new ColumnDefinition()
{
Width = new GridLength(ratio, GridUnitType.Star)
});
}
}
else
{
//_layoutRoot.RowSpacing = (!IsListView ? WIDTH_GRID_ROWSPACING: 0);
_layoutRoot.RowSpacing = WIDTH_GRID_ROWSPACING;
_layoutRoot.ColumnDefinitions.Add(new ColumnDefinition());
for (int i = 0; i < iButtonCount; i++)
{
_layoutRoot.RowDefinitions.Add(new RowDefinition()
{
Height = new GridLength(ratio, GridUnitType.Star)
});
}
}
// create the button style
//if (IsListView)
//{
// _buttonStyle = StyleHelper.GetApplicationStyle("ListViewButton");
//}
//else
//{
_buttonStyle = StyleHelper.GetApplicationStyle("AppSelectorButton");
//}
// JN loop this area to create images and buttons based on list
int index = 0;
if (this.ImagePairs.Count != 0)
{// hubris! dont add clearbutton image pair unless it has a value. should only have a value on colorbook
if (this.ClearButtonImagePair != null)
{
GenerateButton(this.ClearButtonImagePair, 0, 0);
index = 1;
}
else
{
index = 0;
}
for (int i = 0; i < this.ImagePairs.Count; i++, index++)
{
GenerateButton(this.ImagePairs[i], i, index);
}
}
else
{
for (int i = 0; i < this.URIs.Count; i++)
{
GenerateButton(this.URIs[i], i);
}
}
if (this.ShowSelectedLine)
{
selectedLine.StrokeThickness = 5;
double LineRightMargin = StyleHelper.GetApplicationDouble("AppSelectorLineBottomMargin");
double LineBottomMargin = StyleHelper.GetApplicationDouble("AppSelectorLineBottomMargin");
if (this.MainOrientation == Orientation.Vertical)
{
selectedLine.X1 = -LineRightMargin;
selectedLine.Y1 = VERTICAL_LINE_OFFSET;
selectedLine.X2 = -LineRightMargin;
selectedLine.Y2 = this.ButtonHeight + VERTICAL_LINE_OFFSET;
}
if (this.MainOrientation == Orientation.Horizontal)
{
selectedLine.X1 = 3;
selectedLine.Y1 = this.ButtonHeight + 5 + LineBottomMargin;
selectedLine.X2 = this.ButtonWidth + 4;// border thickness for some reason 2 on both sides
selectedLine.Y2 = this.ButtonHeight + 5 + LineBottomMargin;
}
SolidColorBrush SelectedLineColor = RadiatingButton.GetSolidColorBrush("#FF0078D4");
selectedLine.Stroke = SelectedLineColor;
selectedLine.Fill = SelectedLineColor;
_layoutRoot.Children.Add(selectedLine);
this.SelectedButton = this.Buttons[0];// set the first button as the selected button for line moving
// need sine easing
SineEase sineEaseIn = new SineEase()
{
EasingMode = EasingMode.EaseIn
};
// set this once here and forget it.
this.selectedLine.RenderTransform = this.translateTransform;
Duration duration = new Duration(new TimeSpan(0, 0, 0, 0, 400));
daAnimation = new DoubleAnimation()
{
Duration = duration,
EasingFunction = sineEaseIn
};
this.storyboard.Children.Add(daAnimation);
Storyboard.SetTarget(daAnimation, this.translateTransform);
if (this.MainOrientation == Orientation.Horizontal)
{
Storyboard.SetTargetProperty(daAnimation, "X");
}
if (this.MainOrientation == Orientation.Vertical)
{
Storyboard.SetTargetProperty(daAnimation, "Y");
}
}
// set up animations
_storyboardFadeIn = AnimationHelper.CreateEasingAnimation(_layoutRoot, "Opacity", 0.0, 0.0, 1.0, this.DurationInMilliseconds, this.StaggerDelayInMilliseconds, false, false, new RepeatBehavior(1d));
_storyboardFadeOut = AnimationHelper.CreateEasingAnimation(_layoutRoot, "Opacity", 1.0, 1.0, 0.0, this.DurationInMilliseconds, this.StaggerDelayInMilliseconds, false, false, new RepeatBehavior(1d));
this.UpdateUI();
}