Ejemplo n.º 1
0
        public void RadicalCanon()
        {
            var builder = CDK.Builder;

            IAtomContainer mola = builder.NewAtomContainer();

            mola.Atoms.Add(builder.NewAtom("CH3"));
            mola.Atoms.Add(builder.NewAtom("CH2"));
            mola.Atoms.Add(builder.NewAtom("CH2"));
            mola.Atoms.Add(builder.NewAtom("CH2"));
            mola.Atoms.Add(builder.NewAtom("CH2"));
            mola.Atoms.Add(builder.NewAtom("CH1"));
            mola.Atoms.Add(builder.NewAtom("CH3"));
            mola.AddBond(mola.Atoms[1], mola.Atoms[2], BondOrder.Single);
            mola.AddBond(mola.Atoms[2], mola.Atoms[3], BondOrder.Single);
            mola.AddBond(mola.Atoms[3], mola.Atoms[4], BondOrder.Single);
            mola.AddBond(mola.Atoms[4], mola.Atoms[5], BondOrder.Single);
            mola.AddBond(mola.Atoms[5], mola.Atoms[6], BondOrder.Single);
            mola.AddBond(mola.Atoms[0], mola.Atoms[5], BondOrder.Single);
            mola.AddSingleElectronTo(mola.Atoms[1]);

            SmilesParser    smipar = new SmilesParser(builder);
            var             molb   = smipar.ParseSmiles("CC(CCC[CH2])C |^1:5|");
            SmilesGenerator smigen = new SmilesGenerator(SmiFlavors.Canonical | SmiFlavors.CxRadical);

            Assert.AreEqual(smigen.Create(molb), smigen.Create(mola));
        }
Ejemplo n.º 2
0
        public void CanonAtomLabels()
        {
            var             mol    = smipar.ParseSmiles("c1ccccc1O |$_AV:0;1;2;3;4;5;6$|");
            SmilesGenerator smigen = new SmilesGenerator(SmiFlavors.Canonical | SmiFlavors.CxAtomValue);

            Assert.AreEqual("OC=1C=CC=CC1 |$_AV:6;5;0;1;2;3;4$|", smigen.Create(mol));
        }
Ejemplo n.º 3
0
        public void RoundTripReactionAtomLabelsAndFragmentGroups()
        {
            IReaction       rxn    = smipar.ParseReactionSmiles("CC(C)c1ccccc1.ClC([*])=O>ClCCl.[Al+3].[Cl-].[Cl-].[Cl-]>CC(C)c1ccc(cc1)C([*])=O |$;;;;;;;;;;;R1;;;;;;;;;;;;;;;;;;;R1;$,f:3.4.5.6|");
            SmilesGenerator smigen = new SmilesGenerator(SmiFlavors.CxAtomLabel |
                                                         SmiFlavors.CxFragmentGroup);

            Assert.AreEqual("CC(C)C1=CC=CC=C1.ClC(*)=O>ClCCl.[Al+3].[Cl-].[Cl-].[Cl-]>CC(C)C1=CC=C(C=C1)C(*)=O |f:3.4.5.6,$;;;;;;;;;;;R1;;;;;;;;;;;;;;;;;;;R1$|", smigen.Create(rxn));
        }
Ejemplo n.º 4
0
        public void RoundTripRadicals()
        {
            var             mol    = smipar.ParseSmiles("[C]1C[CH][CH]OC1 |^1:2,3,^2:0|");
            SmilesGenerator smigen = new SmilesGenerator(SmiFlavors.CxRadical);
            string          smi    = smigen.Create(mol);

            Assert.AreEqual("[C]1C[CH][CH]OC1 |^1:2,3,^2:0|", smi);
        }
Ejemplo n.º 5
0
        public void NoCoordsInEtOH()
        {
            var             mol    = smipar.ParseSmiles("CCO");
            SmilesGenerator smigen = new SmilesGenerator(SmiFlavors.CxCoordinates);
            string          smi    = smigen.Create(mol);

            Assert.AreEqual("CCO", smi);
        }
Ejemplo n.º 6
0
        public void NoCoordsOptEtOH()
        {
            var             mol    = smipar.ParseSmiles("CCO |(,,;1,1,;2,2,)|");
            SmilesGenerator smigen = new SmilesGenerator(0);
            string          smi    = smigen.Create(mol);

            Assert.AreEqual("CCO", smi);
        }
Ejemplo n.º 7
0
        public void CoordsEtOH()
        {
            var             mol    = smipar.ParseSmiles("CCO |(,,;1,1,;2,2,)|");
            SmilesGenerator smigen = new SmilesGenerator(SmiFlavors.CxCoordinates);
            string          smi    = smigen.Create(mol);

            Assert.AreEqual("CCO |(,,;1,1,;2,2,)|", smi);
        }
Ejemplo n.º 8
0
        public void RoundTripPEGn()
        {
            var             mol    = smipar.ParseSmiles("CCCOCCO |Sg:n:1,2,3::ht|");
            SmilesGenerator smigen = new SmilesGenerator(SmiFlavors.CxPolymer);
            string          smi    = smigen.Create(mol);

            Assert.AreEqual("CCCOCCO |Sg:n:1,2,3:n:ht|", smi);
        }
Ejemplo n.º 9
0
        public void RoundTripMulticenter()
        {
            var             mol    = smipar.ParseSmiles("c1ccccc1.*Cl |m:6:0.1.2.3.4.5|");
            SmilesGenerator smigen = new SmilesGenerator(SmiFlavors.UseAromaticSymbols |
                                                         SmiFlavors.CxMulticenter);
            string smi = smigen.Create(mol);

            Assert.AreEqual("c1ccccc1.*Cl |m:6:0.1.2.3.4.5|", smi);
        }
Ejemplo n.º 10
0
 public void Chembl367774()
 {
     using (MDLV2000Reader mdlr = new MDLV2000Reader(GetType().Assembly.GetManifestResourceStream(GetType(), "CHEMBL367774.mol")))
     {
         IAtomContainer  container = mdlr.Read(builder.NewAtomContainer());
         SmilesGenerator smigen    = new SmilesGenerator(SmiFlavors.CxSmiles);
         Assert.AreEqual("OC(=O)C1=CC(F)=CC=2NC(=NC12)C3=CC=C(C=C3F)C4=CC=CC=C4", smigen.Create(container));
     }
 }
Ejemplo n.º 11
0
        public void CanonicalReactionAtomLabelsAndFragmentGroups()
        {
            IReaction       rxn1   = smipar.ParseReactionSmiles("CC(C)c1ccccc1.ClC([*])=O>[Al+3].[Cl-].[Cl-].[Cl-].ClCCl>CC(C)c1ccc(cc1)C([*])=O |$;;;;;;;;;;;R1;;;;;;;;;;;;;;;;;;;R1;$,f:2.3.4.5|");
            IReaction       rxn2   = smipar.ParseReactionSmiles("ClC([*])=O.CC(C)c1ccccc1>[Al+3].[Cl-].[Cl-].[Cl-].ClCCl>CC(C)c1ccc(cc1)C([*])=O |$;;R1;;;;;;;;;;;;;;;;;;;;;;;;;;;;R1;$,f:2.3.5.4|");
            SmilesGenerator smigen = new SmilesGenerator(SmiFlavors.CxAtomLabel |
                                                         SmiFlavors.CxFragmentGroup |
                                                         SmiFlavors.Canonical);

            Assert.AreEqual(smigen.Create(rxn2), smigen.Create(rxn1));
        }
Ejemplo n.º 12
0
        public void CanonMulticenter()
        {
            var             mol    = smipar.ParseSmiles("c1ccccc1.*Cl |m:6:0.1.2.3.4.5|");
            SmilesGenerator smigen = new SmilesGenerator(SmiFlavors.UseAromaticSymbols |
                                                         SmiFlavors.CxMulticenter |
                                                         SmiFlavors.Canonical);
            string smi = smigen.Create(mol);

            Assert.AreEqual("*Cl.c1ccccc1 |m:0:2.3.4.5.6.7|", smi);
        }
Ejemplo n.º 13
0
 public void Chebi53695()
 {
     using (var ins = GetType().Assembly.GetManifestResourceStream(GetType(), "CHEBI_53695.mol"))
         using (var mdlr = new MDLV2000Reader(ins))
         {
             IAtomContainer  mol    = mdlr.Read(CDK.Builder.NewAtomContainer());
             SmilesGenerator smigen = new SmilesGenerator(SmiFlavors.CxSmiles | SmiFlavors.AtomicMassStrict);
             Assert.AreEqual("C(C(=O)OC)(C*)*C(C(C1=C(C(=C(C(=C1[2H])[2H])[2H])[2H])[2H])(*)[2H])([2H])[2H] |Sg:n:0,1,2,3,4,5:n:ht,Sg:n:8,9,10,11,12,13,14,15,16,17,18,19,20,22,23,24:m:ht|", smigen.Create(mol));
         }
 }
Ejemplo n.º 14
0
        public void GenerateLabelledSmiles()
        {
            var mol = new AtomContainer();

            mol.Atoms.Add(new Atom("C"));
            mol.Atoms[0].ImplicitHydrogenCount = 3;
            mol.Atoms.Add(new Atom("C"));
            mol.Atoms[1].ImplicitHydrogenCount = 2;
            mol.Atoms.Add(new PseudoAtom("R1"));
            mol.Atoms[2].ImplicitHydrogenCount = 0;
            mol.AddBond(mol.Atoms[0], mol.Atoms[1], BondOrder.Single);
            mol.AddBond(mol.Atoms[1], mol.Atoms[2], BondOrder.Single);
            SmilesGenerator smigen = new SmilesGenerator(SmiFlavors.CxAtomLabel);
            string          smi    = smigen.Create(mol);

            Assert.AreEqual("CC* |$;;R1$|", smi);
        }
Ejemplo n.º 15
0
        static void Main()
        {
            {
                #region SmiFlavors
                SmilesGenerator smigen = new SmilesGenerator(SmiFlavors.Isomeric);
                #endregion
            }
            {
                #region SmiFlavor_Isomeric
                SmilesGenerator smigen = new SmilesGenerator(SmiFlavors.Stereo | SmiFlavors.AtomicMass);
                #endregion
            }
            {
                string          smi = null;
                SmilesGenerator sg  = null;
                {
                    #region 1
                    IAtomContainer ethanol = TestMoleculeFactory.MakeEthanol();
                    sg  = new SmilesGenerator(SmiFlavors.Generic);
                    smi = sg.Create(ethanol); // CCO, C(C)O, C(O)C, or OCC

                    sg  = SmilesGenerator.Unique;
                    smi = sg.Create(ethanol); // only CCO
                    #endregion

                    #region 2
                    IAtomContainer benzene = TestMoleculeFactory.MakeBenzene();

                    // 'benzene' molecule has no arom flags, we always get Kekulé output
                    sg  = new SmilesGenerator(SmiFlavors.Generic);
                    smi = sg.Create(benzene); // C1=CC=CC=C1

                    sg  = new SmilesGenerator(SmiFlavors.Generic | SmiFlavors.UseAromaticSymbols);
                    smi = sg.Create(benzene); // C1=CC=CC=C1 flags not set!

                    // Note, in practice we'd use an aromaticity algorithm
                    foreach (IAtom a in benzene.Atoms)
                    {
                        a.IsAromatic = true;
                    }
                    foreach (IBond b in benzene.Bonds)
                    {
                        b.IsAromatic = true;
                    }

                    // 'benzene' molecule now has arom flags, we always get aromatic SMILES if we request it
                    sg  = new SmilesGenerator(SmiFlavors.Generic);
                    smi = sg.Create(benzene); // C1=CC=CC=C1

                    sg  = new SmilesGenerator(SmiFlavors.Generic | SmiFlavors.UseAromaticSymbols);
                    smi = sg.Create(benzene); // c1ccccc1
                    #endregion
                }
            }
            {
                #region 4
                IAtomContainer  mol = TestMoleculeFactory.MakeAlphaPinene();
                SmilesGenerator sg  = new SmilesGenerator(SmiFlavors.Generic);

                int   n     = mol.Atoms.Count;
                int[] order = new int[n];

                // the order array is filled up as the SMILES is generated
                string smi = sg.Create(mol, order);

                // load the coordinates array such that they are in the order the atoms
                // are read when parsing the SMILES
                Vector2[] coords = new Vector2[mol.Atoms.Count];
                for (int i = 0; i < coords.Length; i++)
                {
                    coords[order[i]] = mol.Atoms[i].Point2D.Value;
                }

                // SMILES string suffixed by the coordinates
                string smi2d = smi + " " + Arrays.ToJavaString(coords);
                #endregion
            }
            {
                #region 5 ctor_SmiFlavor
                SmilesGenerator smigen = new SmilesGenerator(SmiFlavors.Stereo | SmiFlavors.Canonical);
                #endregion
            }
            {
                #region Aromatic
                SmilesGenerator smigen = new SmilesGenerator(SmiFlavors.UseAromaticSymbols);
                #endregion
            }

            {
                IAtomContainer container = null;
                #region WithAtomClasses
                SmilesGenerator smigen = new SmilesGenerator(SmiFlavors.AtomAtomMap);
                smigen.CreateSMILES(container); // C[CH2:4]O second atom has class = 4
                #endregion
            }

            {
                #region WithAtomClasses
                IAtomContainer  container = TestMoleculeFactory.MakeAlphaPinene();
                SmilesGenerator smilesGen = SmilesGenerator.Unique.WithAtomClasses();
                smilesGen.CreateSMILES(container); // C[CH2:4]O second atom has class = 4
                #endregion
            }
            {
                #region Create_IAtomContainer_int
                IAtomContainer  mol = TestMoleculeFactory.MakeAlphaPinene();
                SmilesGenerator sg  = new SmilesGenerator();

                int   n     = mol.Atoms.Count;
                int[] order = new int[n];

                // the order array is filled up as the SMILES is generated
                string smi = sg.Create(mol, order);

                // load the coordinates array such that they are in the order the atoms
                // are read when parsing the SMILES
                Vector2[] coords = new Vector2[mol.Atoms.Count];
                for (int i = 0; i < coords.Length; i++)
                {
                    coords[order[i]] = mol.Atoms[i].Point2D.Value;
                }

                // SMILES string suffixed by the coordinates
                string smi2d = smi + " " + Arrays.ToJavaString(coords);
                #endregion
            }
            {
                IAtomContainer container = null;
                #region Create_IAtomContainer_int_int
                IAtomContainer  mol = TestMoleculeFactory.MakeAlphaPinene();
                SmilesGenerator sg  = new SmilesGenerator();

                int   n     = mol.Atoms.Count;
                int[] order = new int[n];

                // the order array is filled up as the SMILES is generated
                string smi = sg.Create(mol, order);

                // load the coordinates array such that they are in the order the atoms
                // are read when parsing the SMILES
                Vector2[] coords = new Vector2[mol.Atoms.Count];
                for (int i = 0; i < coords.Length; i++)
                {
                    coords[order[i]] = container.Atoms[i].Point2D.Value;
                }

                // SMILES string suffixed by the coordinates
                string smi2d = smi + " " + Arrays.ToJavaString(coords);
                #endregion
            }
        }