public static Tuple <Vector3Collection, Color4Collection> BPtoPointCloud(Vector3Collection imageSpace, List <LMData> lmDataList, double angleThreshold = 5, double minCountPercent = 0)
{
if (minCountPercent > 1 || minCountPercent < 0)
{
throw new ArgumentOutOfRangeException(nameof(minCountPercent));
}
Vector3Collection vector3sOut = new Vector3Collection();
Color4Collection color4sOut = new Color4Collection();
if (imageSpace.Count == 0 || lmDataList.Count == 0)
{
var tupleOut1 = new Tuple <Vector3Collection, Color4Collection>(vector3sOut, color4sOut);
return(tupleOut1);
}
int[] counts = new int[imageSpace.Count];
var templmlist = lmDataList.ToArray();
foreach (var lmData in templmlist)
{
if (lmData.Type == LMData.InteractionType.Compton)
{
Parallel.For(0, imageSpace.Count, i =>
{
if (IsEffectedBPPoint(lmData.ScatterLMDataInfos[0].RelativeInteractionPoint3D, lmData.ScatterLMDataInfos[0].InteractionEnergy,
lmData.AbsorberLMDataInfos[0].RelativeInteractionPoint3D, lmData.AbsorberLMDataInfos[0].InteractionEnergy,
imageSpace[i].ToPoint3D(), angleThreshold))
{
counts[i]++;
}
});
}
}
int maxCount = counts.Max();
int minCount = Convert.ToInt32(Math.Round(maxCount * minCountPercent));
if (maxCount < 5)
{
var tupleOut2 = new Tuple <Vector3Collection, Color4Collection>(vector3sOut, color4sOut);
return(tupleOut2);
}
for (int i = 0; i < imageSpace.Count; i++)
{
if (counts[i] > minCount)
{
vector3sOut.Add(imageSpace[i]);
color4sOut.Add(ColorScaleJet(counts[i], minCount, maxCount));
}
}
var tupleOut3 = new Tuple <Vector3Collection, Color4Collection>(vector3sOut, color4sOut);
return(tupleOut3);
}
void DrawBPPointCloudToSLAMPointCloud()
{
Stopwatch sw = new Stopwatch();
sw.Start();
VMStatus = $"Reconing......SLAM! {elapsedTime} ms";
var vc = new Vector3Collection();
var cc = new Color4Collection();
var tempposeVect = new List <double[]>();
var tempColorVect = new List <double[]>();
RealsenseControl.GetReconSLAMPointCloud(ref tempposeVect, ref tempColorVect);
for (int i = 0; i < tempposeVect.Count; i++)
{
vc.Add(new Vector3(Convert.ToSingle(tempposeVect[i][0]), Convert.ToSingle(tempposeVect[i][1]), Convert.ToSingle(tempposeVect[i][2])));
cc.Add(new Color4(Convert.ToSingle(tempColorVect[i][0]), Convert.ToSingle(tempColorVect[i][1]), Convert.ToSingle(tempColorVect[i][2]), 0.5f));
}
SLAMReconPointCloud = new PointGeometry3D()
{
Positions = vc, Colors = cc
};
sw.Stop();
elapsedTime = sw.ElapsedMilliseconds;
VMStatus = "Reconing......SLAM Done!";
}
private void LoadThreadFunction()
{
PCD wrapper = new PCD();
Points[] rawPoints = wrapper.LoadPointcloud(Location);
var points = new PointGeometry3D();
var col = new Color4Collection();
var ptPos = new Vector3Collection();
var ptIdx = new IntCollection();
var ptNormals = new Vector3Collection();
var numberOfElements = rawPoints.Length;
var additionalTurns = 0;
foreach (var point in rawPoints)
{
ptIdx.Add(ptPos.Count);
ptPos.Add(new Vector3(point.x, point.z, -point.y));
col.Add(new Color4(new Color3(point.r / (float)255, point.g / (float)255, point.b / (float)255)));
ptNormals.Add(new Vector3(0, 1, 0));
}
if ((rawPoints.Length / 3) * 3 != rawPoints.Length)
{
additionalTurns = ((rawPoints.Length / 3 + 1) * 3) - rawPoints.Length;
}
for (int i = 0; i < additionalTurns; i++)
{
ptIdx.Add(ptPos.Count);
ptPos.Add(ptPos[ptPos.Count - 1]);
col.Add(col[col.Count - 1]);
ptNormals.Add(ptNormals[ptNormals.Count - 1]);
}
points.Positions = ptPos;
points.Indices = ptIdx;
points.Colors = col;
//points.Normals = ptNormals;
Data = points;
}
public static (Vector3Collection, Color4Collection) BPtoPointCloud2Pi(Vector3Collection imageSpace, List <LMData> lmDataList, double angleThreshold = 5, double minCountPercent = 0)
{
if (minCountPercent > 1 || minCountPercent < 0)
{
throw new ArgumentOutOfRangeException(nameof(minCountPercent));
}
Vector3Collection vector3sOut = new Vector3Collection();
Color4Collection color4sOut = new Color4Collection();
if (imageSpace.Count == 0 || lmDataList.Count == 0)
{
return(vector3sOut, color4sOut);
}
int[] counts = new int[imageSpace.Count];
foreach (var lmData in lmDataList)
{
if (lmData.Type == LMData.InteractionType.Compton)
{
for (int i = 0; i < imageSpace.Count; ++i)
{
if (IsEffectedBPPoint2Pi(lmData.ScatterLMDataInfo.TransformedInteractionPoint3D, lmData.ScatterLMDataInfo.InteractionEnergy,
lmData.AbsorberLMDataInfo.TransformedInteractionPoint3D, lmData.AbsorberLMDataInfo.InteractionEnergy,
imageSpace[i].ToPoint3D(), lmData.DeviceTransformMatrix, angleThreshold))
{
counts[i]++;
}
}
}
}
int maxCount = counts.Max();
int minCount = Convert.ToInt32(Math.Round(maxCount * minCountPercent));
if (maxCount < 5)
{
return(vector3sOut, color4sOut);
}
for (int i = 0; i < imageSpace.Count; i++)
{
if (counts[i] > minCount)
{
vector3sOut.Add(imageSpace[i]);
color4sOut.Add(ColorScaleJet(counts[i], minCount, maxCount));
}
}
return(vector3sOut, color4sOut);
}
public static Color4Collection ScaleGridColors(IEnumerable <HelixToolkit.Wpf.SharpDX.Geometry3D.Line> lines, double min, double max, Enums.colorScales colorScale)
{
var colorList = new Color4Collection();
switchColorScale(colorScale);
foreach (var line in lines)
{
var avg = (line.P0.Z + line.P1.Z) / 2;
if (avg > (float)max)
{
colorList.Add(new Color4(scaleHolder((float)min, (float)max, (float)max)));
colorList.Add(new Color4(scaleHolder((float)min, (float)max, (float)max)));
}
else if (avg < (float)min)
{
colorList.Add(new Color4(scaleHolder((float)min, (float)max, (float)min)));
colorList.Add(new Color4(scaleHolder((float)min, (float)max, (float)min)));
}
else
{
colorList.Add(scaleHolder((float)min, (float)max, (float)avg));
colorList.Add(scaleHolder((float)min, (float)max, (float)avg));
}
}
return(colorList);
}
private void LoadThreadFunction()
{
var pt = new PotreeNode(new Uri(Location));
var points = new PointGeometry3D();
var col = new Color4Collection();
var ptPos = new Vector3Collection();
var ptIdx = new IntCollection();
var j = 0;
foreach (var p in pt.Compilation.Points)
{
ptPos.Add(new Vector3(p.x, p.y, p.z));
ptIdx.Add(j);
col.Add(new Color4(p.r / 255f, p.g / 255f, p.b / 255f, p.a / 255f));
j++;
}
var additionalTurns = 0;
if ((pt.Compilation.Points.Count / 3) * 3 != pt.Compilation.Points.Count)
{
additionalTurns = ((pt.Compilation.Points.Count / 3 + 1) * 3) - pt.Compilation.Points.Count;
}
for (int i = 0; i < additionalTurns; i++)
{
ptIdx.Add(ptPos.Count);
ptPos.Add(ptPos[ptPos.Count - 1]);
col.Add(col[col.Count - 1]);
}
points.Positions = ptPos;
points.Indices = ptIdx;
points.Colors = col;
Data = points;
}
private void LoadThreadFunction()
{
var pt = new Potree(new Uri(Filename));
var points = new PointGeometry3D();
var col = new Color4Collection();
var ptPos = new Vector3Collection();
var ptIdx = new IntCollection();
var j = 0;
foreach (var p in pt.Compilation.Points)
{
ptPos.Add(new Vector3(p.x, p.y, p.z));
ptIdx.Add(j);
col.Add(new Color4(p.r/255f, p.g / 255f, p.b / 255f, p.a / 255f));
j++;
}
var additionalTurns = 0;
if ((pt.Compilation.Points.Count / 3) * 3 != pt.Compilation.Points.Count)
{
additionalTurns = ((pt.Compilation.Points.Count / 3 + 1) * 3) - pt.Compilation.Points.Count;
}
for (int i = 0; i < additionalTurns; i++)
{
ptIdx.Add(ptPos.Count);
ptPos.Add(ptPos[ptPos.Count - 1]);
col.Add(col[col.Count - 1]);
}
points.Positions = ptPos;
points.Indices = ptIdx;
points.Colors = col;
Data = points;
}
/// <summary>
/// Add axis in positive, 0.1 m
/// </summary>
private void AddAxisPoints()
{
Vector3Collection vector3s = new Vector3Collection();
Color4Collection color4s = new Color4Collection();
vector3s.Add(new SharpDX.Vector3());
color4s.Add(new SharpDX.Color4(0, 0, 0, 1));
for (int i = 1; i < 50; i++)
{
if (i % 10 == 0)
{
vector3s.Add(new SharpDX.Vector3()
{
X = 0.1f * i
});
color4s.Add(new SharpDX.Color4(0, 1, 1, 1));
vector3s.Add(new SharpDX.Vector3()
{
Y = 0.1f * i
});
color4s.Add(new SharpDX.Color4(1, 0, 1, 1));
vector3s.Add(new SharpDX.Vector3()
{
Z = 0.1f * i
});
color4s.Add(new SharpDX.Color4(1, 1, 0, 1));
}
else
{
vector3s.Add(new SharpDX.Vector3()
{
X = 0.1f * i
});
color4s.Add(new SharpDX.Color4(1, 0, 0, 1));
vector3s.Add(new SharpDX.Vector3()
{
Y = 0.1f * i
});
color4s.Add(new SharpDX.Color4(0, 1, 0, 1));
vector3s.Add(new SharpDX.Vector3()
{
Z = 0.1f * i
});
color4s.Add(new SharpDX.Color4(0, 0, 1, 1));
}
}
AxisPoint = new PointGeometry3D()
{
Positions = vector3s, Colors = color4s
};
}
public static PointGeometry3D ConvertToPointGeometry3D(Points[] points)
{
var geometry = new PointGeometry3D();
var col = new Color4Collection();
var ptPos = new Vector3Collection();
var ptIdx = new IntCollection();
var ptNormals = new Vector3Collection();
var additionalTurns = 0;
foreach (var point in points)
{
ptIdx.Add(ptPos.Count);
ptPos.Add(new Vector3(point.x, point.y, point.z));
col.Add(new Color4(new Color3(point.r / (float)255, point.g / (float)255, point.b / (float)255)));
ptNormals.Add(new Vector3(0, 1, 0));
}
if ((points.Length / 3) * 3 != points.Length)
{
additionalTurns = ((points.Length / 3 + 1) * 3) - points.Length;
}
for (int i = 0; i < additionalTurns; i++)
{
ptIdx.Add(ptPos.Count);
ptPos.Add(ptPos[ptPos.Count - 1]);
col.Add(col[col.Count - 1]);
ptNormals.Add(ptNormals[ptNormals.Count - 1]);
}
geometry.Positions = ptPos;
geometry.Indices = ptIdx;
geometry.Colors = col;
return(geometry);
}
public static Color4Collection ScalePointColors(Vector3Collection points, double actualMin, double actualMax, double newMin, double newMax, Enums.colorScales colorScale)
{
var temp = new Color4Collection();
switchColorScale(colorScale);
foreach (var item in points)
{
if (item.Z > (float)newMax)
{
temp.Add(new Color4(VisualizationTools.scaleHolder((float)actualMin, (float)newMax, (float)newMax)));
}
else if (item.Z < (float)newMin)
{
temp.Add(new Color4(VisualizationTools.scaleHolder((float)newMin, (float)actualMax, (float)newMin)));
}
else
{
temp.Add(new Color4(VisualizationTools.scaleHolder((float)newMin, (float)newMax, item.Z)));
}
}
return(temp);
}
public void SetOspMaterial()
{
if (DiffuseColor != null)
{
this.Material = new PhongMaterial();
Color4Collection colors = new Color4Collection();
for (int i = 0; i < this.Geometry.Positions.Count; i++)
{
colors.Add(DiffuseColor.ToColor4());
}
this.Geometry.Colors = colors;
}
}
public static Color4Collection ToColor4Collection(this byte[] collection)
{
var colors = new Color4Collection();
for (var i = 0; i < collection.Count(); i += 4)
{
var a = collection[i] / 255.0f;
var b = collection[i + 1] / 255.0f;
var c = collection[i + 2] / 255.0f;
var d = collection[i + 3] / 255.0f;
var newColor = new Color4(a, b, c, d);
colors.Add(newColor);
}
return(colors);
}
public void UpdateSLAMPointCloud()
{
int Error = 0;
var pose = new List <HelixToolkit.Wpf.SharpDX.Geometry3D.Line>();
var line = new LineBuilder();
Vector3 previousPose = new Vector3(Convert.ToSingle(poseX), Convert.ToSingle(poseY), Convert.ToSingle(poseZ));
while (IsSLAMOn)
{
var vc = new Vector3Collection();
var id = new IntCollection();
var cc = new Color4Collection();
var poseVect = new List <double[]>();
var colorVect = new List <double[]>();
Vector3 currentPose = new Vector3(Convert.ToSingle(poseX), Convert.ToSingle(poseY), Convert.ToSingle(poseZ));
line.AddLine(previousPose, currentPose);
SLAMPoseInfo = line.ToLineGeometry3D();
previousPose = currentPose;
try
{
RealsenseControl.GetSLAMPointCloud(ref poseVect, ref colorVect, T265ToLACCOffset.X, T265ToLACCOffset.Y, T265ToLACCOffset.Z);
for (int i = 0; i < poseVect.Count; i++)
{
vc.Add(new Vector3(Convert.ToSingle(poseVect[i][0]), Convert.ToSingle(poseVect[i][1]), Convert.ToSingle(poseVect[i][2])));
cc.Add(new Color4(0.1f, 0.1f, 0.1f, 0.5f));
//cc.Add(new Color4(Convert.ToSingle(colorVect[i][0]), Convert.ToSingle(colorVect[i][1]), Convert.ToSingle(colorVect[i][2]), 0.5f));
id.Add(i);
}
SLAMPointCloud = new PointGeometry3D()
{
Positions = vc, Indices = id, Colors = cc
};
}
catch
{
Error++;
Trace.WriteLine("Error Count is " + Error);
}
Thread.Sleep(50);
}
}
/// <summary>
/// Create the grid
/// </summary>
private void DrawGrid()
{
Grid = new LineGeometry3D();
var positions = new Vector3Collection();
var indices = new IntCollection();
var colors = new Color4Collection();
for (var i = 0; i < 10; i += 1)
{
for (var j = 0; j < 10; j += 1)
{
DrawGridPatch(positions, indices, colors, -50 + i * 10, -50 + j * 10);
}
}
Grid.Positions = positions;
Grid.Indices = indices;
Grid.Colors = colors;
Axes = new LineGeometry3D();
var axesPositions = new Vector3Collection();
var axesIndices = new IntCollection();
var axesColors = new Color4Collection();
// Draw the coordinate axes
axesPositions.Add(new Vector3());
axesIndices.Add(axesPositions.Count - 1);
axesPositions.Add(new Vector3(50, 0, 0));
axesIndices.Add(axesPositions.Count - 1);
axesColors.Add(SharpDX.Color.Red);
axesColors.Add(SharpDX.Color.Red);
axesPositions.Add(new Vector3());
axesIndices.Add(axesPositions.Count - 1);
axesPositions.Add(new Vector3(0, 5, 0));
axesIndices.Add(axesPositions.Count - 1);
axesColors.Add(SharpDX.Color.Blue);
axesColors.Add(SharpDX.Color.Blue);
axesPositions.Add(new Vector3());
axesIndices.Add(axesPositions.Count - 1);
axesPositions.Add(new Vector3(0, 0, -50));
axesIndices.Add(axesPositions.Count - 1);
axesColors.Add(SharpDX.Color.Green);
axesColors.Add(SharpDX.Color.Green);
Axes.Positions = axesPositions;
Axes.Indices = axesIndices;
Axes.Colors = axesColors;
}
public static Color4Collection Parse(string source)
{
IFormatProvider formatProvider = CultureInfo.InvariantCulture;
var th = new TokenizerHelper(source, formatProvider);
var resource = new Color4Collection();
Color4 value;
while (th.NextToken())
{
value = new Color4(
Convert.ToSingle(th.GetCurrentToken(), formatProvider),
Convert.ToSingle(th.NextTokenRequired(), formatProvider),
Convert.ToSingle(th.NextTokenRequired(), formatProvider),
Convert.ToSingle(th.NextTokenRequired(), formatProvider));
resource.Add(value);
}
return(resource);
}
public void UpdateRealTimePointCloud()
{
int error = 0;
while (IsRealsensePipelineOn)
{
var vc = new Vector3Collection();
var id = new IntCollection();
var cc = new Color4Collection();
var poseVect = new List <double[]>();
var colorVect = new List <double[]>();
//Debug.WriteLine("Start to get Reatime Data");
try
{
RealsenseControl.GetRealTimePointCloud(ref poseVect, ref colorVect, T265ToLACCOffset.X, T265ToLACCOffset.Y, T265ToLACCOffset.Z);
for (int i = 0; i < poseVect.Count; i++)
{
vc.Add(new Vector3(Convert.ToSingle(poseVect[i][0]), Convert.ToSingle(poseVect[i][1]), Convert.ToSingle(poseVect[i][2])));
cc.Add(new Color4(Convert.ToSingle(colorVect[i][0]), Convert.ToSingle(colorVect[i][1]), Convert.ToSingle(colorVect[i][2]), 0.8f));
//id.Add(i);
}
RTPointCloud = new PointGeometry3D()
{
Positions = vc, Colors = cc
};
}
catch
{
error++;
Trace.WriteLine("Error Count is " + error);
}
}
}
public static void AddPointCloud(Dictionary <KeyValuePair <int, int>, double> PointCollection, out PointModel Points,
out GridModel Grid, out AxisModel Axis, out HelixToolkit.Wpf.SharpDX.Camera Camera, bool cameraType = false)
{
Camera = null;
Points = null;
Grid = null;
Axis = null;
var points = new PointGeometry3D();
var col = new Color4Collection(); // color gradient
var ptPos = new Vector3Collection(); // point positions
var ptIdx = new IntCollection(); // point indexes
if (PointCollection != null && PointCollection.Count() > 1)
{
//newdataFromTxt(path, positionX, positionY, positionZ);
var maxX = PointCollection.Max(x => x.Key.Key); // X
var minX = PointCollection.Min(x => x.Key.Key); // X
var maxY = PointCollection.Max(x => x.Key.Value); // Y
var minY = PointCollection.Min(x => x.Key.Value); // Y
var maxZ = PointCollection.Max(x => x.Value); // Z
var minZ = PointCollection.Min(x => x.Value); // Z
var minYObj = PointCollection.First(x => x.Key.Value == minY);
Trace.WriteLine($"{maxX} {minX} {maxY} {minY} {maxZ} {minZ}");
if (PointCollection.Count() <= 0)
{
return;
}
foreach (var point in PointCollection)
{
var positionToColour = point.Value;
ptIdx.Add(ptPos.Count);
ptPos.Add(new Vector3((float)point.Key.Key, ((float)point.Key.Value), (float)point.Value));
col.Add(new Color4(RedBlueScale((float)minZ, (float)maxZ, (float)positionToColour)));
}
Points = new PointModel
{
// indexes and color gradient
PointsGeometry = new PointGeometry3D {
Positions = ptPos, Indices = ptIdx, Colors = col
},
PointsColor = Colors.White,
PointsTransform = new TranslateTransform3D(-minX, -minY, -minZ)
};
// floor plane grid
LineBuilder gridLines = new LineBuilder();
VisualizationTools.CreateGrid(gridLines, maxX, minX, maxY, minY, minZ);
Grid = new GridModel
{
GridGeometry = gridLines.ToLineGeometry3D(),
GridColor = new Color4(153 / 255.0f, 204 / 255.0f, 255 / 255.0f, 0.3f).ToColor(),
GridTransform = new TranslateTransform3D(0, 0, 0)
};
// lines
LineBuilder arrows = new LineBuilder();
VisualizationTools.CreateAxes(arrows, (float)maxX, (float)minX, (float)maxY, (float)minY, (float)maxZ, (float)minZ);
Axis = new AxisModel
{
AxisGeometry = arrows.ToLineGeometry3D(),
AxisColor = new Color4(0, 255 / 255.0f, 255 / 255.0f, 0.5f).ToColor(),
AxisTransform = new TranslateTransform3D(0, 0, 0)
};
if (cameraType == false)
{
Camera = new HelixToolkit.Wpf.SharpDX.PerspectiveCamera
{
Position = new Point3D(0, 0, Math.Abs(minZ * 100)),
LookDirection = new Vector3D(((float)maxX - (float)minX) / 2, ((float)maxY - (float)minY) / 2, -Math.Abs(minZ * 100)),//z kamerą jest problem przy przybliżaniu prawdopodobnie przez ten LookDirection albo sposób poruszania kamerą
UpDirection = new Vector3D(0, 1, 0),
FarPlaneDistance = 5000000
};
}
else
{
Camera = new HelixToolkit.Wpf.SharpDX.OrthographicCamera
{
Position = new Point3D(0, 0, Math.Abs(minZ * 100)),
LookDirection = new Vector3D(((float)maxX - (float)minX) / 2, ((float)maxY - (float)minY) / 2, -Math.Abs(minZ * 100)),//z kamerą jest problem przy przybliżaniu prawdopodobnie przez ten LookDirection albo sposób poruszania kamerą
UpDirection = new Vector3D(0, 1, 0),
FarPlaneDistance = 5000000
};
}
}
}
public void UpdateSLAMPointCloud()
{
var line = new LineBuilder();
Vector3 previousPose = new Vector3(Convert.ToSingle(systemPoseX), Convert.ToSingle(systemPoseY), Convert.ToSingle(systemPoseZ));
var poseVect = new List <double[]>();
var colorVect = new List <double[]>();
Point3D lineVect = new Point3D(0, 0, 0.3);
while (IsSLAMOn)
{
Thread.Sleep(500);
var vc = new Vector3Collection();
var cc = new Color4Collection();
poseVect = new List <double[]>();
colorVect = new List <double[]>();
Vector3 currentPose = new Vector3(Convert.ToSingle(systemPoseX), Convert.ToSingle(systemPoseY), Convert.ToSingle(systemPoseZ));
line.AddLine(previousPose, currentPose);
SLAMPoseInfo = line.ToLineGeometry3D();
previousPose = currentPose;
RealsenseControl.GetSLAMPointCloud(ref poseVect, ref colorVect);
for (int i = 0; i < poseVect.Count; i++)
{
vc.Add(new Vector3(Convert.ToSingle(poseVect[i][0]), Convert.ToSingle(poseVect[i][1]), Convert.ToSingle(poseVect[i][2])));
//cc.Add(new Color4(0.1f, 0.1f, 0.1f, 0.5f));
cc.Add(new Color4(Convert.ToSingle(colorVect[i][0]), Convert.ToSingle(colorVect[i][1]), Convert.ToSingle(colorVect[i][2]), 0.5f));
//id.Add(i);
}
for (int i = 0; i < 10; ++i)
{
var pointx = new Point3D(0.1 * i, 0, 0);
var pointy = new Point3D(0, 0.1 * i, 0);
var pointz = new Point3D(0, 0, 0.1 * i);
vc.Add(new Vector3(Convert.ToSingle(pointx.X), Convert.ToSingle(pointx.Y), Convert.ToSingle(pointx.Z)));
cc.Add(new Color4(1f, 0f, 0f, 1f));
vc.Add(new Vector3(Convert.ToSingle(pointy.X), Convert.ToSingle(pointy.Y), Convert.ToSingle(pointy.Z)));
cc.Add(new Color4(0f, 1f, 0f, 1f));
vc.Add(new Vector3(Convert.ToSingle(pointz.X), Convert.ToSingle(pointz.Y), Convert.ToSingle(pointz.Z)));
cc.Add(new Color4(0f, 0f, 1f, 1f));
}
for (int i = 0; i < 10; ++i)
{
var pointx = currentSystemTranformation.Transform(new Point3D(0.1 * i, 0, 0));
var pointy = currentSystemTranformation.Transform(new Point3D(0, 0.1 * i, 0));
var pointz = currentSystemTranformation.Transform(new Point3D(0, 0, 0.1 * i));
vc.Add(new Vector3(Convert.ToSingle(pointx.X), Convert.ToSingle(pointx.Y), Convert.ToSingle(pointx.Z)));
cc.Add(new Color4(1f, 0f, 0f, 1f));
vc.Add(new Vector3(Convert.ToSingle(pointy.X), Convert.ToSingle(pointy.Y), Convert.ToSingle(pointy.Z)));
cc.Add(new Color4(0f, 1f, 0f, 1f));
vc.Add(new Vector3(Convert.ToSingle(pointz.X), Convert.ToSingle(pointz.Y), Convert.ToSingle(pointz.Z)));
cc.Add(new Color4(0f, 0f, 1f, 1f));
}
SLAMPointCloud = new PointGeometry3D()
{
Positions = vc, Colors = cc
};
SLAMVector3s = vc;
}
Debug.WriteLine("SLAM Point Cloud Count is " + poseVect.Count);
}
private void LoadThreadFunction()
{
PCD wrapper = new PCD();
Points[] rawPoints = wrapper.LoadPointcloud(Filename);
var points = new PointGeometry3D();
var col = new Color4Collection();
var ptPos = new Vector3Collection();
var ptIdx = new IntCollection();
var ptNormals = new Vector3Collection();
var numberOfElements = rawPoints.Length;
var additionalTurns = 0;
foreach (var point in rawPoints)
{
ptIdx.Add(ptPos.Count);
ptPos.Add(new Vector3(point.x, point.z, -point.y));
col.Add(new Color4(new Color3(point.r / (float)255, point.g / (float)255, point.b / (float)255)));
ptNormals.Add(new Vector3(0, 1, 0));
}
if ((rawPoints.Length / 3) * 3 != rawPoints.Length)
{
additionalTurns = ((rawPoints.Length / 3 + 1) * 3) - rawPoints.Length;
}
for (int i = 0; i < additionalTurns; i++)
{
ptIdx.Add(ptPos.Count);
ptPos.Add(ptPos[ptPos.Count-1]);
col.Add(col[col.Count - 1]);
ptNormals.Add(ptNormals[ptNormals.Count - 1]);
}
points.Positions = ptPos;
points.Indices = ptIdx;
points.Colors = col;
//points.Normals = ptNormals;
Data = points;
}
/// <summary>
/// Parses the MDL file to obtain model information
/// </summary>
/// <param name="selectedItem">The currently selected item</param>
/// <param name="selectedRace">The currently selected race</param>
/// <param name="selectedBody">The currently selected body</param>
/// <param name="selectedPart">The currently selected part</param>
/// <param name="selectedCategory">The items category </param>
public MDL(ItemData selectedItem, string selectedCategory, string selectedRace, string selectedBody, string selectedPart)
{
string itemType = Helper.GetCategoryType(selectedCategory);
string MDLFolder = "";
if (itemType.Equals("weapon") || itemType.Equals("food"))
{
if (selectedPart.Equals("Secondary"))
{
MDLFolder = string.Format(Strings.WeapMDLFolder, selectedItem.SecondaryModelID, selectedItem.SecondaryModelBody);
MDLFile = string.Format(Strings.WeapMDLFile, selectedItem.SecondaryModelID, selectedItem.SecondaryModelBody);
}
else
{
MDLFolder = string.Format(Strings.WeapMDLFolder, selectedItem.PrimaryModelID, selectedItem.PrimaryModelBody);
MDLFile = string.Format(Strings.WeapMDLFile, selectedItem.PrimaryModelID, selectedItem.PrimaryModelBody);
}
}
else if (itemType.Equals("accessory"))
{
MDLFolder = string.Format(Strings.AccMDLFolder, selectedItem.PrimaryModelID);
MDLFile = string.Format(Strings.AccMDLFile, selectedRace, selectedItem.PrimaryModelID, Info.slotAbr[selectedCategory]);
}
else if (itemType.Equals("character"))
{
if (selectedItem.ItemName.Equals(Strings.Body))
{
MDLFolder = string.Format(Strings.BodyMDLFolder, selectedRace, selectedBody.PadLeft(4, '0'));
MDLFile = string.Format(Strings.BodyMDLFile, selectedRace, selectedBody.PadLeft(4, '0'), selectedPart);
}
else if (selectedItem.ItemName.Equals(Strings.Face))
{
MDLFolder = string.Format(Strings.FaceMDLFolder, selectedRace, selectedBody.PadLeft(4, '0'));
MDLFile = string.Format(Strings.FaceMDLFile, selectedRace, selectedBody.PadLeft(4, '0'), selectedPart);
}
else if (selectedItem.ItemName.Equals(Strings.Hair))
{
MDLFolder = string.Format(Strings.HairMDLFolder, selectedRace, selectedBody.PadLeft(4, '0'));
MDLFile = string.Format(Strings.HairMDLFile, selectedRace, selectedBody.PadLeft(4, '0'), selectedPart);
}
else if (selectedItem.ItemName.Equals(Strings.Tail))
{
MDLFolder = string.Format(Strings.TailMDLFolder, selectedRace, selectedBody.PadLeft(4, '0'));
MDLFile = string.Format(Strings.TailMDLFile, selectedRace, selectedBody.PadLeft(4, '0'), selectedPart);
}
}
else if (itemType.Equals("monster"))
{
bool isDemiHuman = false;
if (selectedItem.PrimaryMTRLFolder != null)
{
isDemiHuman = selectedItem.PrimaryMTRLFolder.Contains("demihuman");
}
string ID = "";
string body = "";
if (selectedCategory.Equals(Strings.Pets))
{
int part = 1;
if (selectedItem.ItemName.Equals(Strings.Selene) || selectedItem.ItemName.Equals(Strings.Bishop_Autoturret))
{
part = 2;
}
ID = Info.petID[selectedItem.ItemName];
body = part.ToString().PadLeft(4, '0');
}
else
{
ID = selectedItem.PrimaryModelID.PadLeft(4, '0');
body = selectedItem.PrimaryModelBody;
}
if (isDemiHuman)
{
MDLFolder = string.Format(Strings.DemiMDLFolder, ID, body);
MDLFile = string.Format(Strings.DemiMDLFile, ID, body, selectedPart);
}
else
{
MDLFolder = string.Format(Strings.MonsterMDLFolder, ID, body);
MDLFile = string.Format(Strings.MonsterMDLFile, ID, body);
}
}
else
{
MDLFolder = string.Format(Strings.EquipMDLFolder, selectedItem.PrimaryModelID);
if (selectedPart.Equals("-"))
{
MDLFile = string.Format(Strings.EquipMDLFile, selectedRace, selectedItem.PrimaryModelID, Info.slotAbr[selectedCategory]);
}
else
{
MDLFile = string.Format(Strings.EquipMDLFile, selectedRace, selectedItem.PrimaryModelID, selectedPart);
}
}
fullPath = MDLFolder + "/" + MDLFile;
int offset = Helper.GetDataOffset(FFCRC.GetHash(MDLFolder), FFCRC.GetHash(MDLFile), Strings.ItemsDat);
if (offset == 0)
{
if (itemType.Equals("weapon"))
{
if (selectedPart.Equals("Secondary"))
{
MDLFolder = string.Format(Strings.EquipMDLFolder, selectedItem.SecondaryModelID);
MDLFile = string.Format(Strings.EquipMDLFile, "0101", selectedItem.SecondaryModelID, Info.slotAbr[Strings.Hands]);
offset = Helper.GetDataOffset(FFCRC.GetHash(MDLFolder), FFCRC.GetHash(MDLFile), Strings.ItemsDat);
}
}
}
int datNum = ((offset / 8) & 0x000f) / 2;
var MDLDatData = Helper.GetType3DecompressedData(offset, datNum, Strings.ItemsDat);
using (BinaryReader br = new BinaryReader(new MemoryStream(MDLDatData.Item1)))
{
// The size of the header + (size of the mesh information block (136 bytes) * the number of meshes) + padding
br.BaseStream.Seek(64 + 136 * MDLDatData.Item2 + 4, SeekOrigin.Begin);
var modelStringCount = br.ReadInt32();
var stringBlockSize = br.ReadInt32();
var stringBlock = br.ReadBytes(stringBlockSize);
var unknown = br.ReadBytes(4);
var totalMeshCount = br.ReadInt16();
var attributeStringCount = br.ReadInt16();
var meshPartsCount = br.ReadInt16();
var materialStringCount = br.ReadInt16();
var boneStringCount = br.ReadInt16();
var boneListCount = br.ReadInt16();
var unknown1 = br.ReadInt16();
var unknown2 = br.ReadInt16();
var unknown3 = br.ReadInt16();
var unknown4 = br.ReadInt16();
var unknown5 = br.ReadInt16();
var unknown6 = br.ReadInt16();
br.ReadBytes(10);
var unknown7 = br.ReadInt16();
br.ReadBytes(16);
using (BinaryReader br1 = new BinaryReader(new MemoryStream(stringBlock)))
{
br1.BaseStream.Seek(0, SeekOrigin.Begin);
for (int i = 0; i < attributeStringCount; i++)
{
while (br1.ReadByte() != 0)
{
//extract each atribute string here
}
}
for (int i = 0; i < boneStringCount; i++)
{
byte b;
List <byte> boneName = new List <byte>();
while ((b = br1.ReadByte()) != 0)
{
boneName.Add(b);
}
string bone = Encoding.ASCII.GetString(boneName.ToArray());
bone = bone.Replace("\0", "");
boneStrings.Add(bone);
}
for (int i = 0; i < materialStringCount; i++)
{
byte b;
List <byte> name = new List <byte>();
while ((b = br1.ReadByte()) != 0)
{
name.Add(b);
}
string material = Encoding.ASCII.GetString(name.ToArray());
material = material.Replace("\0", "");
materialStrings.Add(material);
}
}
br.ReadBytes(32 * unknown5);
for (int i = 0; i < 3; i++)
{
LevelOfDetail LoD = new LevelOfDetail();
LoD.MeshOffset = br.ReadInt16();
LoD.MeshCount = br.ReadInt16();
br.ReadBytes(40);
LoD.VertexDataSize = br.ReadInt32();
LoD.IndexDataSize = br.ReadInt32();
LoD.VertexOffset = br.ReadInt32();
LoD.IndexOffset = br.ReadInt32();
modelData.LoD.Add(LoD);
}
var savePos = br.BaseStream.Position;
for (int i = 0; i < modelData.LoD.Count; i++)
{
List <MeshDataInfo> meshInfoList = new List <MeshDataInfo>();
for (int j = 0; j < modelData.LoD[i].MeshCount; j++)
{
modelData.LoD[i].MeshList.Add(new Mesh());
meshInfoList.Clear();
br.BaseStream.Seek((i * 136) + 68, SeekOrigin.Begin);
var dataBlockNum = br.ReadByte();
while (dataBlockNum != 255)
{
MeshDataInfo meshInfo = new MeshDataInfo()
{
VertexDataBlock = dataBlockNum,
Offset = br.ReadByte(),
DataType = br.ReadByte(),
UseType = br.ReadByte()
};
meshInfoList.Add(meshInfo);
br.ReadBytes(4);
dataBlockNum = br.ReadByte();
}
modelData.LoD[i].MeshList[j].MeshDataInfoList = meshInfoList.ToArray();
}
}
br.BaseStream.Seek(savePos, SeekOrigin.Begin);
for (int x = 0; x < modelData.LoD.Count; x++)
{
for (int i = 0; i < modelData.LoD[x].MeshCount; i++)
{
MeshInfo meshInfo = new MeshInfo()
{
VertexCount = br.ReadInt32(),
IndexCount = br.ReadInt32(),
MaterialNum = br.ReadInt16(),
MeshPartOffset = br.ReadInt16(),
MeshPartCount = br.ReadInt16(),
BoneListIndex = br.ReadInt16(),
IndexDataOffset = br.ReadInt32()
};
for (int j = 0; j < 3; j++)
{
meshInfo.VertexDataOffsets.Add(br.ReadInt32());
}
for (int k = 0; k < 3; k++)
{
meshInfo.VertexSizes.Add(br.ReadByte());
}
meshInfo.VertexDataBlockCount = br.ReadByte();
modelData.LoD[x].MeshList[i].MeshInfo = meshInfo;
}
}
br.ReadBytes(attributeStringCount * 4);
br.ReadBytes(unknown6 * 20);
for (int i = 0; i < modelData.LoD.Count; i++)
{
foreach (var mesh in modelData.LoD[i].MeshList)
{
for (int j = 0; j < mesh.MeshInfo.MeshPartCount; j++)
{
MeshPart meshPart = new MeshPart()
{
IndexOffset = br.ReadInt32(),
IndexCount = br.ReadInt32(),
Attributes = br.ReadInt32(),
BoneOffset = br.ReadInt16(),
BoneCount = br.ReadInt16()
};
mesh.MeshPartList.Add(meshPart);
}
}
}
br.ReadBytes(unknown7 * 12);
br.ReadBytes(materialStringCount * 4);
br.ReadBytes(boneStringCount * 4);
for (int i = 0; i < boneListCount; i++)
{
Bones bones = new Bones();
for (int j = 0; j < 64; j++)
{
bones.BoneData.Add(br.ReadInt16());
}
bones.BoneCount = br.ReadInt32();
modelData.BoneSet.Add(bones);
}
//br.ReadBytes(unknown1 * 16);
Dictionary <int, int> indexMin = new Dictionary <int, int>();
Dictionary <int, List <int> > extraIndices = new Dictionary <int, List <int> >();
List <ExtraIndex> indexCounts = new List <ExtraIndex>();
var pCount = 0;
var pCount1 = 0;
var pCount2 = 0;
if (unknown1 > 0)
{
for (int i = 0; i < unknown1; i++)
{
//not sure
br.ReadBytes(4);
//LoD[0] Extra Data Index
var p1 = br.ReadUInt16();
//LoD[1] Extra Data Index
var p2 = br.ReadUInt16();
//LoD[2] Extra Data Index
var p3 = br.ReadUInt16();
//LoD[0] Extra Data Part Count
var p1n = br.ReadUInt16();
pCount += p1n;
//LoD[1] Extra Data Part Count
var p2n = br.ReadUInt16();
pCount1 += p2n;
//LoD[2] Extra Data Part Count
var p3n = br.ReadUInt16();
pCount2 += p3n;
}
}
Dictionary <int, int> indexLoc = new Dictionary <int, int>();
if (unknown1 > 0)
{
for (int i = 0; i < modelData.LoD[0].MeshCount; i++)
{
var ido = modelData.LoD[0].MeshList[i].MeshInfo.IndexDataOffset;
indexLoc.Add(ido, i);
}
}
List <int> maskCounts = new List <int>();
Dictionary <int, int> totalExtraCounts = new Dictionary <int, int>();
if (unknown2 > 0)
{
for (int i = 0; i < pCount; i++)
{
//Index Offset Start
var m1 = br.ReadInt32();
var iLoc = 0;
if (indexLoc.ContainsKey(m1))
{
iLoc = indexLoc[m1];
}
//index count
var mCount = br.ReadInt32();
//index offset in unk3
var mOffset = br.ReadInt32();
indexCounts.Add(new ExtraIndex()
{
IndexLocation = iLoc, IndexCount = mCount
});
maskCounts.Add(mCount);
}
br.ReadBytes((pCount1 + pCount2) * 12);
}
int totalLoD0MaskCount = 0;
if (unknown2 > 0)
{
for (int i = 0; i < pCount; i++)
{
totalLoD0MaskCount += maskCounts[i];
}
}
if (unknown3 > 0)
{
var unk3Remainder = (unknown3 * 4) - (totalLoD0MaskCount * 4);
foreach (var ic in indexCounts)
{
HashSet <int> mIndexList = new HashSet <int>();
for (int i = 0; i < ic.IndexCount; i++)
{
//index its replacing? attatched to?
br.ReadBytes(2);
//extra index following last equipment index
var mIndex = br.ReadInt16();
mIndexList.Add(mIndex);
if (extraIndices.ContainsKey(ic.IndexLocation))
{
extraIndices[ic.IndexLocation].Add(mIndex);
}
else
{
extraIndices.Add(ic.IndexLocation, new List <int>()
{
mIndex
});
}
}
if (totalExtraCounts.ContainsKey(ic.IndexLocation))
{
totalExtraCounts[ic.IndexLocation] += mIndexList.Count;
}
else
{
totalExtraCounts.Add(ic.IndexLocation, mIndexList.Count);
}
}
//the rest of unk3
br.ReadBytes(unk3Remainder);
}
if (unknown3 > 0)
{
foreach (var ei in extraIndices)
{
indexMin.Add(ei.Key, ei.Value.Min());
}
extraIndexData.indexCounts = indexCounts;
extraIndexData.indexMin = indexMin;
extraIndexData.totalExtraCounts = totalExtraCounts;
extraIndexData.extraIndices = extraIndices;
modelData.ExtraData = extraIndexData;
}
//br.ReadBytes(unknown3 * 4);
var boneIndexSize = br.ReadInt32();
for (int i = 0; i < boneIndexSize / 2; i++)
{
modelData.BoneIndicies.Add(br.ReadInt16());
}
int padding = br.ReadByte();
br.ReadBytes(padding);
for (int i = 0; i < 4; i++)
{
ModelMaterial.BoundingBox boundingBox = new ModelMaterial.BoundingBox();
for (int j = 0; j < 4; j++)
{
boundingBox.PointA.Add(br.ReadSingle());
}
for (int k = 0; k < 4; k++)
{
boundingBox.PointB.Add(br.ReadSingle());
}
modelData.BoundingBoxes.Add(boundingBox);
}
//float4x4
for (int i = 0; i < boneStringCount; i++)
{
boneTransforms.Add(br.ReadSingle());
boneTransforms.Add(br.ReadSingle());
boneTransforms.Add(br.ReadSingle());
boneTransforms.Add(br.ReadSingle());
boneTransforms.Add(br.ReadSingle());
boneTransforms.Add(br.ReadSingle());
boneTransforms.Add(br.ReadSingle());
boneTransforms.Add(br.ReadSingle());
}
for (int i = 0; i < 3; i++)
{
for (int j = 0; j < modelData.LoD[i].MeshCount; j++)
{
Mesh mesh = modelData.LoD[i].MeshList[j];
for (int k = 0; k < mesh.MeshInfo.VertexDataBlockCount; k++)
{
br.BaseStream.Seek(modelData.LoD[i].VertexOffset + mesh.MeshInfo.VertexDataOffsets[k], SeekOrigin.Begin);
mesh.MeshVertexData.Add(br.ReadBytes(mesh.MeshInfo.VertexSizes[k] * mesh.MeshInfo.VertexCount));
}
br.BaseStream.Seek(modelData.LoD[i].IndexOffset + (mesh.MeshInfo.IndexDataOffset * 2), SeekOrigin.Begin);
mesh.IndexData = br.ReadBytes(2 * mesh.MeshInfo.IndexCount);
}
}
int vertex = 0, coordinates = 0, normals = 0, tangents = 0, colors = 0, blendWeights = 0, blendIndices = 0;
for (int i = 0; i < modelData.LoD[0].MeshCount; i++)
{
objBytes.Clear();
var vertexList = new Vector3Collection();
var texCoordList = new Vector2Collection();
var texCoordList2 = new Vector2Collection();
var normalList = new Vector3Collection();
var tangentList = new Vector3Collection();
var colorsList = new Color4Collection();
var indexList = new IntCollection();
var blendWeightList = new List <float>();
var blendWeightList2 = new List <float[]>();
var blendIndicesList = new List <int>();
var blendIndicesList2 = new List <int[]>();
var weightCounts = new List <int>();
Mesh mesh = modelData.LoD[0].MeshList[i];
MeshDataInfo[] meshDataInfoList = mesh.MeshDataInfoList;
int c = 0;
foreach (var meshDataInfo in meshDataInfoList)
{
if (meshDataInfo.UseType == 0)
{
vertex = c;
}
else if (meshDataInfo.UseType == 1)
{
blendWeights = c;
}
else if (meshDataInfo.UseType == 2)
{
blendIndices = c;
}
else if (meshDataInfo.UseType == 3)
{
normals = c;
}
else if (meshDataInfo.UseType == 4)
{
coordinates = c;
}
else if (meshDataInfo.UseType == 6)
{
tangents = c;
}
else if (meshDataInfo.UseType == 7)
{
colors = c;
}
c++;
}
/*
* -----------------
* Vertex
* -----------------
*/
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[vertex].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[vertex].VertexDataBlock] + meshDataInfoList[vertex].Offset, SeekOrigin.Begin);
Vector3 vVector = new Vector3();
if (meshDataInfoList[vertex].DataType == 13 || meshDataInfoList[vertex].DataType == 14)
{
System.Half h1 = System.Half.ToHalf((ushort)br1.ReadInt16());
System.Half h2 = System.Half.ToHalf((ushort)br1.ReadInt16());
System.Half h3 = System.Half.ToHalf((ushort)br1.ReadInt16());
float x = HalfHelper.HalfToSingle(h1);
float y = HalfHelper.HalfToSingle(h2);
float z = HalfHelper.HalfToSingle(h3);
vVector = new Vector3(x, y, z);
objBytes.Add("v " + x.ToString("N5") + " " + y.ToString("N5") + " " + z.ToString("N5") + " ");
}
else if (meshDataInfoList[vertex].DataType == 2)
{
var x = BitConverter.ToSingle(br1.ReadBytes(4), 0);
var y = BitConverter.ToSingle(br1.ReadBytes(4), 0);
var z = BitConverter.ToSingle(br1.ReadBytes(4), 0);
vVector = new Vector3(x, y, z);
objBytes.Add("v " + x.ToString("N5") + " " + y.ToString("N5") + " " + z.ToString("N5") + " ");
}
vertexList.Add(vVector);
}
}
/*
* -----------------
* Blend Weight
* -----------------
*/
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[blendWeights].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[blendWeights].VertexDataBlock] + meshDataInfoList[blendWeights].Offset, SeekOrigin.Begin);
float x = br1.ReadByte() / 255.0f;
float y = br1.ReadByte() / 255.0f;
float z = br1.ReadByte() / 255.0f;
float w = br1.ReadByte() / 255.0f;
int count = 0;
if (x != 0)
{
blendWeightList.Add(x);
count++;
if (y != 0)
{
blendWeightList.Add(y);
count++;
if (z != 0)
{
blendWeightList.Add(z);
count++;
if (w != 0)
{
blendWeightList.Add(w);
count++;
}
}
}
}
if (count == 1)
{
blendWeightList2.Add(new float[] { x });
}
else if (count == 2)
{
blendWeightList2.Add(new float[] { x, y });
}
else if (count == 3)
{
blendWeightList2.Add(new float[] { x, y, z });
}
else if (count == 4)
{
blendWeightList2.Add(new float[] { x, y, z, w });
}
weightCounts.Add(count);
}
}
/*
* -----------------
* Blend Index
* -----------------
*/
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[blendIndices].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[blendIndices].VertexDataBlock] + meshDataInfoList[blendIndices].Offset, SeekOrigin.Begin);
int x = br1.ReadByte();
int y = br1.ReadByte();
int z = br1.ReadByte();
int w = br1.ReadByte();
if (weightCounts[j] == 1)
{
blendIndicesList.Add(x);
blendIndicesList2.Add(new int[] { x });
}
else if (weightCounts[j] == 2)
{
blendIndicesList.Add(x);
blendIndicesList.Add(y);
blendIndicesList2.Add(new int[] { x, y });
}
else if (weightCounts[j] == 3)
{
blendIndicesList.Add(x);
blendIndicesList.Add(y);
blendIndicesList.Add(z);
blendIndicesList2.Add(new int[] { x, y, z });
}
else if (weightCounts[j] == 4)
{
blendIndicesList.Add(x);
blendIndicesList.Add(y);
blendIndicesList.Add(z);
blendIndicesList.Add(w);
blendIndicesList2.Add(new int[] { x, y, z, w });
}
}
}
/*
* -----------------
* Texture Coordinates
* -----------------
*/
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[coordinates].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[coordinates].VertexDataBlock] + meshDataInfoList[coordinates].Offset, SeekOrigin.Begin);
float x = 0;
float y = 0;
float z = 0;
float w = 0;
if (meshDataInfoList[coordinates].DataType == 13 || meshDataInfoList[coordinates].DataType == 14)
{
var sx = (ushort)br1.ReadInt16();
var sy = (ushort)br1.ReadInt16();
var sz = (ushort)br1.ReadInt16();
var sw = (ushort)br1.ReadInt16();
var h1 = new SharpDX.Half(sx);
var h2 = new SharpDX.Half(sy);
var h3 = new SharpDX.Half(sz);
var h4 = new SharpDX.Half(sw);
x = h1;
y = h2;
z = h3;
w = h4;
}
else if (meshDataInfoList[coordinates].DataType == 1)
{
x = br1.ReadSingle();
y = br1.ReadSingle();
}
else
{
x = br1.ReadSingle();
y = br1.ReadSingle();
z = br1.ReadSingle();
w = br1.ReadSingle();
}
var ox = x - Math.Truncate(x);
var oy = y - Math.Truncate(y);
objBytes.Add("vt " + ox.ToString("N5") + " " + (1 - y).ToString("N5") + " ");
texCoordList.Add(new Vector2(x, y));
texCoordList2.Add(new Vector2(z, w));
}
}
/*
* -----------------
* Normals
* -----------------
*/
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[normals].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[normals].VertexDataBlock] + meshDataInfoList[normals].Offset, SeekOrigin.Begin);
float x = 0;
float y = 0;
float z = 0;
float w = 0;
if (meshDataInfoList[normals].DataType == 13 || meshDataInfoList[normals].DataType == 14)
{
System.Half h1 = System.Half.ToHalf((ushort)br1.ReadInt16());
System.Half h2 = System.Half.ToHalf((ushort)br1.ReadInt16());
System.Half h3 = System.Half.ToHalf((ushort)br1.ReadInt16());
System.Half h4 = System.Half.ToHalf((ushort)br1.ReadInt16());
x = HalfHelper.HalfToSingle(h1);
y = HalfHelper.HalfToSingle(h2);
z = HalfHelper.HalfToSingle(h3);
w = HalfHelper.HalfToSingle(h4);
}
else
{
x = br1.ReadSingle();
y = br1.ReadSingle();
z = br1.ReadSingle();
}
var nv = new Vector3(x, y, z);
objBytes.Add("vn " + x.ToString("N5") + " " + y.ToString("N5") + " " + z.ToString("N5") + " ");
normalList.Add(nv);
}
}
/*
* -----------------
* Tangents
* -----------------
*/
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[tangents].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[tangents].VertexDataBlock] + meshDataInfoList[tangents].Offset, SeekOrigin.Begin);
int x = br1.ReadByte();
int y = br1.ReadByte();
int z = br1.ReadByte();
int w = br1.ReadByte();
var x1 = x * 2 / 255f - 1f;
var y1 = y * 2 / 255f - 1f;
var z1 = z * 2 / 255f - 1f;
var w1 = w * 2 / 255f - 1f;
var nv = new Vector3(x1, y1, z1);
tangentList.Add(nv);
}
}
/*
* -----------------
* Vertex Color
* -----------------
*/
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[colors].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[colors].VertexDataBlock] + meshDataInfoList[colors].Offset, SeekOrigin.Begin);
int a = br1.ReadByte();
int r = br1.ReadByte();
int g = br1.ReadByte();
int b = br1.ReadByte();
colorsList.Add(new Color4(r, g, b, a));
}
}
/*
* -----------------
* Index
* -----------------
*/
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.IndexData)))
{
for (int j = 0; j < mesh.MeshInfo.IndexCount; j += 3)
{
int i1 = br1.ReadInt16();
int i2 = br1.ReadInt16();
int i3 = br1.ReadInt16();
objBytes.Add("f " + (i1 + 1) + "/" + (i1 + 1) + "/" + (i1 + 1) + " " + (i2 + 1) + "/" + (i2 + 1) + "/" + (i2 + 1) + " " + (i3 + 1) + "/" + (i3 + 1) + "/" + (i3 + 1) + " ");
indexList.Add(i1);
indexList.Add(i2);
indexList.Add(i3);
}
}
ModelMeshData modelMeshData = new ModelMeshData()
{
Vertices = vertexList,
Normals = normalList,
TextureCoordinates = texCoordList,
TextureCoordinates2 = texCoordList2,
BiTangents = tangentList,
Indices = indexList,
VertexColors = colorsList,
OBJFileData = objBytes.ToArray(),
BoneStrings = boneStrings,
BoneIndices = modelData.BoneIndicies,
BoneTransforms = boneTransforms,
BlendWeights = blendWeightList,
BlendIndices = blendIndicesList,
WeightCounts = weightCounts,
MeshPartList = mesh.MeshPartList,
BlendIndicesArrayList = blendIndicesList2,
BlendWeightsArrayList = blendWeightList2,
MaterialNum = mesh.MeshInfo.MaterialNum,
MeshPartCount = mesh.MeshInfo.MeshPartCount,
MeshPartOffset = mesh.MeshInfo.MeshPartOffset
};
meshList.Add(modelMeshData);
}
}
}
public static PointGeometry3D ConvertToPointGeometry3D(Points[] points)
{
var geometry = new PointGeometry3D();
var col = new Color4Collection();
var ptPos = new Vector3Collection();
var ptIdx = new IntCollection();
var ptNormals = new Vector3Collection();
var additionalTurns = 0;
foreach (var point in points)
{
ptIdx.Add(ptPos.Count);
ptPos.Add(new Vector3(point.x, point.y, point.z));
col.Add(new Color4(new Color3(point.r / (float)255, point.g / (float)255, point.b / (float)255)));
ptNormals.Add(new Vector3(0, 1, 0));
}
if ((points.Length / 3) * 3 != points.Length)
{
additionalTurns = ((points.Length / 3 + 1) * 3) - points.Length;
}
for (int i = 0; i < additionalTurns; i++)
{
ptIdx.Add(ptPos.Count);
ptPos.Add(ptPos[ptPos.Count - 1]);
col.Add(col[col.Count - 1]);
ptNormals.Add(ptNormals[ptNormals.Count - 1]);
}
geometry.Positions = ptPos;
geometry.Indices = ptIdx;
geometry.Colors = col;
return geometry;
}
/// <summary>
/// Parses the MDL file to obtain model information
/// </summary>
/// <param name="selectedItem">The currently selected item</param>
/// <param name="selectedRace">The currently selected race</param>
/// <param name="selectedBody">The currently selected body</param>
/// <param name="selectedPart">The currently selected part</param>
/// <param name="selectedCategory">The items category </param>
public MDL(ItemData selectedItem, string selectedCategory, string selectedRace, string selectedBody, string selectedPart)
{
string itemType = Helper.GetCategoryType(selectedCategory);
string MDLFolder = "";
if (itemType.Equals("weapon") || itemType.Equals("food"))
{
if (selectedPart.Equals("Secondary"))
{
MDLFolder = string.Format(Strings.WeapMDLFolder, selectedItem.SecondaryModelID, selectedItem.SecondaryModelBody);
MDLFile = string.Format(Strings.WeapMDLFile, selectedItem.SecondaryModelID, selectedItem.SecondaryModelBody);
}
else
{
MDLFolder = string.Format(Strings.WeapMDLFolder, selectedItem.PrimaryModelID, selectedItem.PrimaryModelBody);
MDLFile = string.Format(Strings.WeapMDLFile, selectedItem.PrimaryModelID, selectedItem.PrimaryModelBody);
}
}
else if (itemType.Equals("accessory"))
{
MDLFolder = string.Format(Strings.AccMDLFolder, selectedItem.PrimaryModelID);
MDLFile = string.Format(Strings.AccMDLFile, selectedRace, selectedItem.PrimaryModelID, Info.slotAbr[selectedCategory]);
}
else if (itemType.Equals("character"))
{
if (selectedItem.ItemName.Equals(Strings.Body))
{
MDLFolder = string.Format(Strings.BodyMDLFolder, selectedRace, selectedBody.PadLeft(4, '0'));
MDLFile = string.Format(Strings.BodyMDLFile, selectedRace, selectedBody.PadLeft(4, '0'), selectedPart);
}
else if (selectedItem.ItemName.Equals(Strings.Face))
{
MDLFolder = string.Format(Strings.FaceMDLFolder, selectedRace, selectedBody.PadLeft(4, '0'));
MDLFile = string.Format(Strings.FaceMDLFile, selectedRace, selectedBody.PadLeft(4, '0'), selectedPart);
}
else if (selectedItem.ItemName.Equals(Strings.Hair))
{
MDLFolder = string.Format(Strings.HairMDLFolder, selectedRace, selectedBody.PadLeft(4, '0'));
MDLFile = string.Format(Strings.HairMDLFile, selectedRace, selectedBody.PadLeft(4, '0'), selectedPart);
}
else if (selectedItem.ItemName.Equals(Strings.Tail))
{
MDLFolder = string.Format(Strings.TailMDLFolder, selectedRace, selectedBody.PadLeft(4, '0'));
MDLFile = string.Format(Strings.TailMDLFile, selectedRace, selectedBody.PadLeft(4, '0'), selectedPart);
}
}
else if (itemType.Equals("monster"))
{
bool isDemiHuman = false;
if (selectedItem.PrimaryMTRLFolder != null)
{
isDemiHuman = selectedItem.PrimaryMTRLFolder.Contains("demihuman");
}
string ID = "";
string body = "";
if (selectedCategory.Equals(Strings.Pets))
{
ID = Info.petID[selectedItem.ItemName];
body = "0001";
}
else
{
ID = selectedItem.PrimaryModelID.PadLeft(4, '0');
body = selectedItem.PrimaryModelBody;
}
if (isDemiHuman)
{
MDLFolder = string.Format(Strings.DemiMDLFolder, ID, body);
MDLFile = string.Format(Strings.DemiMDLFile, ID, body, selectedPart);
}
else
{
MDLFolder = string.Format(Strings.MonsterMDLFolder, ID, body);
MDLFile = string.Format(Strings.MonsterMDLFile, ID, body);
}
}
else
{
MDLFolder = string.Format(Strings.EquipMDLFolder, selectedItem.PrimaryModelID);
MDLFile = string.Format(Strings.EquipMDLFile, selectedRace, selectedItem.PrimaryModelID, Info.slotAbr[selectedCategory]);
}
int offset = Helper.GetItemOffset(FFCRC.GetHash(MDLFolder), FFCRC.GetHash(MDLFile));
int datNum = ((offset / 8) & 0x000f) / 2;
offset = Helper.OffsetCorrection(datNum, offset);
var MDLDatData = Helper.GetType3DecompressedData(offset, datNum);
using (BinaryReader br = new BinaryReader(new MemoryStream(MDLDatData.Item1)))
{
ModelData modelData = new ModelData();
// The size of the header + (size of the mesh information block (136 bytes) * the number of meshes) + padding
br.BaseStream.Seek(64 + 136 * MDLDatData.Item2 + 4, SeekOrigin.Begin);
var modelStringCount = br.ReadInt32();
var stringBlockSize = br.ReadInt32();
var stringBlock = br.ReadBytes(stringBlockSize);
var unknown = br.ReadBytes(4);
var totalMeshCount = br.ReadInt16();
var attributeStringCount = br.ReadInt16();
var meshPartsCount = br.ReadInt16();
var materialStringCount = br.ReadInt16();
var boneStringCount = br.ReadInt16();
var boneListCount = br.ReadInt16();
var unknown1 = br.ReadInt16();
var unknown2 = br.ReadInt16();
var unknown3 = br.ReadInt16();
var unknown4 = br.ReadInt16();
var unknown5 = br.ReadInt16();
var unknown6 = br.ReadInt16();
br.ReadBytes(10);
var unknown7 = br.ReadInt16();
br.ReadBytes(16);
using (BinaryReader br1 = new BinaryReader(new MemoryStream(stringBlock)))
{
br1.BaseStream.Seek(0, SeekOrigin.Begin);
for (int i = 0; i < attributeStringCount; i++)
{
while (br1.ReadByte() != 0)
{
//extract each atribute string here
}
}
for (int i = 0; i < boneStringCount; i++)
{
while (br1.ReadByte() != 0)
{
//extact each bone string here
}
}
for (int i = 0; i < materialStringCount; i++)
{
byte b;
List <byte> name = new List <byte>();
while ((b = br1.ReadByte()) != 0)
{
name.Add(b);
}
string material = Encoding.ASCII.GetString(name.ToArray());
material = material.Replace("\0", "");
materialStrings.Add(material);
}
}
br.ReadBytes(32 * unknown5);
for (int i = 0; i < 3; i++)
{
LevelOfDetail LoD = new LevelOfDetail();
LoD.MeshOffset = br.ReadInt16();
LoD.MeshCount = br.ReadInt16();
br.ReadBytes(40);
LoD.VertexDataSize = br.ReadInt32();
LoD.IndexDataSize = br.ReadInt32();
LoD.VertexOffset = br.ReadInt32();
LoD.IndexOffset = br.ReadInt32();
modelData.LoD.Add(LoD);
}
var savePos = br.BaseStream.Position;
for (int i = 0; i < modelData.LoD.Count; i++)
{
List <MeshDataInfo> meshInfoList = new List <MeshDataInfo>();
for (int j = 0; j < modelData.LoD[i].MeshCount; j++)
{
modelData.LoD[i].MeshList.Add(new Mesh());
meshInfoList.Clear();
br.BaseStream.Seek((i * 136) + 68, SeekOrigin.Begin);
var dataBlockNum = br.ReadByte();
while (dataBlockNum != 255)
{
MeshDataInfo meshInfo = new MeshDataInfo()
{
VertexDataBlock = dataBlockNum,
Offset = br.ReadByte(),
DataType = br.ReadByte(),
UseType = br.ReadByte()
};
meshInfoList.Add(meshInfo);
br.ReadBytes(4);
dataBlockNum = br.ReadByte();
}
modelData.LoD[i].MeshList[j].MeshDataInfoList = meshInfoList.ToArray();
}
}
br.BaseStream.Seek(savePos, SeekOrigin.Begin);
for (int x = 0; x < modelData.LoD.Count; x++)
{
for (int i = 0; i < modelData.LoD[x].MeshCount; i++)
{
MeshInfo meshInfo = new MeshInfo()
{
VertexCount = br.ReadInt32(),
IndexCount = br.ReadInt32(),
MaterialNum = br.ReadInt16(),
MeshPartOffset = br.ReadInt16(),
MeshPartCount = br.ReadInt16(),
BoneListIndex = br.ReadInt16(),
IndexDataOffset = br.ReadInt32()
};
for (int j = 0; j < 3; j++)
{
meshInfo.VertexDataOffsets.Add(br.ReadInt32());
}
for (int k = 0; k < 3; k++)
{
meshInfo.VertexSizes.Add(br.ReadByte());
}
meshInfo.VertexDataBlockCount = br.ReadByte();
modelData.LoD[x].MeshList[i].MeshInfo = meshInfo;
}
}
br.ReadBytes(attributeStringCount * 4);
br.ReadBytes(unknown6 * 20);
for (int i = 0; i < modelData.LoD.Count; i++)
{
foreach (var mesh in modelData.LoD[i].MeshList)
{
for (int j = 0; j < mesh.MeshInfo.MeshPartCount; j++)
{
MeshPart meshPart = new MeshPart()
{
IndexOffset = br.ReadInt32(),
IndexCount = br.ReadInt32(),
Attributes = br.ReadInt32(),
BoneOffset = br.ReadInt16(),
BoneCount = br.ReadInt16()
};
mesh.MeshPartList.Add(meshPart);
}
}
}
br.ReadBytes(unknown7 * 12);
br.ReadBytes(materialStringCount * 4);
br.ReadBytes(boneStringCount * 4);
for (int i = 0; i < boneListCount; i++)
{
Bones bones = new Bones();
for (int j = 0; j < 64; j++)
{
bones.BoneData.Add(br.ReadInt16());
}
bones.BoneCount = br.ReadInt32();
modelData.BoneSet.Add(bones);
}
br.ReadBytes(unknown1 * 16);
br.ReadBytes(unknown2 * 12);
br.ReadBytes(unknown3 * 4);
var boneIndexSize = br.ReadInt32();
for (int i = 0; i < boneIndexSize / 2; i++)
{
modelData.BoneIndicies.Add(br.ReadInt16());
}
int padding = br.ReadByte();
br.ReadBytes(padding);
for (int i = 0; i < 4; i++)
{
ModelMaterial.BoundingBox boundingBox = new ModelMaterial.BoundingBox();
for (int j = 0; j < 4; j++)
{
boundingBox.PointA.Add(br.ReadSingle());
}
for (int k = 0; k < 4; k++)
{
boundingBox.PointB.Add(br.ReadSingle());
}
modelData.BoundingBoxes.Add(boundingBox);
}
for (int i = 0; i < 3; i++)
{
for (int j = 0; j < modelData.LoD[i].MeshCount; j++)
{
Mesh mesh = modelData.LoD[i].MeshList[j];
for (int k = 0; k < mesh.MeshInfo.VertexDataBlockCount; k++)
{
br.BaseStream.Seek(modelData.LoD[i].VertexOffset + mesh.MeshInfo.VertexDataOffsets[k], SeekOrigin.Begin);
mesh.MeshVertexData.Add(br.ReadBytes(mesh.MeshInfo.VertexSizes[k] * mesh.MeshInfo.VertexCount));
}
br.BaseStream.Seek(modelData.LoD[i].IndexOffset + (mesh.MeshInfo.IndexDataOffset * 2), SeekOrigin.Begin);
mesh.IndexData = br.ReadBytes(2 * mesh.MeshInfo.IndexCount);
}
}
int vertex = 0, coordinates = 0, normals = 0, tangents = 0, colors = 0;
for (int i = 0; i < modelData.LoD[0].MeshCount; i++)
{
objBytes.Clear();
var vertexList = new Vector3Collection();
var texCoordList = new Vector2Collection();
var normalList = new Vector3Collection();
var tangentList = new Vector3Collection();
var colorsList = new Color4Collection();
var indexList = new IntCollection();
Mesh mesh = modelData.LoD[0].MeshList[i];
MeshDataInfo[] meshDataInfoList = mesh.MeshDataInfoList;
int c = 0;
foreach (var meshDataInfo in meshDataInfoList)
{
if (meshDataInfo.UseType == 0)
{
vertex = c;
}
else if (meshDataInfo.UseType == 3)
{
normals = c;
}
else if (meshDataInfo.UseType == 4)
{
coordinates = c;
}
else if (meshDataInfo.UseType == 6)
{
tangents = c;
}
else if (meshDataInfo.UseType == 7)
{
colors = c;
}
c++;
}
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[vertex].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[vertex].VertexDataBlock] + meshDataInfoList[vertex].Offset, SeekOrigin.Begin);
if (meshDataInfoList[vertex].DataType == 13 || meshDataInfoList[vertex].DataType == 14)
{
System.Half h1 = System.Half.ToHalf((ushort)br1.ReadInt16());
System.Half h2 = System.Half.ToHalf((ushort)br1.ReadInt16());
System.Half h3 = System.Half.ToHalf((ushort)br1.ReadInt16());
float x = HalfHelper.HalfToSingle(h1);
float y = HalfHelper.HalfToSingle(h2);
float z = HalfHelper.HalfToSingle(h3);
objBytes.Add("v " + x.ToString() + " " + y.ToString() + " " + z.ToString() + " ");
vertexList.Add(new Vector3(x, y, z));
}
else if (meshDataInfoList[vertex].DataType == 2)
{
float x = br1.ReadSingle();
float y = br1.ReadSingle();
float z = br1.ReadSingle();
objBytes.Add("v " + x.ToString() + " " + y.ToString() + " " + z.ToString() + " ");
vertexList.Add(new Vector3(x, y, z));
}
}
}
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[coordinates].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[coordinates].VertexDataBlock] + meshDataInfoList[coordinates].Offset, SeekOrigin.Begin);
System.Half h1 = System.Half.ToHalf((ushort)br1.ReadInt16());
System.Half h2 = System.Half.ToHalf((ushort)br1.ReadInt16());
float x = HalfHelper.HalfToSingle(h1);
float y = HalfHelper.HalfToSingle(h2);
objBytes.Add("vt " + x.ToString() + " " + (y * -1f).ToString() + " ");
texCoordList.Add(new Vector2(x, y));
}
}
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[normals].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[normals].VertexDataBlock] + meshDataInfoList[normals].Offset, SeekOrigin.Begin);
System.Half h1 = System.Half.ToHalf((ushort)br1.ReadInt16());
System.Half h2 = System.Half.ToHalf((ushort)br1.ReadInt16());
System.Half h3 = System.Half.ToHalf((ushort)br1.ReadInt16());
objBytes.Add("vn " + HalfHelper.HalfToSingle(h1).ToString() + " " + HalfHelper.HalfToSingle(h2).ToString() + " " + HalfHelper.HalfToSingle(h3).ToString() + " ");
normalList.Add(new Vector3(HalfHelper.HalfToSingle(h1), HalfHelper.HalfToSingle(h2), HalfHelper.HalfToSingle(h3)));
}
}
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[tangents].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[tangents].VertexDataBlock] + meshDataInfoList[tangents].Offset, SeekOrigin.Begin);
float x = br1.ReadByte() / 255f;
float y = br1.ReadByte() / 255f;
float z = br1.ReadByte() / 255f;
tangentList.Add(new Vector3(x, y, z));
}
}
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[colors].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[colors].VertexDataBlock] + meshDataInfoList[colors].Offset, SeekOrigin.Begin);
int a = br1.ReadByte();
int r = br1.ReadByte();
int g = br1.ReadByte();
int b = br1.ReadByte();
colorsList.Add(new Color4(r, g, b, a));
}
}
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.IndexData)))
{
for (int j = 0; j < mesh.MeshInfo.IndexCount; j += 3)
{
int i1 = br1.ReadInt16();
int i2 = br1.ReadInt16();
int i3 = br1.ReadInt16();
objBytes.Add("f " + (i1 + 1) + "/" + (i1 + 1) + "/" + (i1 + 1) + " " + (i2 + 1) + "/" + (i2 + 1) + "/" + (i2 + 1) + " " + (i3 + 1) + "/" + (i3 + 1) + "/" + (i3 + 1) + " ");
indexList.Add(i1);
indexList.Add(i2);
indexList.Add(i3);
}
}
ModelMeshData modelMeshData = new ModelMeshData()
{
Vertices = vertexList,
Normals = normalList,
TextureCoordinates = texCoordList,
Tangents = tangentList,
Indices = indexList,
VertexColors = colorsList,
OBJFileData = objBytes.ToArray()
};
meshList.Add(modelMeshData);
}
}
}
public static Color4Collection ToColor4Collection(this byte[] collection)
{
var colors = new Color4Collection();
for(var i = 0; i<collection.Count(); i+=4)
{
var a = collection[i]/255.0f;
var b = collection[i + 1]/255.0f;
var c = collection[i + 2]/255.0f;
var d = collection[i + 3]/255.0f;
var newColor = new Color4(a, b, c, d);
colors.Add(newColor);
}
return colors;
}
/// <summary>
/// Parses the MDL file to obtain model information
/// </summary>
/// <param name="selectedItem">The currently selected item</param>
/// <param name="selectedRace">The currently selected race</param>
/// <param name="selectedBody">The currently selected body</param>
/// <param name="selectedPart">The currently selected part</param>
/// <param name="selectedCategory">The items category </param>
public MDL(ItemData selectedItem, string selectedCategory, string selectedRace, string selectedBody, string selectedPart)
{
string itemType = Helper.GetCategoryType(selectedCategory);
string MDLFolder = "";
if (itemType.Equals("weapon") || itemType.Equals("food"))
{
if (selectedPart.Equals("Secondary"))
{
MDLFolder = string.Format(Strings.WeapMDLFolder, selectedItem.SecondaryModelID, selectedItem.SecondaryModelBody);
MDLFile = string.Format(Strings.WeapMDLFile, selectedItem.SecondaryModelID, selectedItem.SecondaryModelBody);
}
else
{
MDLFolder = string.Format(Strings.WeapMDLFolder, selectedItem.PrimaryModelID, selectedItem.PrimaryModelBody);
MDLFile = string.Format(Strings.WeapMDLFile, selectedItem.PrimaryModelID, selectedItem.PrimaryModelBody);
}
}
else if (itemType.Equals("accessory"))
{
MDLFolder = string.Format(Strings.AccMDLFolder, selectedItem.PrimaryModelID);
MDLFile = string.Format(Strings.AccMDLFile, selectedRace, selectedItem.PrimaryModelID, Info.slotAbr[selectedCategory]);
}
else if (itemType.Equals("character"))
{
if (selectedItem.ItemName.Equals(Strings.Body))
{
MDLFolder = string.Format(Strings.BodyMDLFolder, selectedRace, selectedBody.PadLeft(4, '0'));
MDLFile = string.Format(Strings.BodyMDLFile, selectedRace, selectedBody.PadLeft(4, '0'), selectedPart);
}
else if (selectedItem.ItemName.Equals(Strings.Face))
{
MDLFolder = string.Format(Strings.FaceMDLFolder, selectedRace, selectedBody.PadLeft(4, '0'));
MDLFile = string.Format(Strings.FaceMDLFile, selectedRace, selectedBody.PadLeft(4, '0'), selectedPart);
}
else if (selectedItem.ItemName.Equals(Strings.Hair))
{
MDLFolder = string.Format(Strings.HairMDLFolder, selectedRace, selectedBody.PadLeft(4, '0'));
MDLFile = string.Format(Strings.HairMDLFile, selectedRace, selectedBody.PadLeft(4, '0'), selectedPart);
}
else if (selectedItem.ItemName.Equals(Strings.Tail))
{
MDLFolder = string.Format(Strings.TailMDLFolder, selectedRace, selectedBody.PadLeft(4, '0'));
MDLFile = string.Format(Strings.TailMDLFile, selectedRace, selectedBody.PadLeft(4, '0'), selectedPart);
}
}
else if (itemType.Equals("monster"))
{
bool isDemiHuman = false;
if (selectedItem.PrimaryMTRLFolder != null)
{
isDemiHuman = selectedItem.PrimaryMTRLFolder.Contains("demihuman");
}
if (isDemiHuman)
{
MDLFolder = string.Format(Strings.DemiMDLFolder, selectedItem.PrimaryModelID.PadLeft(4, '0'), selectedItem.PrimaryModelBody.PadLeft(4, '0'));
MDLFile = string.Format(Strings.DemiMDLFile, selectedItem.PrimaryModelID.PadLeft(4, '0'), selectedItem.PrimaryModelBody, selectedPart);
}
else
{
MDLFolder = string.Format(Strings.MonsterMDLFolder, selectedItem.PrimaryModelID.PadLeft(4, '0'), selectedItem.PrimaryModelBody.PadLeft(4, '0'));
MDLFile = string.Format(Strings.MonsterMDLFile, selectedItem.PrimaryModelID.PadLeft(4, '0'), selectedItem.PrimaryModelBody.PadLeft(4, '0'));
}
}
else
{
MDLFolder = string.Format(Strings.EquipMDLFolder, selectedItem.PrimaryModelID);
if (selectedPart.Equals("-"))
{
MDLFile = string.Format(Strings.EquipMDLFile, selectedRace, selectedItem.PrimaryModelID, Info.slotAbr[selectedCategory]);
}
else
{
MDLFile = string.Format(Strings.EquipMDLFile, selectedRace, selectedItem.PrimaryModelID, selectedPart);
}
}
fullPath = MDLFolder + "/" + MDLFile;
int offset = Helper.GetDataOffset(FFCRC.GetHash(MDLFolder), FFCRC.GetHash(MDLFile), Strings.ItemsDat);
if (offset == 0)
{
if (itemType.Equals("weapon"))
{
if (selectedPart.Equals("Secondary"))
{
MDLFolder = string.Format(Strings.EquipMDLFolder, selectedItem.SecondaryModelID);
MDLFile = string.Format(Strings.EquipMDLFile, "0101", selectedItem.SecondaryModelID, Info.slotAbr[Strings.Hands]);
offset = Helper.GetDataOffset(FFCRC.GetHash(MDLFolder), FFCRC.GetHash(MDLFile), Strings.ItemsDat);
}
}
}
int datNum = ((offset / 8) & 0x000f) / 2;
var MDLDatData = Helper.GetType3DecompressedData(offset, datNum, Strings.ItemsDat);
using (BinaryReader br = new BinaryReader(new MemoryStream(MDLDatData.Item1)))
{
// The size of the header + (size of the mesh information block (136 bytes) * the meshes) + padding
br.BaseStream.Seek(64 + 136 * MDLDatData.Item2 + 4, SeekOrigin.Begin);
var modelStringCount = br.ReadInt32();
var stringBlockSize = br.ReadInt32();
var stringBlock = br.ReadBytes(stringBlockSize);
var unknown = br.ReadBytes(4);
var totalMeshCount = br.ReadInt16();
var attributeStringCount = br.ReadInt16();
var meshPartsCount = br.ReadInt16();
var materialStringCount = br.ReadInt16();
var boneStringCount = br.ReadInt16();
var boneListCount = br.ReadInt16();
//Has something to do with amount of extra vertex data.
var unknown1 = br.ReadInt16();
//Has something to do with amount of extra vertex data.
var unknown2 = br.ReadInt16();
var unknown3 = br.ReadInt16();
// Seems to always be 1027
var unknown4 = br.ReadInt16();
var unknown5 = br.ReadInt16();
var unknown6 = br.ReadInt16();
br.ReadBytes(10);
var unknown7 = br.ReadInt16();
br.ReadBytes(16);
using (BinaryReader br1 = new BinaryReader(new MemoryStream(stringBlock)))
{
br1.BaseStream.Seek(0, SeekOrigin.Begin);
for (int i = 0; i < attributeStringCount; i++)
{
byte a;
List <byte> atrName = new List <byte>();
while ((a = br1.ReadByte()) != 0)
{
atrName.Add(a);
}
string atr = Encoding.ASCII.GetString(atrName.ToArray());
atr = atr.Replace("\0", "");
modelData.Attributes.Add(atr);
atrStrings.Add(atr);
}
for (int i = 0; i < boneStringCount; i++)
{
byte b;
List <byte> boneName = new List <byte>();
while ((b = br1.ReadByte()) != 0)
{
boneName.Add(b);
}
string bone = Encoding.ASCII.GetString(boneName.ToArray());
bone = bone.Replace("\0", "");
modelData.Bones.Add(bone);
boneStrings.Add(bone);
}
for (int i = 0; i < materialStringCount; i++)
{
byte b;
List <byte> name = new List <byte>();
while ((b = br1.ReadByte()) != 0)
{
name.Add(b);
}
string material = Encoding.ASCII.GetString(name.ToArray());
material = material.Replace("\0", "");
modelData.Materials.Add(material);
materialStrings.Add(material);
}
}
byte[] unknown5Bytes = br.ReadBytes(32 * unknown5);
for (int i = 0; i < 3; i++)
{
LevelOfDetail LoD = new LevelOfDetail();
LoD.MeshOffset = br.ReadInt16();
LoD.MeshCount = br.ReadInt16();
br.ReadBytes(40);
LoD.VertexDataSize = br.ReadInt32();
LoD.IndexDataSize = br.ReadInt32();
LoD.VertexOffset = br.ReadInt32();
LoD.IndexOffset = br.ReadInt32();
modelData.LoD.Add(LoD);
}
var savePos = br.BaseStream.Position;
var lodStructPos = 68;
for (int i = 0; i < modelData.LoD.Count; i++)
{
List <MeshDataInfo> meshInfoList = new List <MeshDataInfo>();
for (int j = 0; j < modelData.LoD[i].MeshCount; j++)
{
modelData.LoD[i].MeshList.Add(new Mesh());
meshInfoList.Clear();
br.BaseStream.Seek((j * 136) + lodStructPos, SeekOrigin.Begin);
var dataBlockNum = br.ReadByte();
while (dataBlockNum != 255)
{
MeshDataInfo meshInfo = new MeshDataInfo()
{
VertexDataBlock = dataBlockNum,
Offset = br.ReadByte(),
DataType = br.ReadByte(),
UseType = br.ReadByte()
};
meshInfoList.Add(meshInfo);
br.ReadBytes(4);
dataBlockNum = br.ReadByte();
}
modelData.LoD[i].MeshList[j].MeshDataInfoList = meshInfoList.ToArray();
}
lodStructPos += 136 * modelData.LoD[i].MeshCount;
}
br.BaseStream.Seek(savePos, SeekOrigin.Begin);
for (int x = 0; x < modelData.LoD.Count; x++)
{
for (int i = 0; i < modelData.LoD[x].MeshCount; i++)
{
MeshInfo meshInfo = new MeshInfo()
{
VertexCount = br.ReadInt32(),
IndexCount = br.ReadInt32(),
MaterialNum = br.ReadInt16(),
MeshPartOffset = br.ReadInt16(),
MeshPartCount = br.ReadInt16(),
BoneListIndex = br.ReadInt16(),
IndexDataOffset = br.ReadInt32()
};
modelData.LoD[x].MeshList[i].MaterialId = meshInfo.MaterialNum;
var typeChar = materialStrings[meshInfo.MaterialNum][4].ToString() + materialStrings[meshInfo.MaterialNum][9].ToString();
modelData.LoD[x].MeshList[i].BoneListIndex = meshInfo.BoneListIndex;
if (typeChar.Equals("cb"))
{
modelData.LoD[x].MeshList[i].IsBody = true;
}
for (int j = 0; j < 3; j++)
{
meshInfo.VertexDataOffsets.Add(br.ReadInt32());
}
for (int k = 0; k < 3; k++)
{
meshInfo.VertexSizes.Add(br.ReadByte());
}
meshInfo.VertexDataBlockCount = br.ReadByte();
modelData.LoD[x].MeshList[i].MeshInfo = meshInfo;
}
}
byte[] attributeOffsetBytes = br.ReadBytes(attributeStringCount * 4);
br.ReadBytes(unknown6 * 20);
for (int i = 0; i < modelData.LoD.Count; i++)
{
foreach (var mesh in modelData.LoD[i].MeshList)
{
for (int j = 0; j < mesh.MeshInfo.MeshPartCount; j++)
{
MeshPart meshPart = new MeshPart()
{
IndexOffset = br.ReadInt32(),
IndexCount = br.ReadInt32(),
Attributes = br.ReadInt32(),
BoneOffset = br.ReadInt16(),
BoneCount = br.ReadInt16()
};
mesh.MeshPartList.Add(meshPart);
}
}
}
br.ReadBytes(unknown7 * 12);
br.ReadBytes(materialStringCount * 4);
List <int> boneIncrements = new List <int>();
// Loop through the increments and save their data.
for (int i = 0; i < boneStringCount; i++)
{
int increment = br.ReadInt32();
boneIncrements.Add(increment);
}
for (int i = 0; i < boneListCount; i++)
{
Bones bones = new Bones();
for (int j = 0; j < 64; j++)
{
bones.BoneData.Add(br.ReadInt16());
}
bones.BoneCount = br.ReadInt32();
modelData.BoneSet.Add(bones);
}
//br.ReadBytes(unknown1 * 16);
Dictionary <int, int> indexMin = new Dictionary <int, int>();
Dictionary <int, List <int> > extraIndices = new Dictionary <int, List <int> >();
Dictionary <int, List <int> > extraIndices2 = new Dictionary <int, List <int> >();
var indexCounts = new List <List <ExtraIndex> >();
// One for each LoD level.
indexCounts.Add(new List <ExtraIndex>());
indexCounts.Add(new List <ExtraIndex>());
indexCounts.Add(new List <ExtraIndex>());
var pCounts = new int[3];
if (unknown1 > 0)
{
for (int i = 0; i < unknown1; i++)
{
//not sure
br.ReadBytes(4);
//LoD[0] Extra Data Index
var p1 = br.ReadUInt16();
//LoD[1] Extra Data Index
var p2 = br.ReadUInt16();
//LoD[2] Extra Data Index
var p3 = br.ReadUInt16();
//LoD[0] Extra Data Part Count
var p1n = br.ReadUInt16();
pCounts[0] += p1n;
//LoD[1] Extra Data Part Count
var p2n = br.ReadUInt16();
pCounts[1] += p2n;
//LoD[2] Extra Data Part Count
var p3n = br.ReadUInt16();
pCounts[2] += p3n;
}
}
Dictionary <int, int> indexLoc = new Dictionary <int, int>();
if (unknown1 > 0)
{
for (int i = 0; i < modelData.LoD[LoDViewLevel].MeshCount; i++)
{
var ido = modelData.LoD[LoDViewLevel].MeshList[i].MeshInfo.IndexDataOffset;
if (!indexLoc.ContainsKey(ido))
{
indexLoc.Add(ido, i);
}
}
}
var totalMaskCounts = new int[3];
Dictionary <int, int> totalExtraCounts = new Dictionary <int, int>();
if (unknown2 > 0)
{
for (int x = 0; x < pCounts.Length; x++)
{
for (int i = 0; i < pCounts[x]; i++)
{
//Index Offset Start
var m1 = br.ReadInt32();
//index count
var mCount = br.ReadInt32();
//index offset in unk3
var mOffset = br.ReadInt32();
var iLoc = 0;
if (indexLoc.ContainsKey(m1))
{
iLoc = indexLoc[m1];
}
indexCounts[x].Add(new ExtraIndex()
{
IndexLocation = iLoc, IndexCount = mCount
});
totalMaskCounts[x] += mCount;
}
}
}
if (unknown3 > 0)
{
//var unk3Remainder = (unknown3 * 4) - (totalLoD0MaskCount * 4);
var c = 0;
for (int l = 0; l < indexCounts.Count; l++)
{
foreach (var ic in indexCounts[l])
{
HashSet <int> mIndexList = new HashSet <int>();
for (int i = 0; i < ic.IndexCount; i++)
{
//index its replacing? attatched to?
var oIndex = br.ReadUInt16();
//extra index following last equipment index
var mIndex = br.ReadUInt16();
if (l == LoDViewLevel)
{
mIndexList.Add(mIndex);
if (extraIndices.ContainsKey(ic.IndexLocation))
{
extraIndices[ic.IndexLocation].Add(mIndex);
extraIndices2[ic.IndexLocation].Add(oIndex);
}
else
{
extraIndices.Add(ic.IndexLocation, new List <int>()
{
mIndex
});
extraIndices2.Add(ic.IndexLocation, new List <int>()
{
oIndex
});
}
}
}
if (l == LoDViewLevel)
{
if (totalExtraCounts.ContainsKey(ic.IndexLocation))
{
totalExtraCounts[ic.IndexLocation] += mIndexList.Count;
}
else
{
totalExtraCounts.Add(ic.IndexLocation, mIndexList.Count);
}
}
c++;
}
}
//the rest of unk3
//br.ReadBytes(unk3Remainder);
foreach (var ei in extraIndices)
{
indexMin.Add(ei.Key, ei.Value.Min());
}
extraIndexData.indexCounts = indexCounts[LoDViewLevel];
extraIndexData.indexMin = indexMin;
extraIndexData.totalExtraCounts = totalExtraCounts;
extraIndexData.extraIndices = extraIndices;
extraIndexData.extraIndices2 = extraIndices2;
modelData.ExtraData = extraIndexData;
}
//br.ReadBytes(unknown3 * 4);
var boneIndexSize = br.ReadInt32();
for (int i = 0; i < boneIndexSize / 2; i++)
{
modelData.BoneIndicies.Add(br.ReadUInt16());
}
int padding = br.ReadByte();
br.ReadBytes(padding);
for (int i = 0; i < 4; i++)
{
ModelMaterial.BoundingBox boundingBox = new ModelMaterial.BoundingBox();
for (int j = 0; j < 4; j++)
{
boundingBox.PointA.Add(br.ReadSingle());
}
for (int k = 0; k < 4; k++)
{
boundingBox.PointB.Add(br.ReadSingle());
}
modelData.BoundingBoxes.Add(boundingBox);
}
//float4x4
for (int i = 0; i < boneStringCount; i++)
{
string boneName = boneStrings[i];
Vector4 transform1 = new Vector4();
Vector4 transform2 = new Vector4();
transform1.X = br.ReadSingle();
transform1.Y = br.ReadSingle();
transform1.Z = br.ReadSingle();
transform1.W = br.ReadSingle();
transform2.X = br.ReadSingle();
transform2.Y = br.ReadSingle();
transform2.Z = br.ReadSingle();
transform2.W = br.ReadSingle();
boneTransforms.Add(transform1.X);
boneTransforms.Add(transform1.Y);
boneTransforms.Add(transform1.Z);
boneTransforms.Add(transform1.W);
boneTransforms.Add(transform2.X);
boneTransforms.Add(transform2.Y);
boneTransforms.Add(transform2.Z);
boneTransforms.Add(transform2.W);
}
for (int i = 0; i < 3; i++)
{
for (int j = 0; j < modelData.LoD[i].MeshCount; j++)
{
Mesh mesh = modelData.LoD[i].MeshList[j];
for (int k = 0; k < mesh.MeshInfo.VertexDataBlockCount; k++)
{
br.BaseStream.Seek(modelData.LoD[i].VertexOffset + mesh.MeshInfo.VertexDataOffsets[k], SeekOrigin.Begin);
mesh.MeshVertexData.Add(br.ReadBytes(mesh.MeshInfo.VertexSizes[k] * mesh.MeshInfo.VertexCount));
}
br.BaseStream.Seek(modelData.LoD[i].IndexOffset + (mesh.MeshInfo.IndexDataOffset * 2), SeekOrigin.Begin);
mesh.IndexData = br.ReadBytes(2 * mesh.MeshInfo.IndexCount);
}
}
int vertex = 0, coordinates = 0, normals = 0, tangents = 0, colors = 0, blendWeights = 0, blendIndices = 0;
for (int i = 0; i < modelData.LoD[LoDViewLevel].MeshCount; i++)
{
objBytes.Clear();
var vertexList = new Vector3Collection();
var texCoordList = new Vector2Collection();
var texCoordList2 = new Vector2Collection();
var normalList = new Vector3Collection();
var tangentList = new Vector3Collection();
var colorsList = new Color4Collection();
var indexList = new IntCollection();
var blendWeightList = new List <float>();
var blendWeightList2 = new List <float[]>();
var blendIndicesList = new List <int>();
var blendIndicesList2 = new List <int[]>();
var weightCounts = new List <int>();
var extraVerts = new HashSet <Vector3>();
Dictionary <int, Vector3> extraVertDict = new Dictionary <int, Vector3>();
Mesh mesh = modelData.LoD[LoDViewLevel].MeshList[i];
MeshDataInfo[] meshDataInfoList = mesh.MeshDataInfoList;
int c = 0;
foreach (var meshDataInfo in meshDataInfoList)
{
if (meshDataInfo.UseType == 0)
{
vertex = c;
}
else if (meshDataInfo.UseType == 1)
{
blendWeights = c;
}
else if (meshDataInfo.UseType == 2)
{
blendIndices = c;
}
else if (meshDataInfo.UseType == 3)
{
normals = c;
}
else if (meshDataInfo.UseType == 4)
{
coordinates = c;
}
else if (meshDataInfo.UseType == 6)
{
tangents = c;
}
else if (meshDataInfo.UseType == 7)
{
colors = c;
}
c++;
}
/*
* -----------------
* Vertex
* -----------------
*/
// Only actually read the buffers if they have data in them.
if (mesh.MeshVertexData.Count > 0)
{
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[vertex].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[vertex].VertexDataBlock] + meshDataInfoList[vertex].Offset, SeekOrigin.Begin);
Vector3 vVector = new Vector3();
if (meshDataInfoList[vertex].DataType == 13 || meshDataInfoList[vertex].DataType == 14)
{
System.Half h1 = System.Half.ToHalf(br1.ReadUInt16());
System.Half h2 = System.Half.ToHalf(br1.ReadUInt16());
System.Half h3 = System.Half.ToHalf(br1.ReadUInt16());
float x = HalfHelper.HalfToSingle(h1);
float y = HalfHelper.HalfToSingle(h2);
float z = HalfHelper.HalfToSingle(h3);
vVector = new Vector3(x, y, z);
objBytes.Add("v " + x.ToString("N5") + " " + y.ToString("N5") + " " + z.ToString("N5") + " ");
}
else if (meshDataInfoList[vertex].DataType == 2)
{
var x = BitConverter.ToSingle(br1.ReadBytes(4), 0);
var y = BitConverter.ToSingle(br1.ReadBytes(4), 0);
var z = BitConverter.ToSingle(br1.ReadBytes(4), 0);
vVector = new Vector3(x, y, z);
objBytes.Add("v " + x.ToString("N5") + " " + y.ToString("N5") + " " + z.ToString("N5") + " ");
}
vertexList.Add(vVector);
}
}
/*
* -----------------
* Blend Weight
* -----------------
*/
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[blendWeights].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[blendWeights].VertexDataBlock] + meshDataInfoList[blendWeights].Offset, SeekOrigin.Begin);
float x = br1.ReadByte() / 255.0f;
float y = br1.ReadByte() / 255.0f;
float z = br1.ReadByte() / 255.0f;
float w = br1.ReadByte() / 255.0f;
int count = 0;
if (x != 0)
{
blendWeightList.Add(x);
count++;
if (y != 0)
{
blendWeightList.Add(y);
count++;
if (z != 0)
{
blendWeightList.Add(z);
count++;
if (w != 0)
{
blendWeightList.Add(w);
count++;
}
}
}
}
if (count == 1)
{
blendWeightList2.Add(new float[] { x });
}
else if (count == 2)
{
blendWeightList2.Add(new float[] { x, y });
}
else if (count == 3)
{
blendWeightList2.Add(new float[] { x, y, z });
}
else if (count == 4)
{
blendWeightList2.Add(new float[] { x, y, z, w });
}
weightCounts.Add(count);
}
}
/*
* -----------------
* Blend Index
* -----------------
*/
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[blendIndices].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[blendIndices].VertexDataBlock] + meshDataInfoList[blendIndices].Offset, SeekOrigin.Begin);
int x = br1.ReadByte();
int y = br1.ReadByte();
int z = br1.ReadByte();
int w = br1.ReadByte();
if (weightCounts[j] == 1)
{
blendIndicesList.Add(x);
blendIndicesList2.Add(new int[] { x });
}
else if (weightCounts[j] == 2)
{
blendIndicesList.Add(x);
blendIndicesList.Add(y);
blendIndicesList2.Add(new int[] { x, y });
}
else if (weightCounts[j] == 3)
{
blendIndicesList.Add(x);
blendIndicesList.Add(y);
blendIndicesList.Add(z);
blendIndicesList2.Add(new int[] { x, y, z });
}
else if (weightCounts[j] == 4)
{
blendIndicesList.Add(x);
blendIndicesList.Add(y);
blendIndicesList.Add(z);
blendIndicesList.Add(w);
blendIndicesList2.Add(new int[] { x, y, z, w });
}
}
}
/*
* -----------------
* Texture Coordinates
* -----------------
*/
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[coordinates].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[coordinates].VertexDataBlock] + meshDataInfoList[coordinates].Offset, SeekOrigin.Begin);
float x = 0;
float y = 0;
float z = 0;
float w = 0;
if (meshDataInfoList[coordinates].DataType == 13 || meshDataInfoList[coordinates].DataType == 14)
{
var sx = br1.ReadUInt16();
var sy = br1.ReadUInt16();
var sz = br1.ReadUInt16();
var sw = br1.ReadUInt16();
var h1 = new SharpDX.Half(sx);
var h2 = new SharpDX.Half(sy);
var h3 = new SharpDX.Half(sz);
var h4 = new SharpDX.Half(sw);
x = h1;
y = h2;
z = h3;
w = h4;
}
else if (meshDataInfoList[coordinates].DataType == 1)
{
x = br1.ReadSingle();
y = br1.ReadSingle();
}
else
{
x = br1.ReadSingle();
y = br1.ReadSingle();
z = br1.ReadSingle();
w = br1.ReadSingle();
}
var ox = x - Math.Truncate(x);
var oy = y - Math.Truncate(y);
objBytes.Add("vt " + ox.ToString("N5") + " " + (1 - y).ToString("N5") + " ");
texCoordList.Add(new Vector2(x, y));
texCoordList2.Add(new Vector2(z, w));
}
}
/*
* -----------------
* Normals
* -----------------
*/
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[normals].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[normals].VertexDataBlock] + meshDataInfoList[normals].Offset, SeekOrigin.Begin);
float x = 0;
float y = 0;
float z = 0;
float w = 0;
if (meshDataInfoList[normals].DataType == 13 || meshDataInfoList[normals].DataType == 14)
{
System.Half h1 = System.Half.ToHalf(br1.ReadUInt16());
System.Half h2 = System.Half.ToHalf(br1.ReadUInt16());
System.Half h3 = System.Half.ToHalf(br1.ReadUInt16());
System.Half h4 = System.Half.ToHalf(br1.ReadUInt16());
x = HalfHelper.HalfToSingle(h1);
y = HalfHelper.HalfToSingle(h2);
z = HalfHelper.HalfToSingle(h3);
w = HalfHelper.HalfToSingle(h4);
}
else
{
x = br1.ReadSingle();
y = br1.ReadSingle();
z = br1.ReadSingle();
}
var nv = new Vector3(x, y, z);
objBytes.Add("vn " + x.ToString("N5") + " " + y.ToString("N5") + " " + z.ToString("N5") + " ");
normalList.Add(nv);
}
}
/*
* -----------------
* Tangents
* -----------------
*/
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[tangents].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[tangents].VertexDataBlock] + meshDataInfoList[tangents].Offset, SeekOrigin.Begin);
int x = br1.ReadByte();
int y = br1.ReadByte();
int z = br1.ReadByte();
int w = br1.ReadByte();
var x1 = x * 2 / 255f - 1f;
var y1 = y * 2 / 255f - 1f;
var z1 = z * 2 / 255f - 1f;
var w1 = w * 2 / 255f - 1f;
var nv = new Vector3(x1, y1, z1);
tangentList.Add(nv);
}
}
/*
* -----------------
* Vertex Color
* -----------------
*/
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.MeshVertexData[meshDataInfoList[colors].VertexDataBlock])))
{
for (int j = 0; j < mesh.MeshInfo.VertexCount; j++)
{
br1.BaseStream.Seek(j * mesh.MeshInfo.VertexSizes[meshDataInfoList[colors].VertexDataBlock] + meshDataInfoList[colors].Offset, SeekOrigin.Begin);
int a = br1.ReadByte();
int r = br1.ReadByte();
int g = br1.ReadByte();
int b = br1.ReadByte();
colorsList.Add(new Color4(r, g, b, a));
}
}
}
/*
* -----------------
* Index
* -----------------
*/
using (BinaryReader br1 = new BinaryReader(new MemoryStream(mesh.IndexData)))
{
for (int j = 0; j < mesh.MeshInfo.IndexCount; j += 3)
{
int i1 = br1.ReadUInt16();
int i2 = br1.ReadUInt16();
int i3 = br1.ReadUInt16();
objBytes.Add("f " + (i1 + 1) + "/" + (i1 + 1) + "/" + (i1 + 1) + " " + (i2 + 1) + "/" + (i2 + 1) + "/" + (i2 + 1) + " " + (i3 + 1) + "/" + (i3 + 1) + "/" + (i3 + 1) + " ");
indexList.Add(i1);
indexList.Add(i2);
indexList.Add(i3);
}
}
ModelMeshData modelMeshData = new ModelMeshData()
{
Vertices = vertexList,
Normals = normalList,
TextureCoordinates = texCoordList,
TextureCoordinates2 = texCoordList2,
BiTangents = tangentList,
Indices = indexList,
VertexColors = colorsList,
OBJFileData = objBytes.ToArray(),
BoneStrings = boneStrings,
AttributeStrings = atrStrings,
BoneIndices = modelData.BoneIndicies,
BoneTransforms = boneTransforms,
BlendWeights = blendWeightList,
BlendIndices = blendIndicesList,
WeightCounts = weightCounts,
MeshPartList = mesh.MeshPartList,
BlendIndicesArrayList = blendIndicesList2,
BlendWeightsArrayList = blendWeightList2,
MaterialNum = mesh.MeshInfo.MaterialNum,
MeshPartCount = mesh.MeshInfo.MeshPartCount,
MeshPartOffset = mesh.MeshInfo.MeshPartOffset
};
if (extraIndices2.ContainsKey(i))
{
foreach (var id in extraIndices2[i])
{
if (!extraVertDict.ContainsKey(id))
{
if (modelMeshData.Indices.Count >= id)
{
var v = 0;
try
{
v = modelMeshData.Indices[id];
}
catch
{
v = 0;
}
extraVertDict.Add(id, modelMeshData.Vertices[v]);
}
else
{
//new Thread(() => MessageBox.Show("There was an error reading the models extra data.\n\n" +
// "Mesh " + i + " Index " + id + "\n\n" +
// "This is likely caused by parts of a mesh being deleted and may cause crashes in-game.\n\n" +
// "Consider using Advanced Import to Fix or Disable Hiding for the above mesh.",
// "Extra Data Warning" + Info.appVersion, MessageBoxButtons.OK, MessageBoxIcon.Warning)).Start();
new Thread(() => MessageBox.Show(string.Format(Dialogs.MDLExtraDataWarning, i, id),
Dialogs.ExtraDataWarning + Info.appVersion, MessageBoxButtons.OK, MessageBoxIcon.Warning)).Start();
break;
}
}
}
}
mesh.extraVertDict = extraVertDict;
meshList.Add(modelMeshData);
}
}
}
private void Update_Preview()
{
try
{
if (ImageConverter.IsLoaded && UsePreviewBox.IsChecked.Value)
{
int coord = CoordinateAxis.SelectedIndex;
int verAlig = VerticalAlignmentBox.SelectedIndex;
int horAlig = HorizontalAlignmentBox.SelectedIndex;
//Mat smat = ImageConverter.GetModifiedImage();
//System.Windows.Size size = ImageConverter.GetBlocks();
//Bitmap bitmap = smat.ToBitmap();
//var mb = new MeshBuilder(false, true);
//IList<Point3D> pnts = new List<Point3D>
//{
// new Point3D(0, 0, 0),
// new Point3D(size.Width, 0, 0),
// new Point3D(size.Width, size.Height, 0),
// new Point3D(0, size.Height, 0)
//};
//mb.AddPolygon(pnts);
//var mesh = mb.ToMesh(false);
//PointCollection pntCol = new PointCollection
//{
// new System.Windows.Point(0, 0),
// new System.Windows.Point(bitmap.Size.Width, 0),
// new System.Windows.Point(bitmap.Size.Width, bitmap.Size.Height),
// new System.Windows.Point(0, bitmap.Size.Height)
//};
//mesh.TextureCoordinates = pntCol;
//ImageBrush brush = new ImageBrush();
//using (Stream stream = new MemoryStream())
//{
// bitmap.Save(stream, ImageFormat.Png);
// stream.Seek(0, SeekOrigin.Begin);
// BitmapImage img = new BitmapImage();
// img.BeginInit();
// img.CacheOption = BitmapCacheOption.OnLoad;
// img.StreamSource = stream;
// img.EndInit();
// brush.ImageSource = img;
//}
//brush.TileMode = TileMode.Tile;
//brush.ViewportUnits = BrushMappingMode.Absolute;
//brush.ViewboxUnits = BrushMappingMode.Absolute;
//brush.Stretch = Stretch.None;
//brush.AlignmentX = AlignmentX.Left;
//brush.AlignmentY = AlignmentY.Top;
//brush.Viewport = new System.Windows.Rect(0, 0, brush.ImageSource.Width, brush.ImageSource.Height);
//DiffuseMaterial mat = new DiffuseMaterial(brush);
//GeometryModel3D gModel3D = new GeometryModel3D { Geometry = mesh, Material = mat, BackMaterial = mat };
//PreviewModel.Content = gModel3D;
Particle[] particles = ImageConverter.GetParticles(coord, verAlig, horAlig);
//ParticleModel.Children.Clear();
var points = new PointGeometry3D();
var vectors = new Vector3Collection();
var colors = new Color4Collection();
var ptIdx = new IntCollection();
int i = 0;
foreach (Particle particle in particles)
{
vectors.Add(new Vector3((float)particle.x, (float)particle.y, (float)particle.z));
if (UseStaticDustColor.IsChecked.Value)
{
Color c = (Color)ColorConverter.ConvertFromString(ColorCodeBox.Text);
colors.Add(new Color4(c.R / 255f, c.G / 255f, c.B / 255f, 1.0f));
}
else
{
colors.Add(new Color4(particle.r / 255f, particle.g / 255f, particle.b / 255f, 1.0f));
}
ptIdx.Add(i);
i++;
}
points.Positions = vectors;
points.Colors = colors;
points.Indices = ptIdx;
ParticleModel.Geometry = points;
double size = double.Parse(ParticleSizeBox.Text);
ParticleModel.Size = new System.Windows.Size(3 * Math.Sqrt(size), 3 * Math.Sqrt(size));
ParticleCounter.Text = $"Particles: {particles.Length}";
if (particles.Length >= 2000)
{
ParticleCounter.Foreground = new SolidColorBrush(Colors.Red);
CounterAlert.Visibility = Visibility.Visible;
}
else
{
ParticleCounter.Foreground = new SolidColorBrush(Colors.Snow);
CounterAlert.Visibility = Visibility.Hidden;
}
}
}
catch (Exception e)
{
Logger.WriteExceptionLog(e);
MessageBox.Show("プレビューの更新に失敗しました\nFailed to update preview.",
"エラー/Error",
MessageBoxButton.OK,
MessageBoxImage.Error);
this.Close();
}
}
public static (Vector3Collection, Color4Collection, Bitmap) BPtoPointCloudBitmap(Vector3Collection imageSpace, List <float[]> uvs, List <LMData> lmDataList, int height, int width, bool isTransFormed = false, double angleThreshold = 5, double minCountPercent = 0)
{
if (minCountPercent > 1 || minCountPercent < 0)
{
throw new ArgumentOutOfRangeException(nameof(minCountPercent));
}
Vector3Collection vector3sOut = new Vector3Collection();
Color4Collection color4sOut = new Color4Collection();
Bitmap bitmapOut = new Bitmap(1, 1);
if (imageSpace.Count == 0 || lmDataList.Count == 0 || height == 0 || width == 0)
{
return(vector3sOut, color4sOut, bitmapOut);
}
bitmapOut = new Bitmap(width, height);
int[] counts = new int[imageSpace.Count];
if (isTransFormed)
{
foreach (var lmData in lmDataList)
{
if (lmData.Type == LMData.InteractionType.Compton)
{
Parallel.For(0, imageSpace.Count, i =>// for (int i = 0; i < imageSpace.Count; ++i)
{
if (IsEffectedBPPoint(lmData.ScatterLMDataInfo.TransformedInteractionPoint3D, lmData.ScatterLMDataInfo.InteractionEnergy,
lmData.AbsorberLMDataInfo.TransformedInteractionPoint3D, lmData.AbsorberLMDataInfo.InteractionEnergy,
imageSpace[i].ToPoint3D(), angleThreshold))
{
counts[i]++;
}
});
}
}
}
else
{
foreach (var lmData in lmDataList)
{
if (lmData.Type == LMData.InteractionType.Compton)
{
for (int i = 0; i < imageSpace.Count; ++i)
{
if (IsEffectedBPPoint(lmData.ScatterLMDataInfo.RelativeInteractionPoint3D, lmData.ScatterLMDataInfo.InteractionEnergy,
lmData.AbsorberLMDataInfo.RelativeInteractionPoint3D, lmData.AbsorberLMDataInfo.InteractionEnergy,
imageSpace[i].ToPoint3D(), angleThreshold))
{
counts[i]++;
}
}
}
}
}
int maxCount = counts.Max();
int minCount = Convert.ToInt32(Math.Round(maxCount * minCountPercent));
if (maxCount < 5)
{
return(vector3sOut, color4sOut, bitmapOut);
}
for (int i = 0; i < imageSpace.Count; i++)
{
if (counts[i] > minCount)
{
vector3sOut.Add(imageSpace[i]);
Color4 jetColor = ColorScaleJet(counts[i], minCount, maxCount);
System.Drawing.Color bitMapColor = System.Drawing.Color.FromArgb(Convert.ToInt32(jetColor.Alpha * 255),
Convert.ToInt32(jetColor.Red * 255),
Convert.ToInt32(jetColor.Green * 255),
Convert.ToInt32(jetColor.Blue * 255));
color4sOut.Add(jetColor);
int u = (int)Math.Round(uvs[i][0] * width);
int v = (int)Math.Round(uvs[i][1] * height);
if (u == width)
{
--u;
}
if (v == height)
{
--v;
}
bitmapOut.SetPixel(u, v, bitMapColor);
}
}
var tupleOut3 = new Tuple <Vector3Collection, Color4Collection>(vector3sOut, color4sOut);
return(vector3sOut, color4sOut, bitmapOut);
}
private static void DrawGridPatch(
Vector3Collection positions, IntCollection indices, Color4Collection colors, int startX, int startY)
{
var c1 = (Color)ColorConverter.ConvertFromString("#c5d1d8");
c1.Clamp();
var c2 = (Color)ColorConverter.ConvertFromString("#ddeaf2");
c2.Clamp();
var darkGridColor = new Color4(new Vector4(c1.ScR, c1.ScG, c1.ScB, 1));
var lightGridColor = new Color4(new Vector4(c2.ScR, c2.ScG, c2.ScB, 1));
const int size = 10;
for (var x = startX; x <= startX + size; x++)
{
if (x == 0 && startY < 0)
{
continue;
}
var v = new Vector3(x, -.001f, startY);
positions.Add(v);
indices.Add(positions.Count - 1);
positions.Add(new Vector3(x, -.001f, startY + size));
indices.Add(positions.Count - 1);
if (x % 5 == 0)
{
colors.Add(darkGridColor);
colors.Add(darkGridColor);
}
else
{
colors.Add(lightGridColor);
colors.Add(lightGridColor);
}
}
for (var y = startY; y <= startY + size; y++)
{
if (y == 0 && startX >= 0)
{
continue;
}
positions.Add(new Vector3(startX, -.001f, y));
indices.Add(positions.Count - 1);
positions.Add(new Vector3(startX + size, -.001f, y));
indices.Add(positions.Count - 1);
if (y % 5 == 0)
{
colors.Add(darkGridColor);
colors.Add(darkGridColor);
}
else
{
colors.Add(lightGridColor);
colors.Add(lightGridColor);
}
}
}
/// <summary>
/// Create the grid
/// </summary>
private void DrawGrid()
{
Grid = new LineGeometry3D();
var positions = new Vector3Collection();
var indices = new IntCollection();
var colors = new Color4Collection();
for(var i= 0; i < 10; i += 1)
{
for (var j = 0; j < 10; j += 1)
{
DrawGridPatch(positions, indices, colors, -50 + i * 10, -50 + j * 10);
}
}
Grid.Positions = positions;
Grid.Indices = indices;
Grid.Colors = colors;
Axes = new LineGeometry3D();
var axesPositions = new Vector3Collection();
var axesIndices = new IntCollection();
var axesColors = new Color4Collection();
// Draw the coordinate axes
axesPositions.Add(new Vector3());
axesIndices.Add(axesPositions.Count - 1);
axesPositions.Add(new Vector3(50, 0, 0));
axesIndices.Add(axesPositions.Count - 1);
axesColors.Add(SharpDX.Color.Red);
axesColors.Add(SharpDX.Color.Red);
axesPositions.Add(new Vector3());
axesIndices.Add(axesPositions.Count - 1);
axesPositions.Add(new Vector3(0, 5, 0));
axesIndices.Add(axesPositions.Count - 1);
axesColors.Add(SharpDX.Color.Blue);
axesColors.Add(SharpDX.Color.Blue);
axesPositions.Add(new Vector3());
axesIndices.Add(axesPositions.Count - 1);
axesPositions.Add(new Vector3(0, 0, -50));
axesIndices.Add(axesPositions.Count - 1);
axesColors.Add(SharpDX.Color.Green);
axesColors.Add(SharpDX.Color.Green);
Axes.Positions = axesPositions;
Axes.Indices = axesIndices;
Axes.Colors = axesColors;
}
public MainViewModel()
{ // titles
this.Title = "DynamicTexture Demo";
this.SubTitle = "WPF & SharpDX";
EffectsManager = new DefaultEffectsManager();
this.Camera = new HelixToolkit.Wpf.SharpDX.PerspectiveCamera
{
Position = new Point3D(10, 10, 10),
LookDirection = new Vector3D(-10, -10, -10),
UpDirection = new Vector3D(0, 1, 0)
};
this.Light1Color = Colors.White;
this.Light1Direction = new Vector3D(-10, -10, -10);
this.AmbientLightColor = Colors.Black;
var b2 = new MeshBuilder(true, true, true);
b2.AddSphere(new Vector3(0f, 0f, 0f), 4, 64, 64);
this.Model = b2.ToMeshGeometry3D();
Model.IsDynamic = true;
this.InnerModel = new MeshGeometry3D()
{
Indices = Model.Indices,
Positions = Model.Positions,
Normals = Model.Normals,
TextureCoordinates = Model.TextureCoordinates,
Tangents = Model.Tangents,
BiTangents = Model.BiTangents,
IsDynamic = true
};
var image = TextureModel.Create(new System.Uri(@"test.png", System.UriKind.RelativeOrAbsolute).ToString());
this.ModelMaterial = new PhongMaterial
{
AmbientColor = Colors.Gray.ToColor4(),
DiffuseColor = Colors.White.ToColor4(),
SpecularColor = Colors.White.ToColor4(),
SpecularShininess = 100f,
DiffuseAlphaMap = image,
DiffuseMap = TextureModel.Create(new System.Uri(@"TextureCheckerboard2.dds", System.UriKind.RelativeOrAbsolute).ToString()),
NormalMap = TextureModel.Create(new System.Uri(@"TextureCheckerboard2_dot3.dds", System.UriKind.RelativeOrAbsolute).ToString()),
};
this.InnerModelMaterial = new PhongMaterial
{
AmbientColor = Colors.Gray.ToColor4(),
DiffuseColor = new Color4(0.75f, 0.75f, 0.75f, 1.0f),
SpecularColor = Colors.White.ToColor4(),
SpecularShininess = 100f,
DiffuseAlphaMap = image,
DiffuseMap = TextureModel.Create(new System.Uri(@"TextureNoise1.jpg", System.UriKind.RelativeOrAbsolute).ToString()),
NormalMap = ModelMaterial.NormalMap
};
initialPosition = Model.Positions;
initialIndicies = Model.Indices;
#region Point Model
PointModel = new PointGeometry3D()
{
IsDynamic = true, Positions = Model.Positions
};
int count = PointModel.Positions.Count;
var colors = new Color4Collection(count);
for (int i = 0; i < count / 2; ++i)
{
colors.Add(new Color4(0, 1, 1, 1));
}
for (int i = 0; i < count / 2; ++i)
{
colors.Add(new Color4(0, 0, 0, 0));
}
PointModel.Colors = colors;
#endregion
#region Line Model
LineModel = new LineGeometry3D()
{
IsDynamic = true, Positions = new Vector3Collection(PointModel.Positions)
};
LineModel.Positions.Add(Vector3.Zero);
var indices = new IntCollection(count * 2);
for (int i = 0; i < count; ++i)
{
indices.Add(count);
indices.Add(i);
}
LineModel.Indices = indices;
colors = new Color4Collection(LineModel.Positions.Count);
for (int i = 0; i < count; ++i)
{
colors.Add(new Color4((float)i / count, 1 - (float)i / count, 0, 1));
}
colors.Add(Colors.Blue.ToColor4());
LineModel.Colors = colors;
LineMaterial = new LineArrowHeadMaterial()
{
Color = Colors.White, Thickness = 0.5, ArrowSize = 0.02
};
#endregion
var token = cts.Token;
Task.Run(() =>
{
while (!token.IsCancellationRequested)
{
Timer_Tick();
Task.Delay(16).Wait();
}
}, token);
//timer.Interval = TimeSpan.FromMilliseconds(16);
//timer.Tick += Timer_Tick;
//timer.Start();
}
private static void DrawGridPatch(
Vector3Collection positions, IntCollection indices, Color4Collection colors, int startX, int startY)
{
var c1 = (Color)ColorConverter.ConvertFromString("#c5d1d8");
c1.Clamp();
var c2 = (Color)ColorConverter.ConvertFromString("#ddeaf2");
c2.Clamp();
var darkGridColor = new Color4(new Vector4(c1.ScR,c1.ScG ,c1.ScB, 1));
var lightGridColor = new Color4(new Vector4(c2.ScR, c2.ScG, c2.ScB, 1));
const int size = 10;
for (var x = startX; x <= startX + size; x++)
{
if (x == 0 && startY < 0) continue;
var v = new Vector3(x, -.001f, startY);
positions.Add(v);
indices.Add(positions.Count - 1);
positions.Add(new Vector3(x, -.001f, startY + size));
indices.Add(positions.Count - 1);
if (x % 5 == 0)
{
colors.Add(darkGridColor);
colors.Add(darkGridColor);
}
else
{
colors.Add(lightGridColor);
colors.Add(lightGridColor);
}
}
for (var y = startY; y <= startY + size; y++)
{
if (y == 0 && startX >= 0) continue;
positions.Add(new Vector3(startX, -.001f, y));
indices.Add(positions.Count - 1);
positions.Add(new Vector3(startX + size, -.001f, y));
indices.Add(positions.Count - 1);
if (y % 5 == 0)
{
colors.Add(darkGridColor);
colors.Add(darkGridColor);
}
else
{
colors.Add(lightGridColor);
colors.Add(lightGridColor);
}
}
}
private void AddPointCloud()
{
var points = new PointGeometry3D();
var col = new Color4Collection(); // gradient na kolory
var ptPos = new Vector3Collection(); // pozycje punktów
var ptIdx = new IntCollection(); // indeksy punktów
int dataSampling = 2; // taki prosty przeskok miedzy punktami /można zrobić coś na podstawie odległości kamery albo różnicy wysokości między kolejnymi punktami
// wpisywane na sztywno dane (lepiej zrobić funkcję obsługującą odpowiednie typy)
// path = "C:/Users/astat/Desktop/DaneViewer/xyzi_wrakII.txt";
//path = "C:/Users/astat/Desktop/DaneViewer/export_xyzi.txt";
if (filepath != null && positionX != null && positionY != null && positionZ != null)
{
dataFromTxt(filepath, positionX, positionY, positionZ);
//newdataFromTxt(path, positionX, positionY, positionZ);
double maxX = positionX.Max();
double minX = positionX.Min();
double maxY = positionY.Max();
double minY = positionY.Min();
double maxZ = positionZ.Max();
double minZ = positionZ.Min();
Trace.WriteLine($"{maxX} {minX} {maxY} {minY} {maxZ} {minZ}");
for (int i = 0; i < positionX.Count(); i += dataSampling) // tutaj powinna być pętla foreach ale potrzebowałem prostego przerzedzenia dannych
{
// Trace.WriteLine($"{i} {positionX[i]} {positionY[i]} {positionZ[i]}");
bool reverse = true;
var positionZReversed = maxZ - positionZ[i]; // czasami dostawałem punkty z odwróconą osią Z po to ta zmienna
var positionToColour = Math.Abs(positionZ[i] / (maxZ - minZ));
ptIdx.Add(ptPos.Count);
if (reverse == true)
{
ptPos.Add(new Vector3((float)positionX[i], (float)positionY[i], (float)positionZReversed));
}
else
{
ptPos.Add(new Vector3((float)positionX[i], (float)positionY[i], (float)positionZ[i]));
}
// Trace.WriteLine($"{i} {positionX[i]} {positionY[i]} {positionZ[i]} {positionToColour}");
var colourR = Math.Sqrt(-positionToColour + 0.75);
var colourG = (Math.Sin(4 * positionToColour - 0.2)) / 1.6;//tutaj trzeba potworzyć funkcje matematyczne żeby zmieniały się kolorki/ można też użyć warunków i color4.Scale
var colourB = Math.Sqrt(positionToColour - 0.25);
col.Add(new Color4((float)colourR, (float)colourG, (float)colourB, 1f)); //te kolory to czarna magia ale nie są według żadnej skali tylko żeby ładnie wyglądały hehe
} //Trace.WriteLine($"{i} {positionToColour} {colourR} {colourG} {colourB} {col[i]}");
points.Positions = ptPos;
points.Indices = ptIdx;
points.Colors = col;
PointsColor = Colors.White; // <- nie pamiętam po co to tutaj ale bez tego nie działa
Points = points;
PointsTransform = new Media3D.TranslateTransform3D(0, 0, minZ);
// floor plane grid
CreateGrid(maxX, minX, maxY, minY, minZ);
Grid = lines.ToLineGeometry3D();
GridColor = new Color4(153 / 255.0f, 204 / 255.0f, 255 / 255.0f, (float)0.3).ToColor();;
GridTransform = new Media3D.TranslateTransform3D(0, 0, minZ);
// strzałki
CreateArrows((float)maxX, (float)minX, (float)maxY, (float)minY, (float)maxZ, (float)minZ);
Arrow = arrows.ToLineGeometry3D();
ArrowColor = new Color4(0, 255 / 255.0f, 255 / 255.0f, (float)0.5).ToColor();;
ArrowTransform = new Media3D.TranslateTransform3D(0, 0, minZ);
}
}
