public static IConnection Connect(this RadDiagram diagram, IShape a, IShape b, string name = null)
{
var c = diagram.AddConnection(a, b);
if (!string.IsNullOrEmpty(name))
c.Name = name;
return c;
}
/// <summary>
/// Creates a diagram or visual representation of the given incidence structure, returning in addition the association between the graph elements on the one hand
/// and the visuals on the other.
/// </summary>
/// <param name="diagram">The diagram.</param>
/// <param name="g">The graph to visualize.</param>
/// <param name="nodeMap">The node map.</param>
/// <param name="edgeMap">The edge map.</param>
/// <returns></returns>
/// <seealso cref="Parse"/>
public static Graph CreateDiagram(this Telerik.Windows.Controls.RadDiagram diagram, Graph g, out Dictionary<Node, RadDiagramShape> nodeMap, out Dictionary<Edge, RadDiagramConnection> edgeMap, CreateShapeDelegate create, bool randomSize = false)
{
if (g == null) throw new ArgumentNullException("g");
diagram.Clear();
var dic = new Dictionary<int, RadDiagramShape>();
nodeMap = new Dictionary<Node, RadDiagramShape>();
edgeMap = new Dictionary<Edge, RadDiagramConnection>();
foreach (var node in g.Nodes)
{
var shape = create(node, randomSize, null);
nodeMap.Add(node, shape);
diagram.AddShape(shape);
dic.Add(node.Id, shape);
}
foreach (Edge link in g.Links)
{
var con = diagram.AddConnection(dic[link.Source.Id], dic[link.Sink.Id]) as RadDiagramConnection;
edgeMap.Add(link, con);
con.TargetCapType = CapType.Arrow1Filled;
}
return g;
}
public static List<RadDiagramShape> CreateDivisionBranch(this RadDiagram diagram, string name)
{
var shapes = new List<RadDiagramShape>();
var director = diagram.CreateShape(name + " director");
shapes.Add(director);
var manCount = Rand.Next(2, 4);
for (var j = 0; j < manCount; j++)
{
var man = diagram.CreateShape(name + " manager");
shapes.Add(man);
man.Geometry = ShapeFactory.GetShapeGeometry(CommonShapeType.EllipseShape);
man.Background = new SolidColorBrush(Colors.Brown);
var devCount = Rand.Next(3, 6);
diagram.AddConnection(director, man, ConnectorPosition.Bottom,ConnectorPosition.Top);
for (var k = 0; k < devCount; k++)
{
var dev = diagram.CreateShape("Dev " + k);
shapes.Add(dev);
dev.Background = new SolidColorBrush(Colors.LightGray);
diagram.Connect(man, dev);
}
}
return shapes;
}
/// <summary>
/// Creates a diagram or visual representation of the given incidence structure.
/// </summary>
/// <param name="diagram">The diagram.</param>
/// <param name="g">The graph structure.</param>
/// <param name="create">The create.</param>
/// <returns></returns>
public static Graph CreateDiagram(this Telerik.Windows.Controls.RadDiagram diagram, Graph g, CreateShapeDelegate create = null, bool randomSize = false)
{
if (diagram == null) throw new ArgumentNullException("diagram");
if (g == null) throw new ArgumentNullException("g");
diagram.Clear();
var dic = new Dictionary<int, RadDiagramShape>();
foreach (var node in g.Nodes)
{
var shape = create == null ? CreateShape(node, randomSize) : create(node, randomSize, null);
diagram.AddShape(shape);
dic.Add(node.Id, shape);
}
foreach (var con in g.Links.Select(link => diagram.AddConnection(dic[link.Source.Id], dic[link.Sink.Id]))) con.TargetCapType = CapType.Arrow1Filled;
return g;
}
